From 0af16455b9d14a2ed87872b9ab8ad106a8a42c40 Mon Sep 17 00:00:00 2001 From: liabru Date: Fri, 13 Mar 2020 22:08:39 +0000 Subject: [PATCH 01/23] fix decomp require --- src/factory/Bodies.js | 9 ++++++++- 1 file changed, 8 insertions(+), 1 deletion(-) diff --git a/src/factory/Bodies.js b/src/factory/Bodies.js index 1a703fa..9103d5d 100644 --- a/src/factory/Bodies.js +++ b/src/factory/Bodies.js @@ -196,7 +196,8 @@ var Vector = require('../geometry/Vector'); * @return {body} */ Bodies.fromVertices = function(x, y, vertexSets, options, flagInternal, removeCollinear, minimumArea) { - var decomp = global.decomp || require('poly-decomp'), + var globals = typeof global !== 'undefined' ? global : window, + decomp, body, parts, isConvex, @@ -207,6 +208,12 @@ var Vector = require('../geometry/Vector'); v, z; + try { + decomp = globals.decomp || require('poly-decomp'); + } catch (e) { + // decomp is undefined + } + options = options || {}; parts = []; From e1e058c35d393df549a770523b1e7e0fd7dd258d Mon Sep 17 00:00:00 2001 From: liabru Date: Tue, 24 Nov 2020 22:56:45 +0000 Subject: [PATCH 02/23] update dependencies --- package-lock.json | 5117 ++++++++++++++++++++++++++++----------------- package.json | 8 +- 2 files changed, 3194 insertions(+), 1931 deletions(-) diff --git a/package-lock.json b/package-lock.json index a68ccb3..5aa80fc 100644 --- a/package-lock.json +++ b/package-lock.json @@ -14,45 +14,46 @@ } }, "@babel/core": { - "version": "7.8.7", - "resolved": "https://registry.npmjs.org/@babel/core/-/core-7.8.7.tgz", - "integrity": "sha512-rBlqF3Yko9cynC5CCFy6+K/w2N+Sq/ff2BPy+Krp7rHlABIr5epbA7OxVeKoMHB39LZOp1UY5SuLjy6uWi35yA==", + "version": "7.12.9", + "resolved": "https://registry.npmjs.org/@babel/core/-/core-7.12.9.tgz", + "integrity": "sha512-gTXYh3M5wb7FRXQy+FErKFAv90BnlOuNn1QkCK2lREoPAjrQCO49+HVSrFoe5uakFAF5eenS75KbO2vQiLrTMQ==", "dev": true, "requires": { - "@babel/code-frame": "^7.8.3", - "@babel/generator": "^7.8.7", - "@babel/helpers": "^7.8.4", - "@babel/parser": "^7.8.7", - "@babel/template": "^7.8.6", - "@babel/traverse": "^7.8.6", - "@babel/types": "^7.8.7", + "@babel/code-frame": "^7.10.4", + "@babel/generator": "^7.12.5", + "@babel/helper-module-transforms": "^7.12.1", + "@babel/helpers": "^7.12.5", + "@babel/parser": "^7.12.7", + "@babel/template": "^7.12.7", + "@babel/traverse": "^7.12.9", + "@babel/types": "^7.12.7", "convert-source-map": "^1.7.0", "debug": "^4.1.0", "gensync": "^1.0.0-beta.1", - "json5": "^2.1.0", - "lodash": "^4.17.13", + "json5": "^2.1.2", + "lodash": "^4.17.19", "resolve": "^1.3.2", "semver": "^5.4.1", "source-map": "^0.5.0" }, "dependencies": { "@babel/code-frame": { - "version": "7.8.3", - "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.8.3.tgz", - "integrity": "sha512-a9gxpmdXtZEInkCSHUJDLHZVBgb1QS0jhss4cPP93EW7s+uC5bikET2twEF3KV+7rDblJcmNvTR7VJejqd2C2g==", + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", + "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "requires": { - "@babel/highlight": "^7.8.3" + "@babel/highlight": "^7.10.4" } }, "@babel/highlight": { - "version": "7.8.3", - "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.8.3.tgz", - "integrity": "sha512-PX4y5xQUvy0fnEVHrYOarRPXVWafSjTW9T0Hab8gVIawpl2Sj0ORyrygANq+KjcNlSSTw0YCLSNA8OyZ1I4yEg==", + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", + "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "requires": { + "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", - "esutils": "^2.0.2", "js-tokens": "^4.0.0" } }, @@ -74,61 +75,131 @@ } }, "@babel/generator": { - "version": "7.8.7", - "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.8.7.tgz", - "integrity": "sha512-DQwjiKJqH4C3qGiyQCAExJHoZssn49JTMJgZ8SANGgVFdkupcUhLOdkAeoC6kmHZCPfoDG5M0b6cFlSN5wW7Ew==", + "version": "7.12.5", + "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.12.5.tgz", + "integrity": "sha512-m16TQQJ8hPt7E+OS/XVQg/7U184MLXtvuGbCdA7na61vha+ImkyyNM/9DDA0unYCVZn3ZOhng+qz48/KBOT96A==", "dev": true, "requires": { - "@babel/types": "^7.8.7", + "@babel/types": "^7.12.5", "jsesc": "^2.5.1", - "lodash": "^4.17.13", "source-map": "^0.5.0" } }, "@babel/helper-function-name": { - "version": "7.8.3", - "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.8.3.tgz", - "integrity": "sha512-BCxgX1BC2hD/oBlIFUgOCQDOPV8nSINxCwM3o93xP4P9Fq6aV5sgv2cOOITDMtCfQ+3PvHp3l689XZvAM9QyOA==", + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", + "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", "dev": true, "requires": { - "@babel/helper-get-function-arity": "^7.8.3", - "@babel/template": "^7.8.3", - "@babel/types": "^7.8.3" + "@babel/helper-get-function-arity": "^7.10.4", + "@babel/template": "^7.10.4", + "@babel/types": "^7.10.4" } }, "@babel/helper-get-function-arity": { - "version": "7.8.3", - "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.8.3.tgz", - "integrity": "sha512-FVDR+Gd9iLjUMY1fzE2SR0IuaJToR4RkCDARVfsBBPSP53GEqSFjD8gNyxg246VUyc/ALRxFaAK8rVG7UT7xRA==", + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", + "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", "dev": true, "requires": { - "@babel/types": "^7.8.3" + "@babel/types": "^7.10.4" + } + }, + "@babel/helper-member-expression-to-functions": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/helper-member-expression-to-functions/-/helper-member-expression-to-functions-7.12.7.tgz", + "integrity": "sha512-DCsuPyeWxeHgh1Dus7APn7iza42i/qXqiFPWyBDdOFtvS581JQePsc1F/nD+fHrcswhLlRc2UpYS1NwERxZhHw==", + "dev": true, + "requires": { + "@babel/types": "^7.12.7" + } + }, + "@babel/helper-module-imports": { + "version": "7.12.5", + "resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.12.5.tgz", + "integrity": "sha512-SR713Ogqg6++uexFRORf/+nPXMmWIn80TALu0uaFb+iQIUoR7bOC7zBWyzBs5b3tBBJXuyD0cRu1F15GyzjOWA==", + "dev": true, + "requires": { + "@babel/types": "^7.12.5" + } + }, + "@babel/helper-module-transforms": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/helper-module-transforms/-/helper-module-transforms-7.12.1.tgz", + "integrity": "sha512-QQzehgFAZ2bbISiCpmVGfiGux8YVFXQ0abBic2Envhej22DVXV9nCFaS5hIQbkyo1AdGb+gNME2TSh3hYJVV/w==", + "dev": true, + "requires": { + "@babel/helper-module-imports": "^7.12.1", + "@babel/helper-replace-supers": "^7.12.1", + "@babel/helper-simple-access": "^7.12.1", + "@babel/helper-split-export-declaration": "^7.11.0", + "@babel/helper-validator-identifier": "^7.10.4", + "@babel/template": "^7.10.4", + "@babel/traverse": "^7.12.1", + "@babel/types": "^7.12.1", + "lodash": "^4.17.19" + } + }, + "@babel/helper-optimise-call-expression": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.12.7.tgz", + "integrity": "sha512-I5xc9oSJ2h59OwyUqjv95HRyzxj53DAubUERgQMrpcCEYQyToeHA+NEcUEsVWB4j53RDeskeBJ0SgRAYHDBckw==", + "dev": true, + "requires": { + "@babel/types": "^7.12.7" } }, "@babel/helper-plugin-utils": { - "version": "7.8.3", - "resolved": "https://registry.npmjs.org/@babel/helper-plugin-utils/-/helper-plugin-utils-7.8.3.tgz", - "integrity": "sha512-j+fq49Xds2smCUNYmEHF9kGNkhbet6yVIBp4e6oeQpH1RUs/Ir06xUKzDjDkGcaaokPiTNs2JBWHjaE4csUkZQ==", + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/helper-plugin-utils/-/helper-plugin-utils-7.10.4.tgz", + "integrity": "sha512-O4KCvQA6lLiMU9l2eawBPMf1xPP8xPfB3iEQw150hOVTqj/rfXz0ThTb4HEzqQfs2Bmo5Ay8BzxfzVtBrr9dVg==", "dev": true }, - "@babel/helper-split-export-declaration": { - "version": "7.8.3", - "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.8.3.tgz", - "integrity": "sha512-3x3yOeyBhW851hroze7ElzdkeRXQYQbFIb7gLK1WQYsw2GWDay5gAJNw1sWJ0VFP6z5J1whqeXH/WCdCjZv6dA==", + "@babel/helper-replace-supers": { + "version": "7.12.5", + "resolved": "https://registry.npmjs.org/@babel/helper-replace-supers/-/helper-replace-supers-7.12.5.tgz", + "integrity": "sha512-5YILoed0ZyIpF4gKcpZitEnXEJ9UoDRki1Ey6xz46rxOzfNMAhVIJMoune1hmPVxh40LRv1+oafz7UsWX+vyWA==", "dev": true, "requires": { - "@babel/types": "^7.8.3" + "@babel/helper-member-expression-to-functions": "^7.12.1", + "@babel/helper-optimise-call-expression": "^7.10.4", + "@babel/traverse": "^7.12.5", + "@babel/types": "^7.12.5" } }, - "@babel/helpers": { - "version": "7.8.4", - "resolved": "https://registry.npmjs.org/@babel/helpers/-/helpers-7.8.4.tgz", - "integrity": "sha512-VPbe7wcQ4chu4TDQjimHv/5tj73qz88o12EPkO2ValS2QiQS/1F2SsjyIGNnAD0vF/nZS6Cf9i+vW6HIlnaR8w==", + "@babel/helper-simple-access": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/helper-simple-access/-/helper-simple-access-7.12.1.tgz", + "integrity": "sha512-OxBp7pMrjVewSSC8fXDFrHrBcJATOOFssZwv16F3/6Xtc138GHybBfPbm9kfiqQHKhYQrlamWILwlDCeyMFEaA==", "dev": true, "requires": { - "@babel/template": "^7.8.3", - "@babel/traverse": "^7.8.4", - "@babel/types": "^7.8.3" + "@babel/types": "^7.12.1" + } + }, + "@babel/helper-split-export-declaration": { + "version": "7.11.0", + "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz", + "integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==", + "dev": true, + "requires": { + "@babel/types": "^7.11.0" + } + }, + "@babel/helper-validator-identifier": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.10.4.tgz", + "integrity": "sha512-3U9y+43hz7ZM+rzG24Qe2mufW5KhvFg/NhnNph+i9mgCtdTCtMJuI1TMkrIUiK7Ix4PYlRF9I5dhqaLYA/ADXw==", + "dev": true + }, + "@babel/helpers": { + "version": "7.12.5", + "resolved": "https://registry.npmjs.org/@babel/helpers/-/helpers-7.12.5.tgz", + "integrity": "sha512-lgKGMQlKqA8meJqKsW6rUnc4MdUk35Ln0ATDqdM1a/UpARODdI4j5Y5lVfUScnSNkJcdCRAaWkspykNoFg9sJA==", + "dev": true, + "requires": { + "@babel/template": "^7.10.4", + "@babel/traverse": "^7.12.5", + "@babel/types": "^7.12.5" } }, "@babel/highlight": { @@ -143,11 +214,20 @@ } }, "@babel/parser": { - "version": "7.8.7", - "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.8.7.tgz", - "integrity": "sha512-9JWls8WilDXFGxs0phaXAZgpxTZhSk/yOYH2hTHC0X1yC7Z78IJfvR1vJ+rmJKq3I35td2XzXzN6ZLYlna+r/A==", + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.12.7.tgz", + "integrity": "sha512-oWR02Ubp4xTLCAqPRiNIuMVgNO5Aif/xpXtabhzW2HWUD47XJsAB4Zd/Rg30+XeQA3juXigV7hlquOTmwqLiwg==", "dev": true }, + "@babel/plugin-syntax-async-generators": { + "version": "7.8.4", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-async-generators/-/plugin-syntax-async-generators-7.8.4.tgz", + "integrity": "sha512-tycmZxkGfZaxhMRbXlPXuVFpdWlXpir2W4AMhSJgRKzk/eDlIXOhb2LHWoLpDF7TEHylV5zNhykX6KAgHJmTNw==", + "dev": true, + "requires": { + "@babel/helper-plugin-utils": "^7.8.0" + } + }, "@babel/plugin-syntax-bigint": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-bigint/-/plugin-syntax-bigint-7.8.3.tgz", @@ -157,6 +237,60 @@ "@babel/helper-plugin-utils": "^7.8.0" } }, + "@babel/plugin-syntax-class-properties": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-class-properties/-/plugin-syntax-class-properties-7.12.1.tgz", + "integrity": "sha512-U40A76x5gTwmESz+qiqssqmeEsKvcSyvtgktrm0uzcARAmM9I1jR221f6Oq+GmHrcD+LvZDag1UTOTe2fL3TeA==", + "dev": true, + "requires": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "@babel/plugin-syntax-import-meta": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-import-meta/-/plugin-syntax-import-meta-7.10.4.tgz", + "integrity": "sha512-Yqfm+XDx0+Prh3VSeEQCPU81yC+JWZ2pDPFSS4ZdpfZhp4MkFMaDC1UqseovEKwSUpnIL7+vK+Clp7bfh0iD7g==", + "dev": true, + "requires": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "@babel/plugin-syntax-json-strings": { + "version": "7.8.3", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-json-strings/-/plugin-syntax-json-strings-7.8.3.tgz", + "integrity": "sha512-lY6kdGpWHvjoe2vk4WrAapEuBR69EMxZl+RoGRhrFGNYVK8mOPAW8VfbT/ZgrFbXlDNiiaxQnAtgVCZ6jv30EA==", + "dev": true, + "requires": { + "@babel/helper-plugin-utils": "^7.8.0" + } + }, + "@babel/plugin-syntax-logical-assignment-operators": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-logical-assignment-operators/-/plugin-syntax-logical-assignment-operators-7.10.4.tgz", + "integrity": "sha512-d8waShlpFDinQ5MtvGU9xDAOzKH47+FFoney2baFIoMr952hKOLp1HR7VszoZvOsV/4+RRszNY7D17ba0te0ig==", + "dev": true, + "requires": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "@babel/plugin-syntax-nullish-coalescing-operator": { + "version": "7.8.3", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-nullish-coalescing-operator/-/plugin-syntax-nullish-coalescing-operator-7.8.3.tgz", + "integrity": "sha512-aSff4zPII1u2QD7y+F8oDsz19ew4IGEJg9SVW+bqwpwtfFleiQDMdzA/R+UlWDzfnHFCxxleFT0PMIrR36XLNQ==", + "dev": true, + "requires": { + "@babel/helper-plugin-utils": "^7.8.0" + } + }, + "@babel/plugin-syntax-numeric-separator": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-numeric-separator/-/plugin-syntax-numeric-separator-7.10.4.tgz", + "integrity": "sha512-9H6YdfkcK/uOnY/K7/aA2xpzaAgkQn37yzWUMRK7OaPOqOpGS1+n0H5hxT9AUw9EsSjPW8SVyMJwYRtWs3X3ug==", + "dev": true, + "requires": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, "@babel/plugin-syntax-object-rest-spread": { "version": "7.8.3", "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-object-rest-spread/-/plugin-syntax-object-rest-spread-7.8.3.tgz", @@ -166,86 +300,104 @@ "@babel/helper-plugin-utils": "^7.8.0" } }, - "@babel/template": { - "version": "7.8.6", - "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.8.6.tgz", - "integrity": "sha512-zbMsPMy/v0PWFZEhQJ66bqjhH+z0JgMoBWuikXybgG3Gkd/3t5oQ1Rw2WQhnSrsOmsKXnZOx15tkC4qON/+JPg==", + "@babel/plugin-syntax-optional-catch-binding": { + "version": "7.8.3", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-optional-catch-binding/-/plugin-syntax-optional-catch-binding-7.8.3.tgz", + "integrity": "sha512-6VPD0Pc1lpTqw0aKoeRTMiB+kWhAoT24PA+ksWSBrFtl5SIRVpZlwN3NNPQjehA2E/91FV3RjLWoVTglWcSV3Q==", "dev": true, "requires": { - "@babel/code-frame": "^7.8.3", - "@babel/parser": "^7.8.6", - "@babel/types": "^7.8.6" + "@babel/helper-plugin-utils": "^7.8.0" + } + }, + "@babel/plugin-syntax-optional-chaining": { + "version": "7.8.3", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-optional-chaining/-/plugin-syntax-optional-chaining-7.8.3.tgz", + "integrity": "sha512-KoK9ErH1MBlCPxV0VANkXW2/dw4vlbGDrFgz8bmUsBGYkFRcbRwMh6cIJubdPrkxRwuGdtCk0v/wPTKbQgBjkg==", + "dev": true, + "requires": { + "@babel/helper-plugin-utils": "^7.8.0" + } + }, + "@babel/template": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.12.7.tgz", + "integrity": "sha512-GkDzmHS6GV7ZeXfJZ0tLRBhZcMcY0/Lnb+eEbXDBfCAcZCjrZKe6p3J4we/D24O9Y8enxWAg1cWwof59yLh2ow==", + "dev": true, + "requires": { + "@babel/code-frame": "^7.10.4", + "@babel/parser": "^7.12.7", + "@babel/types": "^7.12.7" }, "dependencies": { "@babel/code-frame": { - "version": "7.8.3", - "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.8.3.tgz", - "integrity": "sha512-a9gxpmdXtZEInkCSHUJDLHZVBgb1QS0jhss4cPP93EW7s+uC5bikET2twEF3KV+7rDblJcmNvTR7VJejqd2C2g==", + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", + "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "requires": { - "@babel/highlight": "^7.8.3" + "@babel/highlight": "^7.10.4" } }, "@babel/highlight": { - "version": "7.8.3", - "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.8.3.tgz", - "integrity": "sha512-PX4y5xQUvy0fnEVHrYOarRPXVWafSjTW9T0Hab8gVIawpl2Sj0ORyrygANq+KjcNlSSTw0YCLSNA8OyZ1I4yEg==", + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", + "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "requires": { + "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", - "esutils": "^2.0.2", "js-tokens": "^4.0.0" } } } }, "@babel/traverse": { - "version": "7.8.6", - "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.8.6.tgz", - "integrity": "sha512-2B8l0db/DPi8iinITKuo7cbPznLCEk0kCxDoB9/N6gGNg/gxOXiR/IcymAFPiBwk5w6TtQ27w4wpElgp9btR9A==", + "version": "7.12.9", + "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.12.9.tgz", + "integrity": "sha512-iX9ajqnLdoU1s1nHt36JDI9KG4k+vmI8WgjK5d+aDTwQbL2fUnzedNedssA645Ede3PM2ma1n8Q4h2ohwXgMXw==", "dev": true, "requires": { - "@babel/code-frame": "^7.8.3", - "@babel/generator": "^7.8.6", - "@babel/helper-function-name": "^7.8.3", - "@babel/helper-split-export-declaration": "^7.8.3", - "@babel/parser": "^7.8.6", - "@babel/types": "^7.8.6", + "@babel/code-frame": "^7.10.4", + "@babel/generator": "^7.12.5", + "@babel/helper-function-name": "^7.10.4", + "@babel/helper-split-export-declaration": "^7.11.0", + "@babel/parser": "^7.12.7", + "@babel/types": "^7.12.7", "debug": "^4.1.0", "globals": "^11.1.0", - "lodash": "^4.17.13" + "lodash": "^4.17.19" }, "dependencies": { "@babel/code-frame": { - "version": "7.8.3", - "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.8.3.tgz", - "integrity": "sha512-a9gxpmdXtZEInkCSHUJDLHZVBgb1QS0jhss4cPP93EW7s+uC5bikET2twEF3KV+7rDblJcmNvTR7VJejqd2C2g==", + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", + "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", "dev": true, "requires": { - "@babel/highlight": "^7.8.3" + "@babel/highlight": "^7.10.4" } }, "@babel/highlight": { - "version": "7.8.3", - "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.8.3.tgz", - "integrity": "sha512-PX4y5xQUvy0fnEVHrYOarRPXVWafSjTW9T0Hab8gVIawpl2Sj0ORyrygANq+KjcNlSSTw0YCLSNA8OyZ1I4yEg==", + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", + "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "requires": { + "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", - "esutils": "^2.0.2", "js-tokens": "^4.0.0" } } } }, "@babel/types": { - "version": "7.8.7", - "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.8.7.tgz", - "integrity": "sha512-k2TreEHxFA4CjGkL+GYjRyx35W0Mr7DP5+9q6WMkyKXB+904bYmG40syjMFV0oLlhhFCwWl0vA0DyzTDkwAiJw==", + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.12.7.tgz", + "integrity": "sha512-MNyI92qZq6jrQkXvtIiykvl4WtoRrVV9MPn+ZfsoEENjiWcBQ3ZSHrkxnJWgWtLX3XXqX5hrSQ+X69wkmesXuQ==", "dev": true, "requires": { - "esutils": "^2.0.2", - "lodash": "^4.17.13", + "@babel/helper-validator-identifier": "^7.10.4", + "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } }, @@ -266,21 +418,22 @@ }, "dependencies": { "minimist": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", - "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", + "version": "1.2.5", + "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", + "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==", "dev": true } } }, "@istanbuljs/load-nyc-config": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/@istanbuljs/load-nyc-config/-/load-nyc-config-1.0.0.tgz", - "integrity": "sha512-ZR0rq/f/E4f4XcgnDvtMWXCUJpi8eO0rssVhmztsZqLIEFA9UUP9zmpE0VxlM+kv/E1ul2I876Fwil2ayptDVg==", + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/@istanbuljs/load-nyc-config/-/load-nyc-config-1.1.0.tgz", + "integrity": "sha512-VjeHSlIzpv/NyD3N0YuHfXOPDIixcA1q2ZV98wsMqcYlPmv2n3Yb2lYP9XMElnaFVXg5A7YLTeLu6V84uQDjmQ==", "dev": true, "requires": { "camelcase": "^5.3.1", "find-up": "^4.1.0", + "get-package-type": "^0.1.0", "js-yaml": "^3.13.1", "resolve-from": "^5.0.0" }, @@ -311,9 +464,9 @@ } }, "p-limit": { - "version": "2.2.2", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.2.2.tgz", - "integrity": "sha512-WGR+xHecKTr7EbUEhyLSh5Dube9JtdiG78ufaeLxTgpudf/20KqyMioIUZJAezlTIi6evxuoUs9YXc11cU+yzQ==", + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.3.0.tgz", + "integrity": "sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==", "dev": true, "requires": { "p-try": "^2.0.0" @@ -355,24 +508,24 @@ "dev": true }, "@jest/console": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/@jest/console/-/console-25.1.0.tgz", - "integrity": "sha512-3P1DpqAMK/L07ag/Y9/Jup5iDEG9P4pRAuZiMQnU0JB3UOvCyYCjCoxr7sIA80SeyUCUKrr24fKAxVpmBgQonA==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/@jest/console/-/console-25.5.0.tgz", + "integrity": "sha512-T48kZa6MK1Y6k4b89sexwmSF4YLeZS/Udqg3Jj3jG/cHH+N/sLFCEoXEDMOKugJQ9FxPN1osxIknvKkxt6MKyw==", "dev": true, "requires": { - "@jest/source-map": "^25.1.0", + "@jest/types": "^25.5.0", "chalk": "^3.0.0", - "jest-util": "^25.1.0", + "jest-message-util": "^25.5.0", + "jest-util": "^25.5.0", "slash": "^3.0.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -408,9 +561,9 @@ "dev": true }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -418,226 +571,80 @@ } } }, - "@jest/core": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/@jest/core/-/core-25.1.0.tgz", - "integrity": "sha512-iz05+NmwCmZRzMXvMo6KFipW7nzhbpEawrKrkkdJzgytavPse0biEnCNr2wRlyCsp3SmKaEY+SGv7YWYQnIdig==", - "dev": true, - "requires": { - "@jest/console": "^25.1.0", - "@jest/reporters": "^25.1.0", - "@jest/test-result": "^25.1.0", - "@jest/transform": "^25.1.0", - "@jest/types": "^25.1.0", - "ansi-escapes": "^4.2.1", - "chalk": "^3.0.0", - "exit": "^0.1.2", - "graceful-fs": "^4.2.3", - "jest-changed-files": "^25.1.0", - "jest-config": "^25.1.0", - "jest-haste-map": "^25.1.0", - "jest-message-util": "^25.1.0", - "jest-regex-util": "^25.1.0", - "jest-resolve": "^25.1.0", - "jest-resolve-dependencies": "^25.1.0", - "jest-runner": "^25.1.0", - "jest-runtime": "^25.1.0", - "jest-snapshot": "^25.1.0", - "jest-util": "^25.1.0", - "jest-validate": "^25.1.0", - "jest-watcher": "^25.1.0", - "micromatch": "^4.0.2", - "p-each-series": "^2.1.0", - "realpath-native": "^1.1.0", - "rimraf": "^3.0.0", - "slash": "^3.0.0", - "strip-ansi": "^6.0.0" - }, - "dependencies": { - "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", - "dev": true, - "requires": { - "@types/color-name": "^1.1.1", - "color-convert": "^2.0.1" - } - }, - "braces": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", - "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", - "dev": true, - "requires": { - "fill-range": "^7.0.1" - } - }, - "chalk": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/chalk/-/chalk-3.0.0.tgz", - "integrity": "sha512-4D3B6Wf41KOYRFdszmDqMCGq5VV/uMAB273JILmO+3jAlh8X4qDtdtgCR3fxtbLEMzSx22QdhnDcJvu2u1fVwg==", - "dev": true, - "requires": { - "ansi-styles": "^4.1.0", - "supports-color": "^7.1.0" - } - }, - "color-convert": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", - "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", - "dev": true, - "requires": { - "color-name": "~1.1.4" - } - }, - "color-name": { - "version": "1.1.4", - "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", - "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", - "dev": true - }, - "fill-range": { - "version": "7.0.1", - "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", - "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", - "dev": true, - "requires": { - "to-regex-range": "^5.0.1" - } - }, - "graceful-fs": { - "version": "4.2.3", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.3.tgz", - "integrity": "sha512-a30VEBm4PEdx1dRB7MFK7BejejvCvBronbLjht+sHuGYj8PHs7M/5Z+rt5lw551vZ7yfTCj4Vuyy3mSJytDWRQ==", - "dev": true - }, - "has-flag": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", - "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", - "dev": true - }, - "is-number": { - "version": "7.0.0", - "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", - "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", - "dev": true - }, - "micromatch": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.2.tgz", - "integrity": "sha512-y7FpHSbMUMoyPbYUSzO6PaZ6FyRnQOpHuKwbo1G+Knck95XVU4QAiKdGEnj5wwoS7PlOgthX/09u5iFJ+aYf5Q==", - "dev": true, - "requires": { - "braces": "^3.0.1", - "picomatch": "^2.0.5" - } - }, - "rimraf": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz", - "integrity": "sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==", - "dev": true, - "requires": { - "glob": "^7.1.3" - } - }, - "strip-ansi": { - "version": "6.0.0", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", - "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", - "dev": true, - "requires": { - "ansi-regex": "^5.0.0" - } - }, - "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", - "dev": true, - "requires": { - "has-flag": "^4.0.0" - } - }, - "to-regex-range": { - "version": "5.0.1", - "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", - "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", - "dev": true, - "requires": { - "is-number": "^7.0.0" - } - } - } - }, "@jest/environment": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/@jest/environment/-/environment-25.1.0.tgz", - "integrity": "sha512-cTpUtsjU4cum53VqBDlcW0E4KbQF03Cn0jckGPW/5rrE9tb+porD3+hhLtHAwhthsqfyF+bizyodTlsRA++sHg==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/@jest/environment/-/environment-25.5.0.tgz", + "integrity": "sha512-U2VXPEqL07E/V7pSZMSQCvV5Ea4lqOlT+0ZFijl/i316cRMHvZ4qC+jBdryd+lmRetjQo0YIQr6cVPNxxK87mA==", "dev": true, "requires": { - "@jest/fake-timers": "^25.1.0", - "@jest/types": "^25.1.0", - "jest-mock": "^25.1.0" + "@jest/fake-timers": "^25.5.0", + "@jest/types": "^25.5.0", + "jest-mock": "^25.5.0" } }, "@jest/fake-timers": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/@jest/fake-timers/-/fake-timers-25.1.0.tgz", - "integrity": "sha512-Eu3dysBzSAO1lD7cylZd/CVKdZZ1/43SF35iYBNV1Lvvn2Undp3Grwsv8PrzvbLhqwRzDd4zxrY4gsiHc+wygQ==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/@jest/fake-timers/-/fake-timers-25.5.0.tgz", + "integrity": "sha512-9y2+uGnESw/oyOI3eww9yaxdZyHq7XvprfP/eeoCsjqKYts2yRlsHS/SgjPDV8FyMfn2nbMy8YzUk6nyvdLOpQ==", "dev": true, "requires": { - "@jest/types": "^25.1.0", - "jest-message-util": "^25.1.0", - "jest-mock": "^25.1.0", - "jest-util": "^25.1.0", + "@jest/types": "^25.5.0", + "jest-message-util": "^25.5.0", + "jest-mock": "^25.5.0", + "jest-util": "^25.5.0", "lolex": "^5.0.0" } }, + "@jest/globals": { + "version": "25.5.2", + "resolved": "https://registry.npmjs.org/@jest/globals/-/globals-25.5.2.tgz", + "integrity": "sha512-AgAS/Ny7Q2RCIj5kZ+0MuKM1wbF0WMLxbCVl/GOMoCNbODRdJ541IxJ98xnZdVSZXivKpJlNPIWa3QmY0l4CXA==", + "dev": true, + "requires": { + "@jest/environment": "^25.5.0", + "@jest/types": "^25.5.0", + "expect": "^25.5.0" + } + }, "@jest/reporters": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/@jest/reporters/-/reporters-25.1.0.tgz", - "integrity": "sha512-ORLT7hq2acJQa8N+NKfs68ZtHFnJPxsGqmofxW7v7urVhzJvpKZG9M7FAcgh9Ee1ZbCteMrirHA3m5JfBtAaDg==", + "version": "25.5.1", + "resolved": "https://registry.npmjs.org/@jest/reporters/-/reporters-25.5.1.tgz", + "integrity": "sha512-3jbd8pPDTuhYJ7vqiHXbSwTJQNavczPs+f1kRprRDxETeE3u6srJ+f0NPuwvOmk+lmunZzPkYWIFZDLHQPkviw==", "dev": true, "requires": { "@bcoe/v8-coverage": "^0.2.3", - "@jest/console": "^25.1.0", - "@jest/environment": "^25.1.0", - "@jest/test-result": "^25.1.0", - "@jest/transform": "^25.1.0", - "@jest/types": "^25.1.0", + "@jest/console": "^25.5.0", + "@jest/test-result": "^25.5.0", + "@jest/transform": "^25.5.1", + "@jest/types": "^25.5.0", "chalk": "^3.0.0", "collect-v8-coverage": "^1.0.0", "exit": "^0.1.2", "glob": "^7.1.2", + "graceful-fs": "^4.2.4", "istanbul-lib-coverage": "^3.0.0", "istanbul-lib-instrument": "^4.0.0", "istanbul-lib-report": "^3.0.0", "istanbul-lib-source-maps": "^4.0.0", - "istanbul-reports": "^3.0.0", - "jest-haste-map": "^25.1.0", - "jest-resolve": "^25.1.0", - "jest-runtime": "^25.1.0", - "jest-util": "^25.1.0", - "jest-worker": "^25.1.0", + "istanbul-reports": "^3.0.2", + "jest-haste-map": "^25.5.1", + "jest-resolve": "^25.5.1", + "jest-util": "^25.5.0", + "jest-worker": "^25.5.0", "node-notifier": "^6.0.0", "slash": "^3.0.0", "source-map": "^0.6.0", "string-length": "^3.1.0", "terminal-link": "^2.0.0", - "v8-to-istanbul": "^4.0.1" + "v8-to-istanbul": "^4.1.3" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -666,6 +673,12 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, + "graceful-fs": { + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", + "dev": true + }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", @@ -673,9 +686,9 @@ "dev": true }, "jest-worker": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-worker/-/jest-worker-25.1.0.tgz", - "integrity": "sha512-ZHhHtlxOWSxCoNOKHGbiLzXnl42ga9CxDr27H36Qn+15pQZd3R/F24jrmjDelw9j/iHUIWMWs08/u2QN50HHOg==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-worker/-/jest-worker-25.5.0.tgz", + "integrity": "sha512-/dsSmUkIy5EBGfv/IjjqmFxrNAUpBERfGs1oHROyD7yxjG/w+t0GOJDX8O1k32ySmd7+a5IhnJU2qQFcJ4n1vw==", "dev": true, "requires": { "merge-stream": "^2.0.0", @@ -689,9 +702,9 @@ "dev": true }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -700,20 +713,20 @@ } }, "@jest/source-map": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/@jest/source-map/-/source-map-25.1.0.tgz", - "integrity": "sha512-ohf2iKT0xnLWcIUhL6U6QN+CwFWf9XnrM2a6ybL9NXxJjgYijjLSitkYHIdzkd8wFliH73qj/+epIpTiWjRtAA==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/@jest/source-map/-/source-map-25.5.0.tgz", + "integrity": "sha512-eIGx0xN12yVpMcPaVpjXPnn3N30QGJCJQSkEDUt9x1fI1Gdvb07Ml6K5iN2hG7NmMP6FDmtPEssE3z6doOYUwQ==", "dev": true, "requires": { "callsites": "^3.0.0", - "graceful-fs": "^4.2.3", + "graceful-fs": "^4.2.4", "source-map": "^0.6.0" }, "dependencies": { "graceful-fs": { - "version": "4.2.3", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.3.tgz", - "integrity": "sha512-a30VEBm4PEdx1dRB7MFK7BejejvCvBronbLjht+sHuGYj8PHs7M/5Z+rt5lw551vZ7yfTCj4Vuyy3mSJytDWRQ==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", "dev": true }, "source-map": { @@ -725,61 +738,68 @@ } }, "@jest/test-result": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/@jest/test-result/-/test-result-25.1.0.tgz", - "integrity": "sha512-FZzSo36h++U93vNWZ0KgvlNuZ9pnDnztvaM7P/UcTx87aPDotG18bXifkf1Ji44B7k/eIatmMzkBapnAzjkJkg==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/@jest/test-result/-/test-result-25.5.0.tgz", + "integrity": "sha512-oV+hPJgXN7IQf/fHWkcS99y0smKLU2czLBJ9WA0jHITLst58HpQMtzSYxzaBvYc6U5U6jfoMthqsUlUlbRXs0A==", "dev": true, "requires": { - "@jest/console": "^25.1.0", - "@jest/transform": "^25.1.0", - "@jest/types": "^25.1.0", + "@jest/console": "^25.5.0", + "@jest/types": "^25.5.0", "@types/istanbul-lib-coverage": "^2.0.0", "collect-v8-coverage": "^1.0.0" } }, "@jest/test-sequencer": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/@jest/test-sequencer/-/test-sequencer-25.1.0.tgz", - "integrity": "sha512-WgZLRgVr2b4l/7ED1J1RJQBOharxS11EFhmwDqknpknE0Pm87HLZVS2Asuuw+HQdfQvm2aXL2FvvBLxOD1D0iw==", + "version": "25.5.4", + "resolved": "https://registry.npmjs.org/@jest/test-sequencer/-/test-sequencer-25.5.4.tgz", + "integrity": "sha512-pTJGEkSeg1EkCO2YWq6hbFvKNXk8ejqlxiOg1jBNLnWrgXOkdY6UmqZpwGFXNnRt9B8nO1uWMzLLZ4eCmhkPNA==", "dev": true, "requires": { - "@jest/test-result": "^25.1.0", - "jest-haste-map": "^25.1.0", - "jest-runner": "^25.1.0", - "jest-runtime": "^25.1.0" + "@jest/test-result": "^25.5.0", + "graceful-fs": "^4.2.4", + "jest-haste-map": "^25.5.1", + "jest-runner": "^25.5.4", + "jest-runtime": "^25.5.4" + }, + "dependencies": { + "graceful-fs": { + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", + "dev": true + } } }, "@jest/transform": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/@jest/transform/-/transform-25.1.0.tgz", - "integrity": "sha512-4ktrQ2TPREVeM+KxB4zskAT84SnmG1vaz4S+51aTefyqn3zocZUnliLLm5Fsl85I3p/kFPN4CRp1RElIfXGegQ==", + "version": "25.5.1", + "resolved": "https://registry.npmjs.org/@jest/transform/-/transform-25.5.1.tgz", + "integrity": "sha512-Y8CEoVwXb4QwA6Y/9uDkn0Xfz0finGkieuV0xkdF9UtZGJeLukD5nLkaVrVsODB1ojRWlaoD0AJZpVHCSnJEvg==", "dev": true, "requires": { "@babel/core": "^7.1.0", - "@jest/types": "^25.1.0", + "@jest/types": "^25.5.0", "babel-plugin-istanbul": "^6.0.0", "chalk": "^3.0.0", "convert-source-map": "^1.4.0", "fast-json-stable-stringify": "^2.0.0", - "graceful-fs": "^4.2.3", - "jest-haste-map": "^25.1.0", - "jest-regex-util": "^25.1.0", - "jest-util": "^25.1.0", + "graceful-fs": "^4.2.4", + "jest-haste-map": "^25.5.1", + "jest-regex-util": "^25.2.6", + "jest-util": "^25.5.0", "micromatch": "^4.0.2", "pirates": "^4.0.1", - "realpath-native": "^1.1.0", + "realpath-native": "^2.0.0", "slash": "^3.0.0", "source-map": "^0.6.1", "write-file-atomic": "^3.0.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -827,9 +847,9 @@ } }, "graceful-fs": { - "version": "4.2.3", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.3.tgz", - "integrity": "sha512-a30VEBm4PEdx1dRB7MFK7BejejvCvBronbLjht+sHuGYj8PHs7M/5Z+rt5lw551vZ7yfTCj4Vuyy3mSJytDWRQ==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", "dev": true }, "has-flag": { @@ -861,9 +881,9 @@ "dev": true }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -881,9 +901,9 @@ } }, "@jest/types": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/@jest/types/-/types-25.1.0.tgz", - "integrity": "sha512-VpOtt7tCrgvamWZh1reVsGADujKigBUFTi19mlRjqEGsE8qH4r3s+skY33dNdXOwyZIvuftZ5tqdF1IgsMejMA==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/@jest/types/-/types-25.5.0.tgz", + "integrity": "sha512-OXD0RgQ86Tu3MazKo8bnrkDRaDXXMGUqd+kTtLtK1Zb7CRzQcaSRPPPV37SvYTdevXEBVxe0HXylEjs8ibkmCw==", "dev": true, "requires": { "@types/istanbul-lib-coverage": "^2.0.0", @@ -893,12 +913,11 @@ }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -934,9 +953,9 @@ "dev": true }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -945,18 +964,18 @@ } }, "@sinonjs/commons": { - "version": "1.7.1", - "resolved": "https://registry.npmjs.org/@sinonjs/commons/-/commons-1.7.1.tgz", - "integrity": "sha512-Debi3Baff1Qu1Unc3mjJ96MgpbwTn43S1+9yJ0llWygPwDNu2aaWBD6yc9y/Z8XDRNhx7U+u2UDg2OGQXkclUQ==", + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/@sinonjs/commons/-/commons-1.8.1.tgz", + "integrity": "sha512-892K+kWUUi3cl+LlqEWIDrhvLgdL79tECi8JZUyq6IviKy/DNhuzCRlbHUjxK89f4ypPMMaFnFuR9Ie6DoIMsw==", "dev": true, "requires": { "type-detect": "4.0.8" } }, "@types/babel__core": { - "version": "7.1.6", - "resolved": "https://registry.npmjs.org/@types/babel__core/-/babel__core-7.1.6.tgz", - "integrity": "sha512-tTnhWszAqvXnhW7m5jQU9PomXSiKXk2sFxpahXvI20SZKu9ylPi8WtIxueZ6ehDWikPT0jeFujMj3X4ZHuf3Tg==", + "version": "7.1.12", + "resolved": "https://registry.npmjs.org/@types/babel__core/-/babel__core-7.1.12.tgz", + "integrity": "sha512-wMTHiiTiBAAPebqaPiPDLFA4LYPKr6Ph0Xq/6rq1Ur3v66HXyG+clfR9CNETkD7MQS8ZHvpQOtA53DLws5WAEQ==", "dev": true, "requires": { "@babel/parser": "^7.1.0", @@ -967,18 +986,18 @@ } }, "@types/babel__generator": { - "version": "7.6.1", - "resolved": "https://registry.npmjs.org/@types/babel__generator/-/babel__generator-7.6.1.tgz", - "integrity": "sha512-bBKm+2VPJcMRVwNhxKu8W+5/zT7pwNEqeokFOmbvVSqGzFneNxYcEBro9Ac7/N9tlsaPYnZLK8J1LWKkMsLAew==", + "version": "7.6.2", + "resolved": "https://registry.npmjs.org/@types/babel__generator/-/babel__generator-7.6.2.tgz", + "integrity": "sha512-MdSJnBjl+bdwkLskZ3NGFp9YcXGx5ggLpQQPqtgakVhsWK0hTtNYhjpZLlWQTviGTvF8at+Bvli3jV7faPdgeQ==", "dev": true, "requires": { "@babel/types": "^7.0.0" } }, "@types/babel__template": { - "version": "7.0.2", - "resolved": "https://registry.npmjs.org/@types/babel__template/-/babel__template-7.0.2.tgz", - "integrity": "sha512-/K6zCpeW7Imzgab2bLkLEbz0+1JlFSrUMdw7KoIIu+IUdu51GWaBZpd3y1VXGVXzynvGa4DaIaxNZHiON3GXUg==", + "version": "7.4.0", + "resolved": "https://registry.npmjs.org/@types/babel__template/-/babel__template-7.4.0.tgz", + "integrity": "sha512-NTPErx4/FiPCGScH7foPyr+/1Dkzkni+rHiYHHoTjvwou7AQzJkNeD60A9CXRy+ZEN2B1bggmkTMCDb+Mv5k+A==", "dev": true, "requires": { "@babel/parser": "^7.1.0", @@ -986,9 +1005,9 @@ } }, "@types/babel__traverse": { - "version": "7.0.9", - "resolved": "https://registry.npmjs.org/@types/babel__traverse/-/babel__traverse-7.0.9.tgz", - "integrity": "sha512-jEFQ8L1tuvPjOI8lnpaf73oCJe+aoxL6ygqSy6c8LcW98zaC+4mzWuQIRCEvKeCOu+lbqdXcg4Uqmm1S8AP1tw==", + "version": "7.0.15", + "resolved": "https://registry.npmjs.org/@types/babel__traverse/-/babel__traverse-7.0.15.tgz", + "integrity": "sha512-Pzh9O3sTK8V6I1olsXpCfj2k/ygO2q1X0vhhnDrEQyYLHZesWz+zMZMVcwXLCYf0U36EtmyYaFGPfXlTtDHe3A==", "dev": true, "requires": { "@babel/types": "^7.3.0" @@ -1000,27 +1019,29 @@ "integrity": "sha512-rr+OQyAjxze7GgWrSaJwydHStIhHq2lvY3BOC2Mj7KnzI7XK0Uw1TOOdI9lDoajEbSWLiYgoo4f1R51erQfhPQ==", "dev": true }, - "@types/events": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/@types/events/-/events-3.0.0.tgz", - "integrity": "sha512-EaObqwIvayI5a8dCzhFrjKzVwKLxjoG9T6Ppd5CEo07LRKfQ8Yokw54r5+Wq7FaBQ+yXRvQAYPrHwya1/UFt9g==", - "dev": true - }, "@types/glob": { - "version": "7.1.1", - "resolved": "https://registry.npmjs.org/@types/glob/-/glob-7.1.1.tgz", - "integrity": "sha512-1Bh06cbWJUHMC97acuD6UMG29nMt0Aqz1vF3guLfG+kHHJhy3AyohZFFxYk2f7Q1SQIrNwvncxAE0N/9s70F2w==", + "version": "7.1.3", + "resolved": "https://registry.npmjs.org/@types/glob/-/glob-7.1.3.tgz", + "integrity": "sha512-SEYeGAIQIQX8NN6LDKprLjbrd5dARM5EXsd8GI/A5l0apYI1fGMWgPHSe4ZKL4eozlAyI+doUE9XbYS4xCkQ1w==", "dev": true, "requires": { - "@types/events": "*", "@types/minimatch": "*", "@types/node": "*" } }, + "@types/graceful-fs": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@types/graceful-fs/-/graceful-fs-4.1.4.tgz", + "integrity": "sha512-mWA/4zFQhfvOA8zWkXobwJvBD7vzcxgrOQ0J5CH1votGqdq9m7+FwtGaqyCZqC3NyyBkc9z4m+iry4LlqcMWJg==", + "dev": true, + "requires": { + "@types/node": "*" + } + }, "@types/istanbul-lib-coverage": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/@types/istanbul-lib-coverage/-/istanbul-lib-coverage-2.0.1.tgz", - "integrity": "sha512-hRJD2ahnnpLgsj6KWMYSrmXkM3rm2Dl1qkx6IOFD5FnuNPXJIG5L0dhgKXCYTRMGzU4n0wImQ/xfmRc4POUFlg==", + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/@types/istanbul-lib-coverage/-/istanbul-lib-coverage-2.0.3.tgz", + "integrity": "sha512-sz7iLqvVUg1gIedBOvlkxPlc8/uVzyS5OwGz1cKjXzkl3FpL3al0crU8YGU1WoHkxn0Wxbw5tyi6hvzJKNzFsw==", "dev": true }, "@types/istanbul-lib-report": { @@ -1033,9 +1054,9 @@ } }, "@types/istanbul-reports": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/@types/istanbul-reports/-/istanbul-reports-1.1.1.tgz", - "integrity": "sha512-UpYjBi8xefVChsCoBpKShdxTllC9pwISirfoZsUa2AAdQg/Jd2KQGtSbw+ya7GPo7x/wAPlH6JBhKhAsXUEZNA==", + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/@types/istanbul-reports/-/istanbul-reports-1.1.2.tgz", + "integrity": "sha512-P/W9yOX/3oPZSpaYOCQzGqgCQRXn0FFO/V8bWrCQs+wLmvVVxk6CRBXALEvNs9OHIatlnlFokfhuDo2ug01ciw==", "dev": true, "requires": { "@types/istanbul-lib-coverage": "*", @@ -1048,12 +1069,30 @@ "integrity": "sha512-tHq6qdbT9U1IRSGf14CL0pUlULksvY9OZ+5eEgl1N7t+OA3tGvNpxJCzuKQlsNgCVwbAs670L1vcVQi8j9HjnA==", "dev": true }, + "@types/minimist": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/@types/minimist/-/minimist-1.2.1.tgz", + "integrity": "sha512-fZQQafSREFyuZcdWFAExYjBiCL7AUCdgsk80iO0q4yihYYdcIiH28CcuPTGFgLOCC8RlW49GSQxdHwZP+I7CNg==", + "dev": true + }, "@types/node": { "version": "13.9.0", "resolved": "https://registry.npmjs.org/@types/node/-/node-13.9.0.tgz", "integrity": "sha512-0ARSQootUG1RljH2HncpsY2TJBfGQIKOOi7kxzUY6z54ePu/ZD+wJA8zI2Q6v8rol2qpG/rvqsReco8zNMPvhQ==", "dev": true }, + "@types/normalize-package-data": { + "version": "2.4.0", + "resolved": "https://registry.npmjs.org/@types/normalize-package-data/-/normalize-package-data-2.4.0.tgz", + "integrity": "sha512-f5j5b/Gf71L+dbqxIpQ4Z2WlmI/mPJ0fOkGGmFgtb6sAu97EPczzbS3/tJKxmcYDj55OX6ssqwDAWOHIYDRDGA==", + "dev": true + }, + "@types/prettier": { + "version": "1.19.1", + "resolved": "https://registry.npmjs.org/@types/prettier/-/prettier-1.19.1.tgz", + "integrity": "sha512-5qOlnZscTn4xxM5MeGXAMOsIOIKIbh9e85zJWfBRVPlRMEVawzoPhINYbRGkBZCI8LxvBe7tJCdWiarA99OZfQ==", + "dev": true + }, "@types/stack-utils": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/@types/stack-utils/-/stack-utils-1.0.1.tgz", @@ -1061,9 +1100,9 @@ "dev": true }, "@types/yargs": { - "version": "15.0.4", - "resolved": "https://registry.npmjs.org/@types/yargs/-/yargs-15.0.4.tgz", - "integrity": "sha512-9T1auFmbPZoxHz0enUFlUuKRy3it01R+hlggyVUMtnCTQRunsQYifnSGb8hET4Xo8yiC0o0r1paW3ud5+rbURg==", + "version": "15.0.10", + "resolved": "https://registry.npmjs.org/@types/yargs/-/yargs-15.0.10.tgz", + "integrity": "sha512-z8PNtlhrj7eJNLmrAivM7rjBESG6JwC5xP3RVk12i/8HVP7Xnx/sEmERnRImyEuUaJfO942X0qMOYsoupaJbZQ==", "dev": true, "requires": { "@types/yargs-parser": "*" @@ -1076,178 +1115,177 @@ "dev": true }, "@webassemblyjs/ast": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/ast/-/ast-1.8.5.tgz", - "integrity": "sha512-aJMfngIZ65+t71C3y2nBBg5FFG0Okt9m0XEgWZ7Ywgn1oMAT8cNwx00Uv1cQyHtidq0Xn94R4TAywO+LCQ+ZAQ==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/ast/-/ast-1.9.0.tgz", + "integrity": "sha512-C6wW5L+b7ogSDVqymbkkvuW9kruN//YisMED04xzeBBqjHa2FYnmvOlS6Xj68xWQRgWvI9cIglsjFowH/RJyEA==", "dev": true, "requires": { - "@webassemblyjs/helper-module-context": "1.8.5", - "@webassemblyjs/helper-wasm-bytecode": "1.8.5", - "@webassemblyjs/wast-parser": "1.8.5" + "@webassemblyjs/helper-module-context": "1.9.0", + "@webassemblyjs/helper-wasm-bytecode": "1.9.0", + "@webassemblyjs/wast-parser": "1.9.0" } }, "@webassemblyjs/floating-point-hex-parser": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/floating-point-hex-parser/-/floating-point-hex-parser-1.8.5.tgz", - "integrity": "sha512-9p+79WHru1oqBh9ewP9zW95E3XAo+90oth7S5Re3eQnECGq59ly1Ri5tsIipKGpiStHsUYmY3zMLqtk3gTcOtQ==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/floating-point-hex-parser/-/floating-point-hex-parser-1.9.0.tgz", + "integrity": "sha512-TG5qcFsS8QB4g4MhrxK5TqfdNe7Ey/7YL/xN+36rRjl/BlGE/NcBvJcqsRgCP6Z92mRE+7N50pRIi8SmKUbcQA==", "dev": true }, "@webassemblyjs/helper-api-error": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-api-error/-/helper-api-error-1.8.5.tgz", - "integrity": "sha512-Za/tnzsvnqdaSPOUXHyKJ2XI7PDX64kWtURyGiJJZKVEdFOsdKUCPTNEVFZq3zJ2R0G5wc2PZ5gvdTRFgm81zA==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-api-error/-/helper-api-error-1.9.0.tgz", + "integrity": "sha512-NcMLjoFMXpsASZFxJ5h2HZRcEhDkvnNFOAKneP5RbKRzaWJN36NC4jqQHKwStIhGXu5mUWlUUk7ygdtrO8lbmw==", "dev": true }, "@webassemblyjs/helper-buffer": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-buffer/-/helper-buffer-1.8.5.tgz", - "integrity": "sha512-Ri2R8nOS0U6G49Q86goFIPNgjyl6+oE1abW1pS84BuhP1Qcr5JqMwRFT3Ah3ADDDYGEgGs1iyb1DGX+kAi/c/Q==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-buffer/-/helper-buffer-1.9.0.tgz", + "integrity": "sha512-qZol43oqhq6yBPx7YM3m9Bv7WMV9Eevj6kMi6InKOuZxhw+q9hOkvq5e/PpKSiLfyetpaBnogSbNCfBwyB00CA==", "dev": true }, "@webassemblyjs/helper-code-frame": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-code-frame/-/helper-code-frame-1.8.5.tgz", - "integrity": "sha512-VQAadSubZIhNpH46IR3yWO4kZZjMxN1opDrzePLdVKAZ+DFjkGD/rf4v1jap744uPVU6yjL/smZbRIIJTOUnKQ==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-code-frame/-/helper-code-frame-1.9.0.tgz", + "integrity": "sha512-ERCYdJBkD9Vu4vtjUYe8LZruWuNIToYq/ME22igL+2vj2dQ2OOujIZr3MEFvfEaqKoVqpsFKAGsRdBSBjrIvZA==", "dev": true, "requires": { - "@webassemblyjs/wast-printer": "1.8.5" + "@webassemblyjs/wast-printer": "1.9.0" } }, "@webassemblyjs/helper-fsm": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-fsm/-/helper-fsm-1.8.5.tgz", - "integrity": "sha512-kRuX/saORcg8se/ft6Q2UbRpZwP4y7YrWsLXPbbmtepKr22i8Z4O3V5QE9DbZK908dh5Xya4Un57SDIKwB9eow==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-fsm/-/helper-fsm-1.9.0.tgz", + "integrity": "sha512-OPRowhGbshCb5PxJ8LocpdX9Kl0uB4XsAjl6jH/dWKlk/mzsANvhwbiULsaiqT5GZGT9qinTICdj6PLuM5gslw==", "dev": true }, "@webassemblyjs/helper-module-context": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-module-context/-/helper-module-context-1.8.5.tgz", - "integrity": "sha512-/O1B236mN7UNEU4t9X7Pj38i4VoU8CcMHyy3l2cV/kIF4U5KoHXDVqcDuOs1ltkac90IM4vZdHc52t1x8Yfs3g==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-module-context/-/helper-module-context-1.9.0.tgz", + "integrity": "sha512-MJCW8iGC08tMk2enck1aPW+BE5Cw8/7ph/VGZxwyvGbJwjktKkDK7vy7gAmMDx88D7mhDTCNKAW5tED+gZ0W8g==", "dev": true, "requires": { - "@webassemblyjs/ast": "1.8.5", - "mamacro": "^0.0.3" + "@webassemblyjs/ast": "1.9.0" } }, "@webassemblyjs/helper-wasm-bytecode": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-bytecode/-/helper-wasm-bytecode-1.8.5.tgz", - "integrity": "sha512-Cu4YMYG3Ddl72CbmpjU/wbP6SACcOPVbHN1dI4VJNJVgFwaKf1ppeFJrwydOG3NDHxVGuCfPlLZNyEdIYlQ6QQ==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-bytecode/-/helper-wasm-bytecode-1.9.0.tgz", + "integrity": "sha512-R7FStIzyNcd7xKxCZH5lE0Bqy+hGTwS3LJjuv1ZVxd9O7eHCedSdrId/hMOd20I+v8wDXEn+bjfKDLzTepoaUw==", "dev": true }, "@webassemblyjs/helper-wasm-section": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-section/-/helper-wasm-section-1.8.5.tgz", - "integrity": "sha512-VV083zwR+VTrIWWtgIUpqfvVdK4ff38loRmrdDBgBT8ADXYsEZ5mPQ4Nde90N3UYatHdYoDIFb7oHzMncI02tA==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-section/-/helper-wasm-section-1.9.0.tgz", + "integrity": "sha512-XnMB8l3ek4tvrKUUku+IVaXNHz2YsJyOOmz+MMkZvh8h1uSJpSen6vYnw3IoQ7WwEuAhL8Efjms1ZWjqh2agvw==", "dev": true, "requires": { - "@webassemblyjs/ast": "1.8.5", - "@webassemblyjs/helper-buffer": "1.8.5", - "@webassemblyjs/helper-wasm-bytecode": "1.8.5", - "@webassemblyjs/wasm-gen": "1.8.5" + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/helper-buffer": "1.9.0", + "@webassemblyjs/helper-wasm-bytecode": "1.9.0", + "@webassemblyjs/wasm-gen": "1.9.0" } }, "@webassemblyjs/ieee754": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/ieee754/-/ieee754-1.8.5.tgz", - "integrity": "sha512-aaCvQYrvKbY/n6wKHb/ylAJr27GglahUO89CcGXMItrOBqRarUMxWLJgxm9PJNuKULwN5n1csT9bYoMeZOGF3g==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/ieee754/-/ieee754-1.9.0.tgz", + "integrity": "sha512-dcX8JuYU/gvymzIHc9DgxTzUUTLexWwt8uCTWP3otys596io0L5aW02Gb1RjYpx2+0Jus1h4ZFqjla7umFniTg==", "dev": true, "requires": { "@xtuc/ieee754": "^1.2.0" } }, "@webassemblyjs/leb128": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/leb128/-/leb128-1.8.5.tgz", - "integrity": "sha512-plYUuUwleLIziknvlP8VpTgO4kqNaH57Y3JnNa6DLpu/sGcP6hbVdfdX5aHAV716pQBKrfuU26BJK29qY37J7A==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/leb128/-/leb128-1.9.0.tgz", + "integrity": "sha512-ENVzM5VwV1ojs9jam6vPys97B/S65YQtv/aanqnU7D8aSoHFX8GyhGg0CMfyKNIHBuAVjy3tlzd5QMMINa7wpw==", "dev": true, "requires": { "@xtuc/long": "4.2.2" } }, "@webassemblyjs/utf8": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/utf8/-/utf8-1.8.5.tgz", - "integrity": "sha512-U7zgftmQriw37tfD934UNInokz6yTmn29inT2cAetAsaU9YeVCveWEwhKL1Mg4yS7q//NGdzy79nlXh3bT8Kjw==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/utf8/-/utf8-1.9.0.tgz", + "integrity": "sha512-GZbQlWtopBTP0u7cHrEx+73yZKrQoBMpwkGEIqlacljhXCkVM1kMQge/Mf+csMJAjEdSwhOyLAS0AoR3AG5P8w==", "dev": true }, "@webassemblyjs/wasm-edit": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-edit/-/wasm-edit-1.8.5.tgz", - "integrity": "sha512-A41EMy8MWw5yvqj7MQzkDjU29K7UJq1VrX2vWLzfpRHt3ISftOXqrtojn7nlPsZ9Ijhp5NwuODuycSvfAO/26Q==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-edit/-/wasm-edit-1.9.0.tgz", + "integrity": "sha512-FgHzBm80uwz5M8WKnMTn6j/sVbqilPdQXTWraSjBwFXSYGirpkSWE2R9Qvz9tNiTKQvoKILpCuTjBKzOIm0nxw==", "dev": true, "requires": { - "@webassemblyjs/ast": "1.8.5", - "@webassemblyjs/helper-buffer": "1.8.5", - "@webassemblyjs/helper-wasm-bytecode": "1.8.5", - "@webassemblyjs/helper-wasm-section": "1.8.5", - "@webassemblyjs/wasm-gen": "1.8.5", - "@webassemblyjs/wasm-opt": "1.8.5", - "@webassemblyjs/wasm-parser": "1.8.5", - "@webassemblyjs/wast-printer": "1.8.5" + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/helper-buffer": "1.9.0", + "@webassemblyjs/helper-wasm-bytecode": "1.9.0", + "@webassemblyjs/helper-wasm-section": "1.9.0", + "@webassemblyjs/wasm-gen": "1.9.0", + "@webassemblyjs/wasm-opt": "1.9.0", + "@webassemblyjs/wasm-parser": "1.9.0", + "@webassemblyjs/wast-printer": "1.9.0" } }, "@webassemblyjs/wasm-gen": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-gen/-/wasm-gen-1.8.5.tgz", - "integrity": "sha512-BCZBT0LURC0CXDzj5FXSc2FPTsxwp3nWcqXQdOZE4U7h7i8FqtFK5Egia6f9raQLpEKT1VL7zr4r3+QX6zArWg==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-gen/-/wasm-gen-1.9.0.tgz", + "integrity": "sha512-cPE3o44YzOOHvlsb4+E9qSqjc9Qf9Na1OO/BHFy4OI91XDE14MjFN4lTMezzaIWdPqHnsTodGGNP+iRSYfGkjA==", "dev": true, "requires": { - "@webassemblyjs/ast": "1.8.5", - "@webassemblyjs/helper-wasm-bytecode": "1.8.5", - "@webassemblyjs/ieee754": "1.8.5", - "@webassemblyjs/leb128": "1.8.5", - "@webassemblyjs/utf8": "1.8.5" + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/helper-wasm-bytecode": "1.9.0", + "@webassemblyjs/ieee754": "1.9.0", + "@webassemblyjs/leb128": "1.9.0", + "@webassemblyjs/utf8": "1.9.0" } }, "@webassemblyjs/wasm-opt": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-opt/-/wasm-opt-1.8.5.tgz", - "integrity": "sha512-HKo2mO/Uh9A6ojzu7cjslGaHaUU14LdLbGEKqTR7PBKwT6LdPtLLh9fPY33rmr5wcOMrsWDbbdCHq4hQUdd37Q==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-opt/-/wasm-opt-1.9.0.tgz", + "integrity": "sha512-Qkjgm6Anhm+OMbIL0iokO7meajkzQD71ioelnfPEj6r4eOFuqm4YC3VBPqXjFyyNwowzbMD+hizmprP/Fwkl2A==", "dev": true, "requires": { - "@webassemblyjs/ast": "1.8.5", - "@webassemblyjs/helper-buffer": "1.8.5", - "@webassemblyjs/wasm-gen": "1.8.5", - "@webassemblyjs/wasm-parser": "1.8.5" + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/helper-buffer": "1.9.0", + "@webassemblyjs/wasm-gen": "1.9.0", + "@webassemblyjs/wasm-parser": "1.9.0" } }, "@webassemblyjs/wasm-parser": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-parser/-/wasm-parser-1.8.5.tgz", - "integrity": "sha512-pi0SYE9T6tfcMkthwcgCpL0cM9nRYr6/6fjgDtL6q/ZqKHdMWvxitRi5JcZ7RI4SNJJYnYNaWy5UUrHQy998lw==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-parser/-/wasm-parser-1.9.0.tgz", + "integrity": "sha512-9+wkMowR2AmdSWQzsPEjFU7njh8HTO5MqO8vjwEHuM+AMHioNqSBONRdr0NQQ3dVQrzp0s8lTcYqzUdb7YgELA==", "dev": true, "requires": { - "@webassemblyjs/ast": "1.8.5", - "@webassemblyjs/helper-api-error": "1.8.5", - "@webassemblyjs/helper-wasm-bytecode": "1.8.5", - "@webassemblyjs/ieee754": "1.8.5", - "@webassemblyjs/leb128": "1.8.5", - "@webassemblyjs/utf8": "1.8.5" + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/helper-api-error": "1.9.0", + "@webassemblyjs/helper-wasm-bytecode": "1.9.0", + "@webassemblyjs/ieee754": "1.9.0", + "@webassemblyjs/leb128": "1.9.0", + "@webassemblyjs/utf8": "1.9.0" } }, "@webassemblyjs/wast-parser": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-parser/-/wast-parser-1.8.5.tgz", - "integrity": "sha512-daXC1FyKWHF1i11obK086QRlsMsY4+tIOKgBqI1lxAnkp9xe9YMcgOxm9kLe+ttjs5aWV2KKE1TWJCN57/Btsg==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-parser/-/wast-parser-1.9.0.tgz", + "integrity": "sha512-qsqSAP3QQ3LyZjNC/0jBJ/ToSxfYJ8kYyuiGvtn/8MK89VrNEfwj7BPQzJVHi0jGTRK2dGdJ5PRqhtjzoww+bw==", "dev": true, "requires": { - "@webassemblyjs/ast": "1.8.5", - "@webassemblyjs/floating-point-hex-parser": "1.8.5", - "@webassemblyjs/helper-api-error": "1.8.5", - "@webassemblyjs/helper-code-frame": "1.8.5", - "@webassemblyjs/helper-fsm": "1.8.5", + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/floating-point-hex-parser": "1.9.0", + "@webassemblyjs/helper-api-error": "1.9.0", + "@webassemblyjs/helper-code-frame": "1.9.0", + "@webassemblyjs/helper-fsm": "1.9.0", "@xtuc/long": "4.2.2" } }, "@webassemblyjs/wast-printer": { - "version": "1.8.5", - "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-printer/-/wast-printer-1.8.5.tgz", - "integrity": "sha512-w0U0pD4EhlnvRyeJzBqaVSJAo9w/ce7/WPogeXLzGkO6hzhr4GnQIZ4W4uUt5b9ooAaXPtnXlj0gzsXEOUNYMg==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-printer/-/wast-printer-1.9.0.tgz", + "integrity": "sha512-2J0nE95rHXHyQ24cWjMKJ1tqB/ds8z/cyeOZxJhcb+rW+SQASVjuznUSmdz5GpVJTzU8JkhYut0D3siFDD6wsA==", "dev": true, "requires": { - "@webassemblyjs/ast": "1.8.5", - "@webassemblyjs/wast-parser": "1.8.5", + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/wast-parser": "1.9.0", "@xtuc/long": "4.2.2" } }, @@ -1274,9 +1312,9 @@ } }, "abab": { - "version": "2.0.3", - "resolved": "https://registry.npmjs.org/abab/-/abab-2.0.3.tgz", - "integrity": "sha512-tsFzPpcttalNjFBCFMqsKYQcWxxen1pgJR56by//QwvJc4/OUS3kPOOttx2tSIfjsylB0pYu7f5D3K1RCxUnUg==", + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/abab/-/abab-2.0.5.tgz", + "integrity": "sha512-9IK9EadsbHo6jLWIpxpR6pL0sazTXV6+SQv25ZB+F7Bj9mJNaOc4nCRabwd5M/JwmUa8idz6Eci6eKfJryPs6Q==", "dev": true }, "accepts": { @@ -1306,9 +1344,9 @@ }, "dependencies": { "acorn": { - "version": "6.4.1", - "resolved": "https://registry.npmjs.org/acorn/-/acorn-6.4.1.tgz", - "integrity": "sha512-ZVA9k326Nwrj3Cj9jlh3wGFutC2ZornPNARZwsNYqQYgN0EsV2d53w5RN/co65Ohn4sUAUtb1rSUAOD6XN9idA==", + "version": "6.4.2", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-6.4.2.tgz", + "integrity": "sha512-XtGIhXwF8YM8bJhGxG5kXgjkEuNGLTkoYqVE+KMR+aspr4KGYmKYg7yUe3KghyQ9yheNwLnjmzh/7+gfDBmHCQ==", "dev": true } } @@ -1350,9 +1388,9 @@ "dev": true }, "ajv-keywords": { - "version": "3.4.1", - "resolved": "https://registry.npmjs.org/ajv-keywords/-/ajv-keywords-3.4.1.tgz", - "integrity": "sha512-RO1ibKvd27e6FEShVFfPALuHI3WjSVNeK5FIsmme/LYRNxjKuNj+Dt7bucLa6NdSv3JcVTyMlm9kGR84z1XpaQ==", + "version": "3.5.2", + "resolved": "https://registry.npmjs.org/ajv-keywords/-/ajv-keywords-3.5.2.tgz", + "integrity": "sha512-5p6WTN0DdTGVQk6VjcEju19IgaHudalcfabD7yhDGeA6bcQnmL+CpveLJq/3hvfwd1aof6L386Ougkx6RfyMIQ==", "dev": true }, "ansi-colors": { @@ -1650,14 +1688,23 @@ } }, "asn1.js": { - "version": "4.10.1", - "resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-4.10.1.tgz", - "integrity": "sha512-p32cOF5q0Zqs9uBiONKYLm6BClCoBCM5O9JfeUSlnQLBTxYdTK+pW+nXflm8UkKd2UYlEbYz5qEi0JuZR9ckSw==", + "version": "5.4.1", + "resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-5.4.1.tgz", + "integrity": "sha512-+I//4cYPccV8LdmBLiX8CYvf9Sp3vQsrqu2QNXRcrbiWvcx/UdlFiqUJJzxRQxgsZmvhXhn4cSKeSmoFjVdupA==", "dev": true, "requires": { "bn.js": "^4.0.0", "inherits": "^2.0.1", - "minimalistic-assert": "^1.0.0" + "minimalistic-assert": "^1.0.0", + "safer-buffer": "^2.1.0" + }, + "dependencies": { + "bn.js": { + "version": "4.11.9", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.9.tgz", + "integrity": "sha512-E6QoYqCKZfgatHTdHzs1RRKP7ip4vvm+EyRUeE2RF0NblwVvb0p6jSVeNTOFxPn26QXN2o6SMfNxKp6kU8zQaw==", + "dev": true + } } }, "assert": { @@ -1766,33 +1813,33 @@ "dev": true }, "aws4": { - "version": "1.9.1", - "resolved": "https://registry.npmjs.org/aws4/-/aws4-1.9.1.tgz", - "integrity": "sha512-wMHVg2EOHaMRxbzgFJ9gtjOOCrI80OHLG14rxi28XwOW8ux6IiEbRCGGGqCtdAIg4FQCbW20k9RsT4y3gJlFug==", + "version": "1.11.0", + "resolved": "https://registry.npmjs.org/aws4/-/aws4-1.11.0.tgz", + "integrity": "sha512-xh1Rl34h6Fi1DC2WWKfxUTVqRsNnr6LsKz2+hfwDxQJWmrx8+c7ylaqBMcHfl1U1r2dsifOvKX3LQuLNZ+XSvA==", "dev": true }, "babel-jest": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/babel-jest/-/babel-jest-25.1.0.tgz", - "integrity": "sha512-tz0VxUhhOE2y+g8R2oFrO/2VtVjA1lkJeavlhExuRBg3LdNJY9gwQ+Vcvqt9+cqy71MCTJhewvTB7Qtnnr9SWg==", + "version": "25.5.1", + "resolved": "https://registry.npmjs.org/babel-jest/-/babel-jest-25.5.1.tgz", + "integrity": "sha512-9dA9+GmMjIzgPnYtkhBg73gOo/RHqPmLruP3BaGL4KEX3Dwz6pI8auSN8G8+iuEG90+GSswyKvslN+JYSaacaQ==", "dev": true, "requires": { - "@jest/transform": "^25.1.0", - "@jest/types": "^25.1.0", - "@types/babel__core": "^7.1.0", + "@jest/transform": "^25.5.1", + "@jest/types": "^25.5.0", + "@types/babel__core": "^7.1.7", "babel-plugin-istanbul": "^6.0.0", - "babel-preset-jest": "^25.1.0", + "babel-preset-jest": "^25.5.0", "chalk": "^3.0.0", + "graceful-fs": "^4.2.4", "slash": "^3.0.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -1821,6 +1868,12 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, + "graceful-fs": { + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", + "dev": true + }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", @@ -1828,9 +1881,9 @@ "dev": true }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -1852,23 +1905,43 @@ } }, "babel-plugin-jest-hoist": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/babel-plugin-jest-hoist/-/babel-plugin-jest-hoist-25.1.0.tgz", - "integrity": "sha512-oIsopO41vW4YFZ9yNYoLQATnnN46lp+MZ6H4VvPKFkcc2/fkl3CfE/NZZSmnEIEsJRmJAgkVEK0R7Zbl50CpTw==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/babel-plugin-jest-hoist/-/babel-plugin-jest-hoist-25.5.0.tgz", + "integrity": "sha512-u+/W+WAjMlvoocYGTwthAiQSxDcJAyHpQ6oWlHdFZaaN+Rlk8Q7iiwDPg2lN/FyJtAYnKjFxbn7xus4HCFkg5g==", "dev": true, "requires": { + "@babel/template": "^7.3.3", + "@babel/types": "^7.3.3", "@types/babel__traverse": "^7.0.6" } }, - "babel-preset-jest": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/babel-preset-jest/-/babel-preset-jest-25.1.0.tgz", - "integrity": "sha512-eCGn64olaqwUMaugXsTtGAM2I0QTahjEtnRu0ql8Ie+gDWAc1N6wqN0k2NilnyTunM69Pad7gJY7LOtwLimoFQ==", + "babel-preset-current-node-syntax": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/babel-preset-current-node-syntax/-/babel-preset-current-node-syntax-0.1.4.tgz", + "integrity": "sha512-5/INNCYhUGqw7VbVjT/hb3ucjgkVHKXY7lX3ZjlN4gm565VyFmJUrJ/h+h16ECVB38R/9SF6aACydpKMLZ/c9w==", "dev": true, "requires": { - "@babel/plugin-syntax-bigint": "^7.0.0", - "@babel/plugin-syntax-object-rest-spread": "^7.0.0", - "babel-plugin-jest-hoist": "^25.1.0" + "@babel/plugin-syntax-async-generators": "^7.8.4", + "@babel/plugin-syntax-bigint": "^7.8.3", + "@babel/plugin-syntax-class-properties": "^7.8.3", + "@babel/plugin-syntax-import-meta": "^7.8.3", + "@babel/plugin-syntax-json-strings": "^7.8.3", + "@babel/plugin-syntax-logical-assignment-operators": "^7.8.3", + "@babel/plugin-syntax-nullish-coalescing-operator": "^7.8.3", + "@babel/plugin-syntax-numeric-separator": "^7.8.3", + "@babel/plugin-syntax-object-rest-spread": "^7.8.3", + "@babel/plugin-syntax-optional-catch-binding": "^7.8.3", + "@babel/plugin-syntax-optional-chaining": "^7.8.3" + } + }, + "babel-preset-jest": { + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/babel-preset-jest/-/babel-preset-jest-25.5.0.tgz", + "integrity": "sha512-8ZczygctQkBU+63DtSOKGh7tFL0CeCuz+1ieud9lJ1WPQ9O6A1a/r+LGn6Y705PA6whHQ3T1XuB/PmpfNYf8Fw==", + "dev": true, + "requires": { + "babel-plugin-jest-hoist": "^25.5.0", + "babel-preset-current-node-syntax": "^0.1.2" } }, "bach": { @@ -1950,9 +2023,9 @@ } }, "base64-js": { - "version": "1.3.1", - "resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.3.1.tgz", - "integrity": "sha512-mLQ4i2QO1ytvGWFWmcngKO//JXAQueZvwEKtjgQFM4jIK0kU+ytMfplL8j+n5mspOfjHwoAg+9yhb7BwAHm36g==", + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.5.1.tgz", + "integrity": "sha512-AKpaYlHn8t4SVbOHCy+b5+KKgvR4vrsD8vbvrbiQJps7fKDTkjkDry6ji0rUJjC0kzbNePLwzxq8iypo41qeWA==", "dev": true }, "batch": { @@ -1995,9 +2068,9 @@ "dev": true }, "bn.js": { - "version": "4.11.8", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.8.tgz", - "integrity": "sha512-ItfYfPLkWHUjckQCk8xC+LwxgK8NYcXywGigJgSwOP8Y2iyWT4f2vsZnoOXTTbo+o5yXmIUJ4gn5538SO5S3gA==", + "version": "5.1.3", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-5.1.3.tgz", + "integrity": "sha512-GkTiFpjFtUzU9CbMeJ5iazkCzGL3jrhzerzZIuqLABjbwRaFt33I9tUdSNryIptM+RxDet6OKm2WnLXzW51KsQ==", "dev": true }, "body-parser": { @@ -2167,28 +2240,49 @@ } }, "browserify-rsa": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/browserify-rsa/-/browserify-rsa-4.0.1.tgz", - "integrity": "sha1-IeCr+vbyApzy+vsTNWenAdQTVSQ=", + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/browserify-rsa/-/browserify-rsa-4.1.0.tgz", + "integrity": "sha512-AdEER0Hkspgno2aR97SAf6vi0y0k8NuOpGnVH3O99rcA5Q6sh8QxcngtHuJ6uXwnfAXNM4Gn1Gb7/MV1+Ymbog==", "dev": true, "requires": { - "bn.js": "^4.1.0", + "bn.js": "^5.0.0", "randombytes": "^2.0.1" } }, "browserify-sign": { - "version": "4.0.4", - "resolved": "https://registry.npmjs.org/browserify-sign/-/browserify-sign-4.0.4.tgz", - "integrity": "sha1-qk62jl17ZYuqa/alfmMMvXqT0pg=", + "version": "4.2.1", + "resolved": "https://registry.npmjs.org/browserify-sign/-/browserify-sign-4.2.1.tgz", + "integrity": "sha512-/vrA5fguVAKKAVTNJjgSm1tRQDHUU6DbwO9IROu/0WAzC8PKhucDSh18J0RMvVeHAn5puMd+QHC2erPRNf8lmg==", "dev": true, "requires": { - "bn.js": "^4.1.1", - "browserify-rsa": "^4.0.0", - "create-hash": "^1.1.0", - "create-hmac": "^1.1.2", - "elliptic": "^6.0.0", - "inherits": "^2.0.1", - "parse-asn1": "^5.0.0" + "bn.js": "^5.1.1", + "browserify-rsa": "^4.0.1", + "create-hash": "^1.2.0", + "create-hmac": "^1.1.7", + "elliptic": "^6.5.3", + "inherits": "^2.0.4", + "parse-asn1": "^5.1.5", + "readable-stream": "^3.6.0", + "safe-buffer": "^5.2.0" + }, + "dependencies": { + "readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "dev": true, + "requires": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + } + }, + "safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==", + "dev": true + } } }, "browserify-zlib": { @@ -2275,9 +2369,9 @@ "dev": true }, "cacache": { - "version": "12.0.3", - "resolved": "https://registry.npmjs.org/cacache/-/cacache-12.0.3.tgz", - "integrity": "sha512-kqdmfXEGFepesTuROHMs3MpFLWrPkSSpRqOw80RCflZXy/khxaArvFrQ7uJxSUduzAufc6G0g1VUCOZXxWavPw==", + "version": "12.0.4", + "resolved": "https://registry.npmjs.org/cacache/-/cacache-12.0.4.tgz", + "integrity": "sha512-a0tMB40oefvuInr4Cwb3GerbL9xTj1D5yg0T5xrjGCGyfvbxseIXX7BAO/u/hIXdafzOI5JC3wDwHyf24buOAQ==", "dev": true, "requires": { "bluebird": "^3.5.5", @@ -2297,11 +2391,26 @@ "y18n": "^4.0.0" }, "dependencies": { + "lru-cache": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-5.1.1.tgz", + "integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==", + "dev": true, + "requires": { + "yallist": "^3.0.2" + } + }, "y18n": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz", "integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==", "dev": true + }, + "yallist": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", + "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==", + "dev": true } } }, @@ -2322,6 +2431,16 @@ "unset-value": "^1.0.0" } }, + "call-bind": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.0.tgz", + "integrity": "sha512-AEXsYIyyDY3MCzbwdhzG3Jx1R0J2wetQyUynn6dYHAO+bg8l1k7jwZtRv4ryryFs7EP+NDlikJlVe59jr0cM2w==", + "dev": true, + "requires": { + "function-bind": "^1.1.1", + "get-intrinsic": "^1.0.0" + } + }, "callsites": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/callsites/-/callsites-3.1.0.tgz", @@ -2592,9 +2711,9 @@ "dev": true }, "collect-v8-coverage": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/collect-v8-coverage/-/collect-v8-coverage-1.0.0.tgz", - "integrity": "sha512-VKIhJgvk8E1W28m5avZ2Gv2Ruv5YiF56ug2oclvaG9md69BuZImMG2sk9g7QNKLUbtYAKQjXjYxbYZVUlMMKmQ==", + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/collect-v8-coverage/-/collect-v8-coverage-1.0.1.tgz", + "integrity": "sha512-iBPtljfCNcTKNAto0KEtDfZ3qzjJvqE3aTGZsbhjSBlorqpXJlaWWtPO35D+ZImoC3KWejX64o+yPGxhWSTzfg==", "dev": true }, "collection-map": { @@ -2649,9 +2768,9 @@ } }, "commander": { - "version": "2.20.0", - "resolved": "https://registry.npmjs.org/commander/-/commander-2.20.0.tgz", - "integrity": "sha512-7j2y+40w61zy6YC2iRNpUe/NwhNyoXrYpHMrSunaMG64nRnaf96zO/KMQR4OyN/UnE5KLyEBnKHd4aG3rskjpQ==", + "version": "2.20.3", + "resolved": "https://registry.npmjs.org/commander/-/commander-2.20.3.tgz", + "integrity": "sha512-GpVkmM8vF2vQUkj2LvZmD35JxeJOLCwJ9cUkugyk2nuhbv3+mJvpLYYt+0+USMxE+oj+ey/lJEnhZw75x/OMcQ==", "dev": true }, "commondir": { @@ -2661,13 +2780,13 @@ "dev": true }, "compare-func": { - "version": "1.3.2", - "resolved": "https://registry.npmjs.org/compare-func/-/compare-func-1.3.2.tgz", - "integrity": "sha1-md0LpFfh+bxyKxLAjsM+6rMfpkg=", + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/compare-func/-/compare-func-2.0.0.tgz", + "integrity": "sha512-zHig5N+tPWARooBnb0Zx1MFcdfpyJrfTJ3Y5L+IFvUm8rM74hHz66z0gw0x4tijh5CorKkKUCnW82R2vmpeCRA==", "dev": true, "requires": { "array-ify": "^1.0.0", - "dot-prop": "^3.0.0" + "dot-prop": "^5.1.0" } }, "component-emitter": { @@ -2686,9 +2805,9 @@ }, "dependencies": { "mime-db": { - "version": "1.43.0", - "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.43.0.tgz", - "integrity": "sha512-+5dsGEEovYbT8UY9yD7eE4XTc4UwJ1jBYlgaQQF38ENsKR3wj/8q8RFZrF9WIZpB2V1ArTVFUva8sAul1NzRzQ==", + "version": "1.45.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.45.0.tgz", + "integrity": "sha512-CkqLUxUk15hofLoLyljJSrukZi8mAtgd+yE5uO4tqRZsdsAJKv0O+rFMhVDRJgozy+yG6md5KwuXhD4ocIoP+w==", "dev": true } } @@ -2777,71 +2896,84 @@ "dev": true }, "conventional-changelog": { - "version": "1.1.24", - "resolved": "https://registry.npmjs.org/conventional-changelog/-/conventional-changelog-1.1.24.tgz", - "integrity": "sha512-2WcSUst4Y3Z4hHvoMTWXMJr/DmgVdLiMOVY1Kak2LfFz+GIz2KDp5naqbFesYbfXPmaZ5p491dO0FWZIJoJw1Q==", + "version": "3.1.24", + "resolved": "https://registry.npmjs.org/conventional-changelog/-/conventional-changelog-3.1.24.tgz", + "integrity": "sha512-ed6k8PO00UVvhExYohroVPXcOJ/K1N0/drJHx/faTH37OIZthlecuLIRX/T6uOp682CAoVoFpu+sSEaeuH6Asg==", "dev": true, "requires": { - "conventional-changelog-angular": "^1.6.6", - "conventional-changelog-atom": "^0.2.8", - "conventional-changelog-codemirror": "^0.3.8", - "conventional-changelog-core": "^2.0.11", - "conventional-changelog-ember": "^0.3.12", - "conventional-changelog-eslint": "^1.0.9", - "conventional-changelog-express": "^0.3.6", - "conventional-changelog-jquery": "^0.1.0", - "conventional-changelog-jscs": "^0.1.0", - "conventional-changelog-jshint": "^0.3.8", - "conventional-changelog-preset-loader": "^1.1.8" + "conventional-changelog-angular": "^5.0.12", + "conventional-changelog-atom": "^2.0.8", + "conventional-changelog-codemirror": "^2.0.8", + "conventional-changelog-conventionalcommits": "^4.5.0", + "conventional-changelog-core": "^4.2.1", + "conventional-changelog-ember": "^2.0.9", + "conventional-changelog-eslint": "^3.0.9", + "conventional-changelog-express": "^2.0.6", + "conventional-changelog-jquery": "^3.0.11", + "conventional-changelog-jshint": "^2.0.9", + "conventional-changelog-preset-loader": "^2.3.4" } }, "conventional-changelog-angular": { - "version": "1.6.6", - "resolved": "https://registry.npmjs.org/conventional-changelog-angular/-/conventional-changelog-angular-1.6.6.tgz", - "integrity": "sha512-suQnFSqCxRwyBxY68pYTsFkG0taIdinHLNEAX5ivtw8bCRnIgnpvcHmlR/yjUyZIrNPYAoXlY1WiEKWgSE4BNg==", + "version": "5.0.12", + "resolved": "https://registry.npmjs.org/conventional-changelog-angular/-/conventional-changelog-angular-5.0.12.tgz", + "integrity": "sha512-5GLsbnkR/7A89RyHLvvoExbiGbd9xKdKqDTrArnPbOqBqG/2wIosu0fHwpeIRI8Tl94MhVNBXcLJZl92ZQ5USw==", "dev": true, "requires": { - "compare-func": "^1.3.1", + "compare-func": "^2.0.0", "q": "^1.5.1" } }, "conventional-changelog-atom": { - "version": "0.2.8", - "resolved": "https://registry.npmjs.org/conventional-changelog-atom/-/conventional-changelog-atom-0.2.8.tgz", - "integrity": "sha512-8pPZqhMbrnltNBizjoDCb/Sz85KyUXNDQxuAEYAU5V/eHn0okMBVjqc8aHWYpHrytyZWvMGbayOlDv7i8kEf6g==", + "version": "2.0.8", + "resolved": "https://registry.npmjs.org/conventional-changelog-atom/-/conventional-changelog-atom-2.0.8.tgz", + "integrity": "sha512-xo6v46icsFTK3bb7dY/8m2qvc8sZemRgdqLb/bjpBsH2UyOS8rKNTgcb5025Hri6IpANPApbXMg15QLb1LJpBw==", "dev": true, "requires": { "q": "^1.5.1" } }, "conventional-changelog-codemirror": { - "version": "0.3.8", - "resolved": "https://registry.npmjs.org/conventional-changelog-codemirror/-/conventional-changelog-codemirror-0.3.8.tgz", - "integrity": "sha512-3HFZKtBXTaUCHvz7ai6nk2+psRIkldDoNzCsom0egDtVmPsvvHZkzjynhdQyULfacRSsBTaiQ0ol6nBOL4dDiQ==", + "version": "2.0.8", + "resolved": "https://registry.npmjs.org/conventional-changelog-codemirror/-/conventional-changelog-codemirror-2.0.8.tgz", + "integrity": "sha512-z5DAsn3uj1Vfp7po3gpt2Boc+Bdwmw2++ZHa5Ak9k0UKsYAO5mH1UBTN0qSCuJZREIhX6WU4E1p3IW2oRCNzQw==", "dev": true, "requires": { "q": "^1.5.1" } }, - "conventional-changelog-core": { - "version": "2.0.11", - "resolved": "https://registry.npmjs.org/conventional-changelog-core/-/conventional-changelog-core-2.0.11.tgz", - "integrity": "sha512-HvTE6RlqeEZ/NFPtQeFLsIDOLrGP3bXYr7lFLMhCVsbduF1MXIe8OODkwMFyo1i9ku9NWBwVnVn0jDmIFXjDRg==", + "conventional-changelog-conventionalcommits": { + "version": "4.5.0", + "resolved": "https://registry.npmjs.org/conventional-changelog-conventionalcommits/-/conventional-changelog-conventionalcommits-4.5.0.tgz", + "integrity": "sha512-buge9xDvjjOxJlyxUnar/+6i/aVEVGA7EEh4OafBCXPlLUQPGbRUBhBUveWRxzvR8TEjhKEP4BdepnpG2FSZXw==", "dev": true, "requires": { - "conventional-changelog-writer": "^3.0.9", - "conventional-commits-parser": "^2.1.7", + "compare-func": "^2.0.0", + "lodash": "^4.17.15", + "q": "^1.5.1" + } + }, + "conventional-changelog-core": { + "version": "4.2.1", + "resolved": "https://registry.npmjs.org/conventional-changelog-core/-/conventional-changelog-core-4.2.1.tgz", + "integrity": "sha512-8cH8/DEoD3e5Q6aeogdR5oaaKs0+mG6+f+Om0ZYt3PNv7Zo0sQhu4bMDRsqAF+UTekTAtP1W/C41jH/fkm8Jtw==", + "dev": true, + "requires": { + "add-stream": "^1.0.0", + "conventional-changelog-writer": "^4.0.18", + "conventional-commits-parser": "^3.2.0", "dateformat": "^3.0.0", "get-pkg-repo": "^1.0.0", - "git-raw-commits": "^1.3.6", + "git-raw-commits": "2.0.0", "git-remote-origin-url": "^2.0.0", - "git-semver-tags": "^1.3.6", - "lodash": "^4.2.1", - "normalize-package-data": "^2.3.5", + "git-semver-tags": "^4.1.1", + "lodash": "^4.17.15", + "normalize-package-data": "^3.0.0", "q": "^1.5.1", - "read-pkg": "^1.1.0", - "read-pkg-up": "^1.0.1", - "through2": "^2.0.0" + "read-pkg": "^3.0.0", + "read-pkg-up": "^3.0.0", + "shelljs": "^0.8.3", + "through2": "^4.0.0" }, "dependencies": { "dateformat": { @@ -2849,103 +2981,290 @@ "resolved": "https://registry.npmjs.org/dateformat/-/dateformat-3.0.3.tgz", "integrity": "sha512-jyCETtSl3VMZMWeRo7iY1FL19ges1t55hMo5yaam4Jrsm5EPL89UQkoQRyiI+Yf4k8r2ZpdngkV8hr1lIdjb3Q==", "dev": true + }, + "find-up": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-2.1.0.tgz", + "integrity": "sha1-RdG35QbHF93UgndaK3eSCjwMV6c=", + "dev": true, + "requires": { + "locate-path": "^2.0.0" + } + }, + "hosted-git-info": { + "version": "3.0.7", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-3.0.7.tgz", + "integrity": "sha512-fWqc0IcuXs+BmE9orLDyVykAG9GJtGLGuZAAqgcckPgv5xad4AcXGIv8galtQvlwutxSlaMcdw7BUtq2EIvqCQ==", + "dev": true, + "requires": { + "lru-cache": "^6.0.0" + } + }, + "load-json-file": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-4.0.0.tgz", + "integrity": "sha1-L19Fq5HjMhYjT9U62rZo607AmTs=", + "dev": true, + "requires": { + "graceful-fs": "^4.1.2", + "parse-json": "^4.0.0", + "pify": "^3.0.0", + "strip-bom": "^3.0.0" + } + }, + "locate-path": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-2.0.0.tgz", + "integrity": "sha1-K1aLJl7slExtnA3pw9u7ygNUzY4=", + "dev": true, + "requires": { + "p-locate": "^2.0.0", + "path-exists": "^3.0.0" + } + }, + "normalize-package-data": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-3.0.0.tgz", + "integrity": "sha512-6lUjEI0d3v6kFrtgA/lOx4zHCWULXsFNIjHolnZCKCTLA6m/G625cdn3O7eNmT0iD3jfo6HZ9cdImGZwf21prw==", + "dev": true, + "requires": { + "hosted-git-info": "^3.0.6", + "resolve": "^1.17.0", + "semver": "^7.3.2", + "validate-npm-package-license": "^3.0.1" + } + }, + "p-limit": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-1.3.0.tgz", + "integrity": "sha512-vvcXsLAJ9Dr5rQOPk7toZQZJApBl2K4J6dANSsEuh6QI41JYcsS/qhTGa9ErIUUgK3WNQoJYvylxvjqmiqEA9Q==", + "dev": true, + "requires": { + "p-try": "^1.0.0" + } + }, + "p-locate": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-2.0.0.tgz", + "integrity": "sha1-IKAQOyIqcMj9OcwuWAaA893l7EM=", + "dev": true, + "requires": { + "p-limit": "^1.1.0" + } + }, + "p-try": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/p-try/-/p-try-1.0.0.tgz", + "integrity": "sha1-y8ec26+P1CKOE/Yh8rGiN8GyB7M=", + "dev": true + }, + "parse-json": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz", + "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=", + "dev": true, + "requires": { + "error-ex": "^1.3.1", + "json-parse-better-errors": "^1.0.1" + } + }, + "path-exists": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", + "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", + "dev": true + }, + "path-type": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/path-type/-/path-type-3.0.0.tgz", + "integrity": "sha512-T2ZUsdZFHgA3u4e5PfPbjd7HDDpxPnQb5jN0SrDsjNSuVXHJqtwTnWqG0B1jZrgmJ/7lj1EmVIByWt1gxGkWvg==", + "dev": true, + "requires": { + "pify": "^3.0.0" + } + }, + "pify": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz", + "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=", + "dev": true + }, + "read-pkg": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-3.0.0.tgz", + "integrity": "sha1-nLxoaXj+5l0WwA4rGcI3/Pbjg4k=", + "dev": true, + "requires": { + "load-json-file": "^4.0.0", + "normalize-package-data": "^2.3.2", + "path-type": "^3.0.0" + }, + "dependencies": { + "hosted-git-info": { + "version": "2.8.8", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", + "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==", + "dev": true + }, + "normalize-package-data": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", + "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", + "dev": true, + "requires": { + "hosted-git-info": "^2.1.4", + "resolve": "^1.10.0", + "semver": "2 || 3 || 4 || 5", + "validate-npm-package-license": "^3.0.1" + } + }, + "semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "dev": true + } + } + }, + "read-pkg-up": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-3.0.0.tgz", + "integrity": "sha1-PtSWaF26D4/hGNBpHcUfSh/5bwc=", + "dev": true, + "requires": { + "find-up": "^2.0.0", + "read-pkg": "^3.0.0" + } + }, + "readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "dev": true, + "requires": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + } + }, + "resolve": { + "version": "1.19.0", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.19.0.tgz", + "integrity": "sha512-rArEXAgsBG4UgRGcynxWIWKFvh/XZCcS8UJdHhwy91zwAvCZIbcs+vAbflgBnNjYMs/i/i+/Ux6IZhML1yPvxg==", + "dev": true, + "requires": { + "is-core-module": "^2.1.0", + "path-parse": "^1.0.6" + } + }, + "semver": { + "version": "7.3.2", + "resolved": "https://registry.npmjs.org/semver/-/semver-7.3.2.tgz", + "integrity": "sha512-OrOb32TeeambH6UrhtShmF7CRDqhL6/5XpPNp2DuRH6+9QLw/orhp72j87v8Qa1ScDkvrrBNpZcDejAirJmfXQ==", + "dev": true + }, + "strip-bom": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-3.0.0.tgz", + "integrity": "sha1-IzTBjpx1n3vdVv3vfprj1YjmjtM=", + "dev": true + }, + "through2": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/through2/-/through2-4.0.2.tgz", + "integrity": "sha512-iOqSav00cVxEEICeD7TjLB1sueEL+81Wpzp2bY17uZjZN0pWZPuo4suZ/61VujxmqSGFfgOcNuTZ85QJwNZQpw==", + "dev": true, + "requires": { + "readable-stream": "3" + } } } }, "conventional-changelog-ember": { - "version": "0.3.12", - "resolved": "https://registry.npmjs.org/conventional-changelog-ember/-/conventional-changelog-ember-0.3.12.tgz", - "integrity": "sha512-mmJzA7uzbrOqeF89dMMi6z17O07ORTXlTMArnLG9ZTX4oLaKNolUlxFUFlFm9JUoVWajVpaHQWjxH1EOQ+ARoQ==", + "version": "2.0.9", + "resolved": "https://registry.npmjs.org/conventional-changelog-ember/-/conventional-changelog-ember-2.0.9.tgz", + "integrity": "sha512-ulzIReoZEvZCBDhcNYfDIsLTHzYHc7awh+eI44ZtV5cx6LVxLlVtEmcO+2/kGIHGtw+qVabJYjdI5cJOQgXh1A==", "dev": true, "requires": { "q": "^1.5.1" } }, "conventional-changelog-eslint": { - "version": "1.0.9", - "resolved": "https://registry.npmjs.org/conventional-changelog-eslint/-/conventional-changelog-eslint-1.0.9.tgz", - "integrity": "sha512-h87nfVh2fdk9fJIvz26wCBsbDC/KxqCc5wSlNMZbXcARtbgNbNDIF7Y7ctokFdnxkzVdaHsbINkh548T9eBA7Q==", + "version": "3.0.9", + "resolved": "https://registry.npmjs.org/conventional-changelog-eslint/-/conventional-changelog-eslint-3.0.9.tgz", + "integrity": "sha512-6NpUCMgU8qmWmyAMSZO5NrRd7rTgErjrm4VASam2u5jrZS0n38V7Y9CzTtLT2qwz5xEChDR4BduoWIr8TfwvXA==", "dev": true, "requires": { "q": "^1.5.1" } }, "conventional-changelog-express": { - "version": "0.3.6", - "resolved": "https://registry.npmjs.org/conventional-changelog-express/-/conventional-changelog-express-0.3.6.tgz", - "integrity": "sha512-3iWVtBJZ9RnRnZveNDzOD8QRn6g6vUif0qVTWWyi5nUIAbuN1FfPVyKdAlJJfp5Im+dE8Kiy/d2SpaX/0X678Q==", + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/conventional-changelog-express/-/conventional-changelog-express-2.0.6.tgz", + "integrity": "sha512-SDez2f3iVJw6V563O3pRtNwXtQaSmEfTCaTBPCqn0oG0mfkq0rX4hHBq5P7De2MncoRixrALj3u3oQsNK+Q0pQ==", "dev": true, "requires": { "q": "^1.5.1" } }, "conventional-changelog-jquery": { - "version": "0.1.0", - "resolved": "https://registry.npmjs.org/conventional-changelog-jquery/-/conventional-changelog-jquery-0.1.0.tgz", - "integrity": "sha1-Agg5cWLjhGmG5xJztsecW1+A9RA=", + "version": "3.0.11", + "resolved": "https://registry.npmjs.org/conventional-changelog-jquery/-/conventional-changelog-jquery-3.0.11.tgz", + "integrity": "sha512-x8AWz5/Td55F7+o/9LQ6cQIPwrCjfJQ5Zmfqi8thwUEKHstEn4kTIofXub7plf1xvFA2TqhZlq7fy5OmV6BOMw==", "dev": true, "requires": { - "q": "^1.4.1" - } - }, - "conventional-changelog-jscs": { - "version": "0.1.0", - "resolved": "https://registry.npmjs.org/conventional-changelog-jscs/-/conventional-changelog-jscs-0.1.0.tgz", - "integrity": "sha1-BHnrRDzH1yxYvwvPDvHURKkvDlw=", - "dev": true, - "requires": { - "q": "^1.4.1" + "q": "^1.5.1" } }, "conventional-changelog-jshint": { - "version": "0.3.8", - "resolved": "https://registry.npmjs.org/conventional-changelog-jshint/-/conventional-changelog-jshint-0.3.8.tgz", - "integrity": "sha512-hn9QU4ZI/5V50wKPJNPGT4gEWgiBFpV6adieILW4MaUFynuDYOvQ71EMSj3EznJyKi/KzuXpc9dGmX8njZMjig==", + "version": "2.0.9", + "resolved": "https://registry.npmjs.org/conventional-changelog-jshint/-/conventional-changelog-jshint-2.0.9.tgz", + "integrity": "sha512-wMLdaIzq6TNnMHMy31hql02OEQ8nCQfExw1SE0hYL5KvU+JCTuPaDO+7JiogGT2gJAxiUGATdtYYfh+nT+6riA==", "dev": true, "requires": { - "compare-func": "^1.3.1", + "compare-func": "^2.0.0", "q": "^1.5.1" } }, "conventional-changelog-preset-loader": { - "version": "1.1.8", - "resolved": "https://registry.npmjs.org/conventional-changelog-preset-loader/-/conventional-changelog-preset-loader-1.1.8.tgz", - "integrity": "sha512-MkksM4G4YdrMlT2MbTsV2F6LXu/hZR0Tc/yenRrDIKRwBl/SP7ER4ZDlglqJsCzLJi4UonBc52Bkm5hzrOVCcw==", + "version": "2.3.4", + "resolved": "https://registry.npmjs.org/conventional-changelog-preset-loader/-/conventional-changelog-preset-loader-2.3.4.tgz", + "integrity": "sha512-GEKRWkrSAZeTq5+YjUZOYxdHq+ci4dNwHvpaBC3+ENalzFWuCWa9EZXSuZBpkr72sMdKB+1fyDV4takK1Lf58g==", "dev": true }, "conventional-changelog-writer": { - "version": "3.0.9", - "resolved": "https://registry.npmjs.org/conventional-changelog-writer/-/conventional-changelog-writer-3.0.9.tgz", - "integrity": "sha512-n9KbsxlJxRQsUnK6wIBRnARacvNnN4C/nxnxCkH+B/R1JS2Fa+DiP1dU4I59mEDEjgnFaN2+9wr1P1s7GYB5/Q==", + "version": "4.0.18", + "resolved": "https://registry.npmjs.org/conventional-changelog-writer/-/conventional-changelog-writer-4.0.18.tgz", + "integrity": "sha512-mAQDCKyB9HsE8Ko5cCM1Jn1AWxXPYV0v8dFPabZRkvsiWUul2YyAqbIaoMKF88Zf2ffnOPSvKhboLf3fnjo5/A==", "dev": true, "requires": { - "compare-func": "^1.3.1", - "conventional-commits-filter": "^1.1.6", + "compare-func": "^2.0.0", + "conventional-commits-filter": "^2.0.7", "dateformat": "^3.0.0", - "handlebars": "^4.0.2", + "handlebars": "^4.7.6", "json-stringify-safe": "^5.0.1", - "lodash": "^4.2.1", - "meow": "^4.0.0", - "semver": "^5.5.0", + "lodash": "^4.17.15", + "meow": "^8.0.0", + "semver": "^6.0.0", "split": "^1.0.0", - "through2": "^2.0.0" + "through2": "^4.0.0" }, "dependencies": { "camelcase": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz", - "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=", + "version": "5.3.1", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", + "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", "dev": true }, "camelcase-keys": { - "version": "4.2.0", - "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-4.2.0.tgz", - "integrity": "sha1-oqpfsa9oh1glnDLBQUJteJI7m3c=", + "version": "6.2.2", + "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-6.2.2.tgz", + "integrity": "sha512-YrwaA0vEKazPBkn0ipTiMpSajYDSe+KjQfrjhcBMxJt/znbvlHd8Pw/Vamaz5EB4Wfhs3SUR3Z9mwRu/P3s3Yg==", "dev": true, "requires": { - "camelcase": "^4.1.0", - "map-obj": "^2.0.0", - "quick-lru": "^1.0.0" + "camelcase": "^5.3.1", + "map-obj": "^4.0.0", + "quick-lru": "^4.0.1" } }, "dateformat": { @@ -2955,313 +3274,481 @@ "dev": true }, "find-up": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-2.1.0.tgz", - "integrity": "sha1-RdG35QbHF93UgndaK3eSCjwMV6c=", + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", + "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", "dev": true, "requires": { - "locate-path": "^2.0.0" + "locate-path": "^5.0.0", + "path-exists": "^4.0.0" + } + }, + "hosted-git-info": { + "version": "3.0.7", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-3.0.7.tgz", + "integrity": "sha512-fWqc0IcuXs+BmE9orLDyVykAG9GJtGLGuZAAqgcckPgv5xad4AcXGIv8galtQvlwutxSlaMcdw7BUtq2EIvqCQ==", + "dev": true, + "requires": { + "lru-cache": "^6.0.0" } }, "indent-string": { - "version": "3.2.0", - "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-3.2.0.tgz", - "integrity": "sha1-Sl/W0nzDMvN+VBmlBNu4NxBckok=", + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-4.0.0.tgz", + "integrity": "sha512-EdDDZu4A2OyIK7Lr/2zG+w5jmbuk1DVBnEwREQvBzspBJkCEbRa8GxU1lghYcaGJCnRWibjDXlq779X1/y5xwg==", "dev": true }, - "load-json-file": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-4.0.0.tgz", - "integrity": "sha1-L19Fq5HjMhYjT9U62rZo607AmTs=", - "dev": true, - "requires": { - "graceful-fs": "^4.1.2", - "parse-json": "^4.0.0", - "pify": "^3.0.0", - "strip-bom": "^3.0.0" - } - }, "map-obj": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-2.0.0.tgz", - "integrity": "sha1-plzSkIepJZi4eRJXpSPgISIqwfk=", + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-4.1.0.tgz", + "integrity": "sha512-glc9y00wgtwcDmp7GaE/0b0OnxpNJsVf3ael/An6Fe2Q51LLwN1er6sdomLRzz5h0+yMpiYLhWYF5R7HeqVd4g==", "dev": true }, "meow": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/meow/-/meow-4.0.1.tgz", - "integrity": "sha512-xcSBHD5Z86zaOc+781KrupuHAzeGXSLtiAOmBsiLDiPSaYSB6hdew2ng9EBAnZ62jagG9MHAOdxpDi/lWBFJ/A==", + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/meow/-/meow-8.0.0.tgz", + "integrity": "sha512-nbsTRz2fwniJBFgUkcdISq8y/q9n9VbiHYbfwklFh5V4V2uAcxtKQkDc0yCLPM/kP0d+inZBewn3zJqewHE7kg==", "dev": true, "requires": { - "camelcase-keys": "^4.0.0", - "decamelize-keys": "^1.0.0", - "loud-rejection": "^1.0.0", - "minimist": "^1.1.3", - "minimist-options": "^3.0.1", - "normalize-package-data": "^2.3.4", - "read-pkg-up": "^3.0.0", - "redent": "^2.0.0", - "trim-newlines": "^2.0.0" + "@types/minimist": "^1.2.0", + "camelcase-keys": "^6.2.2", + "decamelize-keys": "^1.1.0", + "hard-rejection": "^2.1.0", + "minimist-options": "4.1.0", + "normalize-package-data": "^3.0.0", + "read-pkg-up": "^7.0.1", + "redent": "^3.0.0", + "trim-newlines": "^3.0.0", + "type-fest": "^0.18.0", + "yargs-parser": "^20.2.3" } }, - "minimist": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", - "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", - "dev": true + "normalize-package-data": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-3.0.0.tgz", + "integrity": "sha512-6lUjEI0d3v6kFrtgA/lOx4zHCWULXsFNIjHolnZCKCTLA6m/G625cdn3O7eNmT0iD3jfo6HZ9cdImGZwf21prw==", + "dev": true, + "requires": { + "hosted-git-info": "^3.0.6", + "resolve": "^1.17.0", + "semver": "^7.3.2", + "validate-npm-package-license": "^3.0.1" + }, + "dependencies": { + "semver": { + "version": "7.3.2", + "resolved": "https://registry.npmjs.org/semver/-/semver-7.3.2.tgz", + "integrity": "sha512-OrOb32TeeambH6UrhtShmF7CRDqhL6/5XpPNp2DuRH6+9QLw/orhp72j87v8Qa1ScDkvrrBNpZcDejAirJmfXQ==", + "dev": true + } + } }, "parse-json": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz", - "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=", + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-5.1.0.tgz", + "integrity": "sha512-+mi/lmVVNKFNVyLXV31ERiy2CY5E1/F6QtJFEzoChPRwwngMNXRDQ9GJ5WdE2Z2P4AujsOi0/+2qHID68KwfIQ==", "dev": true, "requires": { + "@babel/code-frame": "^7.0.0", "error-ex": "^1.3.1", - "json-parse-better-errors": "^1.0.1" + "json-parse-even-better-errors": "^2.3.0", + "lines-and-columns": "^1.1.6" } }, - "path-type": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/path-type/-/path-type-3.0.0.tgz", - "integrity": "sha512-T2ZUsdZFHgA3u4e5PfPbjd7HDDpxPnQb5jN0SrDsjNSuVXHJqtwTnWqG0B1jZrgmJ/7lj1EmVIByWt1gxGkWvg==", - "dev": true, - "requires": { - "pify": "^3.0.0" - } - }, - "pify": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz", - "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=", + "path-exists": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", + "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", "dev": true }, "read-pkg": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-3.0.0.tgz", - "integrity": "sha1-nLxoaXj+5l0WwA4rGcI3/Pbjg4k=", + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-5.2.0.tgz", + "integrity": "sha512-Ug69mNOpfvKDAc2Q8DRpMjjzdtrnv9HcSMX+4VsZxD1aZ6ZzrIE7rlzXBtWTyhULSMKg076AW6WR5iZpD0JiOg==", "dev": true, "requires": { - "load-json-file": "^4.0.0", - "normalize-package-data": "^2.3.2", - "path-type": "^3.0.0" + "@types/normalize-package-data": "^2.4.0", + "normalize-package-data": "^2.5.0", + "parse-json": "^5.0.0", + "type-fest": "^0.6.0" + }, + "dependencies": { + "hosted-git-info": { + "version": "2.8.8", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", + "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==", + "dev": true + }, + "normalize-package-data": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", + "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", + "dev": true, + "requires": { + "hosted-git-info": "^2.1.4", + "resolve": "^1.10.0", + "semver": "2 || 3 || 4 || 5", + "validate-npm-package-license": "^3.0.1" + } + }, + "semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "dev": true + }, + "type-fest": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.6.0.tgz", + "integrity": "sha512-q+MB8nYR1KDLrgr4G5yemftpMC7/QLqVndBmEEdqzmNj5dcFOO4Oo8qlwZE3ULT3+Zim1F8Kq4cBnikNhlCMlg==", + "dev": true + } } }, "read-pkg-up": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-3.0.0.tgz", - "integrity": "sha1-PtSWaF26D4/hGNBpHcUfSh/5bwc=", + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-7.0.1.tgz", + "integrity": "sha512-zK0TB7Xd6JpCLmlLmufqykGE+/TlOePD6qKClNW7hHDKFh/J7/7gCWGR7joEQEW1bKq3a3yUZSObOoWLFQ4ohg==", "dev": true, "requires": { - "find-up": "^2.0.0", - "read-pkg": "^3.0.0" + "find-up": "^4.1.0", + "read-pkg": "^5.2.0", + "type-fest": "^0.8.1" + }, + "dependencies": { + "type-fest": { + "version": "0.8.1", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.8.1.tgz", + "integrity": "sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==", + "dev": true + } + } + }, + "readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "dev": true, + "requires": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" } }, "redent": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/redent/-/redent-2.0.0.tgz", - "integrity": "sha1-wbIAe0LVfrE4kHmzyDM2OdXhzKo=", + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/redent/-/redent-3.0.0.tgz", + "integrity": "sha512-6tDA8g98We0zd0GvVeMT9arEOnTw9qM03L9cJXaCjrip1OO764RDBLBfrB4cwzNGDj5OA5ioymC9GkizgWJDUg==", "dev": true, "requires": { - "indent-string": "^3.0.0", - "strip-indent": "^2.0.0" + "indent-string": "^4.0.0", + "strip-indent": "^3.0.0" } }, - "semver": { - "version": "5.7.1", - "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", - "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", - "dev": true - }, - "strip-bom": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-3.0.0.tgz", - "integrity": "sha1-IzTBjpx1n3vdVv3vfprj1YjmjtM=", - "dev": true + "resolve": { + "version": "1.19.0", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.19.0.tgz", + "integrity": "sha512-rArEXAgsBG4UgRGcynxWIWKFvh/XZCcS8UJdHhwy91zwAvCZIbcs+vAbflgBnNjYMs/i/i+/Ux6IZhML1yPvxg==", + "dev": true, + "requires": { + "is-core-module": "^2.1.0", + "path-parse": "^1.0.6" + } }, "strip-indent": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-2.0.0.tgz", - "integrity": "sha1-XvjbKV0B5u1sv3qrlpmNeCJSe2g=", - "dev": true + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-3.0.0.tgz", + "integrity": "sha512-laJTa3Jb+VQpaC6DseHhF7dXVqHTfJPCRDaEbid/drOhgitgYku/letMUqOXFoWV0zIIUbjpdH2t+tYj4bQMRQ==", + "dev": true, + "requires": { + "min-indent": "^1.0.0" + } + }, + "through2": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/through2/-/through2-4.0.2.tgz", + "integrity": "sha512-iOqSav00cVxEEICeD7TjLB1sueEL+81Wpzp2bY17uZjZN0pWZPuo4suZ/61VujxmqSGFfgOcNuTZ85QJwNZQpw==", + "dev": true, + "requires": { + "readable-stream": "3" + } }, "trim-newlines": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-2.0.0.tgz", - "integrity": "sha1-tAPQuRvlDDMd/EuC7s6yLD3hbSA=", + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-3.0.0.tgz", + "integrity": "sha512-C4+gOpvmxaSMKuEf9Qc134F1ZuOHVXKRbtEflf4NTtuuJDEIJ9p5PXsalL8SkeRw+qit1Mo+yuvMPAKwWg/1hA==", + "dev": true + }, + "type-fest": { + "version": "0.18.1", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.18.1.tgz", + "integrity": "sha512-OIAYXk8+ISY+qTOwkHtKqzAuxchoMiD9Udx+FSGQDuiRR+PJKJHc2NJAXlbhkGwTt/4/nKZxELY1w3ReWOL8mw==", + "dev": true + }, + "yargs-parser": { + "version": "20.2.4", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-20.2.4.tgz", + "integrity": "sha512-WOkpgNhPTlE73h4VFAFsOnomJVaovO8VqLDzy5saChRBFQFBoMYirowyW+Q9HB4HFF4Z7VZTiG3iSzJJA29yRA==", "dev": true } } }, "conventional-commits-filter": { - "version": "1.1.6", - "resolved": "https://registry.npmjs.org/conventional-commits-filter/-/conventional-commits-filter-1.1.6.tgz", - "integrity": "sha512-KcDgtCRKJCQhyk6VLT7zR+ZOyCnerfemE/CsR3iQpzRRFbLEs0Y6rwk3mpDvtOh04X223z+1xyJ582Stfct/0Q==", + "version": "2.0.7", + "resolved": "https://registry.npmjs.org/conventional-commits-filter/-/conventional-commits-filter-2.0.7.tgz", + "integrity": "sha512-ASS9SamOP4TbCClsRHxIHXRfcGCnIoQqkvAzCSbZzTFLfcTqJVugB0agRgsEELsqaeWgsXv513eS116wnlSSPA==", "dev": true, "requires": { - "is-subset": "^0.1.1", + "lodash.ismatch": "^4.4.0", "modify-values": "^1.0.0" } }, "conventional-commits-parser": { - "version": "2.1.7", - "resolved": "https://registry.npmjs.org/conventional-commits-parser/-/conventional-commits-parser-2.1.7.tgz", - "integrity": "sha512-BoMaddIEJ6B4QVMSDu9IkVImlGOSGA1I2BQyOZHeLQ6qVOJLcLKn97+fL6dGbzWEiqDzfH4OkcveULmeq2MHFQ==", + "version": "3.2.0", + "resolved": "https://registry.npmjs.org/conventional-commits-parser/-/conventional-commits-parser-3.2.0.tgz", + "integrity": "sha512-XmJiXPxsF0JhAKyfA2Nn+rZwYKJ60nanlbSWwwkGwLQFbugsc0gv1rzc7VbbUWAzJfR1qR87/pNgv9NgmxtBMQ==", "dev": true, "requires": { "JSONStream": "^1.0.4", - "is-text-path": "^1.0.0", - "lodash": "^4.2.1", - "meow": "^4.0.0", + "is-text-path": "^1.0.1", + "lodash": "^4.17.15", + "meow": "^8.0.0", "split2": "^2.0.0", - "through2": "^2.0.0", + "through2": "^4.0.0", "trim-off-newlines": "^1.0.0" }, "dependencies": { "camelcase": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz", - "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=", + "version": "5.3.1", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", + "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", "dev": true }, "camelcase-keys": { - "version": "4.2.0", - "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-4.2.0.tgz", - "integrity": "sha1-oqpfsa9oh1glnDLBQUJteJI7m3c=", + "version": "6.2.2", + "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-6.2.2.tgz", + "integrity": "sha512-YrwaA0vEKazPBkn0ipTiMpSajYDSe+KjQfrjhcBMxJt/znbvlHd8Pw/Vamaz5EB4Wfhs3SUR3Z9mwRu/P3s3Yg==", "dev": true, "requires": { - "camelcase": "^4.1.0", - "map-obj": "^2.0.0", - "quick-lru": "^1.0.0" + "camelcase": "^5.3.1", + "map-obj": "^4.0.0", + "quick-lru": "^4.0.1" } }, "find-up": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-2.1.0.tgz", - "integrity": "sha1-RdG35QbHF93UgndaK3eSCjwMV6c=", + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", + "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", "dev": true, "requires": { - "locate-path": "^2.0.0" + "locate-path": "^5.0.0", + "path-exists": "^4.0.0" + } + }, + "hosted-git-info": { + "version": "3.0.7", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-3.0.7.tgz", + "integrity": "sha512-fWqc0IcuXs+BmE9orLDyVykAG9GJtGLGuZAAqgcckPgv5xad4AcXGIv8galtQvlwutxSlaMcdw7BUtq2EIvqCQ==", + "dev": true, + "requires": { + "lru-cache": "^6.0.0" } }, "indent-string": { - "version": "3.2.0", - "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-3.2.0.tgz", - "integrity": "sha1-Sl/W0nzDMvN+VBmlBNu4NxBckok=", + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-4.0.0.tgz", + "integrity": "sha512-EdDDZu4A2OyIK7Lr/2zG+w5jmbuk1DVBnEwREQvBzspBJkCEbRa8GxU1lghYcaGJCnRWibjDXlq779X1/y5xwg==", "dev": true }, - "load-json-file": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-4.0.0.tgz", - "integrity": "sha1-L19Fq5HjMhYjT9U62rZo607AmTs=", - "dev": true, - "requires": { - "graceful-fs": "^4.1.2", - "parse-json": "^4.0.0", - "pify": "^3.0.0", - "strip-bom": "^3.0.0" - } - }, "map-obj": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-2.0.0.tgz", - "integrity": "sha1-plzSkIepJZi4eRJXpSPgISIqwfk=", + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-4.1.0.tgz", + "integrity": "sha512-glc9y00wgtwcDmp7GaE/0b0OnxpNJsVf3ael/An6Fe2Q51LLwN1er6sdomLRzz5h0+yMpiYLhWYF5R7HeqVd4g==", "dev": true }, "meow": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/meow/-/meow-4.0.1.tgz", - "integrity": "sha512-xcSBHD5Z86zaOc+781KrupuHAzeGXSLtiAOmBsiLDiPSaYSB6hdew2ng9EBAnZ62jagG9MHAOdxpDi/lWBFJ/A==", + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/meow/-/meow-8.0.0.tgz", + "integrity": "sha512-nbsTRz2fwniJBFgUkcdISq8y/q9n9VbiHYbfwklFh5V4V2uAcxtKQkDc0yCLPM/kP0d+inZBewn3zJqewHE7kg==", "dev": true, "requires": { - "camelcase-keys": "^4.0.0", - "decamelize-keys": "^1.0.0", - "loud-rejection": "^1.0.0", - "minimist": "^1.1.3", - "minimist-options": "^3.0.1", - "normalize-package-data": "^2.3.4", - "read-pkg-up": "^3.0.0", - "redent": "^2.0.0", - "trim-newlines": "^2.0.0" + "@types/minimist": "^1.2.0", + "camelcase-keys": "^6.2.2", + "decamelize-keys": "^1.1.0", + "hard-rejection": "^2.1.0", + "minimist-options": "4.1.0", + "normalize-package-data": "^3.0.0", + "read-pkg-up": "^7.0.1", + "redent": "^3.0.0", + "trim-newlines": "^3.0.0", + "type-fest": "^0.18.0", + "yargs-parser": "^20.2.3" } }, - "minimist": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", - "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", - "dev": true + "normalize-package-data": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-3.0.0.tgz", + "integrity": "sha512-6lUjEI0d3v6kFrtgA/lOx4zHCWULXsFNIjHolnZCKCTLA6m/G625cdn3O7eNmT0iD3jfo6HZ9cdImGZwf21prw==", + "dev": true, + "requires": { + "hosted-git-info": "^3.0.6", + "resolve": "^1.17.0", + "semver": "^7.3.2", + "validate-npm-package-license": "^3.0.1" + } }, "parse-json": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz", - "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=", + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-5.1.0.tgz", + "integrity": "sha512-+mi/lmVVNKFNVyLXV31ERiy2CY5E1/F6QtJFEzoChPRwwngMNXRDQ9GJ5WdE2Z2P4AujsOi0/+2qHID68KwfIQ==", "dev": true, "requires": { + "@babel/code-frame": "^7.0.0", "error-ex": "^1.3.1", - "json-parse-better-errors": "^1.0.1" + "json-parse-even-better-errors": "^2.3.0", + "lines-and-columns": "^1.1.6" } }, - "path-type": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/path-type/-/path-type-3.0.0.tgz", - "integrity": "sha512-T2ZUsdZFHgA3u4e5PfPbjd7HDDpxPnQb5jN0SrDsjNSuVXHJqtwTnWqG0B1jZrgmJ/7lj1EmVIByWt1gxGkWvg==", - "dev": true, - "requires": { - "pify": "^3.0.0" - } - }, - "pify": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz", - "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=", + "path-exists": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", + "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", "dev": true }, "read-pkg": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-3.0.0.tgz", - "integrity": "sha1-nLxoaXj+5l0WwA4rGcI3/Pbjg4k=", + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-5.2.0.tgz", + "integrity": "sha512-Ug69mNOpfvKDAc2Q8DRpMjjzdtrnv9HcSMX+4VsZxD1aZ6ZzrIE7rlzXBtWTyhULSMKg076AW6WR5iZpD0JiOg==", "dev": true, "requires": { - "load-json-file": "^4.0.0", - "normalize-package-data": "^2.3.2", - "path-type": "^3.0.0" + "@types/normalize-package-data": "^2.4.0", + "normalize-package-data": "^2.5.0", + "parse-json": "^5.0.0", + "type-fest": "^0.6.0" + }, + "dependencies": { + "hosted-git-info": { + "version": "2.8.8", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", + "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==", + "dev": true + }, + "normalize-package-data": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", + "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", + "dev": true, + "requires": { + "hosted-git-info": "^2.1.4", + "resolve": "^1.10.0", + "semver": "2 || 3 || 4 || 5", + "validate-npm-package-license": "^3.0.1" + } + }, + "semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "dev": true + }, + "type-fest": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.6.0.tgz", + "integrity": "sha512-q+MB8nYR1KDLrgr4G5yemftpMC7/QLqVndBmEEdqzmNj5dcFOO4Oo8qlwZE3ULT3+Zim1F8Kq4cBnikNhlCMlg==", + "dev": true + } } }, "read-pkg-up": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-3.0.0.tgz", - "integrity": "sha1-PtSWaF26D4/hGNBpHcUfSh/5bwc=", + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-7.0.1.tgz", + "integrity": "sha512-zK0TB7Xd6JpCLmlLmufqykGE+/TlOePD6qKClNW7hHDKFh/J7/7gCWGR7joEQEW1bKq3a3yUZSObOoWLFQ4ohg==", "dev": true, "requires": { - "find-up": "^2.0.0", - "read-pkg": "^3.0.0" + "find-up": "^4.1.0", + "read-pkg": "^5.2.0", + "type-fest": "^0.8.1" + }, + "dependencies": { + "type-fest": { + "version": "0.8.1", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.8.1.tgz", + "integrity": "sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==", + "dev": true + } + } + }, + "readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "dev": true, + "requires": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" } }, "redent": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/redent/-/redent-2.0.0.tgz", - "integrity": "sha1-wbIAe0LVfrE4kHmzyDM2OdXhzKo=", + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/redent/-/redent-3.0.0.tgz", + "integrity": "sha512-6tDA8g98We0zd0GvVeMT9arEOnTw9qM03L9cJXaCjrip1OO764RDBLBfrB4cwzNGDj5OA5ioymC9GkizgWJDUg==", "dev": true, "requires": { - "indent-string": "^3.0.0", - "strip-indent": "^2.0.0" + "indent-string": "^4.0.0", + "strip-indent": "^3.0.0" } }, - "strip-bom": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-3.0.0.tgz", - "integrity": "sha1-IzTBjpx1n3vdVv3vfprj1YjmjtM=", + "resolve": { + "version": "1.19.0", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.19.0.tgz", + "integrity": "sha512-rArEXAgsBG4UgRGcynxWIWKFvh/XZCcS8UJdHhwy91zwAvCZIbcs+vAbflgBnNjYMs/i/i+/Ux6IZhML1yPvxg==", + "dev": true, + "requires": { + "is-core-module": "^2.1.0", + "path-parse": "^1.0.6" + } + }, + "semver": { + "version": "7.3.2", + "resolved": "https://registry.npmjs.org/semver/-/semver-7.3.2.tgz", + "integrity": "sha512-OrOb32TeeambH6UrhtShmF7CRDqhL6/5XpPNp2DuRH6+9QLw/orhp72j87v8Qa1ScDkvrrBNpZcDejAirJmfXQ==", "dev": true }, "strip-indent": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-2.0.0.tgz", - "integrity": "sha1-XvjbKV0B5u1sv3qrlpmNeCJSe2g=", - "dev": true + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-3.0.0.tgz", + "integrity": "sha512-laJTa3Jb+VQpaC6DseHhF7dXVqHTfJPCRDaEbid/drOhgitgYku/letMUqOXFoWV0zIIUbjpdH2t+tYj4bQMRQ==", + "dev": true, + "requires": { + "min-indent": "^1.0.0" + } + }, + "through2": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/through2/-/through2-4.0.2.tgz", + "integrity": "sha512-iOqSav00cVxEEICeD7TjLB1sueEL+81Wpzp2bY17uZjZN0pWZPuo4suZ/61VujxmqSGFfgOcNuTZ85QJwNZQpw==", + "dev": true, + "requires": { + "readable-stream": "3" + } }, "trim-newlines": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-2.0.0.tgz", - "integrity": "sha1-tAPQuRvlDDMd/EuC7s6yLD3hbSA=", + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-3.0.0.tgz", + "integrity": "sha512-C4+gOpvmxaSMKuEf9Qc134F1ZuOHVXKRbtEflf4NTtuuJDEIJ9p5PXsalL8SkeRw+qit1Mo+yuvMPAKwWg/1hA==", + "dev": true + }, + "type-fest": { + "version": "0.18.1", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.18.1.tgz", + "integrity": "sha512-OIAYXk8+ISY+qTOwkHtKqzAuxchoMiD9Udx+FSGQDuiRR+PJKJHc2NJAXlbhkGwTt/4/nKZxELY1w3ReWOL8mw==", + "dev": true + }, + "yargs-parser": { + "version": "20.2.4", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-20.2.4.tgz", + "integrity": "sha512-WOkpgNhPTlE73h4VFAFsOnomJVaovO8VqLDzy5saChRBFQFBoMYirowyW+Q9HB4HFF4Z7VZTiG3iSzJJA29yRA==", "dev": true } } @@ -3324,13 +3811,21 @@ "dev": true }, "create-ecdh": { - "version": "4.0.3", - "resolved": "https://registry.npmjs.org/create-ecdh/-/create-ecdh-4.0.3.tgz", - "integrity": "sha512-GbEHQPMOswGpKXM9kCWVrremUcBmjteUaQ01T9rkKCPDXfUHX0IoP9LpHYo2NPFampa4e+/pFDc3jQdxrxQLaw==", + "version": "4.0.4", + "resolved": "https://registry.npmjs.org/create-ecdh/-/create-ecdh-4.0.4.tgz", + "integrity": "sha512-mf+TCx8wWc9VpuxfP2ht0iSISLZnt0JgWlrOKZiNqyUZWnjIaCIVNQArMHnCZKfEYRg6IM7A+NeJoN8gf/Ws0A==", "dev": true, "requires": { "bn.js": "^4.1.0", - "elliptic": "^6.0.0" + "elliptic": "^6.5.3" + }, + "dependencies": { + "bn.js": { + "version": "4.11.9", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.9.tgz", + "integrity": "sha512-E6QoYqCKZfgatHTdHzs1RRKP7ip4vvm+EyRUeE2RF0NblwVvb0p6jSVeNTOFxPn26QXN2o6SMfNxKp6kU8zQaw==", + "dev": true + } } }, "create-hash": { @@ -3407,9 +3902,9 @@ "dev": true }, "cssstyle": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/cssstyle/-/cssstyle-2.2.0.tgz", - "integrity": "sha512-sEb3XFPx3jNnCAMtqrXPDeSgQr+jojtCeNf8cvMNMh1cG970+lljssvQDzPq6lmmJu2Vhqood/gtEomBiHOGnA==", + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/cssstyle/-/cssstyle-2.3.0.tgz", + "integrity": "sha512-AZL67abkUzIuvcHqk7c09cezpGNcxUxU4Ioi/05xHk4DQeTkWmGYftIE6ctU6AEt+Gn4n1lDStOtj7FKycP71A==", "dev": true, "requires": { "cssom": "~0.3.6" @@ -3538,6 +4033,12 @@ "integrity": "sha1-s2nW+128E+7PUk+RsHD+7cNXzzQ=", "dev": true }, + "deepmerge": { + "version": "4.2.2", + "resolved": "https://registry.npmjs.org/deepmerge/-/deepmerge-4.2.2.tgz", + "integrity": "sha512-FJ3UgI4gIl+PHZm53knsuSFpE+nESMr7M4v9QcgB7S63Kj/6WqMiFQJpBBYz1Pt+66bZpP3Q7Lye0Oo9MPKEdg==", + "dev": true + }, "default-compare": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/default-compare/-/default-compare-1.0.0.tgz", @@ -3691,9 +4192,9 @@ "dev": true }, "diff-sequences": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/diff-sequences/-/diff-sequences-25.1.0.tgz", - "integrity": "sha512-nFIfVk5B/NStCsJ+zaPO4vYuLjlzQ6uFvPxzYyHlejNZ/UGa7G/n7peOXVrVNvRuyfstt+mZQYGpjxg9Z6N8Kw==", + "version": "25.2.6", + "resolved": "https://registry.npmjs.org/diff-sequences/-/diff-sequences-25.2.6.tgz", + "integrity": "sha512-Hq8o7+6GaZeoFjtpgvRBUknSXNeJiCx7V9Fr94ZMljNiCr9n9L8H8aJqgWOQiDDGdyn29fRNcDdRVJ5fdyihfg==", "dev": true }, "diffie-hellman": { @@ -3705,6 +4206,14 @@ "bn.js": "^4.1.0", "miller-rabin": "^4.0.0", "randombytes": "^2.0.0" + }, + "dependencies": { + "bn.js": { + "version": "4.11.9", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.9.tgz", + "integrity": "sha512-E6QoYqCKZfgatHTdHzs1RRKP7ip4vvm+EyRUeE2RF0NblwVvb0p6jSVeNTOFxPn26QXN2o6SMfNxKp6kU8zQaw==", + "dev": true + } } }, "dns-equal": { @@ -3757,12 +4266,12 @@ } }, "dot-prop": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/dot-prop/-/dot-prop-3.0.0.tgz", - "integrity": "sha1-G3CK8JSknJoOfbyteQq6U52sEXc=", + "version": "5.3.0", + "resolved": "https://registry.npmjs.org/dot-prop/-/dot-prop-5.3.0.tgz", + "integrity": "sha512-QM8q3zDe58hqUqjraQOmzZ1LIH9SWQJTlEKCH4kJ2oQvLZk7RbQXvtDM2XEq3fwkV9CCvvH4LA0AV+ogFsBM2Q==", "dev": true, "requires": { - "is-obj": "^1.0.0" + "is-obj": "^2.0.0" } }, "duplexer2": { @@ -3839,9 +4348,9 @@ "dev": true }, "elliptic": { - "version": "6.5.2", - "resolved": "https://registry.npmjs.org/elliptic/-/elliptic-6.5.2.tgz", - "integrity": "sha512-f4x70okzZbIQl/NSRLkI/+tteV/9WqL98zx+SQ69KbXxmVrmjwsNUPn/gYJJ0sHvEak24cZgHIPegRePAtA/xw==", + "version": "6.5.3", + "resolved": "https://registry.npmjs.org/elliptic/-/elliptic-6.5.3.tgz", + "integrity": "sha512-IMqzv5wNQf+E6aHeIqATs0tOLeOTwj1QKbRcS3jBbYkl5oLAserA8yJTT7/VyHUYG91PRmPyeQDObKLPpeS4dw==", "dev": true, "requires": { "bn.js": "^4.4.0", @@ -3851,6 +4360,14 @@ "inherits": "^2.0.1", "minimalistic-assert": "^1.0.0", "minimalistic-crypto-utils": "^1.0.0" + }, + "dependencies": { + "bn.js": { + "version": "4.11.9", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.9.tgz", + "integrity": "sha512-E6QoYqCKZfgatHTdHzs1RRKP7ip4vvm+EyRUeE2RF0NblwVvb0p6jSVeNTOFxPn26QXN2o6SMfNxKp6kU8zQaw==", + "dev": true + } } }, "emoji-regex": { @@ -3881,9 +4398,9 @@ } }, "enhanced-resolve": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.1.1.tgz", - "integrity": "sha512-98p2zE+rL7/g/DzMHMTF4zZlCgeVdJ7yr6xzEpJRYwFYrGi9ANdn5DnJURg6RpBkyk60XYDnWIv51VfIhfNGuA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.3.0.tgz", + "integrity": "sha512-3e87LvavsdxyoCfGusJnrZ5G8SLPOFeHSNpZI/ATL9a5leXo2k0w6MKnbqhdBad9qTobSfB20Ld7UmgoNbAZkQ==", "dev": true, "requires": { "graceful-fs": "^4.1.2", @@ -3922,22 +4439,23 @@ } }, "es-abstract": { - "version": "1.17.4", - "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.17.4.tgz", - "integrity": "sha512-Ae3um/gb8F0mui/jPL+QiqmglkUsaQf7FwBEHYIFkztkneosu9imhqHpBzQ3h1vit8t5iQ74t6PEVvphBZiuiQ==", + "version": "1.18.0-next.1", + "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.18.0-next.1.tgz", + "integrity": "sha512-I4UGspA0wpZXWENrdA0uHbnhte683t3qT/1VFH9aX2dA5PPSf6QW5HHXf5HImaqPmjXaVeVk4RGWnaylmV7uAA==", "dev": true, "requires": { "es-to-primitive": "^1.2.1", "function-bind": "^1.1.1", "has": "^1.0.3", "has-symbols": "^1.0.1", - "is-callable": "^1.1.5", - "is-regex": "^1.0.5", - "object-inspect": "^1.7.0", + "is-callable": "^1.2.2", + "is-negative-zero": "^2.0.0", + "is-regex": "^1.1.1", + "object-inspect": "^1.8.0", "object-keys": "^1.1.1", - "object.assign": "^4.1.0", - "string.prototype.trimleft": "^2.1.1", - "string.prototype.trimright": "^2.1.1" + "object.assign": "^4.1.1", + "string.prototype.trimend": "^1.0.1", + "string.prototype.trimstart": "^1.0.1" }, "dependencies": { "has-symbols": { @@ -3946,13 +4464,16 @@ "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", "dev": true }, - "is-regex": { - "version": "1.0.5", - "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.0.5.tgz", - "integrity": "sha512-vlKW17SNq44owv5AQR3Cq0bQPEb8+kF3UKZ2fiZNOWtztYE5i0CzCZxFDwO58qAOWtxdBRVO/V5Qin1wjCqFYQ==", + "object.assign": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.2.tgz", + "integrity": "sha512-ixT2L5THXsApyiUPYKmW+2EHpXXe5Ii3M+f4e+aJFAHao5amFRW6J0OO6c/LU8Be47utCx2GL89hxGB6XSmKuQ==", "dev": true, "requires": { - "has": "^1.0.3" + "call-bind": "^1.0.0", + "define-properties": "^1.1.3", + "has-symbols": "^1.0.1", + "object-keys": "^1.1.1" } } } @@ -4025,9 +4546,9 @@ "dev": true }, "escodegen": { - "version": "1.14.1", - "resolved": "https://registry.npmjs.org/escodegen/-/escodegen-1.14.1.tgz", - "integrity": "sha512-Bmt7NcRySdIfNPfU2ZoXDrrXsG9ZjvDxcAlMfDUgRBjLOWTuIACXPBFJH7Z+cLb40JeQco5toikyc9t9P8E9SQ==", + "version": "1.14.3", + "resolved": "https://registry.npmjs.org/escodegen/-/escodegen-1.14.3.tgz", + "integrity": "sha512-qFcX0XJkdg+PB3xjZZG/wKSuT1PnQWx57+TVSjIMmILd2yC/6ByYElPwJnslDsuWuSAp4AwJGumarAAmJch5Kw==", "dev": true, "requires": { "esprima": "^4.0.1", @@ -4195,15 +4716,15 @@ "dev": true }, "eventemitter3": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/eventemitter3/-/eventemitter3-4.0.0.tgz", - "integrity": "sha512-qerSRB0p+UDEssxTtm6EDKcE7W4OaoisfIMl4CngyEhjpYglocpNg6UEqCvemdGhosAsg4sO2dXJOdyBifPGCg==", + "version": "4.0.7", + "resolved": "https://registry.npmjs.org/eventemitter3/-/eventemitter3-4.0.7.tgz", + "integrity": "sha512-8guHBZCwKnFhYdHr2ysuRWErTwhoN2X8XELRlrRwpmfeY2jjuUN4taQMsULKUVo1K4DvZl+0pgfyoysHxvmvEw==", "dev": true }, "events": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/events/-/events-3.1.0.tgz", - "integrity": "sha512-Rv+u8MLHNOdMjTAFeT3nCjHn2aGlx435FP/sDHNaRhDEMwyI/aB22Kj2qIN8R0cw3z28psEQLYwxVKLsKrMgWg==", + "version": "3.2.0", + "resolved": "https://registry.npmjs.org/events/-/events-3.2.0.tgz", + "integrity": "sha512-/46HWwbfCX2xTawVfkKLGxMifJYQBWMwY1mjywRtb4c9x8l5NP3KoJtnIOiL1hfdRkIuYhETxQlo62IF8tcnlg==", "dev": true }, "eventsource": { @@ -4312,26 +4833,25 @@ } }, "expect": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/expect/-/expect-25.1.0.tgz", - "integrity": "sha512-wqHzuoapQkhc3OKPlrpetsfueuEiMf3iWh0R8+duCu9PIjXoP7HgD5aeypwTnXUAjC8aMsiVDaWwlbJ1RlQ38g==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/expect/-/expect-25.5.0.tgz", + "integrity": "sha512-w7KAXo0+6qqZZhovCaBVPSIqQp7/UTcx4M9uKt2m6pd2VB1voyC8JizLRqeEqud3AAVP02g+hbErDu5gu64tlA==", "dev": true, "requires": { - "@jest/types": "^25.1.0", + "@jest/types": "^25.5.0", "ansi-styles": "^4.0.0", - "jest-get-type": "^25.1.0", - "jest-matcher-utils": "^25.1.0", - "jest-message-util": "^25.1.0", - "jest-regex-util": "^25.1.0" + "jest-get-type": "^25.2.6", + "jest-matcher-utils": "^25.5.0", + "jest-message-util": "^25.5.0", + "jest-regex-util": "^25.2.6" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -4577,9 +5097,9 @@ } }, "figgy-pudding": { - "version": "3.5.1", - "resolved": "https://registry.npmjs.org/figgy-pudding/-/figgy-pudding-3.5.1.tgz", - "integrity": "sha512-vNKxJHTEKNThjfrdJwHc7brvM6eVevuO5nTj6ez8ZQ1qbXTvGthucRF7S4vf2cr71QVnT70V34v0S1DyQsti0w==", + "version": "3.5.2", + "resolved": "https://registry.npmjs.org/figgy-pudding/-/figgy-pudding-3.5.2.tgz", + "integrity": "sha512-0btnI/H8f2pavGMN8w40mlSKOfTK2SVJmBfBeVIj3kNw0swwgzyRq0d5TJVOwodFmtvpPeWPN/MCcfuWF0Ezbw==", "dev": true }, "figures": { @@ -4744,24 +5264,10 @@ } }, "follow-redirects": { - "version": "1.10.0", - "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.10.0.tgz", - "integrity": "sha512-4eyLK6s6lH32nOvLLwlIOnr9zrL8Sm+OvW4pVTJNoXeGzYIkHVf+pADQi+OJ0E67hiuSLezPVPyBcIZO50TmmQ==", - "dev": true, - "requires": { - "debug": "^3.0.0" - }, - "dependencies": { - "debug": { - "version": "3.2.6", - "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.6.tgz", - "integrity": "sha512-mel+jf7nrtEl5Pn1Qx46zARXKDpBbvzezse7p7LqINmdoIk8PYP5SySaxEmYv6TZ0JyEKA1hsCId6DIhgITtWQ==", - "dev": true, - "requires": { - "ms": "^2.1.1" - } - } - } + "version": "1.13.0", + "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.13.0.tgz", + "integrity": "sha512-aq6gF1BEKje4a9i9+5jimNFIpq4Q1WiwBToeRK5NvZBd/TRsmW8BsJfOEGkr76TbOyPVD3OVDN910EcUNtRYEA==", + "dev": true }, "for-in": { "version": "1.0.2", @@ -4874,7 +5380,8 @@ "ansi-regex": { "version": "2.1.1", "bundled": true, - "dev": true + "dev": true, + "optional": true }, "aproba": { "version": "1.2.0", @@ -4895,12 +5402,14 @@ "balanced-match": { "version": "1.0.0", "bundled": true, - "dev": true + "dev": true, + "optional": true }, "brace-expansion": { "version": "1.1.11", "bundled": true, "dev": true, + "optional": true, "requires": { "balanced-match": "^1.0.0", "concat-map": "0.0.1" @@ -4915,17 +5424,20 @@ "code-point-at": { "version": "1.1.0", "bundled": true, - "dev": true + "dev": true, + "optional": true }, "concat-map": { "version": "0.0.1", "bundled": true, - "dev": true + "dev": true, + "optional": true }, "console-control-strings": { "version": "1.1.0", "bundled": true, - "dev": true + "dev": true, + "optional": true }, "core-util-is": { "version": "1.0.2", @@ -5042,7 +5554,8 @@ "inherits": { "version": "2.0.3", "bundled": true, - "dev": true + "dev": true, + "optional": true }, "ini": { "version": "1.3.5", @@ -5054,6 +5567,7 @@ "version": "1.0.0", "bundled": true, "dev": true, + "optional": true, "requires": { "number-is-nan": "^1.0.0" } @@ -5068,6 +5582,7 @@ "version": "3.0.4", "bundled": true, "dev": true, + "optional": true, "requires": { "brace-expansion": "^1.1.7" } @@ -5075,12 +5590,14 @@ "minimist": { "version": "0.0.8", "bundled": true, - "dev": true + "dev": true, + "optional": true }, "minipass": { "version": "2.3.5", "bundled": true, "dev": true, + "optional": true, "requires": { "safe-buffer": "^5.1.2", "yallist": "^3.0.0" @@ -5099,6 +5616,7 @@ "version": "0.5.1", "bundled": true, "dev": true, + "optional": true, "requires": { "minimist": "0.0.8" } @@ -5179,7 +5697,8 @@ "number-is-nan": { "version": "1.0.1", "bundled": true, - "dev": true + "dev": true, + "optional": true }, "object-assign": { "version": "4.1.1", @@ -5191,6 +5710,7 @@ "version": "1.4.0", "bundled": true, "dev": true, + "optional": true, "requires": { "wrappy": "1" } @@ -5276,7 +5796,8 @@ "safe-buffer": { "version": "5.1.2", "bundled": true, - "dev": true + "dev": true, + "optional": true }, "safer-buffer": { "version": "2.1.2", @@ -5312,6 +5833,7 @@ "version": "1.0.2", "bundled": true, "dev": true, + "optional": true, "requires": { "code-point-at": "^1.0.0", "is-fullwidth-code-point": "^1.0.0", @@ -5331,6 +5853,7 @@ "version": "3.0.1", "bundled": true, "dev": true, + "optional": true, "requires": { "ansi-regex": "^2.0.0" } @@ -5374,12 +5897,14 @@ "wrappy": { "version": "1.0.2", "bundled": true, - "dev": true + "dev": true, + "optional": true }, "yallist": { "version": "3.0.3", "bundled": true, - "dev": true + "dev": true, + "optional": true } } }, @@ -5396,9 +5921,9 @@ "dev": true }, "gensync": { - "version": "1.0.0-beta.1", - "resolved": "https://registry.npmjs.org/gensync/-/gensync-1.0.0-beta.1.tgz", - "integrity": "sha512-r8EC6NO1sngH/zdD9fiRDLdcgnbayXah+mLgManTaIZJqEC1MZstmnox8KpnI2/fxQwrp5OpCOYWLp4rBl4Jcg==", + "version": "1.0.0-beta.2", + "resolved": "https://registry.npmjs.org/gensync/-/gensync-1.0.0-beta.2.tgz", + "integrity": "sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg==", "dev": true }, "get-caller-file": { @@ -5407,6 +5932,31 @@ "integrity": "sha512-3t6rVToeoZfYSGd8YoLFR2DJkiQrIiUrGcjvFX2mDw3bn6k2OtwHN0TNCLbBO+w8qTvimhDkv+LSscbJY1vE6w==", "dev": true }, + "get-intrinsic": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.0.1.tgz", + "integrity": "sha512-ZnWP+AmS1VUaLgTRy47+zKtjTxz+0xMpx3I52i+aalBK1QP19ggLF3Db89KJX7kjfOfP2eoa01qc++GwPgufPg==", + "dev": true, + "requires": { + "function-bind": "^1.1.1", + "has": "^1.0.3", + "has-symbols": "^1.0.1" + }, + "dependencies": { + "has-symbols": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz", + "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", + "dev": true + } + } + }, + "get-package-type": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/get-package-type/-/get-package-type-0.1.0.tgz", + "integrity": "sha512-pjzuKtY64GYfWizNAJ0fr9VqttZkNiK2iS430LtIHzjBEr6bX8Am2zm4sW4Ro5wjWW5cAlRL1qAMTcXbjNAO2Q==", + "dev": true + }, "get-pkg-repo": { "version": "1.4.0", "resolved": "https://registry.npmjs.org/get-pkg-repo/-/get-pkg-repo-1.4.0.tgz", @@ -5463,9 +6013,9 @@ } }, "git-raw-commits": { - "version": "1.3.6", - "resolved": "https://registry.npmjs.org/git-raw-commits/-/git-raw-commits-1.3.6.tgz", - "integrity": "sha512-svsK26tQ8vEKnMshTDatSIQSMDdz8CxIIqKsvPqbtV23Etmw6VNaFAitu8zwZ0VrOne7FztwPyRLxK7/DIUTQg==", + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/git-raw-commits/-/git-raw-commits-2.0.0.tgz", + "integrity": "sha512-w4jFEJFgKXMQJ0H0ikBk2S+4KP2VEjhCvLCNqbNRQC8BgGWgLKNCO7a9K9LI+TVT7Gfoloje502sEnctibffgg==", "dev": true, "requires": { "dargs": "^4.0.1", @@ -5519,6 +6069,16 @@ "strip-bom": "^3.0.0" } }, + "locate-path": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-2.0.0.tgz", + "integrity": "sha1-K1aLJl7slExtnA3pw9u7ygNUzY4=", + "dev": true, + "requires": { + "p-locate": "^2.0.0", + "path-exists": "^3.0.0" + } + }, "map-obj": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-2.0.0.tgz", @@ -5542,10 +6102,38 @@ "trim-newlines": "^2.0.0" } }, - "minimist": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", - "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", + "minimist-options": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/minimist-options/-/minimist-options-3.0.2.tgz", + "integrity": "sha512-FyBrT/d0d4+uiZRbqznPXqw3IpZZG3gl3wKWiX784FycUKVwBt0uLBFkQrtE4tZOrgo78nZp2jnKz3L65T5LdQ==", + "dev": true, + "requires": { + "arrify": "^1.0.1", + "is-plain-obj": "^1.1.0" + } + }, + "p-limit": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-1.3.0.tgz", + "integrity": "sha512-vvcXsLAJ9Dr5rQOPk7toZQZJApBl2K4J6dANSsEuh6QI41JYcsS/qhTGa9ErIUUgK3WNQoJYvylxvjqmiqEA9Q==", + "dev": true, + "requires": { + "p-try": "^1.0.0" + } + }, + "p-locate": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-2.0.0.tgz", + "integrity": "sha1-IKAQOyIqcMj9OcwuWAaA893l7EM=", + "dev": true, + "requires": { + "p-limit": "^1.1.0" + } + }, + "p-try": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/p-try/-/p-try-1.0.0.tgz", + "integrity": "sha1-y8ec26+P1CKOE/Yh8rGiN8GyB7M=", "dev": true }, "parse-json": { @@ -5558,6 +6146,12 @@ "json-parse-better-errors": "^1.0.1" } }, + "path-exists": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", + "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", + "dev": true + }, "path-type": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/path-type/-/path-type-3.0.0.tgz", @@ -5573,6 +6167,12 @@ "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=", "dev": true }, + "quick-lru": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/quick-lru/-/quick-lru-1.1.0.tgz", + "integrity": "sha1-Q2CxfGETatOAeDl/8RQW4Ybc+7g=", + "dev": true + }, "read-pkg": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-3.0.0.tgz", @@ -5635,166 +6235,228 @@ } }, "git-semver-tags": { - "version": "1.3.6", - "resolved": "https://registry.npmjs.org/git-semver-tags/-/git-semver-tags-1.3.6.tgz", - "integrity": "sha512-2jHlJnln4D/ECk9FxGEBh3k44wgYdWjWDtMmJPaecjoRmxKo3Y1Lh8GMYuOPu04CHw86NTAODchYjC5pnpMQig==", + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/git-semver-tags/-/git-semver-tags-4.1.1.tgz", + "integrity": "sha512-OWyMt5zBe7xFs8vglMmhM9lRQzCWL3WjHtxNNfJTMngGym7pC1kh8sP6jevfydJ6LP3ZvGxfb6ABYgPUM0mtsA==", "dev": true, "requires": { - "meow": "^4.0.0", - "semver": "^5.5.0" + "meow": "^8.0.0", + "semver": "^6.0.0" }, "dependencies": { "camelcase": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz", - "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=", + "version": "5.3.1", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", + "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", "dev": true }, "camelcase-keys": { - "version": "4.2.0", - "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-4.2.0.tgz", - "integrity": "sha1-oqpfsa9oh1glnDLBQUJteJI7m3c=", + "version": "6.2.2", + "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-6.2.2.tgz", + "integrity": "sha512-YrwaA0vEKazPBkn0ipTiMpSajYDSe+KjQfrjhcBMxJt/znbvlHd8Pw/Vamaz5EB4Wfhs3SUR3Z9mwRu/P3s3Yg==", "dev": true, "requires": { - "camelcase": "^4.1.0", - "map-obj": "^2.0.0", - "quick-lru": "^1.0.0" + "camelcase": "^5.3.1", + "map-obj": "^4.0.0", + "quick-lru": "^4.0.1" } }, "find-up": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-2.1.0.tgz", - "integrity": "sha1-RdG35QbHF93UgndaK3eSCjwMV6c=", + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", + "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", "dev": true, "requires": { - "locate-path": "^2.0.0" + "locate-path": "^5.0.0", + "path-exists": "^4.0.0" + } + }, + "hosted-git-info": { + "version": "3.0.7", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-3.0.7.tgz", + "integrity": "sha512-fWqc0IcuXs+BmE9orLDyVykAG9GJtGLGuZAAqgcckPgv5xad4AcXGIv8galtQvlwutxSlaMcdw7BUtq2EIvqCQ==", + "dev": true, + "requires": { + "lru-cache": "^6.0.0" } }, "indent-string": { - "version": "3.2.0", - "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-3.2.0.tgz", - "integrity": "sha1-Sl/W0nzDMvN+VBmlBNu4NxBckok=", + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-4.0.0.tgz", + "integrity": "sha512-EdDDZu4A2OyIK7Lr/2zG+w5jmbuk1DVBnEwREQvBzspBJkCEbRa8GxU1lghYcaGJCnRWibjDXlq779X1/y5xwg==", "dev": true }, - "load-json-file": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-4.0.0.tgz", - "integrity": "sha1-L19Fq5HjMhYjT9U62rZo607AmTs=", - "dev": true, - "requires": { - "graceful-fs": "^4.1.2", - "parse-json": "^4.0.0", - "pify": "^3.0.0", - "strip-bom": "^3.0.0" - } - }, "map-obj": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-2.0.0.tgz", - "integrity": "sha1-plzSkIepJZi4eRJXpSPgISIqwfk=", + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-4.1.0.tgz", + "integrity": "sha512-glc9y00wgtwcDmp7GaE/0b0OnxpNJsVf3ael/An6Fe2Q51LLwN1er6sdomLRzz5h0+yMpiYLhWYF5R7HeqVd4g==", "dev": true }, "meow": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/meow/-/meow-4.0.1.tgz", - "integrity": "sha512-xcSBHD5Z86zaOc+781KrupuHAzeGXSLtiAOmBsiLDiPSaYSB6hdew2ng9EBAnZ62jagG9MHAOdxpDi/lWBFJ/A==", + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/meow/-/meow-8.0.0.tgz", + "integrity": "sha512-nbsTRz2fwniJBFgUkcdISq8y/q9n9VbiHYbfwklFh5V4V2uAcxtKQkDc0yCLPM/kP0d+inZBewn3zJqewHE7kg==", "dev": true, "requires": { - "camelcase-keys": "^4.0.0", - "decamelize-keys": "^1.0.0", - "loud-rejection": "^1.0.0", - "minimist": "^1.1.3", - "minimist-options": "^3.0.1", - "normalize-package-data": "^2.3.4", - "read-pkg-up": "^3.0.0", - "redent": "^2.0.0", - "trim-newlines": "^2.0.0" + "@types/minimist": "^1.2.0", + "camelcase-keys": "^6.2.2", + "decamelize-keys": "^1.1.0", + "hard-rejection": "^2.1.0", + "minimist-options": "4.1.0", + "normalize-package-data": "^3.0.0", + "read-pkg-up": "^7.0.1", + "redent": "^3.0.0", + "trim-newlines": "^3.0.0", + "type-fest": "^0.18.0", + "yargs-parser": "^20.2.3" } }, - "minimist": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", - "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", - "dev": true + "normalize-package-data": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-3.0.0.tgz", + "integrity": "sha512-6lUjEI0d3v6kFrtgA/lOx4zHCWULXsFNIjHolnZCKCTLA6m/G625cdn3O7eNmT0iD3jfo6HZ9cdImGZwf21prw==", + "dev": true, + "requires": { + "hosted-git-info": "^3.0.6", + "resolve": "^1.17.0", + "semver": "^7.3.2", + "validate-npm-package-license": "^3.0.1" + }, + "dependencies": { + "semver": { + "version": "7.3.2", + "resolved": "https://registry.npmjs.org/semver/-/semver-7.3.2.tgz", + "integrity": "sha512-OrOb32TeeambH6UrhtShmF7CRDqhL6/5XpPNp2DuRH6+9QLw/orhp72j87v8Qa1ScDkvrrBNpZcDejAirJmfXQ==", + "dev": true + } + } }, "parse-json": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz", - "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=", + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-5.1.0.tgz", + "integrity": "sha512-+mi/lmVVNKFNVyLXV31ERiy2CY5E1/F6QtJFEzoChPRwwngMNXRDQ9GJ5WdE2Z2P4AujsOi0/+2qHID68KwfIQ==", "dev": true, "requires": { + "@babel/code-frame": "^7.0.0", "error-ex": "^1.3.1", - "json-parse-better-errors": "^1.0.1" + "json-parse-even-better-errors": "^2.3.0", + "lines-and-columns": "^1.1.6" } }, - "path-type": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/path-type/-/path-type-3.0.0.tgz", - "integrity": "sha512-T2ZUsdZFHgA3u4e5PfPbjd7HDDpxPnQb5jN0SrDsjNSuVXHJqtwTnWqG0B1jZrgmJ/7lj1EmVIByWt1gxGkWvg==", - "dev": true, - "requires": { - "pify": "^3.0.0" - } - }, - "pify": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz", - "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=", + "path-exists": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", + "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", "dev": true }, "read-pkg": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-3.0.0.tgz", - "integrity": "sha1-nLxoaXj+5l0WwA4rGcI3/Pbjg4k=", + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-5.2.0.tgz", + "integrity": "sha512-Ug69mNOpfvKDAc2Q8DRpMjjzdtrnv9HcSMX+4VsZxD1aZ6ZzrIE7rlzXBtWTyhULSMKg076AW6WR5iZpD0JiOg==", "dev": true, "requires": { - "load-json-file": "^4.0.0", - "normalize-package-data": "^2.3.2", - "path-type": "^3.0.0" + "@types/normalize-package-data": "^2.4.0", + "normalize-package-data": "^2.5.0", + "parse-json": "^5.0.0", + "type-fest": "^0.6.0" + }, + "dependencies": { + "hosted-git-info": { + "version": "2.8.8", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", + "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==", + "dev": true + }, + "normalize-package-data": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", + "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", + "dev": true, + "requires": { + "hosted-git-info": "^2.1.4", + "resolve": "^1.10.0", + "semver": "2 || 3 || 4 || 5", + "validate-npm-package-license": "^3.0.1" + } + }, + "semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "dev": true + }, + "type-fest": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.6.0.tgz", + "integrity": "sha512-q+MB8nYR1KDLrgr4G5yemftpMC7/QLqVndBmEEdqzmNj5dcFOO4Oo8qlwZE3ULT3+Zim1F8Kq4cBnikNhlCMlg==", + "dev": true + } } }, "read-pkg-up": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-3.0.0.tgz", - "integrity": "sha1-PtSWaF26D4/hGNBpHcUfSh/5bwc=", + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-7.0.1.tgz", + "integrity": "sha512-zK0TB7Xd6JpCLmlLmufqykGE+/TlOePD6qKClNW7hHDKFh/J7/7gCWGR7joEQEW1bKq3a3yUZSObOoWLFQ4ohg==", "dev": true, "requires": { - "find-up": "^2.0.0", - "read-pkg": "^3.0.0" + "find-up": "^4.1.0", + "read-pkg": "^5.2.0", + "type-fest": "^0.8.1" + }, + "dependencies": { + "type-fest": { + "version": "0.8.1", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.8.1.tgz", + "integrity": "sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==", + "dev": true + } } }, "redent": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/redent/-/redent-2.0.0.tgz", - "integrity": "sha1-wbIAe0LVfrE4kHmzyDM2OdXhzKo=", + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/redent/-/redent-3.0.0.tgz", + "integrity": "sha512-6tDA8g98We0zd0GvVeMT9arEOnTw9qM03L9cJXaCjrip1OO764RDBLBfrB4cwzNGDj5OA5ioymC9GkizgWJDUg==", "dev": true, "requires": { - "indent-string": "^3.0.0", - "strip-indent": "^2.0.0" + "indent-string": "^4.0.0", + "strip-indent": "^3.0.0" } }, - "semver": { - "version": "5.7.1", - "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", - "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", - "dev": true - }, - "strip-bom": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-3.0.0.tgz", - "integrity": "sha1-IzTBjpx1n3vdVv3vfprj1YjmjtM=", - "dev": true + "resolve": { + "version": "1.19.0", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.19.0.tgz", + "integrity": "sha512-rArEXAgsBG4UgRGcynxWIWKFvh/XZCcS8UJdHhwy91zwAvCZIbcs+vAbflgBnNjYMs/i/i+/Ux6IZhML1yPvxg==", + "dev": true, + "requires": { + "is-core-module": "^2.1.0", + "path-parse": "^1.0.6" + } }, "strip-indent": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-2.0.0.tgz", - "integrity": "sha1-XvjbKV0B5u1sv3qrlpmNeCJSe2g=", - "dev": true + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-3.0.0.tgz", + "integrity": "sha512-laJTa3Jb+VQpaC6DseHhF7dXVqHTfJPCRDaEbid/drOhgitgYku/letMUqOXFoWV0zIIUbjpdH2t+tYj4bQMRQ==", + "dev": true, + "requires": { + "min-indent": "^1.0.0" + } }, "trim-newlines": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-2.0.0.tgz", - "integrity": "sha1-tAPQuRvlDDMd/EuC7s6yLD3hbSA=", + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-3.0.0.tgz", + "integrity": "sha512-C4+gOpvmxaSMKuEf9Qc134F1ZuOHVXKRbtEflf4NTtuuJDEIJ9p5PXsalL8SkeRw+qit1Mo+yuvMPAKwWg/1hA==", + "dev": true + }, + "type-fest": { + "version": "0.18.1", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.18.1.tgz", + "integrity": "sha512-OIAYXk8+ISY+qTOwkHtKqzAuxchoMiD9Udx+FSGQDuiRR+PJKJHc2NJAXlbhkGwTt/4/nKZxELY1w3ReWOL8mw==", + "dev": true + }, + "yargs-parser": { + "version": "20.2.4", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-20.2.4.tgz", + "integrity": "sha512-WOkpgNhPTlE73h4VFAFsOnomJVaovO8VqLDzy5saChRBFQFBoMYirowyW+Q9HB4HFF4Z7VZTiG3iSzJJA29yRA==", "dev": true } } @@ -6011,20 +6673,32 @@ } }, "gulp-conventional-changelog": { - "version": "1.1.24", - "resolved": "https://registry.npmjs.org/gulp-conventional-changelog/-/gulp-conventional-changelog-1.1.24.tgz", - "integrity": "sha512-8nw2Vh7HSvNkmYLRrpt77zGjSjz+GoG9uMWCIJWHEoCR4iAHJ1w6PaPJ39C8xdkAfvPdowyKrAhUi3WepELiTA==", + "version": "2.0.35", + "resolved": "https://registry.npmjs.org/gulp-conventional-changelog/-/gulp-conventional-changelog-2.0.35.tgz", + "integrity": "sha512-9khc2fGUc6qWUoQYnqck6/d28lIgP+49kOyYtOIJtp6pthqikSL1UQ8n+Erg9X/z83+z9OX1HWWuVIXbpxvdkw==", "dev": true, "requires": { "add-stream": "^1.0.0", - "concat-stream": "^1.6.0", - "conventional-changelog": "^1.1.24", + "concat-stream": "^2.0.0", + "conventional-changelog": "^3.1.24", "fancy-log": "^1.3.2", "object-assign": "^4.0.1", "plugin-error": "^1.0.1", - "through2": "^2.0.0" + "through2": "^4.0.0" }, "dependencies": { + "concat-stream": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/concat-stream/-/concat-stream-2.0.0.tgz", + "integrity": "sha512-MWufYdFw53ccGjCA+Ol7XJYpAlW6/prSMzuPOTRnJGcGzuhLn4Scrz7qf6o8bROZ514ltazcIFJZevcfbo0x7A==", + "dev": true, + "requires": { + "buffer-from": "^1.0.0", + "inherits": "^2.0.3", + "readable-stream": "^3.0.2", + "typedarray": "^0.0.6" + } + }, "plugin-error": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/plugin-error/-/plugin-error-1.0.1.tgz", @@ -6036,6 +6710,26 @@ "arr-union": "^3.1.0", "extend-shallow": "^3.0.2" } + }, + "readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "dev": true, + "requires": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + } + }, + "through2": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/through2/-/through2-4.0.2.tgz", + "integrity": "sha512-iOqSav00cVxEEICeD7TjLB1sueEL+81Wpzp2bY17uZjZN0pWZPuo4suZ/61VujxmqSGFfgOcNuTZ85QJwNZQpw==", + "dev": true, + "requires": { + "readable-stream": "3" + } } } }, @@ -6244,21 +6938,22 @@ } }, "handle-thing": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/handle-thing/-/handle-thing-2.0.0.tgz", - "integrity": "sha512-d4sze1JNC454Wdo2fkuyzCr6aHcbL6PGGuFAz0Li/NcOm1tCHGnWDRmJP85dh9IhQErTc2svWFEX5xHIOo//kQ==", + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/handle-thing/-/handle-thing-2.0.1.tgz", + "integrity": "sha512-9Qn4yBxelxoh2Ow62nP+Ka/kMnOXRi8BXnRaUwezLNhqelnN49xKz4F/dPP8OYLxLxq6JDtZb2i9XznUQbNPTg==", "dev": true }, "handlebars": { - "version": "4.7.3", - "resolved": "https://registry.npmjs.org/handlebars/-/handlebars-4.7.3.tgz", - "integrity": "sha512-SRGwSYuNfx8DwHD/6InAPzD6RgeruWLT+B8e8a7gGs8FWgHzlExpTFMEq2IA6QpAfOClpKHy6+8IqTjeBCu6Kg==", + "version": "4.7.6", + "resolved": "https://registry.npmjs.org/handlebars/-/handlebars-4.7.6.tgz", + "integrity": "sha512-1f2BACcBfiwAfStCKZNrUCgqNZkGsAT7UM3kkYtXuLo0KnaVfjKOyf7PRzB6++aK9STyT1Pd2ZCPe3EGOXleXA==", "dev": true, "requires": { + "minimist": "^1.2.5", "neo-async": "^2.6.0", - "optimist": "^0.6.1", "source-map": "^0.6.1", - "uglify-js": "^3.1.4" + "uglify-js": "^3.1.4", + "wordwrap": "^1.0.0" }, "dependencies": { "source-map": { @@ -6276,15 +6971,41 @@ "dev": true }, "har-validator": { - "version": "5.1.3", - "resolved": "https://registry.npmjs.org/har-validator/-/har-validator-5.1.3.tgz", - "integrity": "sha512-sNvOCzEQNr/qrvJgc3UG/kD4QtlHycrzwS+6mfTrrSq97BvaYcPZZI1ZSqGSPR73Cxn4LKTD4PttRwfU7jWq5g==", + "version": "5.1.5", + "resolved": "https://registry.npmjs.org/har-validator/-/har-validator-5.1.5.tgz", + "integrity": "sha512-nmT2T0lljbxdQZfspsno9hgrG3Uir6Ks5afism62poxqBM6sDnMEuPmzTq8XN0OEwqKLLdh1jQI3qyE66Nzb3w==", "dev": true, "requires": { - "ajv": "^6.5.5", + "ajv": "^6.12.3", "har-schema": "^2.0.0" + }, + "dependencies": { + "ajv": { + "version": "6.12.6", + "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.6.tgz", + "integrity": "sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==", + "dev": true, + "requires": { + "fast-deep-equal": "^3.1.1", + "fast-json-stable-stringify": "^2.0.0", + "json-schema-traverse": "^0.4.1", + "uri-js": "^4.2.2" + } + }, + "fast-deep-equal": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz", + "integrity": "sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==", + "dev": true + } } }, + "hard-rejection": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/hard-rejection/-/hard-rejection-2.1.0.tgz", + "integrity": "sha512-VIZB+ibDhx7ObhAe7OVtoEbuP4h/MuOTHJ+J8h/eBXotJYl0fBgR72xDFCKgIh22OJZIOVNxBMWuhAr10r8HdA==", + "dev": true + }, "has": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/has/-/has-1.0.3.tgz", @@ -6365,13 +7086,33 @@ } }, "hash-base": { - "version": "3.0.4", - "resolved": "https://registry.npmjs.org/hash-base/-/hash-base-3.0.4.tgz", - "integrity": "sha1-X8hoaEfs1zSZQDMZprCj8/auSRg=", + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/hash-base/-/hash-base-3.1.0.tgz", + "integrity": "sha512-1nmYp/rhMDiE7AYkDw+lLwlAzz0AntGIe51F3RfFfEqyQ3feY2eI/NcwC6umIQVOASPMsWJLJScWKSSvzL9IVA==", "dev": true, "requires": { - "inherits": "^2.0.1", - "safe-buffer": "^5.0.1" + "inherits": "^2.0.4", + "readable-stream": "^3.6.0", + "safe-buffer": "^5.2.0" + }, + "dependencies": { + "readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "dev": true, + "requires": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + } + }, + "safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==", + "dev": true + } } }, "hash.js": { @@ -6432,15 +7173,15 @@ } }, "html-entities": { - "version": "1.2.1", - "resolved": "https://registry.npmjs.org/html-entities/-/html-entities-1.2.1.tgz", - "integrity": "sha1-DfKTUfByEWNRXfueVUPl9u7VFi8=", + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/html-entities/-/html-entities-1.3.1.tgz", + "integrity": "sha512-rhE/4Z3hIhzHAUKbW8jVcCyuT5oJCXXqhN/6mXXVCpzTmvJnoH2HL/bt3EZ6p55jbFJBeAe1ZNpL5BugLujxNA==", "dev": true }, "html-escaper": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/html-escaper/-/html-escaper-2.0.0.tgz", - "integrity": "sha512-a4u9BeERWGu/S8JiWEAQcdrg9v4QArtP9keViQjGMdff20fBdd8waotXaNmODqBe6uZ3Nafi7K/ho4gCQHV3Ig==", + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/html-escaper/-/html-escaper-2.0.2.tgz", + "integrity": "sha512-H2iMtd0I4Mt5eYiapRdIDjp+XzelXQ0tFE4JS7YFwFevXXMmOp9myNrUvCg0D6ws8iqkRPBfKHgbwig1SmlLfg==", "dev": true }, "http-deceiver": { @@ -6470,16 +7211,10 @@ } } }, - "http-parser-js": { - "version": "0.4.10", - "resolved": "https://registry.npmjs.org/http-parser-js/-/http-parser-js-0.4.10.tgz", - "integrity": "sha1-ksnBN0w1CF912zWexWzCV8u5P6Q=", - "dev": true - }, "http-proxy": { - "version": "1.18.0", - "resolved": "https://registry.npmjs.org/http-proxy/-/http-proxy-1.18.0.tgz", - "integrity": "sha512-84I2iJM/n1d4Hdgc6y2+qY5mDaz2PUVjlg9znE9byl+q0uC3DeByqBGReQu5tpLK0TAqTIXScRUV+dg7+bUPpQ==", + "version": "1.18.1", + "resolved": "https://registry.npmjs.org/http-proxy/-/http-proxy-1.18.1.tgz", + "integrity": "sha512-7mz/721AbnJwIVbnaSv1Cz3Am0ZLT/UBwkC92VlxhXv/k/BBQfM2fXElQNC27BVGr0uwUpplYPQM9LnaBMR5NQ==", "dev": true, "requires": { "eventemitter3": "^4.0.0", @@ -6532,9 +7267,9 @@ } }, "ieee754": { - "version": "1.1.13", - "resolved": "https://registry.npmjs.org/ieee754/-/ieee754-1.1.13.tgz", - "integrity": "sha512-4vf7I2LYV/HaWerSo3XmlMkp5eZ83i+/CDluXi/IGTs/O1sejBNhTtnxzmRZfvOUqj7lZjqHkeTvpgSFDlWZTg==", + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/ieee754/-/ieee754-1.2.1.tgz", + "integrity": "sha512-dcyqhDvX1C46lXZcVqCpK+FtMRQVdIMN6/Df5js2zouUsqG7I6sFxitIC+7KYK29KdXOLHdu9zL4sFnoVQnqaA==", "dev": true }, "iferr": { @@ -6819,9 +7554,9 @@ "dev": true }, "is-callable": { - "version": "1.1.5", - "resolved": "https://registry.npmjs.org/is-callable/-/is-callable-1.1.5.tgz", - "integrity": "sha512-ESKv5sMCJB2jnHTWZ3O5itG+O128Hsus4K4Qh1h2/cgn2vbgnLSVqfV46AeJA9D5EeeLa9w81KUXMtn34zhX+Q==", + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/is-callable/-/is-callable-1.2.2.tgz", + "integrity": "sha512-dnMqspv5nU3LoewK2N/y7KLtxtakvTuaCsU9FU50/QDmdbHNy/4/JuRtMHqRU22o3q+W89YQndQEeCVwK+3qrA==", "dev": true }, "is-ci": { @@ -6833,6 +7568,15 @@ "ci-info": "^2.0.0" } }, + "is-core-module": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.1.0.tgz", + "integrity": "sha512-YcV7BgVMRFRua2FqQzKtTDMz8iCuLEyGKjr70q8Zm1yy2qKcurbFEd79PAdHV77oL3NrAaOVQIbMmiHQCHB7ZA==", + "dev": true, + "requires": { + "has": "^1.0.3" + } + }, "is-data-descriptor": { "version": "0.1.4", "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz", @@ -6854,9 +7598,9 @@ } }, "is-date-object": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/is-date-object/-/is-date-object-1.0.1.tgz", - "integrity": "sha1-mqIOtq7rv/d/vTPnTKAbM1gdOhY=", + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-date-object/-/is-date-object-1.0.2.tgz", + "integrity": "sha512-USlDT524woQ08aoZFzh3/Z6ch9Y/EWXEHQ/AaRN0SkKq4t2Jw2R2339tSXmwuVoY7LLlBCbOIlx2myP/L5zk0g==", "dev": true }, "is-descriptor": { @@ -6878,6 +7622,13 @@ } } }, + "is-docker": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/is-docker/-/is-docker-2.1.1.tgz", + "integrity": "sha512-ZOoqiXfEwtGknTiuDEy8pN2CfE3TxMHprvNer1mXiqwkOT77Rw3YVrUQ52EqAOU3QAWDQ+bQdx7HJzrv7LS2Hw==", + "dev": true, + "optional": true + }, "is-extendable": { "version": "0.1.1", "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz", @@ -6926,6 +7677,12 @@ "integrity": "sha1-aRC8pdqMleeEtXUbl2z1oQ/uNtI=", "dev": true }, + "is-negative-zero": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-negative-zero/-/is-negative-zero-2.0.0.tgz", + "integrity": "sha1-lVOxIbD6wohp2p7UWeIMdUN4hGE=", + "dev": true + }, "is-number": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", @@ -6947,9 +7704,9 @@ } }, "is-obj": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/is-obj/-/is-obj-1.0.1.tgz", - "integrity": "sha1-PkcprB9f3gJc19g6iW2rn09n2w8=", + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-obj/-/is-obj-2.0.0.tgz", + "integrity": "sha512-drqDG3cbczxxEJRoOXcOjtdp1J/lyp1mNn0xaznRs8+muBhgQcrnbspox5X5fOw0HnMnbfDzvnEMEtqDEJEo8w==", "dev": true }, "is-path-cwd": { @@ -6998,12 +7755,20 @@ "dev": true }, "is-regex": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.0.4.tgz", - "integrity": "sha1-VRdIm1RwkbCTDglWVM7SXul+lJE=", + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.1.1.tgz", + "integrity": "sha512-1+QkEcxiLlB7VEyFtyBg94e08OAsvq7FUBgApTq/w2ymCLyKJgDPsybBENVtA7XCQEgEXxKPonG+mvYRxh/LIg==", "dev": true, "requires": { - "has": "^1.0.1" + "has-symbols": "^1.0.1" + }, + "dependencies": { + "has-symbols": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz", + "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", + "dev": true + } } }, "is-relative": { @@ -7021,19 +7786,21 @@ "integrity": "sha1-EtSj3U5o4Lec6428hBc66A2RykQ=", "dev": true }, - "is-subset": { - "version": "0.1.1", - "resolved": "https://registry.npmjs.org/is-subset/-/is-subset-0.1.1.tgz", - "integrity": "sha1-ilkRfZMt4d4A8kX83TnOQ/HpOaY=", - "dev": true - }, "is-symbol": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/is-symbol/-/is-symbol-1.0.2.tgz", - "integrity": "sha512-HS8bZ9ox60yCJLH9snBpIwv9pYUAkcuLhSA1oero1UB5y9aiQpRA8y2ex945AOtCZL1lJDeIk3G5LthswI46Lw==", + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/is-symbol/-/is-symbol-1.0.3.tgz", + "integrity": "sha512-OwijhaRSgqvhm/0ZdAcXNZt9lYdKFpcRDT5ULUuYXPoT794UNOdU+gpT6Rzo7b4V2HUl/op6GqY894AZwv9faQ==", "dev": true, "requires": { - "has-symbols": "^1.0.0" + "has-symbols": "^1.0.1" + }, + "dependencies": { + "has-symbols": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz", + "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", + "dev": true + } } }, "is-text-path": { @@ -7115,15 +7882,12 @@ "dev": true }, "istanbul-lib-instrument": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/istanbul-lib-instrument/-/istanbul-lib-instrument-4.0.1.tgz", - "integrity": "sha512-imIchxnodll7pvQBYOqUu88EufLCU56LMeFPZZM/fJZ1irYcYdqroaV+ACK1Ila8ls09iEYArp+nqyC6lW1Vfg==", + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/istanbul-lib-instrument/-/istanbul-lib-instrument-4.0.3.tgz", + "integrity": "sha512-BXgQl9kf4WTCPCCpmFGoJkz/+uhvm7h7PFKUYxh7qarQd3ER33vHG//qaE8eN25l07YqZPpHXU9I09l/RD5aGQ==", "dev": true, "requires": { "@babel/core": "^7.7.5", - "@babel/parser": "^7.7.5", - "@babel/template": "^7.7.4", - "@babel/traverse": "^7.7.4", "@istanbuljs/schema": "^0.1.2", "istanbul-lib-coverage": "^3.0.0", "semver": "^6.3.0" @@ -7147,18 +7911,18 @@ "dev": true }, "make-dir": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.0.2.tgz", - "integrity": "sha512-rYKABKutXa6vXTXhoV18cBE7PaewPXHe/Bdq4v+ZLMhxbWApkFFplT0LcbMW+6BbjnQXzZ/sAvSE/JdguApG5w==", + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", + "integrity": "sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==", "dev": true, "requires": { "semver": "^6.0.0" } }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -7186,9 +7950,9 @@ } }, "istanbul-reports": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/istanbul-reports/-/istanbul-reports-3.0.0.tgz", - "integrity": "sha512-2osTcC8zcOSUkImzN2EWQta3Vdi4WjjKw99P2yWx5mLnigAM0Rd5uYFn1cf2i/Ois45GkNjaoTqc5CxgMSX80A==", + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/istanbul-reports/-/istanbul-reports-3.0.2.tgz", + "integrity": "sha512-9tZvz7AiR3PEDNGiV9vIouQ/EAcqMXFmkcA1CDFTwOB98OZVDL0PH9glHotf5Ugp6GCOTypfzGWI/OqjWNCRUw==", "dev": true, "requires": { "html-escaper": "^2.0.0", @@ -7206,16 +7970,152 @@ "jest-cli": "^25.1.0" }, "dependencies": { - "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "@jest/core": { + "version": "25.5.4", + "resolved": "https://registry.npmjs.org/@jest/core/-/core-25.5.4.tgz", + "integrity": "sha512-3uSo7laYxF00Dg/DMgbn4xMJKmDdWvZnf89n8Xj/5/AeQ2dOQmn6b6Hkj/MleyzZWXpwv+WSdYWl4cLsy2JsoA==", + "dev": true, + "requires": { + "@jest/console": "^25.5.0", + "@jest/reporters": "^25.5.1", + "@jest/test-result": "^25.5.0", + "@jest/transform": "^25.5.1", + "@jest/types": "^25.5.0", + "ansi-escapes": "^4.2.1", + "chalk": "^3.0.0", + "exit": "^0.1.2", + "graceful-fs": "^4.2.4", + "jest-changed-files": "^25.5.0", + "jest-config": "^25.5.4", + "jest-haste-map": "^25.5.1", + "jest-message-util": "^25.5.0", + "jest-regex-util": "^25.2.6", + "jest-resolve": "^25.5.1", + "jest-resolve-dependencies": "^25.5.4", + "jest-runner": "^25.5.4", + "jest-runtime": "^25.5.4", + "jest-snapshot": "^25.5.1", + "jest-util": "^25.5.0", + "jest-validate": "^25.5.0", + "jest-watcher": "^25.5.0", + "micromatch": "^4.0.2", + "p-each-series": "^2.1.0", + "realpath-native": "^2.0.0", + "rimraf": "^3.0.0", + "slash": "^3.0.0", + "strip-ansi": "^6.0.0" + }, + "dependencies": { + "@jest/test-result": { + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/@jest/test-result/-/test-result-25.5.0.tgz", + "integrity": "sha512-oV+hPJgXN7IQf/fHWkcS99y0smKLU2czLBJ9WA0jHITLst58HpQMtzSYxzaBvYc6U5U6jfoMthqsUlUlbRXs0A==", + "dev": true, + "requires": { + "@jest/console": "^25.5.0", + "@jest/types": "^25.5.0", + "@types/istanbul-lib-coverage": "^2.0.0", + "collect-v8-coverage": "^1.0.0" + } + }, + "@jest/types": { + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/@jest/types/-/types-25.5.0.tgz", + "integrity": "sha512-OXD0RgQ86Tu3MazKo8bnrkDRaDXXMGUqd+kTtLtK1Zb7CRzQcaSRPPPV37SvYTdevXEBVxe0HXylEjs8ibkmCw==", + "dev": true, + "requires": { + "@types/istanbul-lib-coverage": "^2.0.0", + "@types/istanbul-reports": "^1.1.1", + "@types/yargs": "^15.0.0", + "chalk": "^3.0.0" + } + }, + "exit": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/exit/-/exit-0.1.2.tgz", + "integrity": "sha1-BjJjj42HfMghB9MKD/8aF8uhzQw=", + "dev": true + }, + "jest-config": { + "version": "25.5.4", + "resolved": "https://registry.npmjs.org/jest-config/-/jest-config-25.5.4.tgz", + "integrity": "sha512-SZwR91SwcdK6bz7Gco8qL7YY2sx8tFJYzvg216DLihTWf+LKY/DoJXpM9nTzYakSyfblbqeU48p/p7Jzy05Atg==", + "dev": true, + "requires": { + "@babel/core": "^7.1.0", + "@jest/test-sequencer": "^25.5.4", + "@jest/types": "^25.5.0", + "babel-jest": "^25.5.1", + "chalk": "^3.0.0", + "deepmerge": "^4.2.2", + "glob": "^7.1.1", + "graceful-fs": "^4.2.4", + "jest-environment-jsdom": "^25.5.0", + "jest-environment-node": "^25.5.0", + "jest-get-type": "^25.2.6", + "jest-jasmine2": "^25.5.4", + "jest-regex-util": "^25.2.6", + "jest-resolve": "^25.5.1", + "jest-util": "^25.5.0", + "jest-validate": "^25.5.0", + "micromatch": "^4.0.2", + "pretty-format": "^25.5.0", + "realpath-native": "^2.0.0" + } + }, + "jest-util": { + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-util/-/jest-util-25.5.0.tgz", + "integrity": "sha512-KVlX+WWg1zUTB9ktvhsg2PXZVdkI1NBevOJSkTKYAyXyH4QSvh+Lay/e/v+bmaFfrkfx43xD8QTfgobzlEXdIA==", + "dev": true, + "requires": { + "@jest/types": "^25.5.0", + "chalk": "^3.0.0", + "graceful-fs": "^4.2.4", + "is-ci": "^2.0.0", + "make-dir": "^3.0.0" + } + }, + "jest-validate": { + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-validate/-/jest-validate-25.5.0.tgz", + "integrity": "sha512-okUFKqhZIpo3jDdtUXUZ2LxGUZJIlfdYBvZb1aczzxrlyMlqdnnws9MOxezoLGhSaFc2XYaHNReNQfj5zPIWyQ==", + "dev": true, + "requires": { + "@jest/types": "^25.5.0", + "camelcase": "^5.3.1", + "chalk": "^3.0.0", + "jest-get-type": "^25.2.6", + "leven": "^3.1.0", + "pretty-format": "^25.5.0" + } + }, + "realpath-native": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/realpath-native/-/realpath-native-2.0.0.tgz", + "integrity": "sha512-v1SEYUOXXdbBZK8ZuNgO4TBjamPsiSgcFr0aP+tEKpQZK8vooEUqV6nm6Cv502mX4NF2EfsnVqtNAHG+/6Ur1Q==", + "dev": true + } + } + }, + "ansi-styles": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, + "braces": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", + "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", + "dev": true, + "requires": { + "fill-range": "^7.0.1" + } + }, "camelcase": { "version": "5.3.1", "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", @@ -7258,6 +8158,15 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, + "fill-range": { + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", + "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", + "dev": true, + "requires": { + "to-regex-range": "^5.0.1" + } + }, "find-up": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", @@ -7274,6 +8183,12 @@ "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==", "dev": true }, + "graceful-fs": { + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", + "dev": true + }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", @@ -7290,25 +8205,44 @@ "resolve-cwd": "^3.0.0" } }, + "is-number": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", + "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", + "dev": true + }, "jest-cli": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-cli/-/jest-cli-25.1.0.tgz", - "integrity": "sha512-p+aOfczzzKdo3AsLJlhs8J5EW6ffVidfSZZxXedJ0mHPBOln1DccqFmGCoO8JWd4xRycfmwy1eoQkMsF8oekPg==", + "version": "25.5.4", + "resolved": "https://registry.npmjs.org/jest-cli/-/jest-cli-25.5.4.tgz", + "integrity": "sha512-rG8uJkIiOUpnREh1768/N3n27Cm+xPFkSNFO91tgg+8o2rXeVLStz+vkXkGr4UtzH6t1SNbjwoiswd7p4AhHTw==", "dev": true, "requires": { - "@jest/core": "^25.1.0", - "@jest/test-result": "^25.1.0", - "@jest/types": "^25.1.0", + "@jest/core": "^25.5.4", + "@jest/test-result": "^25.5.0", + "@jest/types": "^25.5.0", "chalk": "^3.0.0", "exit": "^0.1.2", + "graceful-fs": "^4.2.4", "import-local": "^3.0.2", "is-ci": "^2.0.0", - "jest-config": "^25.1.0", - "jest-util": "^25.1.0", - "jest-validate": "^25.1.0", + "jest-config": "^25.5.4", + "jest-util": "^25.5.0", + "jest-validate": "^25.5.0", "prompts": "^2.0.1", - "realpath-native": "^1.1.0", - "yargs": "^15.0.0" + "realpath-native": "^2.0.0", + "yargs": "^15.3.1" + }, + "dependencies": { + "prompts": { + "version": "2.4.0", + "resolved": "https://registry.npmjs.org/prompts/-/prompts-2.4.0.tgz", + "integrity": "sha512-awZAKrk3vN6CroQukBL+R9051a4R3zCZBlJm/HBfrSZ8iTpYix3VX1vU4mveiLpiwmOJT4wokTF9m6HUk4KqWQ==", + "dev": true, + "requires": { + "kleur": "^3.0.3", + "sisteransi": "^1.0.5" + } + } } }, "locate-path": { @@ -7320,6 +8254,25 @@ "p-locate": "^4.1.0" } }, + "make-dir": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", + "integrity": "sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==", + "dev": true, + "requires": { + "semver": "^6.0.0" + } + }, + "micromatch": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.2.tgz", + "integrity": "sha512-y7FpHSbMUMoyPbYUSzO6PaZ6FyRnQOpHuKwbo1G+Knck95XVU4QAiKdGEnj5wwoS7PlOgthX/09u5iFJ+aYf5Q==", + "dev": true, + "requires": { + "braces": "^3.0.1", + "picomatch": "^2.0.5" + } + }, "p-limit": { "version": "2.2.2", "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.2.2.tgz", @@ -7380,6 +8333,15 @@ "integrity": "sha512-qYg9KP24dD5qka9J47d0aVky0N+b4fTU89LN9iDnjB5waksiC49rvMB0PrUJQGoTmH50XPiqOvAjDfaijGxYZw==", "dev": true }, + "rimraf": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz", + "integrity": "sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==", + "dev": true, + "requires": { + "glob": "^7.1.3" + } + }, "strip-ansi": { "version": "6.0.0", "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", @@ -7390,14 +8352,23 @@ } }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" } }, + "to-regex-range": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", + "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", + "dev": true, + "requires": { + "is-number": "^7.0.0" + } + }, "which-module": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz", @@ -7422,9 +8393,9 @@ "dev": true }, "yargs": { - "version": "15.3.0", - "resolved": "https://registry.npmjs.org/yargs/-/yargs-15.3.0.tgz", - "integrity": "sha512-g/QCnmjgOl1YJjGsnUg2SatC7NUYEiLXJqxNOQU9qSpjzGtGXda9b+OKccr1kLTy8BN9yqEyqfq5lxlwdc13TA==", + "version": "15.4.1", + "resolved": "https://registry.npmjs.org/yargs/-/yargs-15.4.1.tgz", + "integrity": "sha512-aePbxDmcYW++PaqBsJ+HYUFwCdv4LVvdnhBy78E57PIor8/OVvhMrADFFEDh8DHDFRv/O9i3lPhsENjO7QX0+A==", "dev": true, "requires": { "cliui": "^6.0.0", @@ -7437,13 +8408,13 @@ "string-width": "^4.2.0", "which-module": "^2.0.0", "y18n": "^4.0.0", - "yargs-parser": "^18.1.0" + "yargs-parser": "^18.1.2" } }, "yargs-parser": { - "version": "18.1.0", - "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-18.1.0.tgz", - "integrity": "sha512-o/Jr6JBOv6Yx3pL+5naWSoIA2jJ+ZkMYQG/ie9qFbukBe4uzmBatlXFOiu/tNKRWEtyf+n5w7jc/O16ufqOTdQ==", + "version": "18.1.3", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-18.1.3.tgz", + "integrity": "sha512-o50j0JeToy/4K6OZcaQmW6lyXXKhq7csREXcDwk2omFPJEwUNOVtJKvmDr9EI1fAJZUyZcRF7kxGBWmRXudrCQ==", "dev": true, "requires": { "camelcase": "^5.0.0", @@ -7453,20 +8424,20 @@ } }, "jest-changed-files": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-changed-files/-/jest-changed-files-25.1.0.tgz", - "integrity": "sha512-bdL1aHjIVy3HaBO3eEQeemGttsq1BDlHgWcOjEOIAcga7OOEGWHD2WSu8HhL7I1F0mFFyci8VKU4tRNk+qtwDA==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-changed-files/-/jest-changed-files-25.5.0.tgz", + "integrity": "sha512-EOw9QEqapsDT7mKF162m8HFzRPbmP8qJQny6ldVOdOVBz3ACgPm/1nAn5fPQ/NDaYhX/AHkrGwwkCncpAVSXcw==", "dev": true, "requires": { - "@jest/types": "^25.1.0", + "@jest/types": "^25.5.0", "execa": "^3.2.0", "throat": "^5.0.0" }, "dependencies": { "cross-spawn": { - "version": "7.0.1", - "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-7.0.1.tgz", - "integrity": "sha512-u7v4o84SwFpD32Z8IIcPZ6z1/ie24O6RU3RbtL5Y316l3KuHVPx9ItBgWQ6VlfAFnRnTtMUrsQ9MUUTuEZjogg==", + "version": "7.0.3", + "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-7.0.3.tgz", + "integrity": "sha512-iRDPJKUPVEND7dHPO8rkbOnPpyDygcDFtWjpeWNCgy8WP2rXcxXL8TskReQl6OrB2G7+UJrags1q15Fudc7G6w==", "dev": true, "requires": { "path-key": "^3.1.0", @@ -7493,9 +8464,9 @@ } }, "get-stream": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-5.1.0.tgz", - "integrity": "sha512-EXr1FOzrzTfGeL0gQdeFEvOMm2mzMOglyiOXSTpPC+iAjAKftbr3jpCMWynogwYnM+eSj9sHGc6wjIcDvYiygw==", + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-5.2.0.tgz", + "integrity": "sha512-nBF+F1rAZVCu/p7rjzgA+Yb4lfYXrpl7a6VmJrU8wF9I1CKvP/QwPNZHnOlwbTkY6dvtFIzFMSyQXbLoTQPRpA==", "dev": true, "requires": { "pump": "^3.0.0" @@ -7565,37 +8536,38 @@ } }, "jest-config": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-config/-/jest-config-25.1.0.tgz", - "integrity": "sha512-tLmsg4SZ5H7tuhBC5bOja0HEblM0coS3Wy5LTCb2C8ZV6eWLewHyK+3qSq9Bi29zmWQ7ojdCd3pxpx4l4d2uGw==", + "version": "25.5.4", + "resolved": "https://registry.npmjs.org/jest-config/-/jest-config-25.5.4.tgz", + "integrity": "sha512-SZwR91SwcdK6bz7Gco8qL7YY2sx8tFJYzvg216DLihTWf+LKY/DoJXpM9nTzYakSyfblbqeU48p/p7Jzy05Atg==", "dev": true, "requires": { "@babel/core": "^7.1.0", - "@jest/test-sequencer": "^25.1.0", - "@jest/types": "^25.1.0", - "babel-jest": "^25.1.0", + "@jest/test-sequencer": "^25.5.4", + "@jest/types": "^25.5.0", + "babel-jest": "^25.5.1", "chalk": "^3.0.0", + "deepmerge": "^4.2.2", "glob": "^7.1.1", - "jest-environment-jsdom": "^25.1.0", - "jest-environment-node": "^25.1.0", - "jest-get-type": "^25.1.0", - "jest-jasmine2": "^25.1.0", - "jest-regex-util": "^25.1.0", - "jest-resolve": "^25.1.0", - "jest-util": "^25.1.0", - "jest-validate": "^25.1.0", + "graceful-fs": "^4.2.4", + "jest-environment-jsdom": "^25.5.0", + "jest-environment-node": "^25.5.0", + "jest-get-type": "^25.2.6", + "jest-jasmine2": "^25.5.4", + "jest-regex-util": "^25.2.6", + "jest-resolve": "^25.5.1", + "jest-util": "^25.5.0", + "jest-validate": "^25.5.0", "micromatch": "^4.0.2", - "pretty-format": "^25.1.0", - "realpath-native": "^1.1.0" + "pretty-format": "^25.5.0", + "realpath-native": "^2.0.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -7642,6 +8614,12 @@ "to-regex-range": "^5.0.1" } }, + "graceful-fs": { + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", + "dev": true + }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", @@ -7665,9 +8643,9 @@ } }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -7685,24 +8663,23 @@ } }, "jest-diff": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-diff/-/jest-diff-25.1.0.tgz", - "integrity": "sha512-nepXgajT+h017APJTreSieh4zCqnSHEJ1iT8HDlewu630lSJ4Kjjr9KNzm+kzGwwcpsDE6Snx1GJGzzsefaEHw==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-diff/-/jest-diff-25.5.0.tgz", + "integrity": "sha512-z1kygetuPiREYdNIumRpAHY6RXiGmp70YHptjdaxTWGmA085W3iCnXNx0DhflK3vwrKmrRWyY1wUpkPMVxMK7A==", "dev": true, "requires": { "chalk": "^3.0.0", - "diff-sequences": "^25.1.0", - "jest-get-type": "^25.1.0", - "pretty-format": "^25.1.0" + "diff-sequences": "^25.2.6", + "jest-get-type": "^25.2.6", + "pretty-format": "^25.5.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -7738,9 +8715,9 @@ "dev": true }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -7749,34 +8726,33 @@ } }, "jest-docblock": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-docblock/-/jest-docblock-25.1.0.tgz", - "integrity": "sha512-370P/mh1wzoef6hUKiaMcsPtIapY25suP6JqM70V9RJvdKLrV4GaGbfUseUVk4FZJw4oTZ1qSCJNdrClKt5JQA==", + "version": "25.3.0", + "resolved": "https://registry.npmjs.org/jest-docblock/-/jest-docblock-25.3.0.tgz", + "integrity": "sha512-aktF0kCar8+zxRHxQZwxMy70stc9R1mOmrLsT5VO3pIT0uzGRSDAXxSlz4NqQWpuLjPpuMhPRl7H+5FRsvIQAg==", "dev": true, "requires": { "detect-newline": "^3.0.0" } }, "jest-each": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-each/-/jest-each-25.1.0.tgz", - "integrity": "sha512-R9EL8xWzoPySJ5wa0DXFTj7NrzKpRD40Jy+zQDp3Qr/2QmevJgkN9GqioCGtAJ2bW9P/MQRznQHQQhoeAyra7A==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-each/-/jest-each-25.5.0.tgz", + "integrity": "sha512-QBogUxna3D8vtiItvn54xXde7+vuzqRrEeaw8r1s+1TG9eZLVJE5ZkKoSUlqFwRjnlaA4hyKGiu9OlkFIuKnjA==", "dev": true, "requires": { - "@jest/types": "^25.1.0", + "@jest/types": "^25.5.0", "chalk": "^3.0.0", - "jest-get-type": "^25.1.0", - "jest-util": "^25.1.0", - "pretty-format": "^25.1.0" + "jest-get-type": "^25.2.6", + "jest-util": "^25.5.0", + "pretty-format": "^25.5.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -7812,9 +8788,9 @@ "dev": true }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -7823,55 +8799,58 @@ } }, "jest-environment-jsdom": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-environment-jsdom/-/jest-environment-jsdom-25.1.0.tgz", - "integrity": "sha512-ILb4wdrwPAOHX6W82GGDUiaXSSOE274ciuov0lztOIymTChKFtC02ddyicRRCdZlB5YSrv3vzr1Z5xjpEe1OHQ==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-environment-jsdom/-/jest-environment-jsdom-25.5.0.tgz", + "integrity": "sha512-7Jr02ydaq4jaWMZLY+Skn8wL5nVIYpWvmeatOHL3tOcV3Zw8sjnPpx+ZdeBfc457p8jCR9J6YCc+Lga0oIy62A==", "dev": true, "requires": { - "@jest/environment": "^25.1.0", - "@jest/fake-timers": "^25.1.0", - "@jest/types": "^25.1.0", - "jest-mock": "^25.1.0", - "jest-util": "^25.1.0", - "jsdom": "^15.1.1" + "@jest/environment": "^25.5.0", + "@jest/fake-timers": "^25.5.0", + "@jest/types": "^25.5.0", + "jest-mock": "^25.5.0", + "jest-util": "^25.5.0", + "jsdom": "^15.2.1" } }, "jest-environment-node": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-environment-node/-/jest-environment-node-25.1.0.tgz", - "integrity": "sha512-U9kFWTtAPvhgYY5upnH9rq8qZkj6mYLup5l1caAjjx9uNnkLHN2xgZy5mo4SyLdmrh/EtB9UPpKFShvfQHD0Iw==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-environment-node/-/jest-environment-node-25.5.0.tgz", + "integrity": "sha512-iuxK6rQR2En9EID+2k+IBs5fCFd919gVVK5BeND82fYeLWPqvRcFNPKu9+gxTwfB5XwBGBvZ0HFQa+cHtIoslA==", "dev": true, "requires": { - "@jest/environment": "^25.1.0", - "@jest/fake-timers": "^25.1.0", - "@jest/types": "^25.1.0", - "jest-mock": "^25.1.0", - "jest-util": "^25.1.0" + "@jest/environment": "^25.5.0", + "@jest/fake-timers": "^25.5.0", + "@jest/types": "^25.5.0", + "jest-mock": "^25.5.0", + "jest-util": "^25.5.0", + "semver": "^6.3.0" } }, "jest-get-type": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-get-type/-/jest-get-type-25.1.0.tgz", - "integrity": "sha512-yWkBnT+5tMr8ANB6V+OjmrIJufHtCAqI5ic2H40v+tRqxDmE0PGnIiTyvRWFOMtmVHYpwRqyazDbTnhpjsGvLw==", + "version": "25.2.6", + "resolved": "https://registry.npmjs.org/jest-get-type/-/jest-get-type-25.2.6.tgz", + "integrity": "sha512-DxjtyzOHjObRM+sM1knti6or+eOgcGU4xVSb2HNP1TqO4ahsT+rqZg+nyqHWJSvWgKC5cG3QjGFBqxLghiF/Ig==", "dev": true }, "jest-haste-map": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-haste-map/-/jest-haste-map-25.1.0.tgz", - "integrity": "sha512-/2oYINIdnQZAqyWSn1GTku571aAfs8NxzSErGek65Iu5o8JYb+113bZysRMcC/pjE5v9w0Yz+ldbj9NxrFyPyw==", + "version": "25.5.1", + "resolved": "https://registry.npmjs.org/jest-haste-map/-/jest-haste-map-25.5.1.tgz", + "integrity": "sha512-dddgh9UZjV7SCDQUrQ+5t9yy8iEgKc1AKqZR9YDww8xsVOtzPQSMVLDChc21+g29oTRexb9/B0bIlZL+sWmvAQ==", "dev": true, "requires": { - "@jest/types": "^25.1.0", + "@jest/types": "^25.5.0", + "@types/graceful-fs": "^4.1.2", "anymatch": "^3.0.3", "fb-watchman": "^2.0.0", "fsevents": "^2.1.2", - "graceful-fs": "^4.2.3", - "jest-serializer": "^25.1.0", - "jest-util": "^25.1.0", - "jest-worker": "^25.1.0", + "graceful-fs": "^4.2.4", + "jest-serializer": "^25.5.0", + "jest-util": "^25.5.0", + "jest-worker": "^25.5.0", "micromatch": "^4.0.2", "sane": "^4.0.3", - "walker": "^1.0.7" + "walker": "^1.0.7", + "which": "^2.0.2" }, "dependencies": { "anymatch": { @@ -7903,16 +8882,16 @@ } }, "fsevents": { - "version": "2.1.2", - "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.1.2.tgz", - "integrity": "sha512-R4wDiBwZ0KzpgOWetKDug1FZcYhqYnUYKtfZYt4mD5SBz76q0KR4Q9o7GIPamsVPGmW3EYPPJ0dOOjvx32ldZA==", + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.2.1.tgz", + "integrity": "sha512-bTLYHSeC0UH/EFXS9KqWnXuOl/wHK5Z/d+ghd5AsFMYN7wIGkUCOJyzy88+wJKkZPGON8u4Z9f6U4FdgURE9qA==", "dev": true, "optional": true }, "graceful-fs": { - "version": "4.2.3", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.3.tgz", - "integrity": "sha512-a30VEBm4PEdx1dRB7MFK7BejejvCvBronbLjht+sHuGYj8PHs7M/5Z+rt5lw551vZ7yfTCj4Vuyy3mSJytDWRQ==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", "dev": true }, "has-flag": { @@ -7928,9 +8907,9 @@ "dev": true }, "jest-worker": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-worker/-/jest-worker-25.1.0.tgz", - "integrity": "sha512-ZHhHtlxOWSxCoNOKHGbiLzXnl42ga9CxDr27H36Qn+15pQZd3R/F24jrmjDelw9j/iHUIWMWs08/u2QN50HHOg==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-worker/-/jest-worker-25.5.0.tgz", + "integrity": "sha512-/dsSmUkIy5EBGfv/IjjqmFxrNAUpBERfGs1oHROyD7yxjG/w+t0GOJDX8O1k32ySmd7+a5IhnJU2qQFcJ4n1vw==", "dev": true, "requires": { "merge-stream": "^2.0.0", @@ -7954,9 +8933,9 @@ "dev": true }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -7970,41 +8949,49 @@ "requires": { "is-number": "^7.0.0" } + }, + "which": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/which/-/which-2.0.2.tgz", + "integrity": "sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==", + "dev": true, + "requires": { + "isexe": "^2.0.0" + } } } }, "jest-jasmine2": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-jasmine2/-/jest-jasmine2-25.1.0.tgz", - "integrity": "sha512-GdncRq7jJ7sNIQ+dnXvpKO2MyP6j3naNK41DTTjEAhLEdpImaDA9zSAZwDhijjSF/D7cf4O5fdyUApGBZleaEg==", + "version": "25.5.4", + "resolved": "https://registry.npmjs.org/jest-jasmine2/-/jest-jasmine2-25.5.4.tgz", + "integrity": "sha512-9acbWEfbmS8UpdcfqnDO+uBUgKa/9hcRh983IHdM+pKmJPL77G0sWAAK0V0kr5LK3a8cSBfkFSoncXwQlRZfkQ==", "dev": true, "requires": { "@babel/traverse": "^7.1.0", - "@jest/environment": "^25.1.0", - "@jest/source-map": "^25.1.0", - "@jest/test-result": "^25.1.0", - "@jest/types": "^25.1.0", + "@jest/environment": "^25.5.0", + "@jest/source-map": "^25.5.0", + "@jest/test-result": "^25.5.0", + "@jest/types": "^25.5.0", "chalk": "^3.0.0", "co": "^4.6.0", - "expect": "^25.1.0", + "expect": "^25.5.0", "is-generator-fn": "^2.0.0", - "jest-each": "^25.1.0", - "jest-matcher-utils": "^25.1.0", - "jest-message-util": "^25.1.0", - "jest-runtime": "^25.1.0", - "jest-snapshot": "^25.1.0", - "jest-util": "^25.1.0", - "pretty-format": "^25.1.0", + "jest-each": "^25.5.0", + "jest-matcher-utils": "^25.5.0", + "jest-message-util": "^25.5.0", + "jest-runtime": "^25.5.4", + "jest-snapshot": "^25.5.1", + "jest-util": "^25.5.0", + "pretty-format": "^25.5.0", "throat": "^5.0.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -8040,9 +9027,9 @@ "dev": true }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -8051,34 +9038,33 @@ } }, "jest-leak-detector": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-leak-detector/-/jest-leak-detector-25.1.0.tgz", - "integrity": "sha512-3xRI264dnhGaMHRvkFyEKpDeaRzcEBhyNrOG5oT8xPxOyUAblIAQnpiR3QXu4wDor47MDTiHbiFcbypdLcLW5w==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-leak-detector/-/jest-leak-detector-25.5.0.tgz", + "integrity": "sha512-rV7JdLsanS8OkdDpZtgBf61L5xZ4NnYLBq72r6ldxahJWWczZjXawRsoHyXzibM5ed7C2QRjpp6ypgwGdKyoVA==", "dev": true, "requires": { - "jest-get-type": "^25.1.0", - "pretty-format": "^25.1.0" + "jest-get-type": "^25.2.6", + "pretty-format": "^25.5.0" } }, "jest-matcher-utils": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-matcher-utils/-/jest-matcher-utils-25.1.0.tgz", - "integrity": "sha512-KGOAFcSFbclXIFE7bS4C53iYobKI20ZWleAdAFun4W1Wz1Kkej8Ng6RRbhL8leaEvIOjGXhGf/a1JjO8bkxIWQ==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-matcher-utils/-/jest-matcher-utils-25.5.0.tgz", + "integrity": "sha512-VWI269+9JS5cpndnpCwm7dy7JtGQT30UHfrnM3mXl22gHGt/b7NkjBqXfbhZ8V4B7ANUsjK18PlSBmG0YH7gjw==", "dev": true, "requires": { "chalk": "^3.0.0", - "jest-diff": "^25.1.0", - "jest-get-type": "^25.1.0", - "pretty-format": "^25.1.0" + "jest-diff": "^25.5.0", + "jest-get-type": "^25.2.6", + "pretty-format": "^25.5.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -8114,9 +9100,9 @@ "dev": true }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -8125,28 +9111,27 @@ } }, "jest-message-util": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-message-util/-/jest-message-util-25.1.0.tgz", - "integrity": "sha512-Nr/Iwar2COfN22aCqX0kCVbXgn8IBm9nWf4xwGr5Olv/KZh0CZ32RKgZWMVDXGdOahicM10/fgjdimGNX/ttCQ==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-message-util/-/jest-message-util-25.5.0.tgz", + "integrity": "sha512-ezddz3YCT/LT0SKAmylVyWWIGYoKHOFOFXx3/nA4m794lfVUskMcwhip6vTgdVrOtYdjeQeis2ypzes9mZb4EA==", "dev": true, "requires": { "@babel/code-frame": "^7.0.0", - "@jest/test-result": "^25.1.0", - "@jest/types": "^25.1.0", + "@jest/types": "^25.5.0", "@types/stack-utils": "^1.0.1", "chalk": "^3.0.0", + "graceful-fs": "^4.2.4", "micromatch": "^4.0.2", "slash": "^3.0.0", "stack-utils": "^1.0.1" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -8193,6 +9178,12 @@ "to-regex-range": "^5.0.1" } }, + "graceful-fs": { + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", + "dev": true + }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", @@ -8216,9 +9207,9 @@ } }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -8236,46 +9227,49 @@ } }, "jest-mock": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-mock/-/jest-mock-25.1.0.tgz", - "integrity": "sha512-28/u0sqS+42vIfcd1mlcg4ZVDmSUYuNvImP4X2lX5hRMLW+CN0BeiKVD4p+ujKKbSPKd3rg/zuhCF+QBLJ4vag==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-mock/-/jest-mock-25.5.0.tgz", + "integrity": "sha512-eXWuTV8mKzp/ovHc5+3USJMYsTBhyQ+5A1Mak35dey/RG8GlM4YWVylZuGgVXinaW6tpvk/RSecmF37FKUlpXA==", "dev": true, "requires": { - "@jest/types": "^25.1.0" + "@jest/types": "^25.5.0" } }, "jest-pnp-resolver": { - "version": "1.2.1", - "resolved": "https://registry.npmjs.org/jest-pnp-resolver/-/jest-pnp-resolver-1.2.1.tgz", - "integrity": "sha512-pgFw2tm54fzgYvc/OHrnysABEObZCUNFnhjoRjaVOCN8NYc032/gVjPaHD4Aq6ApkSieWtfKAFQtmDKAmhupnQ==", + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/jest-pnp-resolver/-/jest-pnp-resolver-1.2.2.tgz", + "integrity": "sha512-olV41bKSMm8BdnuMsewT4jqlZ8+3TCARAXjZGT9jcoSnrfUnRCqnMoF9XEeoWjbzObpqF9dRhHQj0Xb9QdF6/w==", "dev": true }, "jest-regex-util": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-regex-util/-/jest-regex-util-25.1.0.tgz", - "integrity": "sha512-9lShaDmDpqwg+xAd73zHydKrBbbrIi08Kk9YryBEBybQFg/lBWR/2BDjjiSE7KIppM9C5+c03XiDaZ+m4Pgs1w==", + "version": "25.2.6", + "resolved": "https://registry.npmjs.org/jest-regex-util/-/jest-regex-util-25.2.6.tgz", + "integrity": "sha512-KQqf7a0NrtCkYmZZzodPftn7fL1cq3GQAFVMn5Hg8uKx/fIenLEobNanUxb7abQ1sjADHBseG/2FGpsv/wr+Qw==", "dev": true }, "jest-resolve": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-resolve/-/jest-resolve-25.1.0.tgz", - "integrity": "sha512-XkBQaU1SRCHj2Evz2Lu4Czs+uIgJXWypfO57L7JYccmAXv4slXA6hzNblmcRmf7P3cQ1mE7fL3ABV6jAwk4foQ==", + "version": "25.5.1", + "resolved": "https://registry.npmjs.org/jest-resolve/-/jest-resolve-25.5.1.tgz", + "integrity": "sha512-Hc09hYch5aWdtejsUZhA+vSzcotf7fajSlPA6EZPE1RmPBAD39XtJhvHWFStid58iit4IPDLI/Da4cwdDmAHiQ==", "dev": true, "requires": { - "@jest/types": "^25.1.0", + "@jest/types": "^25.5.0", "browser-resolve": "^1.11.3", "chalk": "^3.0.0", + "graceful-fs": "^4.2.4", "jest-pnp-resolver": "^1.2.1", - "realpath-native": "^1.1.0" + "read-pkg-up": "^7.0.1", + "realpath-native": "^2.0.0", + "resolve": "^1.17.0", + "slash": "^3.0.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -8304,16 +9298,124 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, + "find-up": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", + "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", + "dev": true, + "requires": { + "locate-path": "^5.0.0", + "path-exists": "^4.0.0" + } + }, + "graceful-fs": { + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", + "dev": true + }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", "dev": true }, + "locate-path": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-5.0.0.tgz", + "integrity": "sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==", + "dev": true, + "requires": { + "p-locate": "^4.1.0" + } + }, + "p-limit": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.3.0.tgz", + "integrity": "sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==", + "dev": true, + "requires": { + "p-try": "^2.0.0" + } + }, + "p-locate": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-4.1.0.tgz", + "integrity": "sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==", + "dev": true, + "requires": { + "p-limit": "^2.2.0" + } + }, + "p-try": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", + "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", + "dev": true + }, + "parse-json": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-5.1.0.tgz", + "integrity": "sha512-+mi/lmVVNKFNVyLXV31ERiy2CY5E1/F6QtJFEzoChPRwwngMNXRDQ9GJ5WdE2Z2P4AujsOi0/+2qHID68KwfIQ==", + "dev": true, + "requires": { + "@babel/code-frame": "^7.0.0", + "error-ex": "^1.3.1", + "json-parse-even-better-errors": "^2.3.0", + "lines-and-columns": "^1.1.6" + } + }, + "path-exists": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", + "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", + "dev": true + }, + "read-pkg": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-5.2.0.tgz", + "integrity": "sha512-Ug69mNOpfvKDAc2Q8DRpMjjzdtrnv9HcSMX+4VsZxD1aZ6ZzrIE7rlzXBtWTyhULSMKg076AW6WR5iZpD0JiOg==", + "dev": true, + "requires": { + "@types/normalize-package-data": "^2.4.0", + "normalize-package-data": "^2.5.0", + "parse-json": "^5.0.0", + "type-fest": "^0.6.0" + }, + "dependencies": { + "type-fest": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.6.0.tgz", + "integrity": "sha512-q+MB8nYR1KDLrgr4G5yemftpMC7/QLqVndBmEEdqzmNj5dcFOO4Oo8qlwZE3ULT3+Zim1F8Kq4cBnikNhlCMlg==", + "dev": true + } + } + }, + "read-pkg-up": { + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-7.0.1.tgz", + "integrity": "sha512-zK0TB7Xd6JpCLmlLmufqykGE+/TlOePD6qKClNW7hHDKFh/J7/7gCWGR7joEQEW1bKq3a3yUZSObOoWLFQ4ohg==", + "dev": true, + "requires": { + "find-up": "^4.1.0", + "read-pkg": "^5.2.0", + "type-fest": "^0.8.1" + } + }, + "resolve": { + "version": "1.19.0", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.19.0.tgz", + "integrity": "sha512-rArEXAgsBG4UgRGcynxWIWKFvh/XZCcS8UJdHhwy91zwAvCZIbcs+vAbflgBnNjYMs/i/i+/Ux6IZhML1yPvxg==", + "dev": true, + "requires": { + "is-core-module": "^2.1.0", + "path-parse": "^1.0.6" + } + }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -8322,50 +9424,49 @@ } }, "jest-resolve-dependencies": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-resolve-dependencies/-/jest-resolve-dependencies-25.1.0.tgz", - "integrity": "sha512-Cu/Je38GSsccNy4I2vL12ZnBlD170x2Oh1devzuM9TLH5rrnLW1x51lN8kpZLYTvzx9j+77Y5pqBaTqfdzVzrw==", + "version": "25.5.4", + "resolved": "https://registry.npmjs.org/jest-resolve-dependencies/-/jest-resolve-dependencies-25.5.4.tgz", + "integrity": "sha512-yFmbPd+DAQjJQg88HveObcGBA32nqNZ02fjYmtL16t1xw9bAttSn5UGRRhzMHIQbsep7znWvAvnD4kDqOFM0Uw==", "dev": true, "requires": { - "@jest/types": "^25.1.0", - "jest-regex-util": "^25.1.0", - "jest-snapshot": "^25.1.0" + "@jest/types": "^25.5.0", + "jest-regex-util": "^25.2.6", + "jest-snapshot": "^25.5.1" } }, "jest-runner": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-runner/-/jest-runner-25.1.0.tgz", - "integrity": "sha512-su3O5fy0ehwgt+e8Wy7A8CaxxAOCMzL4gUBftSs0Ip32S0epxyZPDov9Znvkl1nhVOJNf4UwAsnqfc3plfQH9w==", + "version": "25.5.4", + "resolved": "https://registry.npmjs.org/jest-runner/-/jest-runner-25.5.4.tgz", + "integrity": "sha512-V/2R7fKZo6blP8E9BL9vJ8aTU4TH2beuqGNxHbxi6t14XzTb+x90B3FRgdvuHm41GY8ch4xxvf0ATH4hdpjTqg==", "dev": true, "requires": { - "@jest/console": "^25.1.0", - "@jest/environment": "^25.1.0", - "@jest/test-result": "^25.1.0", - "@jest/types": "^25.1.0", + "@jest/console": "^25.5.0", + "@jest/environment": "^25.5.0", + "@jest/test-result": "^25.5.0", + "@jest/types": "^25.5.0", "chalk": "^3.0.0", "exit": "^0.1.2", - "graceful-fs": "^4.2.3", - "jest-config": "^25.1.0", - "jest-docblock": "^25.1.0", - "jest-haste-map": "^25.1.0", - "jest-jasmine2": "^25.1.0", - "jest-leak-detector": "^25.1.0", - "jest-message-util": "^25.1.0", - "jest-resolve": "^25.1.0", - "jest-runtime": "^25.1.0", - "jest-util": "^25.1.0", - "jest-worker": "^25.1.0", + "graceful-fs": "^4.2.4", + "jest-config": "^25.5.4", + "jest-docblock": "^25.3.0", + "jest-haste-map": "^25.5.1", + "jest-jasmine2": "^25.5.4", + "jest-leak-detector": "^25.5.0", + "jest-message-util": "^25.5.0", + "jest-resolve": "^25.5.1", + "jest-runtime": "^25.5.4", + "jest-util": "^25.5.0", + "jest-worker": "^25.5.0", "source-map-support": "^0.5.6", "throat": "^5.0.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -8395,9 +9496,9 @@ "dev": true }, "graceful-fs": { - "version": "4.2.3", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.3.tgz", - "integrity": "sha512-a30VEBm4PEdx1dRB7MFK7BejejvCvBronbLjht+sHuGYj8PHs7M/5Z+rt5lw551vZ7yfTCj4Vuyy3mSJytDWRQ==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", "dev": true }, "has-flag": { @@ -8407,9 +9508,9 @@ "dev": true }, "jest-worker": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-worker/-/jest-worker-25.1.0.tgz", - "integrity": "sha512-ZHhHtlxOWSxCoNOKHGbiLzXnl42ga9CxDr27H36Qn+15pQZd3R/F24jrmjDelw9j/iHUIWMWs08/u2QN50HHOg==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-worker/-/jest-worker-25.5.0.tgz", + "integrity": "sha512-/dsSmUkIy5EBGfv/IjjqmFxrNAUpBERfGs1oHROyD7yxjG/w+t0GOJDX8O1k32ySmd7+a5IhnJU2qQFcJ4n1vw==", "dev": true, "requires": { "merge-stream": "^2.0.0", @@ -8417,9 +9518,9 @@ } }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -8428,45 +9529,45 @@ } }, "jest-runtime": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-runtime/-/jest-runtime-25.1.0.tgz", - "integrity": "sha512-mpPYYEdbExKBIBB16ryF6FLZTc1Rbk9Nx0ryIpIMiDDkOeGa0jQOKVI/QeGvVGlunKKm62ywcioeFVzIbK03bA==", + "version": "25.5.4", + "resolved": "https://registry.npmjs.org/jest-runtime/-/jest-runtime-25.5.4.tgz", + "integrity": "sha512-RWTt8LeWh3GvjYtASH2eezkc8AehVoWKK20udV6n3/gC87wlTbE1kIA+opCvNWyyPeBs6ptYsc6nyHUb1GlUVQ==", "dev": true, "requires": { - "@jest/console": "^25.1.0", - "@jest/environment": "^25.1.0", - "@jest/source-map": "^25.1.0", - "@jest/test-result": "^25.1.0", - "@jest/transform": "^25.1.0", - "@jest/types": "^25.1.0", + "@jest/console": "^25.5.0", + "@jest/environment": "^25.5.0", + "@jest/globals": "^25.5.2", + "@jest/source-map": "^25.5.0", + "@jest/test-result": "^25.5.0", + "@jest/transform": "^25.5.1", + "@jest/types": "^25.5.0", "@types/yargs": "^15.0.0", "chalk": "^3.0.0", "collect-v8-coverage": "^1.0.0", "exit": "^0.1.2", "glob": "^7.1.3", - "graceful-fs": "^4.2.3", - "jest-config": "^25.1.0", - "jest-haste-map": "^25.1.0", - "jest-message-util": "^25.1.0", - "jest-mock": "^25.1.0", - "jest-regex-util": "^25.1.0", - "jest-resolve": "^25.1.0", - "jest-snapshot": "^25.1.0", - "jest-util": "^25.1.0", - "jest-validate": "^25.1.0", - "realpath-native": "^1.1.0", + "graceful-fs": "^4.2.4", + "jest-config": "^25.5.4", + "jest-haste-map": "^25.5.1", + "jest-message-util": "^25.5.0", + "jest-mock": "^25.5.0", + "jest-regex-util": "^25.2.6", + "jest-resolve": "^25.5.1", + "jest-snapshot": "^25.5.1", + "jest-util": "^25.5.0", + "jest-validate": "^25.5.0", + "realpath-native": "^2.0.0", "slash": "^3.0.0", "strip-bom": "^4.0.0", - "yargs": "^15.0.0" + "yargs": "^15.3.1" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -8529,9 +9630,9 @@ "dev": true }, "graceful-fs": { - "version": "4.2.3", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.3.tgz", - "integrity": "sha512-a30VEBm4PEdx1dRB7MFK7BejejvCvBronbLjht+sHuGYj8PHs7M/5Z+rt5lw551vZ7yfTCj4Vuyy3mSJytDWRQ==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", "dev": true }, "has-flag": { @@ -8550,9 +9651,9 @@ } }, "p-limit": { - "version": "2.2.2", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.2.2.tgz", - "integrity": "sha512-WGR+xHecKTr7EbUEhyLSh5Dube9JtdiG78ufaeLxTgpudf/20KqyMioIUZJAezlTIi6evxuoUs9YXc11cU+yzQ==", + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.3.0.tgz", + "integrity": "sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==", "dev": true, "requires": { "p-try": "^2.0.0" @@ -8601,9 +9702,9 @@ "dev": true }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -8633,9 +9734,9 @@ "dev": true }, "yargs": { - "version": "15.3.0", - "resolved": "https://registry.npmjs.org/yargs/-/yargs-15.3.0.tgz", - "integrity": "sha512-g/QCnmjgOl1YJjGsnUg2SatC7NUYEiLXJqxNOQU9qSpjzGtGXda9b+OKccr1kLTy8BN9yqEyqfq5lxlwdc13TA==", + "version": "15.4.1", + "resolved": "https://registry.npmjs.org/yargs/-/yargs-15.4.1.tgz", + "integrity": "sha512-aePbxDmcYW++PaqBsJ+HYUFwCdv4LVvdnhBy78E57PIor8/OVvhMrADFFEDh8DHDFRv/O9i3lPhsENjO7QX0+A==", "dev": true, "requires": { "cliui": "^6.0.0", @@ -8648,13 +9749,13 @@ "string-width": "^4.2.0", "which-module": "^2.0.0", "y18n": "^4.0.0", - "yargs-parser": "^18.1.0" + "yargs-parser": "^18.1.2" } }, "yargs-parser": { - "version": "18.1.0", - "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-18.1.0.tgz", - "integrity": "sha512-o/Jr6JBOv6Yx3pL+5naWSoIA2jJ+ZkMYQG/ie9qFbukBe4uzmBatlXFOiu/tNKRWEtyf+n5w7jc/O16ufqOTdQ==", + "version": "18.1.3", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-18.1.3.tgz", + "integrity": "sha512-o50j0JeToy/4K6OZcaQmW6lyXXKhq7csREXcDwk2omFPJEwUNOVtJKvmDr9EI1fAJZUyZcRF7kxGBWmRXudrCQ==", "dev": true, "requires": { "camelcase": "^5.0.0", @@ -8664,39 +9765,51 @@ } }, "jest-serializer": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-serializer/-/jest-serializer-25.1.0.tgz", - "integrity": "sha512-20Wkq5j7o84kssBwvyuJ7Xhn7hdPeTXndnwIblKDR2/sy1SUm6rWWiG9kSCgJPIfkDScJCIsTtOKdlzfIHOfKA==", - "dev": true + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-serializer/-/jest-serializer-25.5.0.tgz", + "integrity": "sha512-LxD8fY1lByomEPflwur9o4e2a5twSQ7TaVNLlFUuToIdoJuBt8tzHfCsZ42Ok6LkKXWzFWf3AGmheuLAA7LcCA==", + "dev": true, + "requires": { + "graceful-fs": "^4.2.4" + }, + "dependencies": { + "graceful-fs": { + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", + "dev": true + } + } }, "jest-snapshot": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-snapshot/-/jest-snapshot-25.1.0.tgz", - "integrity": "sha512-xZ73dFYN8b/+X2hKLXz4VpBZGIAn7muD/DAg+pXtDzDGw3iIV10jM7WiHqhCcpDZfGiKEj7/2HXAEPtHTj0P2A==", + "version": "25.5.1", + "resolved": "https://registry.npmjs.org/jest-snapshot/-/jest-snapshot-25.5.1.tgz", + "integrity": "sha512-C02JE1TUe64p2v1auUJ2ze5vcuv32tkv9PyhEb318e8XOKF7MOyXdJ7kdjbvrp3ChPLU2usI7Rjxs97Dj5P0uQ==", "dev": true, "requires": { "@babel/types": "^7.0.0", - "@jest/types": "^25.1.0", + "@jest/types": "^25.5.0", + "@types/prettier": "^1.19.0", "chalk": "^3.0.0", - "expect": "^25.1.0", - "jest-diff": "^25.1.0", - "jest-get-type": "^25.1.0", - "jest-matcher-utils": "^25.1.0", - "jest-message-util": "^25.1.0", - "jest-resolve": "^25.1.0", - "mkdirp": "^0.5.1", + "expect": "^25.5.0", + "graceful-fs": "^4.2.4", + "jest-diff": "^25.5.0", + "jest-get-type": "^25.2.6", + "jest-matcher-utils": "^25.5.0", + "jest-message-util": "^25.5.0", + "jest-resolve": "^25.5.1", + "make-dir": "^3.0.0", "natural-compare": "^1.4.0", - "pretty-format": "^25.1.0", - "semver": "^7.1.1" + "pretty-format": "^25.5.0", + "semver": "^6.3.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -8725,22 +9838,31 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, + "graceful-fs": { + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", + "dev": true + }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", "dev": true }, - "semver": { - "version": "7.1.3", - "resolved": "https://registry.npmjs.org/semver/-/semver-7.1.3.tgz", - "integrity": "sha512-ekM0zfiA9SCBlsKa2X1hxyxiI4L3B6EbVJkkdgQXnSEEaHlGdvyodMruTiulSRWMMB4NeIuYNMC9rTKTz97GxA==", - "dev": true + "make-dir": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", + "integrity": "sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==", + "dev": true, + "requires": { + "semver": "^6.0.0" + } }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -8749,24 +9871,24 @@ } }, "jest-util": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-util/-/jest-util-25.1.0.tgz", - "integrity": "sha512-7did6pLQ++87Qsj26Fs/TIwZMUFBXQ+4XXSodRNy3luch2DnRXsSnmpVtxxQ0Yd6WTipGpbhh2IFP1mq6/fQGw==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-util/-/jest-util-25.5.0.tgz", + "integrity": "sha512-KVlX+WWg1zUTB9ktvhsg2PXZVdkI1NBevOJSkTKYAyXyH4QSvh+Lay/e/v+bmaFfrkfx43xD8QTfgobzlEXdIA==", "dev": true, "requires": { - "@jest/types": "^25.1.0", + "@jest/types": "^25.5.0", "chalk": "^3.0.0", + "graceful-fs": "^4.2.4", "is-ci": "^2.0.0", - "mkdirp": "^0.5.1" + "make-dir": "^3.0.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -8795,16 +9917,31 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, + "graceful-fs": { + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", + "dev": true + }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", "dev": true }, + "make-dir": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", + "integrity": "sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==", + "dev": true, + "requires": { + "semver": "^6.0.0" + } + }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -8813,26 +9950,25 @@ } }, "jest-validate": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-validate/-/jest-validate-25.1.0.tgz", - "integrity": "sha512-kGbZq1f02/zVO2+t1KQGSVoCTERc5XeObLwITqC6BTRH3Adv7NZdYqCpKIZLUgpLXf2yISzQ465qOZpul8abXA==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-validate/-/jest-validate-25.5.0.tgz", + "integrity": "sha512-okUFKqhZIpo3jDdtUXUZ2LxGUZJIlfdYBvZb1aczzxrlyMlqdnnws9MOxezoLGhSaFc2XYaHNReNQfj5zPIWyQ==", "dev": true, "requires": { - "@jest/types": "^25.1.0", + "@jest/types": "^25.5.0", "camelcase": "^5.3.1", "chalk": "^3.0.0", - "jest-get-type": "^25.1.0", + "jest-get-type": "^25.2.6", "leven": "^3.1.0", - "pretty-format": "^25.1.0" + "pretty-format": "^25.5.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -8874,9 +10010,9 @@ "dev": true }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -8885,26 +10021,25 @@ } }, "jest-watcher": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest-watcher/-/jest-watcher-25.1.0.tgz", - "integrity": "sha512-Q9eZ7pyaIr6xfU24OeTg4z1fUqBF/4MP6J801lyQfg7CsnZ/TCzAPvCfckKdL5dlBBEKBeHV0AdyjFZ5eWj4ig==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/jest-watcher/-/jest-watcher-25.5.0.tgz", + "integrity": "sha512-XrSfJnVASEl+5+bb51V0Q7WQx65dTSk7NL4yDdVjPnRNpM0hG+ncFmDYJo9O8jaSRcAitVbuVawyXCRoxGrT5Q==", "dev": true, "requires": { - "@jest/test-result": "^25.1.0", - "@jest/types": "^25.1.0", + "@jest/test-result": "^25.5.0", + "@jest/types": "^25.5.0", "ansi-escapes": "^4.2.1", "chalk": "^3.0.0", - "jest-util": "^25.1.0", + "jest-util": "^25.5.0", "string-length": "^3.1.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -8940,9 +10075,9 @@ "dev": true }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -9039,6 +10174,12 @@ "integrity": "sha512-mrqyZKfX5EhL7hvqcV6WG1yYjnjeuYDzDhhcAAUrq8Po85NBQBJP+ZDUT75qZQ98IkUoBqdkExkukOU7Ts2wrw==", "dev": true }, + "json-parse-even-better-errors": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/json-parse-even-better-errors/-/json-parse-even-better-errors-2.3.1.tgz", + "integrity": "sha512-xyFwyhro/JEof6Ghe2iz2NcXoj2sloNsWr/XsERDK/oiPCfaNhl5ONfp+jQdAZRQQ0IJWNzH9zIZF7li91kh2w==", + "dev": true + }, "json-schema": { "version": "0.2.3", "resolved": "https://registry.npmjs.org/json-schema/-/json-schema-0.2.3.tgz", @@ -9076,18 +10217,18 @@ "dev": true }, "json5": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/json5/-/json5-2.1.1.tgz", - "integrity": "sha512-l+3HXD0GEI3huGq1njuqtzYK8OYJyXMkOLtQ53pjWh89tvWS2h6l+1zMkYWqlb57+SiQodKZyvMEFb2X+KrFhQ==", + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/json5/-/json5-2.1.3.tgz", + "integrity": "sha512-KXPvOm8K9IJKFM0bmdn8QXh7udDh1g/giieX0NLCaMnb4hEiVFqnop2ImTXCc5e0/oHz3LTqmHGtExn5hfMkOA==", "dev": true, "requires": { - "minimist": "^1.2.0" + "minimist": "^1.2.5" }, "dependencies": { "minimist": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", - "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", + "version": "1.2.5", + "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", + "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==", "dev": true } } @@ -9203,6 +10344,12 @@ "resolve": "^1.1.7" } }, + "lines-and-columns": { + "version": "1.1.6", + "resolved": "https://registry.npmjs.org/lines-and-columns/-/lines-and-columns-1.1.6.tgz", + "integrity": "sha1-HADHQ7QzzQpOgHWPe2SldEDZ/wA=", + "dev": true + }, "load-json-file": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-1.1.0.tgz", @@ -9241,37 +10388,22 @@ "requires": { "minimist": "^1.2.0" } - }, - "minimist": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", - "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", - "dev": true } } }, "locate-path": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-2.0.0.tgz", - "integrity": "sha1-K1aLJl7slExtnA3pw9u7ygNUzY4=", + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-5.0.0.tgz", + "integrity": "sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==", "dev": true, "requires": { - "p-locate": "^2.0.0", - "path-exists": "^3.0.0" - }, - "dependencies": { - "path-exists": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", - "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", - "dev": true - } + "p-locate": "^4.1.0" } }, "lodash": { - "version": "4.17.15", - "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.15.tgz", - "integrity": "sha512-8xOcRHvCjnocdS5cpwXQXVzmmh5e5+saE2QGoeQmbKmRS6J3VQppPOIt0MnmE+4xlZoumy0GPG0D0MVIQbNA1A==", + "version": "4.17.20", + "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", + "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, "lodash._basecopy": { @@ -9349,6 +10481,12 @@ "integrity": "sha1-eeTriMNqgSKvhvhEqpvNhRtfu1U=", "dev": true }, + "lodash.ismatch": { + "version": "4.4.0", + "resolved": "https://registry.npmjs.org/lodash.ismatch/-/lodash.ismatch-4.4.0.tgz", + "integrity": "sha1-dWy1FQyjum8RCFp4hJZF8Yj4Xzc=", + "dev": true + }, "lodash.keys": { "version": "3.1.2", "resolved": "https://registry.npmjs.org/lodash.keys/-/lodash.keys-3.1.2.tgz", @@ -9392,9 +10530,9 @@ } }, "loglevel": { - "version": "1.6.7", - "resolved": "https://registry.npmjs.org/loglevel/-/loglevel-1.6.7.tgz", - "integrity": "sha512-cY2eLFrQSAfVPhCgH1s7JI73tMbg9YC3v3+ZHVW67sBS7UxWzNEk/ZBbSfLykBWHp33dqqtOv82gjhKEi81T/A==", + "version": "1.7.0", + "resolved": "https://registry.npmjs.org/loglevel/-/loglevel-1.7.0.tgz", + "integrity": "sha512-i2sY04nal5jDcagM3FMfG++T69GEEM8CYuOfeOIvmXzOIcwE9a/CJPR0MFM97pYMj/u10lzz7/zd7+qwhrBTqQ==", "dev": true }, "lolex": { @@ -9417,12 +10555,12 @@ } }, "lru-cache": { - "version": "5.1.1", - "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-5.1.1.tgz", - "integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==", + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-6.0.0.tgz", + "integrity": "sha512-Jo6dJ04CmSjuznwJSS3pUeWmd/H0ffTlkXXgwZi+eq1UCmqQwCh+eLsYOYCwY991i2Fah4h1BEMCx4qThGbsiA==", "dev": true, "requires": { - "yallist": "^3.0.2" + "yallist": "^4.0.0" } }, "make-dir": { @@ -9467,12 +10605,6 @@ "tmpl": "1.0.x" } }, - "mamacro": { - "version": "0.0.3", - "resolved": "https://registry.npmjs.org/mamacro/-/mamacro-0.0.3.tgz", - "integrity": "sha512-qMEwh+UujcQ+kbz3T6V+wAmO2U8veoq2w+3wY8MquqwVA3jChfwY+Tk52GZKDfACEPjuZ7r2oJLejwpt8jtwTA==", - "dev": true - }, "map-age-cleaner": { "version": "0.1.3", "resolved": "https://registry.npmjs.org/map-age-cleaner/-/map-age-cleaner-0.1.3.tgz", @@ -9601,9 +10733,9 @@ }, "dependencies": { "minimist": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", - "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", + "version": "1.2.5", + "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", + "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==", "dev": true } } @@ -9655,6 +10787,14 @@ "requires": { "bn.js": "^4.0.0", "brorand": "^1.0.1" + }, + "dependencies": { + "bn.js": { + "version": "4.11.9", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.9.tgz", + "integrity": "sha512-E6QoYqCKZfgatHTdHzs1RRKP7ip4vvm+EyRUeE2RF0NblwVvb0p6jSVeNTOFxPn26QXN2o6SMfNxKp6kU8zQaw==", + "dev": true + } } }, "mime": { @@ -9684,6 +10824,12 @@ "integrity": "sha512-OqbOk5oEQeAZ8WXWydlu9HJjz9WVdEIvamMCcXmuqUYjTknH/sqsWvhQ3vgwKFRR1HpjvNBKQ37nbJgYzGqGcg==", "dev": true }, + "min-indent": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/min-indent/-/min-indent-1.0.1.tgz", + "integrity": "sha512-I9jwMn07Sy/IwOj3zVkVik2JTvgpaykDZEigL6Rx6N9LbMywwUSMtxET+7lVoDLLd3O3IXwJwvuuns8UB/HeAg==", + "dev": true + }, "minimalistic-assert": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz", @@ -9706,19 +10852,20 @@ } }, "minimist": { - "version": "0.0.8", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-0.0.8.tgz", - "integrity": "sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=", + "version": "1.2.5", + "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", + "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==", "dev": true }, "minimist-options": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/minimist-options/-/minimist-options-3.0.2.tgz", - "integrity": "sha512-FyBrT/d0d4+uiZRbqznPXqw3IpZZG3gl3wKWiX784FycUKVwBt0uLBFkQrtE4tZOrgo78nZp2jnKz3L65T5LdQ==", + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/minimist-options/-/minimist-options-4.1.0.tgz", + "integrity": "sha512-Q4r8ghd80yhO/0j1O3B2BjweX3fiHg9cdOwjJd2J76Q135c+NDxGCqdYKQ1SKBuFfgWbAUzBfvYjPUEeNgqN1A==", "dev": true, "requires": { "arrify": "^1.0.1", - "is-plain-obj": "^1.1.0" + "is-plain-obj": "^1.1.0", + "kind-of": "^6.0.3" } }, "mississippi": { @@ -9773,12 +10920,20 @@ } }, "mkdirp": { - "version": "0.5.1", - "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz", - "integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=", + "version": "0.5.5", + "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.5.tgz", + "integrity": "sha512-NKmAlESf6jMGym1++R0Ra7wvhV+wFW63FaSOFPwRahvea0gMUcGUhVeAg/0BC0wiv9ih5NYPB1Wn1UEI1/L+xQ==", "dev": true, "requires": { - "minimist": "0.0.8" + "minimist": "^1.2.5" + }, + "dependencies": { + "minimist": { + "version": "1.2.5", + "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", + "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==", + "dev": true + } } }, "modify-values": { @@ -9883,9 +11038,9 @@ "dev": true }, "neo-async": { - "version": "2.6.1", - "resolved": "https://registry.npmjs.org/neo-async/-/neo-async-2.6.1.tgz", - "integrity": "sha512-iyam8fBuCUpWeKPGpaNMetEocMt364qkCsfL9JuhjXX6dRnguRVOfk2GZaDpPjcOKiiXCPINZC1GczQ7iTq3Zw==", + "version": "2.6.2", + "resolved": "https://registry.npmjs.org/neo-async/-/neo-async-2.6.2.tgz", + "integrity": "sha512-Yd3UES5mWCSqR+qNT93S3UoYUkqAZ9lLg8a7g9rimsWmYGK8cVToA4/sF3RrshdyV3sAGMXVUmpMYOw+dLpOuw==", "dev": true }, "next-tick": { @@ -9901,9 +11056,9 @@ "dev": true }, "node-forge": { - "version": "0.9.0", - "resolved": "https://registry.npmjs.org/node-forge/-/node-forge-0.9.0.tgz", - "integrity": "sha512-7ASaDa3pD+lJ3WvXFsxekJQelBKRpne+GOVbLbtHYdd7pFspyeuJHnWfLplGf3SwKGbfs/aYl5V/JCIaHVUKKQ==", + "version": "0.10.0", + "resolved": "https://registry.npmjs.org/node-forge/-/node-forge-0.10.0.tgz", + "integrity": "sha512-PPmu8eEeG9saEUvI97fm4OYxXVB6bFvyNTyiUOBichBpFG8A1Ljw3bY62+5oOjDEMHRnd0Y7HQ+x7uzxOzC6JA==", "dev": true }, "node-int64": { @@ -9972,11 +11127,14 @@ }, "dependencies": { "is-wsl": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-2.1.1.tgz", - "integrity": "sha512-umZHcSrwlDHo2TGMXv0DZ8dIUGunZ2Iv68YZnrmCiBPkZ4aaOhtv7pXJKeki9k3qJ3RJr0cDyitcl5wEH3AYog==", + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-2.2.0.tgz", + "integrity": "sha512-fKzAra0rGJUUBwGBgNkHZuToZcn+TtXHpeCgmkMJMMYx1sQDYaCSyjJBSCa2nH1DGm7s3n1oBnohoVTBaN7Lww==", "dev": true, - "optional": true + "optional": true, + "requires": { + "is-docker": "^2.0.0" + } } } }, @@ -10083,16 +11241,20 @@ } }, "object-inspect": { - "version": "1.7.0", - "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.7.0.tgz", - "integrity": "sha512-a7pEHdh1xKIAgTySUGgLMx/xwDZskN1Ud6egYYN3EdRW4ZMPNEDUTF+hwy2LUC+Bl+SyLXANnwz/jyh/qutKUw==", + "version": "1.8.0", + "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.8.0.tgz", + "integrity": "sha512-jLdtEOB112fORuypAyl/50VRVIBIdVQOSUUGQHzJ4xBSbit81zRarz7GThkEFZy1RceYrWYcPcBFPQwHyAc1gA==", "dev": true }, "object-is": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/object-is/-/object-is-1.0.2.tgz", - "integrity": "sha512-Epah+btZd5wrrfjkJZq1AOB9O6OxUQto45hzFd7lXGrpHPGE0W1k+426yrZV+k6NJOzLNNW/nVsmZdIWsAqoOQ==", - "dev": true + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/object-is/-/object-is-1.1.3.tgz", + "integrity": "sha512-teyqLvFWzLkq5B9ki8FVWA902UER2qkxmdA4nLf+wjOLAWgxzCWZNCxpDq9MvE8MmhWNr+I8w3BN49Vx36Y6Xg==", + "dev": true, + "requires": { + "define-properties": "^1.1.3", + "es-abstract": "^1.18.0-next.1" + } }, "object-keys": { "version": "1.1.1", @@ -10133,16 +11295,6 @@ "isobject": "^3.0.0" } }, - "object.getownpropertydescriptors": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/object.getownpropertydescriptors/-/object.getownpropertydescriptors-2.1.0.tgz", - "integrity": "sha512-Z53Oah9A3TdLoblT7VKJaTDdXdT+lQO+cNpKVnya5JDe9uLvzu1YyY1yFDFrcxrlRgWrEFH0jJtD/IbuwjcEVg==", - "dev": true, - "requires": { - "define-properties": "^1.1.3", - "es-abstract": "^1.17.0-next.1" - } - }, "object.map": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/object.map/-/object.map-1.0.1.tgz", @@ -10220,16 +11372,6 @@ "is-wsl": "^1.1.0" } }, - "optimist": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/optimist/-/optimist-0.6.1.tgz", - "integrity": "sha1-2j6nRob6IaGaERwybpDrFaAZZoY=", - "dev": true, - "requires": { - "minimist": "~0.0.1", - "wordwrap": "~0.0.2" - } - }, "optionator": { "version": "0.8.3", "resolved": "https://registry.npmjs.org/optionator/-/optionator-0.8.3.tgz", @@ -10290,9 +11432,9 @@ "dev": true }, "p-each-series": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/p-each-series/-/p-each-series-2.1.0.tgz", - "integrity": "sha512-ZuRs1miPT4HrjFa+9fRfOFXxGJfORgelKV9f9nNOWw2gl6gVsRaVDOQP0+MI0G0wGKns1Yacsu0GjOFbTK0JFQ==", + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/p-each-series/-/p-each-series-2.2.0.tgz", + "integrity": "sha512-ycIL2+1V32th+8scbpTvyHNaHe02z0sjgh91XXjAk+ZeXoPN4Z46DVUnzdso0aX4KckKw0FNNFHdjZ2UsZvxiA==", "dev": true }, "p-finally": { @@ -10308,21 +11450,21 @@ "dev": true }, "p-limit": { - "version": "1.3.0", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-1.3.0.tgz", - "integrity": "sha512-vvcXsLAJ9Dr5rQOPk7toZQZJApBl2K4J6dANSsEuh6QI41JYcsS/qhTGa9ErIUUgK3WNQoJYvylxvjqmiqEA9Q==", + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.3.0.tgz", + "integrity": "sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==", "dev": true, "requires": { - "p-try": "^1.0.0" + "p-try": "^2.0.0" } }, "p-locate": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-2.0.0.tgz", - "integrity": "sha1-IKAQOyIqcMj9OcwuWAaA893l7EM=", + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-4.1.0.tgz", + "integrity": "sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==", "dev": true, "requires": { - "p-limit": "^1.1.0" + "p-limit": "^2.2.0" } }, "p-map": { @@ -10341,9 +11483,9 @@ } }, "p-try": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/p-try/-/p-try-1.0.0.tgz", - "integrity": "sha1-y8ec26+P1CKOE/Yh8rGiN8GyB7M=", + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", + "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", "dev": true }, "pako": { @@ -10373,14 +11515,13 @@ } }, "parse-asn1": { - "version": "5.1.5", - "resolved": "https://registry.npmjs.org/parse-asn1/-/parse-asn1-5.1.5.tgz", - "integrity": "sha512-jkMYn1dcJqF6d5CpU689bq7w/b5ALS9ROVSpQDPrZsqqesUJii9qutvoT5ltGedNXMO2e16YUWIghG9KxaViTQ==", + "version": "5.1.6", + "resolved": "https://registry.npmjs.org/parse-asn1/-/parse-asn1-5.1.6.tgz", + "integrity": "sha512-RnZRo1EPU6JBnra2vGHj0yhp6ebyjBZpmUCLHWiFhxlzvBCCpAuZ7elsBp1PVAbQN0/04VD/19rfzlBSwLstMw==", "dev": true, "requires": { - "asn1.js": "^4.0.0", + "asn1.js": "^5.2.0", "browserify-aes": "^1.0.0", - "create-hash": "^1.1.0", "evp_bytestokey": "^1.0.0", "pbkdf2": "^3.0.3", "safe-buffer": "^5.1.1" @@ -10520,9 +11661,9 @@ } }, "pbkdf2": { - "version": "3.0.17", - "resolved": "https://registry.npmjs.org/pbkdf2/-/pbkdf2-3.0.17.tgz", - "integrity": "sha512-U/il5MsrZp7mGg3mSQfn742na2T+1/vHDCG5/iTI3X9MKUuYUZVLQhyRsg06mCgDBTd57TxzgZt7P+fYfjRLtA==", + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/pbkdf2/-/pbkdf2-3.1.1.tgz", + "integrity": "sha512-4Ejy1OPxi9f2tt1rRV7Go7zmfDQ+ZectEQz3VGUQhgq62HtIRPDyG/JtnwIxs6x3uNMwo2V7q1fMvKjb+Tnpqg==", "dev": true, "requires": { "create-hash": "^1.1.2", @@ -10539,9 +11680,9 @@ "dev": true }, "picomatch": { - "version": "2.2.1", - "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.2.1.tgz", - "integrity": "sha512-ISBaA8xQNmwELC7eOjqFKMESB2VIqt4PPDD0nsS95b/9dZXvVKOlz9keMSnoGGKcOHXfTvDD6WMaRoSc9UuhRA==", + "version": "2.2.2", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.2.2.tgz", + "integrity": "sha512-q0M/9eZHzmr0AulXyPwNfZjtwZ/RBZlbN3K3CErVrk50T2ASYI7Bye0EvekFY3IP1Nt2DHu0re+V2ZHIpMkuWg==", "dev": true }, "pify": { @@ -10745,20 +11886,20 @@ "dev": true }, "portfinder": { - "version": "1.0.25", - "resolved": "https://registry.npmjs.org/portfinder/-/portfinder-1.0.25.tgz", - "integrity": "sha512-6ElJnHBbxVA1XSLgBp7G1FiCkQdlqGzuF7DswL5tcea+E8UpuvPU7beVAjjRwCioTS9ZluNbu+ZyRvgTsmqEBg==", + "version": "1.0.28", + "resolved": "https://registry.npmjs.org/portfinder/-/portfinder-1.0.28.tgz", + "integrity": "sha512-Se+2isanIcEqf2XMHjyUKskczxbPH7dQnlMjXX6+dybayyHvAf/TCgyMRlzf/B6QDhAEFOGes0pzRo3by4AbMA==", "dev": true, "requires": { "async": "^2.6.2", "debug": "^3.1.1", - "mkdirp": "^0.5.1" + "mkdirp": "^0.5.5" }, "dependencies": { "debug": { - "version": "3.2.6", - "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.6.tgz", - "integrity": "sha512-mel+jf7nrtEl5Pn1Qx46zARXKDpBbvzezse7p7LqINmdoIk8PYP5SySaxEmYv6TZ0JyEKA1hsCId6DIhgITtWQ==", + "version": "3.2.7", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.7.tgz", + "integrity": "sha512-CFjzYYAi4ThfiQvizrFQevTTXHtnCqWfe7x1AhgEscTz6ZbLbfoLRLPugTQyBth6f8ZERVUSyWHFD/7Wu4t1XQ==", "dev": true, "requires": { "ms": "^2.1.1" @@ -10779,24 +11920,23 @@ "dev": true }, "pretty-format": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/pretty-format/-/pretty-format-25.1.0.tgz", - "integrity": "sha512-46zLRSGLd02Rp+Lhad9zzuNZ+swunitn8zIpfD2B4OPCRLXbM87RJT2aBLBWYOznNUML/2l/ReMyWNC80PJBUQ==", + "version": "25.5.0", + "resolved": "https://registry.npmjs.org/pretty-format/-/pretty-format-25.5.0.tgz", + "integrity": "sha512-kbo/kq2LQ/A/is0PQwsEHM7Ca6//bGPPvU6UnsdDRSKTWxT/ru/xb88v4BJf6a69H+uTytOEsTusT9ksd/1iWQ==", "dev": true, "requires": { - "@jest/types": "^25.1.0", + "@jest/types": "^25.5.0", "ansi-regex": "^5.0.0", "ansi-styles": "^4.0.0", "react-is": "^16.12.0" }, "dependencies": { "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, @@ -10847,16 +11987,6 @@ "integrity": "sha1-mEcocL8igTL8vdhoEputEsPAKeM=", "dev": true }, - "prompts": { - "version": "2.3.1", - "resolved": "https://registry.npmjs.org/prompts/-/prompts-2.3.1.tgz", - "integrity": "sha512-qIP2lQyCwYbdzcqHIUi2HAxiWixhoM9OdLCWf8txXsapC/X9YdsCoeyRIXE/GP+Q0J37Q7+XN/MFqbUa7IzXNA==", - "dev": true, - "requires": { - "kleur": "^3.0.3", - "sisteransi": "^1.0.4" - } - }, "proxy-addr": { "version": "2.0.6", "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.6.tgz", @@ -10874,9 +12004,9 @@ "dev": true }, "psl": { - "version": "1.7.0", - "resolved": "https://registry.npmjs.org/psl/-/psl-1.7.0.tgz", - "integrity": "sha512-5NsSEDv8zY70ScRnOTn7bK7eanl2MvFrOrS/R6x+dBt5g1ghnj9Zv90kO8GwT8gxcu2ANyFprnFYB85IogIJOQ==", + "version": "1.8.0", + "resolved": "https://registry.npmjs.org/psl/-/psl-1.8.0.tgz", + "integrity": "sha512-RIdOzyoavK+hA18OGGWDqUTsCLhtA7IcZ/6NCs4fFJaHBDab+pDDmDIByWFRQJq2Cd7r1OoQxBGKOaztq+hjIQ==", "dev": true }, "public-encrypt": { @@ -10891,6 +12021,14 @@ "parse-asn1": "^5.0.0", "randombytes": "^2.0.1", "safe-buffer": "^5.1.2" + }, + "dependencies": { + "bn.js": { + "version": "4.11.9", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.9.tgz", + "integrity": "sha512-E6QoYqCKZfgatHTdHzs1RRKP7ip4vvm+EyRUeE2RF0NblwVvb0p6jSVeNTOFxPn26QXN2o6SMfNxKp6kU8zQaw==", + "dev": true + } } }, "pump": { @@ -10945,15 +12083,15 @@ "dev": true }, "querystringify": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/querystringify/-/querystringify-2.1.1.tgz", - "integrity": "sha512-w7fLxIRCRT7U8Qu53jQnJyPkYZIaR4n5151KMfcJlO/A9397Wxb1amJvROTK6TOnp7PfoAmg/qXiNHI+08jRfA==", + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/querystringify/-/querystringify-2.2.0.tgz", + "integrity": "sha512-FIqgj2EUvTa7R50u0rGsyTftzjYmv/a3hO345bZNrqabNqjtgiDMgmo4mkUjd+nzU5oF3dClKqFIPUKybUyqoQ==", "dev": true }, "quick-lru": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/quick-lru/-/quick-lru-1.1.0.tgz", - "integrity": "sha1-Q2CxfGETatOAeDl/8RQW4Ybc+7g=", + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/quick-lru/-/quick-lru-4.0.1.tgz", + "integrity": "sha512-ARhCpm70fzdcvNQfPoy49IaanKkTlRWF2JMzqhcJbhSFRZv7nPTvZJdcY7301IPmvW+/p0RgIWnQDLJxifsQ7g==", "dev": true }, "randombytes": { @@ -11002,9 +12140,9 @@ } }, "react-is": { - "version": "16.13.0", - "resolved": "https://registry.npmjs.org/react-is/-/react-is-16.13.0.tgz", - "integrity": "sha512-GFMtL0vHkiBv9HluwNZTggSn/sCyEt9n02aM0dSAjGGyqyNlAyftYm4phPxdvCigG15JreC5biwxCgTAJZ7yAA==", + "version": "16.13.1", + "resolved": "https://registry.npmjs.org/react-is/-/react-is-16.13.1.tgz", + "integrity": "sha512-24e6ynE2H+OKt4kqsOvNd8kBpV65zoxbA4BVsEOB3ARVWQki/DHzaUoC5KuON/BiccDaCCTZBuOcfZs70kR8bQ==", "dev": true }, "read-pkg": { @@ -11055,13 +12193,10 @@ } }, "realpath-native": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/realpath-native/-/realpath-native-1.1.0.tgz", - "integrity": "sha512-wlgPA6cCIIg9gKz0fgAPjnzh4yR/LnXovwuo9hvyGvx3h8nX4+/iLZplfUWasXpqD8BdnGnP5njOFjkUwPzvjA==", - "dev": true, - "requires": { - "util.promisify": "^1.0.0" - } + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/realpath-native/-/realpath-native-2.0.0.tgz", + "integrity": "sha512-v1SEYUOXXdbBZK8ZuNgO4TBjamPsiSgcFr0aP+tEKpQZK8vooEUqV6nm6Cv502mX4NF2EfsnVqtNAHG+/6Ur1Q==", + "dev": true }, "rechoir": { "version": "0.6.2", @@ -11103,33 +12238,22 @@ }, "dependencies": { "es-abstract": { - "version": "1.17.4", - "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.17.4.tgz", - "integrity": "sha512-Ae3um/gb8F0mui/jPL+QiqmglkUsaQf7FwBEHYIFkztkneosu9imhqHpBzQ3h1vit8t5iQ74t6PEVvphBZiuiQ==", + "version": "1.17.7", + "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.17.7.tgz", + "integrity": "sha512-VBl/gnfcJ7OercKA9MVaegWsBHFjV492syMudcnQZvt/Dw8ezpcOHYZXa/J96O8vx+g4x65YKhxOwDUh63aS5g==", "dev": true, "requires": { "es-to-primitive": "^1.2.1", "function-bind": "^1.1.1", "has": "^1.0.3", "has-symbols": "^1.0.1", - "is-callable": "^1.1.5", - "is-regex": "^1.0.5", - "object-inspect": "^1.7.0", + "is-callable": "^1.2.2", + "is-regex": "^1.1.1", + "object-inspect": "^1.8.0", "object-keys": "^1.1.1", - "object.assign": "^4.1.0", - "string.prototype.trimleft": "^2.1.1", - "string.prototype.trimright": "^2.1.1" - } - }, - "es-to-primitive": { - "version": "1.2.1", - "resolved": "https://registry.npmjs.org/es-to-primitive/-/es-to-primitive-1.2.1.tgz", - "integrity": "sha512-QCOllgZJtaUo9miYBcLChTUaHNjJF3PYs1VidD7AwiEj1kYxKeQTctLAezAOH5ZKRH0g2IgPn6KwB4IT8iRpvA==", - "dev": true, - "requires": { - "is-callable": "^1.1.4", - "is-date-object": "^1.0.1", - "is-symbol": "^1.0.2" + "object.assign": "^4.1.1", + "string.prototype.trimend": "^1.0.1", + "string.prototype.trimstart": "^1.0.1" } }, "has-symbols": { @@ -11138,45 +12262,16 @@ "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", "dev": true }, - "is-callable": { - "version": "1.1.5", - "resolved": "https://registry.npmjs.org/is-callable/-/is-callable-1.1.5.tgz", - "integrity": "sha512-ESKv5sMCJB2jnHTWZ3O5itG+O128Hsus4K4Qh1h2/cgn2vbgnLSVqfV46AeJA9D5EeeLa9w81KUXMtn34zhX+Q==", - "dev": true - }, - "is-regex": { - "version": "1.0.5", - "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.0.5.tgz", - "integrity": "sha512-vlKW17SNq44owv5AQR3Cq0bQPEb8+kF3UKZ2fiZNOWtztYE5i0CzCZxFDwO58qAOWtxdBRVO/V5Qin1wjCqFYQ==", - "dev": true, - "requires": { - "has": "^1.0.3" - } - }, - "object-inspect": { - "version": "1.7.0", - "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.7.0.tgz", - "integrity": "sha512-a7pEHdh1xKIAgTySUGgLMx/xwDZskN1Ud6egYYN3EdRW4ZMPNEDUTF+hwy2LUC+Bl+SyLXANnwz/jyh/qutKUw==", - "dev": true - }, - "string.prototype.trimleft": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/string.prototype.trimleft/-/string.prototype.trimleft-2.1.1.tgz", - "integrity": "sha512-iu2AGd3PuP5Rp7x2kEZCrB2Nf41ehzh+goo8TV7z8/XDBbsvc6HQIlUl9RjkZ4oyrW1XM5UwlGl1oVEaDjg6Ag==", + "object.assign": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.2.tgz", + "integrity": "sha512-ixT2L5THXsApyiUPYKmW+2EHpXXe5Ii3M+f4e+aJFAHao5amFRW6J0OO6c/LU8Be47utCx2GL89hxGB6XSmKuQ==", "dev": true, "requires": { + "call-bind": "^1.0.0", "define-properties": "^1.1.3", - "function-bind": "^1.1.1" - } - }, - "string.prototype.trimright": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/string.prototype.trimright/-/string.prototype.trimright-2.1.1.tgz", - "integrity": "sha512-qFvWL3/+QIgZXVmJBfpHmxLB7xsUXz6HsUmP8+5dRaC3Q7oKUv9Vo6aMCRZC1smrtyECFsIT30PqBJ1gTjAs+g==", - "dev": true, - "requires": { - "define-properties": "^1.1.3", - "function-bind": "^1.1.1" + "has-symbols": "^1.0.1", + "object-keys": "^1.1.1" } } } @@ -11293,21 +12388,21 @@ } }, "request-promise-core": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/request-promise-core/-/request-promise-core-1.1.3.tgz", - "integrity": "sha512-QIs2+ArIGQVp5ZYbWD5ZLCY29D5CfWizP8eWnm8FoGD1TX61veauETVQbrV60662V0oFBkrDOuaBI8XgtuyYAQ==", + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/request-promise-core/-/request-promise-core-1.1.4.tgz", + "integrity": "sha512-TTbAfBBRdWD7aNNOoVOBH4pN/KigV6LyapYNNlAPA8JwbovRti1E88m3sYAwsLi5ryhPKsE9APwnjFTgdUjTpw==", "dev": true, "requires": { - "lodash": "^4.17.15" + "lodash": "^4.17.19" } }, "request-promise-native": { - "version": "1.0.8", - "resolved": "https://registry.npmjs.org/request-promise-native/-/request-promise-native-1.0.8.tgz", - "integrity": "sha512-dapwLGqkHtwL5AEbfenuzjTYg35Jd6KPytsC2/TLkVMz8rm+tNt72MGUWT1RP/aYawMpN6HqbNGBQaRcBtjQMQ==", + "version": "1.0.9", + "resolved": "https://registry.npmjs.org/request-promise-native/-/request-promise-native-1.0.9.tgz", + "integrity": "sha512-wcW+sIUiWnKgNY0dqCpOZkUbF/I+YPi+f09JZIDa39Ec+q82CpSYniDp+ISgTTbKmnpJWASeJBPZmoxH84wt3g==", "dev": true, "requires": { - "request-promise-core": "1.1.3", + "request-promise-core": "1.1.4", "stealthy-require": "^1.1.1", "tough-cookie": "^2.3.3" }, @@ -11471,13 +12566,56 @@ } }, "run-sequence": { - "version": "1.2.2", - "resolved": "https://registry.npmjs.org/run-sequence/-/run-sequence-1.2.2.tgz", - "integrity": "sha1-UJWgvr6YczsBQL0I3YDsAw3azes=", + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/run-sequence/-/run-sequence-2.2.1.tgz", + "integrity": "sha512-qkzZnQWMZjcKbh3CNly2srtrkaO/2H/SI5f2eliMCapdRD3UhMrwjfOAZJAnZ2H8Ju4aBzFZkBGXUqFs9V0yxw==", "dev": true, "requires": { - "chalk": "*", - "gulp-util": "*" + "chalk": "^1.1.3", + "fancy-log": "^1.3.2", + "plugin-error": "^0.1.2" + }, + "dependencies": { + "ansi-regex": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", + "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", + "dev": true + }, + "ansi-styles": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz", + "integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=", + "dev": true + }, + "chalk": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz", + "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=", + "dev": true, + "requires": { + "ansi-styles": "^2.2.1", + "escape-string-regexp": "^1.0.2", + "has-ansi": "^2.0.0", + "strip-ansi": "^3.0.0", + "supports-color": "^2.0.0" + } + }, + "strip-ansi": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", + "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", + "dev": true, + "requires": { + "ansi-regex": "^2.0.0" + } + }, + "supports-color": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz", + "integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=", + "dev": true + } } }, "rxjs": { @@ -11528,9 +12666,9 @@ }, "dependencies": { "minimist": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", - "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", + "version": "1.2.5", + "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", + "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==", "dev": true } } @@ -11562,12 +12700,12 @@ "dev": true }, "selfsigned": { - "version": "1.10.7", - "resolved": "https://registry.npmjs.org/selfsigned/-/selfsigned-1.10.7.tgz", - "integrity": "sha512-8M3wBCzeWIJnQfl43IKwOmC4H/RAp50S8DF60znzjW5GVqTcSe2vWclt7hmYVPkKPlHWOu5EaWOMZ2Y6W8ZXTA==", + "version": "1.10.8", + "resolved": "https://registry.npmjs.org/selfsigned/-/selfsigned-1.10.8.tgz", + "integrity": "sha512-2P4PtieJeEwVgTU9QEcwIRDQ/mXJLX8/+I3ur+Pg16nS8oNbrGxEso9NyYWy8NAmXiNl4dlAp5MwoNeCWzON4w==", "dev": true, "requires": { - "node-forge": "0.9.0" + "node-forge": "^0.10.0" } }, "semver": { @@ -11632,10 +12770,13 @@ } }, "serialize-javascript": { - "version": "2.1.2", - "resolved": "https://registry.npmjs.org/serialize-javascript/-/serialize-javascript-2.1.2.tgz", - "integrity": "sha512-rs9OggEUF0V4jUSecXazOYsLfu7OGK2qIn3c7IPBiffz32XniEp/TX9Xmc9LQfK2nQ2QKHvZ2oygKUGU0lG4jQ==", - "dev": true + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/serialize-javascript/-/serialize-javascript-4.0.0.tgz", + "integrity": "sha512-GaNA54380uFefWghODBWEGisLZFj00nS5ACs6yHa9nLqlLpVLO8ChDGeKRjZnV4Nh4n0Qi7nhYZD/9fCPzEqkw==", + "dev": true, + "requires": { + "randombytes": "^2.1.0" + } }, "serve-index": { "version": "1.9.1", @@ -11771,6 +12912,17 @@ "integrity": "sha1-2kL0l0DAtC2yypcoVxyxkMmO/qM=", "dev": true }, + "shelljs": { + "version": "0.8.4", + "resolved": "https://registry.npmjs.org/shelljs/-/shelljs-0.8.4.tgz", + "integrity": "sha512-7gk3UZ9kOfPLIAbslLzyWeGiEqx9e3rxwZM0KE6EL8GlGwjym9Mrlx5/p33bWTu9YG6vcS4MBxYZDHYr5lr8BQ==", + "dev": true, + "requires": { + "glob": "^7.0.0", + "interpret": "^1.0.0", + "rechoir": "^0.6.2" + } + }, "shellwords": { "version": "0.1.1", "resolved": "https://registry.npmjs.org/shellwords/-/shellwords-0.1.1.tgz", @@ -11785,9 +12937,9 @@ "dev": true }, "sisteransi": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/sisteransi/-/sisteransi-1.0.4.tgz", - "integrity": "sha512-/ekMoM4NJ59ivGSfKapeG+FWtrmWvA1p6FBZwXrqojw90vJu8lBmrTxCMuBCydKtkaUe2zt4PlxeTKpjwMbyig==", + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/sisteransi/-/sisteransi-1.0.5.tgz", + "integrity": "sha512-bLGGlR1QxBcynn2d5YmDX4MGjlZvy2MRBDRNHLJ8VI6l6+9FUiyTFNJ0IveOSP0bcXgVDPRcfGqA0pjaqUpfVg==", "dev": true }, "slash": { @@ -11930,13 +13082,22 @@ } }, "sockjs": { - "version": "0.3.19", - "resolved": "https://registry.npmjs.org/sockjs/-/sockjs-0.3.19.tgz", - "integrity": "sha512-V48klKZl8T6MzatbLlzzRNhMepEys9Y4oGFpypBFFn1gLI/QQ9HtLLyWJNbPlwGLelOVOEijUbTTJeLLI59jLw==", + "version": "0.3.20", + "resolved": "https://registry.npmjs.org/sockjs/-/sockjs-0.3.20.tgz", + "integrity": "sha512-SpmVOVpdq0DJc0qArhF3E5xsxvaiqGNb73XfgBpK1y3UD5gs8DSo8aCTsuT5pX8rssdc2NDIzANwP9eCAiSdTA==", "dev": true, "requires": { "faye-websocket": "^0.10.0", - "uuid": "^3.0.1" + "uuid": "^3.4.0", + "websocket-driver": "0.6.5" + }, + "dependencies": { + "uuid": { + "version": "3.4.0", + "resolved": "https://registry.npmjs.org/uuid/-/uuid-3.4.0.tgz", + "integrity": "sha512-HjSDRw6gZE5JMggctHBcjVak08+KEVhSIiDzFnT9S9aegmp85S/bReBVTb4QTFaRNptJ9kuYaNhnbNEOkbKb/A==", + "dev": true + } } }, "sockjs-client": { @@ -11954,9 +13115,9 @@ }, "dependencies": { "debug": { - "version": "3.2.6", - "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.6.tgz", - "integrity": "sha512-mel+jf7nrtEl5Pn1Qx46zARXKDpBbvzezse7p7LqINmdoIk8PYP5SySaxEmYv6TZ0JyEKA1hsCId6DIhgITtWQ==", + "version": "3.2.7", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.7.tgz", + "integrity": "sha512-CFjzYYAi4ThfiQvizrFQevTTXHtnCqWfe7x1AhgEscTz6ZbLbfoLRLPugTQyBth6f8ZERVUSyWHFD/7Wu4t1XQ==", "dev": true, "requires": { "ms": "^2.1.1" @@ -12061,9 +13222,9 @@ "dev": true }, "spdy": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/spdy/-/spdy-4.0.1.tgz", - "integrity": "sha512-HeZS3PBdMA+sZSu0qwpCxl3DeALD5ASx8pAX0jZdKXSpPWbQ6SYGnlg3BBmYLx5LtiZrmkAZfErCm2oECBcioA==", + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/spdy/-/spdy-4.0.2.tgz", + "integrity": "sha512-r46gZQZQV+Kl9oItvl1JZZqJKGr+oEkB08A6BzkiR7593/7IbtuncXHd2YoYeTsG4157ZssMu9KYvUHLcjcDoA==", "dev": true, "requires": { "debug": "^4.1.0", @@ -12166,10 +13327,21 @@ "dev": true }, "stack-utils": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/stack-utils/-/stack-utils-1.0.2.tgz", - "integrity": "sha512-MTX+MeG5U994cazkjd/9KNAapsHnibjMLnfXodlkXw76JEea0UiNzrqidzo1emMwk7w5Qhc9jd4Bn9TBb1MFwA==", - "dev": true + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/stack-utils/-/stack-utils-1.0.3.tgz", + "integrity": "sha512-WldO+YmqhEpjp23eHZRhOT1NQF51STsbxZ+/AdpFD+EhheFxAe5d0WoK4DQVJkSHacPrJJX3OqRAl9CgHf78pg==", + "dev": true, + "requires": { + "escape-string-regexp": "^2.0.0" + }, + "dependencies": { + "escape-string-regexp": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-2.0.0.tgz", + "integrity": "sha512-UpzcLCXolUWcNu5HtVMHYdXJjArjsF9C0aNnquZYY4uW/Vu0miy5YoWvbV345HauVvcAUnpRuhMMcqTcGOY2+w==", + "dev": true + } + } }, "static-extend": { "version": "0.1.2", @@ -12299,24 +13471,24 @@ } } }, - "string.prototype.trimleft": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/string.prototype.trimleft/-/string.prototype.trimleft-2.1.1.tgz", - "integrity": "sha512-iu2AGd3PuP5Rp7x2kEZCrB2Nf41ehzh+goo8TV7z8/XDBbsvc6HQIlUl9RjkZ4oyrW1XM5UwlGl1oVEaDjg6Ag==", + "string.prototype.trimend": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/string.prototype.trimend/-/string.prototype.trimend-1.0.3.tgz", + "integrity": "sha512-ayH0pB+uf0U28CtjlLvL7NaohvR1amUvVZk+y3DYb0Ey2PUV5zPkkKy9+U1ndVEIXO8hNg18eIv9Jntbii+dKw==", "dev": true, "requires": { - "define-properties": "^1.1.3", - "function-bind": "^1.1.1" + "call-bind": "^1.0.0", + "define-properties": "^1.1.3" } }, - "string.prototype.trimright": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/string.prototype.trimright/-/string.prototype.trimright-2.1.1.tgz", - "integrity": "sha512-qFvWL3/+QIgZXVmJBfpHmxLB7xsUXz6HsUmP8+5dRaC3Q7oKUv9Vo6aMCRZC1smrtyECFsIT30PqBJ1gTjAs+g==", + "string.prototype.trimstart": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/string.prototype.trimstart/-/string.prototype.trimstart-1.0.3.tgz", + "integrity": "sha512-oBIBUy5lea5tt0ovtOFiEQaBkoBBkyJhZXzJYrSmDo5IUUqbOPvVezuRs/agBIdZ2p2Eo1FD6bD9USyBLfl3xg==", "dev": true, "requires": { - "define-properties": "^1.1.3", - "function-bind": "^1.1.1" + "call-bind": "^1.0.0", + "define-properties": "^1.1.3" } }, "string_decoder": { @@ -12426,9 +13598,9 @@ "dev": true }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" @@ -12494,9 +13666,9 @@ } }, "terser": { - "version": "4.6.6", - "resolved": "https://registry.npmjs.org/terser/-/terser-4.6.6.tgz", - "integrity": "sha512-4lYPyeNmstjIIESr/ysHg2vUPRGf2tzF9z2yYwnowXVuVzLEamPN1Gfrz7f8I9uEPuHcbFlW4PLIAsJoxXyJ1g==", + "version": "4.8.0", + "resolved": "https://registry.npmjs.org/terser/-/terser-4.8.0.tgz", + "integrity": "sha512-EAPipTNeWsb/3wLPeup1tVPaXfIaU68xMnVdPafIL1TV05OhASArYyIfFvnvJCNrR2NIOvDVNNTFRa+Re2MWyw==", "dev": true, "requires": { "commander": "^2.20.0", @@ -12513,16 +13685,16 @@ } }, "terser-webpack-plugin": { - "version": "1.4.3", - "resolved": "https://registry.npmjs.org/terser-webpack-plugin/-/terser-webpack-plugin-1.4.3.tgz", - "integrity": "sha512-QMxecFz/gHQwteWwSo5nTc6UaICqN1bMedC5sMtUc7y3Ha3Q8y6ZO0iCR8pq4RJC8Hjf0FEPEHZqcMB/+DFCrA==", + "version": "1.4.5", + "resolved": "https://registry.npmjs.org/terser-webpack-plugin/-/terser-webpack-plugin-1.4.5.tgz", + "integrity": "sha512-04Rfe496lN8EYruwi6oPQkG0vo8C+HT49X687FZnpPF0qMAIHONI6HEXYPKDOE8e5HjXTyKfqRd/agHtH0kOtw==", "dev": true, "requires": { "cacache": "^12.0.2", "find-cache-dir": "^2.1.0", "is-wsl": "^1.1.0", "schema-utils": "^1.0.0", - "serialize-javascript": "^2.1.2", + "serialize-javascript": "^4.0.0", "source-map": "^0.6.1", "terser": "^4.1.2", "webpack-sources": "^1.4.0", @@ -12605,9 +13777,9 @@ "dev": true }, "timers-browserify": { - "version": "2.0.11", - "resolved": "https://registry.npmjs.org/timers-browserify/-/timers-browserify-2.0.11.tgz", - "integrity": "sha512-60aV6sgJ5YEbzUdn9c8kYGIqOubPoUdqQCul3SBAsRCZ40s6Y5cMcrW4dt3/k/EsbLVJNl9n6Vz3fTc+k2GeKQ==", + "version": "2.0.12", + "resolved": "https://registry.npmjs.org/timers-browserify/-/timers-browserify-2.0.12.tgz", + "integrity": "sha512-9phl76Cqm6FhSX9Xe1ZUAMLtm1BLkKj2Qd5ApyWkXzsMRaA7dgr81kf4wJmQf/hAvg8EEyJxDo3du/0KlhPiKQ==", "dev": true, "requires": { "setimmediate": "^1.0.4" @@ -12819,31 +13991,11 @@ } }, "uglify-js": { - "version": "3.8.0", - "resolved": "https://registry.npmjs.org/uglify-js/-/uglify-js-3.8.0.tgz", - "integrity": "sha512-ugNSTT8ierCsDHso2jkBHXYrU8Y5/fY2ZUprfrJUiD7YpuFvV4jODLFmb3h4btQjqr5Nh4TX4XtgDfCU1WdioQ==", + "version": "3.12.0", + "resolved": "https://registry.npmjs.org/uglify-js/-/uglify-js-3.12.0.tgz", + "integrity": "sha512-8lBMSkFZuAK7gGF8LswsXmir8eX8d2AAMOnxSDWjKBx/fBR6MypQjs78m6ML9zQVp1/hD4TBdfeMZMC7nW1TAA==", "dev": true, - "optional": true, - "requires": { - "commander": "~2.20.3", - "source-map": "~0.6.1" - }, - "dependencies": { - "commander": { - "version": "2.20.3", - "resolved": "https://registry.npmjs.org/commander/-/commander-2.20.3.tgz", - "integrity": "sha512-GpVkmM8vF2vQUkj2LvZmD35JxeJOLCwJ9cUkugyk2nuhbv3+mJvpLYYt+0+USMxE+oj+ey/lJEnhZw75x/OMcQ==", - "dev": true, - "optional": true - }, - "source-map": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", - "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", - "dev": true, - "optional": true - } - } + "optional": true }, "unc-path-regex": { "version": "0.1.2", @@ -13038,26 +14190,6 @@ "integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=", "dev": true }, - "util.promisify": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/util.promisify/-/util.promisify-1.0.1.tgz", - "integrity": "sha512-g9JpC/3He3bm38zsLupWryXHoEcS22YHthuPQSJdMy6KNrzIRzWqcsHzD/WUnqe45whVou4VIsPew37DoXWNrA==", - "dev": true, - "requires": { - "define-properties": "^1.1.3", - "es-abstract": "^1.17.2", - "has-symbols": "^1.0.1", - "object.getownpropertydescriptors": "^2.1.0" - }, - "dependencies": { - "has-symbols": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz", - "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", - "dev": true - } - } - }, "utils-merge": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz", @@ -13077,9 +14209,9 @@ "dev": true }, "v8-to-istanbul": { - "version": "4.1.2", - "resolved": "https://registry.npmjs.org/v8-to-istanbul/-/v8-to-istanbul-4.1.2.tgz", - "integrity": "sha512-G9R+Hpw0ITAmPSr47lSlc5A1uekSYzXxTMlFxso2xoffwo4jQnzbv1p9yXIinO8UMZKfAFewaCHwWvnH4Jb4Ug==", + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/v8-to-istanbul/-/v8-to-istanbul-4.1.4.tgz", + "integrity": "sha512-Rw6vJHj1mbdK8edjR7+zuJrpDtKIgNdAvTSAcpYfgMIw+u2dPDntD3dgN4XQFLU2/fvFQdzj+EeSGfd/jnY5fQ==", "dev": true, "requires": { "@types/istanbul-lib-coverage": "^2.0.1", @@ -13227,14 +14359,133 @@ } }, "watchpack": { - "version": "1.6.0", - "resolved": "https://registry.npmjs.org/watchpack/-/watchpack-1.6.0.tgz", - "integrity": "sha512-i6dHe3EyLjMmDlU1/bGQpEw25XSjkJULPuAVKCbNRefQVq48yXKUpwg538F7AZTf9kyr57zj++pQFltUa5H7yA==", + "version": "1.7.5", + "resolved": "https://registry.npmjs.org/watchpack/-/watchpack-1.7.5.tgz", + "integrity": "sha512-9P3MWk6SrKjHsGkLT2KHXdQ/9SNkyoJbabxnKOoJepsvJjJG8uYTR3yTPxPQvNDI3w4Nz1xnE0TLHK4RIVe/MQ==", "dev": true, "requires": { - "chokidar": "^2.0.2", + "chokidar": "^3.4.1", "graceful-fs": "^4.1.2", - "neo-async": "^2.5.0" + "neo-async": "^2.5.0", + "watchpack-chokidar2": "^2.0.1" + }, + "dependencies": { + "anymatch": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.1.tgz", + "integrity": "sha512-mM8522psRCqzV+6LhomX5wgp25YVibjh8Wj23I5RPkPppSVSjyKD2A2mBJmWGa+KN7f2D6LNh9jkBCeyLktzjg==", + "dev": true, + "optional": true, + "requires": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + } + }, + "binary-extensions": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.1.0.tgz", + "integrity": "sha512-1Yj8h9Q+QDF5FzhMs/c9+6UntbD5MkRfRwac8DoEm9ZfUBZ7tZ55YcGVAzEe4bXsdQHEk+s9S5wsOKVdZrw0tQ==", + "dev": true, + "optional": true + }, + "braces": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", + "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", + "dev": true, + "optional": true, + "requires": { + "fill-range": "^7.0.1" + } + }, + "chokidar": { + "version": "3.4.3", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.4.3.tgz", + "integrity": "sha512-DtM3g7juCXQxFVSNPNByEC2+NImtBuxQQvWlHunpJIS5Ocr0lG306cC7FCi7cEA0fzmybPUIl4txBIobk1gGOQ==", + "dev": true, + "optional": true, + "requires": { + "anymatch": "~3.1.1", + "braces": "~3.0.2", + "fsevents": "~2.1.2", + "glob-parent": "~5.1.0", + "is-binary-path": "~2.1.0", + "is-glob": "~4.0.1", + "normalize-path": "~3.0.0", + "readdirp": "~3.5.0" + } + }, + "fill-range": { + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", + "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", + "dev": true, + "optional": true, + "requires": { + "to-regex-range": "^5.0.1" + } + }, + "fsevents": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.1.3.tgz", + "integrity": "sha512-Auw9a4AxqWpa9GUfj370BMPzzyncfBABW8Mab7BGWBYDj4Isgq+cDKtx0i6u9jcX9pQDnswsaaOTgTmA5pEjuQ==", + "dev": true, + "optional": true + }, + "is-binary-path": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", + "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", + "dev": true, + "optional": true, + "requires": { + "binary-extensions": "^2.0.0" + } + }, + "is-number": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", + "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", + "dev": true, + "optional": true + }, + "normalize-path": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", + "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", + "dev": true, + "optional": true + }, + "readdirp": { + "version": "3.5.0", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.5.0.tgz", + "integrity": "sha512-cMhu7c/8rdhkHXWsY+osBhfSy0JikwpHK/5+imo+LpeasTF8ouErHrlYkwT0++njiyuDvc7OFY5T3ukvZ8qmFQ==", + "dev": true, + "optional": true, + "requires": { + "picomatch": "^2.2.1" + } + }, + "to-regex-range": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", + "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", + "dev": true, + "optional": true, + "requires": { + "is-number": "^7.0.0" + } + } + } + }, + "watchpack-chokidar2": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/watchpack-chokidar2/-/watchpack-chokidar2-2.0.1.tgz", + "integrity": "sha512-nCFfBIPKr5Sh61s4LPpy1Wtfi0HE8isJ3d2Yb5/Ppw2P2B/3eVSEBjKfN0fmHJSK14+31KwMKmcrzs2GM4P0Ww==", + "dev": true, + "optional": true, + "requires": { + "chokidar": "^2.1.8" } }, "wbuf": { @@ -13253,40 +14504,40 @@ "dev": true }, "webpack": { - "version": "4.42.0", - "resolved": "https://registry.npmjs.org/webpack/-/webpack-4.42.0.tgz", - "integrity": "sha512-EzJRHvwQyBiYrYqhyjW9AqM90dE4+s1/XtCfn7uWg6cS72zH+2VPFAlsnW0+W0cDi0XRjNKUMoJtpSi50+Ph6w==", + "version": "4.44.2", + "resolved": "https://registry.npmjs.org/webpack/-/webpack-4.44.2.tgz", + "integrity": "sha512-6KJVGlCxYdISyurpQ0IPTklv+DULv05rs2hseIXer6D7KrUicRDLFb4IUM1S6LUAKypPM/nSiVSuv8jHu1m3/Q==", "dev": true, "requires": { - "@webassemblyjs/ast": "1.8.5", - "@webassemblyjs/helper-module-context": "1.8.5", - "@webassemblyjs/wasm-edit": "1.8.5", - "@webassemblyjs/wasm-parser": "1.8.5", - "acorn": "^6.2.1", + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/helper-module-context": "1.9.0", + "@webassemblyjs/wasm-edit": "1.9.0", + "@webassemblyjs/wasm-parser": "1.9.0", + "acorn": "^6.4.1", "ajv": "^6.10.2", "ajv-keywords": "^3.4.1", "chrome-trace-event": "^1.0.2", - "enhanced-resolve": "^4.1.0", + "enhanced-resolve": "^4.3.0", "eslint-scope": "^4.0.3", "json-parse-better-errors": "^1.0.2", "loader-runner": "^2.4.0", "loader-utils": "^1.2.3", "memory-fs": "^0.4.1", "micromatch": "^3.1.10", - "mkdirp": "^0.5.1", + "mkdirp": "^0.5.3", "neo-async": "^2.6.1", "node-libs-browser": "^2.2.1", "schema-utils": "^1.0.0", "tapable": "^1.1.3", "terser-webpack-plugin": "^1.4.3", - "watchpack": "^1.6.0", + "watchpack": "^1.7.4", "webpack-sources": "^1.4.1" }, "dependencies": { "acorn": { - "version": "6.4.1", - "resolved": "https://registry.npmjs.org/acorn/-/acorn-6.4.1.tgz", - "integrity": "sha512-ZVA9k326Nwrj3Cj9jlh3wGFutC2ZornPNARZwsNYqQYgN0EsV2d53w5RN/co65Ohn4sUAUtb1rSUAOD6XN9idA==", + "version": "6.4.2", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-6.4.2.tgz", + "integrity": "sha512-XtGIhXwF8YM8bJhGxG5kXgjkEuNGLTkoYqVE+KMR+aspr4KGYmKYg7yUe3KghyQ9yheNwLnjmzh/7+gfDBmHCQ==", "dev": true }, "eslint-scope": { @@ -13436,8 +14687,7 @@ }, "minimist": { "version": "1.2.0", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", - "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", + "resolved": "", "dev": true }, "os-locale": { @@ -13556,9 +14806,9 @@ } }, "yargs-parser": { - "version": "13.1.1", - "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-13.1.1.tgz", - "integrity": "sha512-oVAVsHz6uFrg3XQheFII8ESO2ssAf9luWuAd6Wexsu4F3OtIW0o8IribPXYrD4WC24LWtPrJlGy87y5udK+dxQ==", + "version": "13.1.2", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-13.1.2.tgz", + "integrity": "sha512-3lbsNRf/j+A4QuSZfDRA7HRSfWrzO0YjqTJd5kjAq37Zep1CEgaYmrH9Q3GwPiB9cHyd1Y1UwggGhJGoxipbzg==", "dev": true, "requires": { "camelcase": "^5.0.0", @@ -13581,17 +14831,17 @@ }, "dependencies": { "mime": { - "version": "2.4.4", - "resolved": "https://registry.npmjs.org/mime/-/mime-2.4.4.tgz", - "integrity": "sha512-LRxmNwziLPT828z+4YkNzloCFC2YM4wrB99k+AV5ZbEyfGNWfG8SO1FUXLmLDBSo89NrJZ4DIWeLjy1CHGhMGA==", + "version": "2.4.6", + "resolved": "https://registry.npmjs.org/mime/-/mime-2.4.6.tgz", + "integrity": "sha512-RZKhC3EmpBchfTGBVb8fb+RL2cWyw/32lshnsETttkBAyAUXSGHxbEJWWRXc751DrIxG1q04b8QwMbAwkRPpUA==", "dev": true } } }, "webpack-dev-server": { - "version": "3.10.3", - "resolved": "https://registry.npmjs.org/webpack-dev-server/-/webpack-dev-server-3.10.3.tgz", - "integrity": "sha512-e4nWev8YzEVNdOMcNzNeCN947sWJNd43E5XvsJzbAL08kGc2frm1tQ32hTJslRS+H65LCb/AaUCYU7fjHCpDeQ==", + "version": "3.11.0", + "resolved": "https://registry.npmjs.org/webpack-dev-server/-/webpack-dev-server-3.11.0.tgz", + "integrity": "sha512-PUxZ+oSTxogFQgkTtFndEtJIPNmml7ExwufBZ9L2/Xyyd5PnOL5UreWe5ZT7IU25DSdykL9p1MLQzmLh2ljSeg==", "dev": true, "requires": { "ansi-html": "0.0.7", @@ -13602,31 +14852,31 @@ "debug": "^4.1.1", "del": "^4.1.1", "express": "^4.17.1", - "html-entities": "^1.2.1", + "html-entities": "^1.3.1", "http-proxy-middleware": "0.19.1", "import-local": "^2.0.0", "internal-ip": "^4.3.0", "ip": "^1.1.5", "is-absolute-url": "^3.0.3", "killable": "^1.0.1", - "loglevel": "^1.6.6", + "loglevel": "^1.6.8", "opn": "^5.5.0", "p-retry": "^3.0.1", - "portfinder": "^1.0.25", + "portfinder": "^1.0.26", "schema-utils": "^1.0.0", "selfsigned": "^1.10.7", "semver": "^6.3.0", "serve-index": "^1.9.1", - "sockjs": "0.3.19", + "sockjs": "0.3.20", "sockjs-client": "1.4.0", - "spdy": "^4.0.1", + "spdy": "^4.0.2", "strip-ansi": "^3.0.1", "supports-color": "^6.1.0", "url": "^0.11.0", "webpack-dev-middleware": "^3.7.2", "webpack-log": "^2.0.0", "ws": "^6.2.1", - "yargs": "12.0.5" + "yargs": "^13.3.2" }, "dependencies": { "ansi-regex": { @@ -13642,29 +14892,29 @@ "dev": true }, "cliui": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/cliui/-/cliui-4.1.0.tgz", - "integrity": "sha512-4FG+RSG9DL7uEwRUZXZn3SS34DiDPfzP0VOiEwtUWlE+AR2EIg+hSyvrIgUUfhdgR/UkAeW2QHgeP+hWrXs7jQ==", + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/cliui/-/cliui-5.0.0.tgz", + "integrity": "sha512-PYeGSEmmHM6zvoef2w8TPzlrnNpXIjTipYK780YswmIP9vjxmd6Y2a3CB2Ks6/AU8NHjZugXvo8w3oWM2qnwXA==", "dev": true, "requires": { - "string-width": "^2.1.1", - "strip-ansi": "^4.0.0", - "wrap-ansi": "^2.0.0" + "string-width": "^3.1.0", + "strip-ansi": "^5.2.0", + "wrap-ansi": "^5.1.0" }, "dependencies": { "ansi-regex": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-3.0.0.tgz", - "integrity": "sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=", + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", + "integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==", "dev": true }, "strip-ansi": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz", - "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=", + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", + "integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", "dev": true, "requires": { - "ansi-regex": "^3.0.0" + "ansi-regex": "^4.1.0" } } } @@ -13678,21 +14928,12 @@ "locate-path": "^3.0.0" } }, - "invert-kv": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/invert-kv/-/invert-kv-2.0.0.tgz", - "integrity": "sha512-wPVv/y/QQ/Uiirj/vh3oP+1Ww+AWehmi1g5fFWGPF6IpCBCDVrhgHRMvrLfdYcwDh3QJbGXDW4JAuzxElLSqKA==", + "get-caller-file": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz", + "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==", "dev": true }, - "lcid": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/lcid/-/lcid-2.0.0.tgz", - "integrity": "sha512-avPEb8P8EGnwXKClwsNUgryVjllcRqtMYa49NTsbQagYuT1DcXnl1915oxWjoyGrXR6zH/Y0Zc96xWsPcoDKeA==", - "dev": true, - "requires": { - "invert-kv": "^2.0.0" - } - }, "locate-path": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz", @@ -13703,26 +14944,6 @@ "path-exists": "^3.0.0" } }, - "os-locale": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/os-locale/-/os-locale-3.1.0.tgz", - "integrity": "sha512-Z8l3R4wYWM40/52Z+S265okfFj8Kt2cC2MKY+xNi3kFs+XGI7WXu/I309QQQYbRW4ijiZ+yxs9pqEhJh0DqW3Q==", - "dev": true, - "requires": { - "execa": "^1.0.0", - "lcid": "^2.0.0", - "mem": "^4.0.0" - } - }, - "p-limit": { - "version": "2.2.2", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.2.2.tgz", - "integrity": "sha512-WGR+xHecKTr7EbUEhyLSh5Dube9JtdiG78ufaeLxTgpudf/20KqyMioIUZJAezlTIi6evxuoUs9YXc11cU+yzQ==", - "dev": true, - "requires": { - "p-try": "^2.0.0" - } - }, "p-locate": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz", @@ -13732,41 +14953,53 @@ "p-limit": "^2.0.0" } }, - "p-try": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", - "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", - "dev": true - }, "path-exists": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", "dev": true }, - "string-width": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz", - "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==", + "require-main-filename": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", + "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==", + "dev": true + }, + "schema-utils": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", + "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", "dev": true, "requires": { + "ajv": "^6.1.0", + "ajv-errors": "^1.0.0", + "ajv-keywords": "^3.1.0" + } + }, + "string-width": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-3.1.0.tgz", + "integrity": "sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w==", + "dev": true, + "requires": { + "emoji-regex": "^7.0.1", "is-fullwidth-code-point": "^2.0.0", - "strip-ansi": "^4.0.0" + "strip-ansi": "^5.1.0" }, "dependencies": { "ansi-regex": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-3.0.0.tgz", - "integrity": "sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=", + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", + "integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==", "dev": true }, "strip-ansi": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz", - "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=", + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", + "integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", "dev": true, "requires": { - "ansi-regex": "^3.0.0" + "ansi-regex": "^4.1.0" } } } @@ -13795,6 +15028,34 @@ "integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho=", "dev": true }, + "wrap-ansi": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-5.1.0.tgz", + "integrity": "sha512-QC1/iN/2/RPVJ5jYK8BGttj5z83LmSKmvbvrXPNCLZSEb32KKVDJDl/MOt2N01qU2H/FkzEa9PKto1BqDjtd7Q==", + "dev": true, + "requires": { + "ansi-styles": "^3.2.0", + "string-width": "^3.0.0", + "strip-ansi": "^5.0.0" + }, + "dependencies": { + "ansi-regex": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", + "integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==", + "dev": true + }, + "strip-ansi": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", + "integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", + "dev": true, + "requires": { + "ansi-regex": "^4.1.0" + } + } + } + }, "ws": { "version": "6.2.1", "resolved": "https://registry.npmjs.org/ws/-/ws-6.2.1.tgz", @@ -13804,30 +15065,34 @@ "async-limiter": "~1.0.0" } }, + "y18n": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz", + "integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==", + "dev": true + }, "yargs": { - "version": "12.0.5", - "resolved": "https://registry.npmjs.org/yargs/-/yargs-12.0.5.tgz", - "integrity": "sha512-Lhz8TLaYnxq/2ObqHDql8dX8CJi97oHxrjUcYtzKbbykPtVW9WB+poxI+NM2UIzsMgNCZTIf0AQwsjK5yMAqZw==", + "version": "13.3.2", + "resolved": "https://registry.npmjs.org/yargs/-/yargs-13.3.2.tgz", + "integrity": "sha512-AX3Zw5iPruN5ie6xGRIDgqkT+ZhnRlZMLMHAs8tg7nRruy2Nb+i5o9bwghAogtM08q1dpr2LVoS8KSTMYpWXUw==", "dev": true, "requires": { - "cliui": "^4.0.0", - "decamelize": "^1.2.0", + "cliui": "^5.0.0", "find-up": "^3.0.0", - "get-caller-file": "^1.0.1", - "os-locale": "^3.0.0", + "get-caller-file": "^2.0.1", "require-directory": "^2.1.1", - "require-main-filename": "^1.0.1", + "require-main-filename": "^2.0.0", "set-blocking": "^2.0.0", - "string-width": "^2.0.0", + "string-width": "^3.0.0", "which-module": "^2.0.0", - "y18n": "^3.2.1 || ^4.0.0", - "yargs-parser": "^11.1.1" + "y18n": "^4.0.0", + "yargs-parser": "^13.1.2" } }, "yargs-parser": { - "version": "11.1.1", - "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-11.1.1.tgz", - "integrity": "sha512-C6kB/WJDiaxONLJQnF8ccx9SEeoTTLek8RVbaOIsrAUS8VrBEXfmeSnCZxygc+XC2sNMBIwOOnfcxiynjHsVSQ==", + "version": "13.1.2", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-13.1.2.tgz", + "integrity": "sha512-3lbsNRf/j+A4QuSZfDRA7HRSfWrzO0YjqTJd5kjAq37Zep1CEgaYmrH9Q3GwPiB9cHyd1Y1UwggGhJGoxipbzg==", "dev": true, "requires": { "camelcase": "^5.0.0", @@ -13873,20 +15138,18 @@ } }, "websocket-driver": { - "version": "0.7.3", - "resolved": "https://registry.npmjs.org/websocket-driver/-/websocket-driver-0.7.3.tgz", - "integrity": "sha512-bpxWlvbbB459Mlipc5GBzzZwhoZgGEZLuqPaR0INBGnPAY1vdBX6hPnoFXiw+3yWxDuHyQjO2oXTMyS8A5haFg==", + "version": "0.6.5", + "resolved": "https://registry.npmjs.org/websocket-driver/-/websocket-driver-0.6.5.tgz", + "integrity": "sha1-XLJVbOuF9Dc8bYI4qmkchFThOjY=", "dev": true, "requires": { - "http-parser-js": ">=0.4.0 <0.4.11", - "safe-buffer": ">=5.1.0", "websocket-extensions": ">=0.1.1" } }, "websocket-extensions": { - "version": "0.1.3", - "resolved": "https://registry.npmjs.org/websocket-extensions/-/websocket-extensions-0.1.3.tgz", - "integrity": "sha512-nqHUnMXmBzT0w570r2JpJxfiSD1IzoI+HGVdd3aZ0yNi3ngvQ4jv1dtHt5VGxfI2yj5yqImPhOK4vmIh2xMbGg==", + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/websocket-extensions/-/websocket-extensions-0.1.4.tgz", + "integrity": "sha512-OqedPIGOfsDlo31UNwYbCFMSaO9m9G/0faIHj5/dZFDMFqPTcx6UwqyOy3COEaEOg/9VsGIpdqn62W5KhoKSpg==", "dev": true }, "whatwg-encoding": { @@ -13937,9 +15200,9 @@ "dev": true }, "wordwrap": { - "version": "0.0.3", - "resolved": "https://registry.npmjs.org/wordwrap/-/wordwrap-0.0.3.tgz", - "integrity": "sha1-o9XabNXAvAAI03I0u68b7WMFkQc=", + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/wordwrap/-/wordwrap-1.0.0.tgz", + "integrity": "sha1-J1hIEIkUVqQXHI0CJkQa3pDLyus=", "dev": true }, "worker-farm": { @@ -14026,9 +15289,9 @@ } }, "ws": { - "version": "7.2.3", - "resolved": "https://registry.npmjs.org/ws/-/ws-7.2.3.tgz", - "integrity": "sha512-HTDl9G9hbkNDk98naoR/cHDws7+EyYMOdL1BmjsZXRUjf7d+MficC4B7HLUPlSiho0vg+CWKrGIt/VJBd1xunQ==", + "version": "7.4.0", + "resolved": "https://registry.npmjs.org/ws/-/ws-7.4.0.tgz", + "integrity": "sha512-kyFwXuV/5ymf+IXhS6f0+eAFvydbaBW3zjpT6hUdAh/hbVjTIB5EHBGi0bPoCLSK2wcuz3BrEkB9LrYv1Nm4NQ==", "dev": true }, "xml-name-validator": { @@ -14056,9 +15319,9 @@ "dev": true }, "yallist": { - "version": "3.1.1", - "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", - "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==", + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-4.0.0.tgz", + "integrity": "sha512-3wdGidZyq5PB084XLES5TpOSRA3wjXAlIWMhum2kRcv/41Sn2emQ0dycQW4uZXLejwKvg6EsvbdlVL+FYEct7A==", "dev": true }, "yargs": { diff --git a/package.json b/package.json index 3f17539..c7a5940 100644 --- a/package.json +++ b/package.json @@ -23,16 +23,16 @@ "eslint": "^6.8.0", "gulp": "^4.0.2", "gulp-bump": "^2.6.1", - "gulp-conventional-changelog": "^1.1.0", + "gulp-conventional-changelog": "^2.0.35", "gulp-tag-version": "^1.3.0", "gulp-util": "^3.0.8", "jest": "^25.1.0", "jest-worker": "^24.9.0", "json-stringify-pretty-compact": "^2.0.0", - "run-sequence": "^1.1.4", - "webpack": "^4.42.0", + "run-sequence": "^2.2.1", + "webpack": "^4.44.2", "webpack-cli": "^3.3.11", - "webpack-dev-server": "^3.10.3" + "webpack-dev-server": "^3.11.0" }, "scripts": { "dev": "webpack-dev-server --watch-content-base", From ceb7cd54e164950c5dd3626d6954db14021c3593 Mon Sep 17 00:00:00 2001 From: liabru Date: Tue, 24 Nov 2020 23:26:20 +0000 Subject: [PATCH 03/23] added browser tests --- CONTRIBUTING.md | 18 ++- demo/js/Demo.js | 2 + package-lock.json | 285 ++++++++++++++++++++++++++++++++++++++++++- package.json | 10 +- test/Browser.spec.js | 90 ++++++++++++++ 5 files changed, 397 insertions(+), 8 deletions(-) create mode 100644 test/Browser.spec.js diff --git a/CONTRIBUTING.md b/CONTRIBUTING.md index 242a4bb..386aa5a 100644 --- a/CONTRIBUTING.md +++ b/CONTRIBUTING.md @@ -6,7 +6,7 @@ By providing any kind of contribution to this project, **you must agree and be l ## Contributions -Contributions by pull request or issues are welcome. Please ensure they follow the same style and architecture as the rest of the code. Use `npm run lint` before submitting. Please **do not include** any changes to the files in the `build` directory. +Contributions by pull request or issues are welcome. Please ensure they follow the same style and architecture as the rest of the code. Use `npm run lint` and see [Testing](#Testing) below before submitting. Please **do not include** any changes to the files in the `build` directory. Before contributing please read the license agreement described at the beginning of this document. @@ -22,6 +22,16 @@ which will install the required build dependencies, then run which will run the development server and opens `http://localhost:8000/` in your browser. Any changes you make to the source will automatically rebuild and reload the page. +## Testing + +All contributions should pass when running the commands + +- `npm run lint` +- `npm run test` +- `npm run test-browser` + +The output of `npm run test` also includes a [comparison report](https://github.com/liabru/matter-js/pull/794), which highlights changes in results, performance and accuracy against the last release build. + ## Commands The following development commands can be run at the terminal @@ -33,8 +43,8 @@ creates a release build - **npm run lint** runs the linter - **npm run test** -runs the tests -- **npm run compare** -compares the output of examples for current source against release build +runs the tests and compares results +- **npm run test-browser** +runs the browser tests - **npm run doc** builds the documentation diff --git a/demo/js/Demo.js b/demo/js/Demo.js index c99888c..3c580c4 100644 --- a/demo/js/Demo.js +++ b/demo/js/Demo.js @@ -99,6 +99,8 @@ examples: examples }); + window.MatterDemo = demo; + document.body.appendChild(demo.dom.root); MatterTools.Demo.start(demo); diff --git a/package-lock.json b/package-lock.json index 5aa80fc..f0803c8 100644 --- a/package-lock.json +++ b/package-lock.json @@ -1114,6 +1114,16 @@ "integrity": "sha512-FA/BWv8t8ZWJ+gEOnLLd8ygxH/2UFbAvgEonyfN6yWGLKc7zVjbpl2Y4CTjid9h2RfgPP6SEt6uHwEOply00yw==", "dev": true }, + "@types/yauzl": { + "version": "2.9.1", + "resolved": "https://registry.npmjs.org/@types/yauzl/-/yauzl-2.9.1.tgz", + "integrity": "sha512-A1b8SU4D10uoPjwb0lnHmmu8wZhR9d+9o2PKBQT2jU5YPTKsxac6M2qGAdY7VcL+dHHhARVUDmeg0rOrcd9EjA==", + "dev": true, + "optional": true, + "requires": { + "@types/node": "*" + } + }, "@webassemblyjs/ast": { "version": "1.9.0", "resolved": "https://registry.npmjs.org/@webassemblyjs/ast/-/ast-1.9.0.tgz", @@ -1369,6 +1379,12 @@ "integrity": "sha1-anmQQ3ynNtXhKI25K9MmbV9csqo=", "dev": true }, + "agent-base": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/agent-base/-/agent-base-5.1.1.tgz", + "integrity": "sha512-TMeqbNl2fMW0nMjTEPOwe3J/PRFP4vqeoNuQMG0HlMrtm5QxKqdvAkZ1pRBQ/ulIyDD5Yq0nJ7YbdD8ey0TO3g==", + "dev": true + }, "ajv": { "version": "6.10.2", "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.10.2.tgz", @@ -2061,6 +2077,40 @@ "integrity": "sha512-Un7MIEDdUC5gNpcGDV97op1Ywk748MpHcFTHoYs6qnj1Z3j7I53VG3nwZhKzoBZmbdRNnb6WRdFlwl7tSDuZGw==", "dev": true }, + "bl": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/bl/-/bl-4.0.3.tgz", + "integrity": "sha512-fs4G6/Hu4/EE+F75J8DuN/0IpQqNjAdC7aEQv7Qt8MHGUH7Ckv2MwTEEeN9QehD0pfIDkMI1bkHYkKy7xHyKIg==", + "dev": true, + "requires": { + "buffer": "^5.5.0", + "inherits": "^2.0.4", + "readable-stream": "^3.4.0" + }, + "dependencies": { + "buffer": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/buffer/-/buffer-5.7.1.tgz", + "integrity": "sha512-EHcyIPBQ4BSGlvjB16k5KgAJ27CIsHY/2JBmCRReo48y9rQ3MaUzWX3KVlBa4U7MyX02HdVj0K7C3WaB3ju7FQ==", + "dev": true, + "requires": { + "base64-js": "^1.3.1", + "ieee754": "^1.1.13" + } + }, + "readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "dev": true, + "requires": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + } + } + } + }, "bluebird": { "version": "3.7.2", "resolved": "https://registry.npmjs.org/bluebird/-/bluebird-3.7.2.tgz", @@ -2314,6 +2364,12 @@ "isarray": "^1.0.0" } }, + "buffer-crc32": { + "version": "0.2.13", + "resolved": "https://registry.npmjs.org/buffer-crc32/-/buffer-crc32-0.2.13.tgz", + "integrity": "sha1-DTM+PwDqxQqhRUq9MO+MKl2ackI=", + "dev": true + }, "buffer-equal": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/buffer-equal/-/buffer-equal-1.0.0.tgz", @@ -4191,6 +4247,12 @@ "integrity": "sha512-ZIzRpLJrOj7jjP2miAtgqIfmzbxa4ZOr5jJc601zklsfEx9oTzmmj2nVpIPRpNlRTIh8lc1kyViIY7BWSGNmKw==", "dev": true }, + "devtools-protocol": { + "version": "0.0.818844", + "resolved": "https://registry.npmjs.org/devtools-protocol/-/devtools-protocol-0.0.818844.tgz", + "integrity": "sha512-AD1hi7iVJ8OD0aMLQU5VK0XH9LDlA1+BcPIgrAxPfaibx2DbWucuyOhc4oyQCbnvDDO68nN6/LcKfqTP343Jjg==", + "dev": true + }, "diff-sequences": { "version": "25.2.6", "resolved": "https://registry.npmjs.org/diff-sequences/-/diff-sequences-25.2.6.tgz", @@ -5042,6 +5104,39 @@ } } }, + "extract-zip": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extract-zip/-/extract-zip-2.0.1.tgz", + "integrity": "sha512-GDhU9ntwuKyGXdZBUgTIe+vXnWj0fppUEtMDL0+idd5Sta8TGpHssn/eusA9mrPr9qNDym6SxAYZjNvCn/9RBg==", + "dev": true, + "requires": { + "@types/yauzl": "^2.9.1", + "debug": "^4.1.1", + "get-stream": "^5.1.0", + "yauzl": "^2.10.0" + }, + "dependencies": { + "get-stream": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-5.2.0.tgz", + "integrity": "sha512-nBF+F1rAZVCu/p7rjzgA+Yb4lfYXrpl7a6VmJrU8wF9I1CKvP/QwPNZHnOlwbTkY6dvtFIzFMSyQXbLoTQPRpA==", + "dev": true, + "requires": { + "pump": "^3.0.0" + } + }, + "pump": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz", + "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", + "dev": true, + "requires": { + "end-of-stream": "^1.1.0", + "once": "^1.3.1" + } + } + } + }, "extsprintf": { "version": "1.3.0", "resolved": "https://registry.npmjs.org/extsprintf/-/extsprintf-1.3.0.tgz", @@ -5096,6 +5191,15 @@ "bser": "2.1.1" } }, + "fd-slicer": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/fd-slicer/-/fd-slicer-1.1.0.tgz", + "integrity": "sha1-JcfInLH5B3+IkbvmHY85Dq4lbx4=", + "dev": true, + "requires": { + "pend": "~1.2.0" + } + }, "figgy-pudding": { "version": "3.5.2", "resolved": "https://registry.npmjs.org/figgy-pudding/-/figgy-pudding-3.5.2.tgz", @@ -5332,6 +5436,12 @@ "readable-stream": "^2.0.0" } }, + "fs-constants": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/fs-constants/-/fs-constants-1.0.0.tgz", + "integrity": "sha512-y6OAwoSIf7FyjMIv94u+b5rdheZEjzR63GTyZJm5qh4Bi+2YgwLCcI/fPFZkL5PSixOt6ZNKm+w+Hfp/Bciwow==", + "dev": true + }, "fs-mkdirp-stream": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/fs-mkdirp-stream/-/fs-mkdirp-stream-1.0.0.tgz", @@ -7251,6 +7361,16 @@ "integrity": "sha1-7AbBDgo0wPL68Zn3/X/Hj//QPHM=", "dev": true }, + "https-proxy-agent": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/https-proxy-agent/-/https-proxy-agent-4.0.0.tgz", + "integrity": "sha512-zoDhWrkR3of1l9QAL8/scJZyLu8j/gBkcwcaQOZh7Gyh/+uJQzGVETdgT30akuwkpL8HTRfssqI3BZuV18teDg==", + "dev": true, + "requires": { + "agent-base": "5", + "debug": "4" + } + }, "human-signals": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/human-signals/-/human-signals-1.1.1.tgz", @@ -10936,6 +11056,12 @@ } } }, + "mkdirp-classic": { + "version": "0.5.3", + "resolved": "https://registry.npmjs.org/mkdirp-classic/-/mkdirp-classic-0.5.3.tgz", + "integrity": "sha512-gKLcREMhtuZRwRAfqP3RFW+TK4JqApVBtOIftVgjuABpAtpxhPGaDcfvbhNvD0B8iD1oUr/txX35NjcaY6Ns/A==", + "dev": true + }, "modify-values": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/modify-values/-/modify-values-1.0.1.tgz", @@ -11055,6 +11181,12 @@ "integrity": "sha512-1nh45deeb5olNY7eX82BkPO7SSxR5SSYJiPTrTdFUVYwAl8CKMA5N9PjTYkHiRjisVcxcQ1HXdLhx2qxxJzLNQ==", "dev": true }, + "node-fetch": { + "version": "2.6.1", + "resolved": "https://registry.npmjs.org/node-fetch/-/node-fetch-2.6.1.tgz", + "integrity": "sha512-V4aYg89jEoVRxRb2fJdAg8FHvI7cEyYdVAh94HH0UIK8oJxUfkjlDQN9RbMx+bEjP7+ggMiFRprSti032Oipxw==", + "dev": true + }, "node-forge": { "version": "0.10.0", "resolved": "https://registry.npmjs.org/node-forge/-/node-forge-0.10.0.tgz", @@ -11673,6 +11805,12 @@ "sha.js": "^2.4.8" } }, + "pend": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/pend/-/pend-1.2.0.tgz", + "integrity": "sha1-elfrVQpng/kRUzH89GY9XI4AelA=", + "dev": true + }, "performance-now": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/performance-now/-/performance-now-2.1.0.tgz", @@ -11997,6 +12135,12 @@ "ipaddr.js": "1.9.1" } }, + "proxy-from-env": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/proxy-from-env/-/proxy-from-env-1.1.0.tgz", + "integrity": "sha512-D+zkORCbA9f1tdWRK0RaCR3GPv50cMxcrz4X8k5LTSUD1Dkw47mKJEZQNunItRTkWwgtaUSo1RVFRIG9ZXiFYg==", + "dev": true + }, "prr": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/prr/-/prr-1.0.1.tgz", @@ -12058,6 +12202,62 @@ "integrity": "sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==", "dev": true }, + "puppeteer-core": { + "version": "5.5.0", + "resolved": "https://registry.npmjs.org/puppeteer-core/-/puppeteer-core-5.5.0.tgz", + "integrity": "sha512-tlA+1n+ziW/Db03hVV+bAecDKse8ihFRXYiEypBe9IlLRvOCzYFG6qrCMBYK34HO/Q/Ecjc+tvkHRAfLVH+NgQ==", + "dev": true, + "requires": { + "debug": "^4.1.0", + "devtools-protocol": "0.0.818844", + "extract-zip": "^2.0.0", + "https-proxy-agent": "^4.0.0", + "node-fetch": "^2.6.1", + "pkg-dir": "^4.2.0", + "progress": "^2.0.1", + "proxy-from-env": "^1.0.0", + "rimraf": "^3.0.2", + "tar-fs": "^2.0.0", + "unbzip2-stream": "^1.3.3", + "ws": "^7.2.3" + }, + "dependencies": { + "find-up": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", + "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", + "dev": true, + "requires": { + "locate-path": "^5.0.0", + "path-exists": "^4.0.0" + } + }, + "path-exists": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", + "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", + "dev": true + }, + "pkg-dir": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-4.2.0.tgz", + "integrity": "sha512-HRDzbaKjC+AOWVXxAU/x54COGeIv9eb+6CkDSQoNTt4XyWoIJvuPsXizxu/Fr23EiekbtZwmh1IcIG/l/a10GQ==", + "dev": true, + "requires": { + "find-up": "^4.0.0" + } + }, + "rimraf": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz", + "integrity": "sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==", + "dev": true, + "requires": { + "glob": "^7.1.3" + } + } + } + }, "q": { "version": "1.5.1", "resolved": "https://registry.npmjs.org/q/-/q-1.5.1.tgz", @@ -13655,6 +13855,56 @@ "integrity": "sha512-4WK/bYZmj8xLr+HUCODHGF1ZFzsYffasLUgEiMBY4fgtltdO6B4WJtlSbPaDTLpYTcGVwM2qLnFTICEcNxs3kA==", "dev": true }, + "tar-fs": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/tar-fs/-/tar-fs-2.1.1.tgz", + "integrity": "sha512-V0r2Y9scmbDRLCNex/+hYzvp/zyYjvFbHPNgVTKfQvVrb6guiE/fxP+XblDNR011utopbkex2nM4dHNV6GDsng==", + "dev": true, + "requires": { + "chownr": "^1.1.1", + "mkdirp-classic": "^0.5.2", + "pump": "^3.0.0", + "tar-stream": "^2.1.4" + }, + "dependencies": { + "pump": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz", + "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", + "dev": true, + "requires": { + "end-of-stream": "^1.1.0", + "once": "^1.3.1" + } + } + } + }, + "tar-stream": { + "version": "2.1.4", + "resolved": "https://registry.npmjs.org/tar-stream/-/tar-stream-2.1.4.tgz", + "integrity": "sha512-o3pS2zlG4gxr67GmFYBLlq+dM8gyRGUOvsrHclSkvtVtQbjV0s/+ZE8OpICbaj8clrX3tjeHngYGP7rweaBnuw==", + "dev": true, + "requires": { + "bl": "^4.0.3", + "end-of-stream": "^1.4.1", + "fs-constants": "^1.0.0", + "inherits": "^2.0.3", + "readable-stream": "^3.1.1" + }, + "dependencies": { + "readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "dev": true, + "requires": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + } + } + } + }, "terminal-link": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/terminal-link/-/terminal-link-2.1.1.tgz", @@ -13997,6 +14247,28 @@ "dev": true, "optional": true }, + "unbzip2-stream": { + "version": "1.4.3", + "resolved": "https://registry.npmjs.org/unbzip2-stream/-/unbzip2-stream-1.4.3.tgz", + "integrity": "sha512-mlExGW4w71ebDJviH16lQLtZS32VKqsSfk80GCfUlwT/4/hNRFsoscrF/c++9xinkMzECL1uL9DDwXqFWkruPg==", + "dev": true, + "requires": { + "buffer": "^5.2.1", + "through": "^2.3.8" + }, + "dependencies": { + "buffer": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/buffer/-/buffer-5.7.1.tgz", + "integrity": "sha512-EHcyIPBQ4BSGlvjB16k5KgAJ27CIsHY/2JBmCRReo48y9rQ3MaUzWX3KVlBa4U7MyX02HdVj0K7C3WaB3ju7FQ==", + "dev": true, + "requires": { + "base64-js": "^1.3.1", + "ieee754": "^1.1.13" + } + } + } + }, "unc-path-regex": { "version": "0.1.2", "resolved": "https://registry.npmjs.org/unc-path-regex/-/unc-path-regex-0.1.2.tgz", @@ -14687,7 +14959,8 @@ }, "minimist": { "version": "1.2.0", - "resolved": "", + "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", + "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", "dev": true }, "os-locale": { @@ -15390,6 +15663,16 @@ "requires": { "camelcase": "^3.0.0" } + }, + "yauzl": { + "version": "2.10.0", + "resolved": "https://registry.npmjs.org/yauzl/-/yauzl-2.10.0.tgz", + "integrity": "sha1-x+sXyT4RLLEIb6bY5R+wZnt5pfk=", + "dev": true, + "requires": { + "buffer-crc32": "~0.2.3", + "fd-slicer": "~1.1.0" + } } } } diff --git a/package.json b/package.json index c7a5940..e296ed4 100644 --- a/package.json +++ b/package.json @@ -31,6 +31,7 @@ "json-stringify-pretty-compact": "^2.0.0", "run-sequence": "^2.2.1", "webpack": "^4.44.2", + "puppeteer-core": "^5.5.0", "webpack-cli": "^3.3.11", "webpack-dev-server": "^3.11.0" }, @@ -41,9 +42,12 @@ "build-examples": "webpack --config webpack.examples.config.js --mode=production --env.ALPHA & webpack --config webpack.examples.config.js --mode=production --env.MINIMIZE --env.ALPHA", "lint": "eslint 'src/**/*.js' 'demo/js/Demo.js' 'demo/js/Compare.js' 'examples/*.js' 'webpack.*.js' 'Gulpfile.js'", "doc": "gulp doc", - "test": "jest", - "test-save": "SAVE=true jest", - "test-watch": "jest --watch" + "test": "npm run test-node", + "test-all": "jest", + "test-save": "SAVE=true npm run test-node", + "test-watch": "npm run test-node -- --watch", + "test-node": "jest ./test/Examples.spec.js", + "test-browser": "jest ./test/Browser.spec.js" }, "dependencies": {}, "files": [ diff --git a/test/Browser.spec.js b/test/Browser.spec.js new file mode 100644 index 0000000..e927160 --- /dev/null +++ b/test/Browser.spec.js @@ -0,0 +1,90 @@ +/* eslint-env es6 */ +"use strict"; + +jest.setTimeout(120 * 1000); + +const puppeteer = require('puppeteer-core'); +const Example = require('../examples/index'); +const fs = require('fs'); + +const examples = Object.keys(Example); +const browserPath = '/Applications/Google\ Chrome.app/Contents/MacOS/Google\ Chrome'; +const demoPagePath = 'http://localhost:8000/'; +const totalUpdates = 5; + +if (!fs.existsSync(browserPath)) { + // Skip if browser is missing + console.warn('Could not find browser. Browser tests skipped.'); + describe.skip('Browser integration tests'); +} else { + describe('Browser integration tests', () => { + let results; + + // Set up the environment and run examples + beforeAll(async () => results = await runExamplesBrowser(totalUpdates)); + + it('all examples run without throwing error', () => { + if (results.error) { + console.error(results.error); + expect(!results.error).toBe(true); + } else { + for (const example of examples) { + expect(results[example].id).toBe(example); + expect(results[example].timestamp).toBeGreaterThan(0); + } + } + }); + }); +} + +const runExamplesBrowser = async updates => { + // Set up browser environment + const browser = await puppeteer.launch({ executablePath: browserPath }); + const page = await browser.newPage(); + const results = {}; + + // Load local demo page and catch errors + let pageError; + const onPageError = error => pageError = error; + page.addListener('pageerror', onPageError); + await page.goto(demoPagePath).catch(onPageError); + + // For every example + for (const example of examples) { + // Bail on error + if (pageError) { + break; + } + + // In the demo page context + results[example] = await page.evaluate(async (example, updates) => { + // Set the current example + MatterTools.Demo.setExampleById(MatterDemo, example); + const instance = MatterDemo.example.instance; + let ticks = 0; + + // Wait while running + await new Promise((resolve) => { + Matter.Events.on(instance.runner, 'tick', () => { + // Stop after enough updates + if (ticks >= updates) { + Matter.Runner.stop(instance.runner); + resolve(); + } + ticks += 1; + }); + }); + + // Return results + return { + id: MatterDemo.example.id, + timestamp: instance.engine.timing.timestamp + }; + }, example, updates); + } + + // Tear down + await browser.close(); + + return pageError ? { error: pageError } : results; +}; From 90abab6c2556d38a005b6a52a5fc5996625092d9 Mon Sep 17 00:00:00 2001 From: liabru Date: Tue, 24 Nov 2020 23:45:18 +0000 Subject: [PATCH 04/23] update build script --- webpack.config.js | 8 +++++--- 1 file changed, 5 insertions(+), 3 deletions(-) diff --git a/webpack.config.js b/webpack.config.js index 1916a42..7174511 100644 --- a/webpack.config.js +++ b/webpack.config.js @@ -4,6 +4,7 @@ const webpack = require('webpack'); const path = require('path'); const pkg = require('./package.json'); +const fs = require('fs'); const execSync = require('child_process').execSync; module.exports = (env = {}) => { @@ -14,13 +15,14 @@ module.exports = (env = {}) => { const commitHash = execSync('git rev-parse --short HEAD').toString().trim(); const version = !alpha ? pkg.version : `${pkg.version}-alpha+${commitHash}`; + const license = fs.readFileSync('LICENSE', 'utf8'); const date = new Date().toISOString().slice(0, 10); const name = 'matter'; const alphaInfo = 'Experimental pre-release build.\n '; const banner = -` ${pkg.name} ${version} by @liabru (c) ${date} - ${alpha ? alphaInfo : ''}${pkg.homepage} - License ${pkg.license}`; +`${pkg.name} ${version} by @liabru ${date} +${alpha ? alphaInfo : ''}${pkg.homepage} +License ${pkg.license}${!minimize ? '\n\n' + license : ''}`; return { entry: { [name]: './src/module/main.js' }, From 6a280902bfeac3b514dd8fba10cbb93cddd891a4 Mon Sep 17 00:00:00 2001 From: liabru Date: Wed, 25 Nov 2020 00:09:11 +0000 Subject: [PATCH 05/23] remove gulp --- Gulpfile.js | 90 -- package-lock.json | 3522 +-------------------------------------------- package.json | 9 +- 3 files changed, 3 insertions(+), 3618 deletions(-) delete mode 100644 Gulpfile.js diff --git a/Gulpfile.js b/Gulpfile.js deleted file mode 100644 index cd7bccb..0000000 --- a/Gulpfile.js +++ /dev/null @@ -1,90 +0,0 @@ -/* eslint-env es6 */ -"use strict"; - -const gulp = require('gulp'); -const bump = require('gulp-bump'); -const changelog = require('gulp-conventional-changelog'); -const tag = require('gulp-tag-version'); -const sequence = require('run-sequence'); -const gutil = require('gulp-util'); -const pkg = require('./package.json'); -const exec = require('child_process').exec; - -const shellExec = (command, callback) => { - const args = process.argv.slice(3).join(' '), - proc = exec(command + ' ' + args, (err, stdout, stderr) => { - callback(err, stdout, stderr, proc); - }); - - proc.stdout.on('data', data => process.stdout.write(data)); - proc.stderr.on('data', data => process.stderr.write(data)); -}; - -const shell = command => (callback => { shellExec(command, callback); }); - -const hint = command => (callback => { - gutil.log(gutil.colors.red('Error'), 'use', gutil.colors.yellow(command), 'instead.'); - callback(); -}); - -gulp.task('default', hint('npm run build')); -gulp.task('dev', hint('npm run dev')); -gulp.task('build', hint('npm run build')); -gulp.task('test', hint('npm run test')); -gulp.task('lint', hint('npm run lint')); - -gulp.task('doc', callback => { - shellExec(`yuidoc --config yuidoc.json --project-version ${pkg.version}`, callback); -}); - -gulp.task('bump', () => { - return gulp.src(['package.json', 'bower.json']) - .pipe(bump({ type: process.argv[4] || 'minor' })) - .pipe(gulp.dest('.')); -}); - -gulp.task('tag', () => { - return gulp.src('package.json') - .pipe(tag({ prefix: '' })); -}); - -gulp.task('changelog', () => { - return gulp.src('CHANGELOG.md') - .pipe(changelog()) - .pipe(gulp.dest('.')); -}); - -gulp.task('release', callback => { - shellExec('git status --porcelain', (err, stdout) => { - if (stdout && stdout.trim()) { - throw new gutil.PluginError({ - plugin: 'release', - message: 'cannot build release as there are uncomitted changes' - }); - } else { - sequence( - 'release:lint', 'bump', 'release:build', 'release:test', - 'doc', 'changelog', callback - ); - } - }); -}); - -gulp.task('release:lint', shell('npm run lint')); -gulp.task('release:build', shell('npm run build')); -gulp.task('release:test', shell('TEST_BUILD=true npm run test')); -gulp.task('release:push:git', shell('git push origin && git push origin --tags')); -gulp.task('release:push:npm', shell('npm publish')); - -gulp.task('release:push', callback => { - shellExec('git status --porcelain', (err, stdout) => { - if (stdout && stdout.trim()) { - throw new gutil.PluginError({ - plugin: 'release', - message: 'cannot push release as it has not yet been committed' - }); - } else { - sequence('tag', 'release:push:git', 'release:push:npm', callback); - } - }); -}); diff --git a/package-lock.json b/package-lock.json index f0803c8..e7968df 100644 --- a/package-lock.json +++ b/package-lock.json @@ -1069,12 +1069,6 @@ "integrity": "sha512-tHq6qdbT9U1IRSGf14CL0pUlULksvY9OZ+5eEgl1N7t+OA3tGvNpxJCzuKQlsNgCVwbAs670L1vcVQi8j9HjnA==", "dev": true }, - "@types/minimist": { - "version": "1.2.1", - "resolved": "https://registry.npmjs.org/@types/minimist/-/minimist-1.2.1.tgz", - "integrity": "sha512-fZQQafSREFyuZcdWFAExYjBiCL7AUCdgsk80iO0q4yihYYdcIiH28CcuPTGFgLOCC8RlW49GSQxdHwZP+I7CNg==", - "dev": true - }, "@types/node": { "version": "13.9.0", "resolved": "https://registry.npmjs.org/@types/node/-/node-13.9.0.tgz", @@ -1311,16 +1305,6 @@ "integrity": "sha512-NuHqBY1PB/D8xU6s/thBgOAiAP7HOYDQ32+BFZILJ8ivkUkAHQnWfn6WhL79Owj1qmUnoN/YPhktdIoucipkAQ==", "dev": true }, - "JSONStream": { - "version": "1.3.5", - "resolved": "https://registry.npmjs.org/JSONStream/-/JSONStream-1.3.5.tgz", - "integrity": "sha512-E+iruNOY8VV9s4JEbe1aNEm6MiszPRr/UfcHMz0TQh1BXSxHK+ASV1R6W4HpjBhSeS+54PIsAMCBmwD06LLsqQ==", - "dev": true, - "requires": { - "jsonparse": "^1.2.0", - "through": ">=2.2.7 <3" - } - }, "abab": { "version": "2.0.5", "resolved": "https://registry.npmjs.org/abab/-/abab-2.0.5.tgz", @@ -1373,12 +1357,6 @@ "integrity": "sha512-7evsyfH1cLOCdAzZAd43Cic04yKydNx0cF+7tiA19p1XnLLPU4dpCQOqpjqwokFe//vS0QqfqqjCS2JkiIs0cA==", "dev": true }, - "add-stream": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/add-stream/-/add-stream-1.0.0.tgz", - "integrity": "sha1-anmQQ3ynNtXhKI25K9MmbV9csqo=", - "dev": true - }, "agent-base": { "version": "5.1.1", "resolved": "https://registry.npmjs.org/agent-base/-/agent-base-5.1.1.tgz", @@ -1409,15 +1387,6 @@ "integrity": "sha512-5p6WTN0DdTGVQk6VjcEju19IgaHudalcfabD7yhDGeA6bcQnmL+CpveLJq/3hvfwd1aof6L386Ougkx6RfyMIQ==", "dev": true }, - "ansi-colors": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/ansi-colors/-/ansi-colors-1.1.0.tgz", - "integrity": "sha512-SFKX67auSNoVR38N3L+nvsPjOE0bybKTYbkf5tRvushrAPQ9V75huw0ZxBkKVeRU9kqH3d6HA4xTckbwZ4ixmA==", - "dev": true, - "requires": { - "ansi-wrap": "^0.1.0" - } - }, "ansi-cyan": { "version": "0.1.1", "resolved": "https://registry.npmjs.org/ansi-cyan/-/ansi-cyan-0.1.1.tgz", @@ -1489,12 +1458,6 @@ "integrity": "sha1-qCJQ3bABXponyoLoLqYDu/pF768=", "dev": true }, - "any-shell-escape": { - "version": "0.1.1", - "resolved": "https://registry.npmjs.org/any-shell-escape/-/any-shell-escape-0.1.1.tgz", - "integrity": "sha1-1Vq5ciRMcaml4asIefML8RCAaVk=", - "dev": true - }, "anymatch": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz", @@ -1505,27 +1468,12 @@ "normalize-path": "^2.1.1" } }, - "append-buffer": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/append-buffer/-/append-buffer-1.0.2.tgz", - "integrity": "sha1-2CIM9GYIFSXv6lBhTz3mUU36WPE=", - "dev": true, - "requires": { - "buffer-equal": "^1.0.0" - } - }, "aproba": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/aproba/-/aproba-1.2.0.tgz", "integrity": "sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw==", "dev": true }, - "archy": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/archy/-/archy-1.0.0.tgz", - "integrity": "sha1-+cjBN1fMHde8N5rHeyxipcKGjEA=", - "dev": true - }, "argparse": { "version": "1.0.10", "resolved": "https://registry.npmjs.org/argparse/-/argparse-1.0.10.tgz", @@ -1541,132 +1489,30 @@ "integrity": "sha1-1kYQdP6/7HHn4VI1dhoyml3HxSA=", "dev": true }, - "arr-filter": { - "version": "1.1.2", - "resolved": "https://registry.npmjs.org/arr-filter/-/arr-filter-1.1.2.tgz", - "integrity": "sha1-Q/3d0JHo7xGqTEXZzcGOLf8XEe4=", - "dev": true, - "requires": { - "make-iterator": "^1.0.0" - } - }, "arr-flatten": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/arr-flatten/-/arr-flatten-1.1.0.tgz", "integrity": "sha512-L3hKV5R/p5o81R7O02IGnwpDmkp6E982XhtbuwSe3O4qOtMMMtodicASA1Cny2U+aCXcNpml+m4dPsvsJ3jatg==", "dev": true }, - "arr-map": { - "version": "2.0.2", - "resolved": "https://registry.npmjs.org/arr-map/-/arr-map-2.0.2.tgz", - "integrity": "sha1-Onc0X/wc814qkYJWAfnljy4kysQ=", - "dev": true, - "requires": { - "make-iterator": "^1.0.0" - } - }, "arr-union": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/arr-union/-/arr-union-3.1.0.tgz", "integrity": "sha1-45sJrqne+Gao8gbiiK9jkZuuOcQ=", "dev": true }, - "array-differ": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/array-differ/-/array-differ-1.0.0.tgz", - "integrity": "sha1-7/UuN1gknTO+QCuLuOVkuytdQDE=", - "dev": true - }, - "array-each": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/array-each/-/array-each-1.0.1.tgz", - "integrity": "sha1-p5SvDAWrF1KEbudTofIRoFugxE8=", - "dev": true - }, "array-equal": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/array-equal/-/array-equal-1.0.0.tgz", "integrity": "sha1-jCpe8kcv2ep0KwTHenUJO6J1fJM=", "dev": true }, - "array-find-index": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/array-find-index/-/array-find-index-1.0.2.tgz", - "integrity": "sha1-3wEKoSh+Fku9pvlyOwqWoexBh6E=", - "dev": true - }, "array-flatten": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-2.1.2.tgz", "integrity": "sha512-hNfzcOV8W4NdualtqBFPyVO+54DSJuZGY9qT4pRroB6S9e3iiido2ISIC5h9R2sPJ8H3FHCIiEnsv1lPXO3KtQ==", "dev": true }, - "array-ify": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/array-ify/-/array-ify-1.0.0.tgz", - "integrity": "sha1-nlKHYrSpBmrRY6aWKjZEGOlibs4=", - "dev": true - }, - "array-initial": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/array-initial/-/array-initial-1.1.0.tgz", - "integrity": "sha1-L6dLJnOTccOUe9enrcc74zSz15U=", - "dev": true, - "requires": { - "array-slice": "^1.0.0", - "is-number": "^4.0.0" - }, - "dependencies": { - "is-number": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/is-number/-/is-number-4.0.0.tgz", - "integrity": "sha512-rSklcAIlf1OmFdyAqbnWTLVelsQ58uvZ66S/ZyawjWqIviTWCjg2PzVGw8WUA+nNuPTqb4wgA+NszrJ+08LlgQ==", - "dev": true - } - } - }, - "array-last": { - "version": "1.3.0", - "resolved": "https://registry.npmjs.org/array-last/-/array-last-1.3.0.tgz", - "integrity": "sha512-eOCut5rXlI6aCOS7Z7kCplKRKyiFQ6dHFBem4PwlwKeNFk2/XxTrhRh5T9PyaEWGy/NHTZWbY+nsZlNFJu9rYg==", - "dev": true, - "requires": { - "is-number": "^4.0.0" - }, - "dependencies": { - "is-number": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/is-number/-/is-number-4.0.0.tgz", - "integrity": "sha512-rSklcAIlf1OmFdyAqbnWTLVelsQ58uvZ66S/ZyawjWqIviTWCjg2PzVGw8WUA+nNuPTqb4wgA+NszrJ+08LlgQ==", - "dev": true - } - } - }, - "array-slice": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/array-slice/-/array-slice-1.1.0.tgz", - "integrity": "sha512-B1qMD3RBP7O8o0H2KbrXDyB0IccejMF15+87Lvlor12ONPRHP6gTjXMNkt/d3ZuOGbAe66hFmaCfECI24Ufp6w==", - "dev": true - }, - "array-sort": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/array-sort/-/array-sort-1.0.0.tgz", - "integrity": "sha512-ihLeJkonmdiAsD7vpgN3CRcx2J2S0TiYW+IS/5zHBI7mKUq3ySvBdzzBfD236ubDBQFiiyG3SWCPc+msQ9KoYg==", - "dev": true, - "requires": { - "default-compare": "^1.0.0", - "get-value": "^2.0.6", - "kind-of": "^5.0.2" - }, - "dependencies": { - "kind-of": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz", - "integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==", - "dev": true - } - } - }, "array-union": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/array-union/-/array-union-1.0.2.tgz", @@ -1688,12 +1534,6 @@ "integrity": "sha1-qJS3XUvE9s1nnvMkSp/Y9Gri1Cg=", "dev": true }, - "arrify": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/arrify/-/arrify-1.0.1.tgz", - "integrity": "sha1-iYUI2iIm84DfkEcoRWhJwVAaSw0=", - "dev": true - }, "asn1": { "version": "0.2.4", "resolved": "https://registry.npmjs.org/asn1/-/asn1-0.2.4.tgz", @@ -1777,18 +1617,6 @@ "lodash": "^4.17.14" } }, - "async-done": { - "version": "1.3.2", - "resolved": "https://registry.npmjs.org/async-done/-/async-done-1.3.2.tgz", - "integrity": "sha512-uYkTP8dw2og1tu1nmza1n1CMW0qb8gWWlwqMmLb7MhBVs4BXrFziT6HXUd+/RlRA/i4H9AkofYloUbs1fwMqlw==", - "dev": true, - "requires": { - "end-of-stream": "^1.1.0", - "once": "^1.3.2", - "process-nextick-args": "^2.0.0", - "stream-exhaust": "^1.0.1" - } - }, "async-each": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/async-each/-/async-each-1.0.3.tgz", @@ -1801,15 +1629,6 @@ "integrity": "sha512-csOlWGAcRFJaI6m+F2WKdnMKr4HhdhFVBk0H/QbJFMCr+uO2kwohwXQPxw/9OCxp05r5ghVBFSyioixx3gfkNQ==", "dev": true }, - "async-settle": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/async-settle/-/async-settle-1.0.0.tgz", - "integrity": "sha1-HQqRS7Aldb7IqPOnTlCA9yssDGs=", - "dev": true, - "requires": { - "async-done": "^1.2.2" - } - }, "asynckit": { "version": "0.4.0", "resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz", @@ -1960,23 +1779,6 @@ "babel-preset-current-node-syntax": "^0.1.2" } }, - "bach": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/bach/-/bach-1.2.0.tgz", - "integrity": "sha1-Szzpa/JxNPeaG0FKUcFONMO9mIA=", - "dev": true, - "requires": { - "arr-filter": "^1.1.1", - "arr-flatten": "^1.0.1", - "arr-map": "^2.0.0", - "array-each": "^1.0.0", - "array-initial": "^1.0.0", - "array-last": "^1.1.1", - "async-done": "^1.2.2", - "async-settle": "^1.0.0", - "now-and-later": "^2.0.0" - } - }, "balanced-match": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz", @@ -2059,12 +1861,6 @@ "tweetnacl": "^0.14.3" } }, - "beeper": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/beeper/-/beeper-1.1.1.tgz", - "integrity": "sha1-5tXqjF2tABMEpwsiY4RH9pyy+Ak=", - "dev": true - }, "big.js": { "version": "5.2.2", "resolved": "https://registry.npmjs.org/big.js/-/big.js-5.2.2.tgz", @@ -2370,12 +2166,6 @@ "integrity": "sha1-DTM+PwDqxQqhRUq9MO+MKl2ackI=", "dev": true }, - "buffer-equal": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/buffer-equal/-/buffer-equal-1.0.0.tgz", - "integrity": "sha1-WWFrSYME1Var1GaWayLu2j7KX74=", - "dev": true - }, "buffer-from": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/buffer-from/-/buffer-from-1.1.1.tgz", @@ -2400,24 +2190,6 @@ "integrity": "sha1-hZgoeOIbmOHGZCXgPQF0eI9Wnug=", "dev": true }, - "bump-regex": { - "version": "2.9.0", - "resolved": "https://registry.npmjs.org/bump-regex/-/bump-regex-2.9.0.tgz", - "integrity": "sha512-o4WC1mKw/kM0zScuOxZKi243lc+/h09b41u2A7HlWbxHsEDsTTZtqDZYkQj65l24J8+9Saahn5ep+EyeqpQoCg==", - "dev": true, - "requires": { - "semver": "^5.1.0", - "xtend": "^4.0.1" - }, - "dependencies": { - "semver": { - "version": "5.7.1", - "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", - "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", - "dev": true - } - } - }, "bytes": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.0.0.tgz", @@ -2503,30 +2275,6 @@ "integrity": "sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==", "dev": true }, - "camelcase": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-3.0.0.tgz", - "integrity": "sha1-MvxLn82vhF/N9+c7uXysImHwqwo=", - "dev": true - }, - "camelcase-keys": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-2.1.0.tgz", - "integrity": "sha1-MIvur/3ygRkFHvodkyITyRuPkuc=", - "dev": true, - "requires": { - "camelcase": "^2.0.0", - "map-obj": "^1.0.0" - }, - "dependencies": { - "camelcase": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-2.1.1.tgz", - "integrity": "sha1-fB0W1nmhu+WcoCys7PsBHiAfWh8=", - "dev": true - } - } - }, "capture-exit": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/capture-exit/-/capture-exit-2.0.0.tgz", @@ -2677,112 +2425,18 @@ "integrity": "sha1-/xnt6Kml5XkyQUewwR8PvLq+1jk=", "dev": true }, - "cliui": { - "version": "3.2.0", - "resolved": "https://registry.npmjs.org/cliui/-/cliui-3.2.0.tgz", - "integrity": "sha1-EgYBU3qRbSmUD5NNo7SNWFo5IT0=", - "dev": true, - "requires": { - "string-width": "^1.0.1", - "strip-ansi": "^3.0.1", - "wrap-ansi": "^2.0.0" - }, - "dependencies": { - "ansi-regex": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", - "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", - "dev": true - }, - "is-fullwidth-code-point": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz", - "integrity": "sha1-754xOG8DGn8NZDr4L95QxFfvAMs=", - "dev": true, - "requires": { - "number-is-nan": "^1.0.0" - } - }, - "string-width": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/string-width/-/string-width-1.0.2.tgz", - "integrity": "sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=", - "dev": true, - "requires": { - "code-point-at": "^1.0.0", - "is-fullwidth-code-point": "^1.0.0", - "strip-ansi": "^3.0.0" - } - }, - "strip-ansi": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", - "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", - "dev": true, - "requires": { - "ansi-regex": "^2.0.0" - } - } - } - }, - "clone": { - "version": "2.1.2", - "resolved": "https://registry.npmjs.org/clone/-/clone-2.1.2.tgz", - "integrity": "sha1-G39Ln1kfHo+DZwQBYANFoCiHQ18=", - "dev": true - }, - "clone-buffer": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/clone-buffer/-/clone-buffer-1.0.0.tgz", - "integrity": "sha1-4+JbIHrE5wGvch4staFnksrD3Fg=", - "dev": true - }, - "clone-stats": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/clone-stats/-/clone-stats-1.0.0.tgz", - "integrity": "sha1-s3gt/4u1R04Yuba/D9/ngvh3doA=", - "dev": true - }, - "cloneable-readable": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/cloneable-readable/-/cloneable-readable-1.1.3.tgz", - "integrity": "sha512-2EF8zTQOxYq70Y4XKtorQupqF0m49MBz2/yf5Bj+MHjvpG3Hy7sImifnqD6UA+TKYxeSV+u6qqQPawN5UvnpKQ==", - "dev": true, - "requires": { - "inherits": "^2.0.1", - "process-nextick-args": "^2.0.0", - "readable-stream": "^2.3.5" - } - }, "co": { "version": "4.6.0", "resolved": "https://registry.npmjs.org/co/-/co-4.6.0.tgz", "integrity": "sha1-bqa989hTrlTMuOR7+gvz+QMfsYQ=", "dev": true }, - "code-point-at": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/code-point-at/-/code-point-at-1.1.0.tgz", - "integrity": "sha1-DQcLTQQ6W+ozovGkDi7bPZpMz3c=", - "dev": true - }, "collect-v8-coverage": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/collect-v8-coverage/-/collect-v8-coverage-1.0.1.tgz", "integrity": "sha512-iBPtljfCNcTKNAto0KEtDfZ3qzjJvqE3aTGZsbhjSBlorqpXJlaWWtPO35D+ZImoC3KWejX64o+yPGxhWSTzfg==", "dev": true }, - "collection-map": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/collection-map/-/collection-map-1.0.0.tgz", - "integrity": "sha1-rqDwb40mx4DCt1SUOFVEsiVa8Yw=", - "dev": true, - "requires": { - "arr-map": "^2.0.2", - "for-own": "^1.0.0", - "make-iterator": "^1.0.0" - } - }, "collection-visit": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/collection-visit/-/collection-visit-1.0.0.tgz", @@ -2835,16 +2489,6 @@ "integrity": "sha1-3dgA2gxmEnOTzKWVDqloo6rxJTs=", "dev": true }, - "compare-func": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/compare-func/-/compare-func-2.0.0.tgz", - "integrity": "sha512-zHig5N+tPWARooBnb0Zx1MFcdfpyJrfTJ3Y5L+IFvUm8rM74hHz66z0gw0x4tijh5CorKkKUCnW82R2vmpeCRA==", - "dev": true, - "requires": { - "array-ify": "^1.0.0", - "dot-prop": "^5.1.0" - } - }, "component-emitter": { "version": "1.3.0", "resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.3.0.tgz", @@ -2951,864 +2595,6 @@ "integrity": "sha512-hIP3EEPs8tB9AT1L+NUqtwOAps4mk2Zob89MWXMHjHWg9milF/j4osnnQLXBCBFBk/tvIG/tUc9mOUJiPBhPXA==", "dev": true }, - "conventional-changelog": { - "version": "3.1.24", - "resolved": "https://registry.npmjs.org/conventional-changelog/-/conventional-changelog-3.1.24.tgz", - "integrity": "sha512-ed6k8PO00UVvhExYohroVPXcOJ/K1N0/drJHx/faTH37OIZthlecuLIRX/T6uOp682CAoVoFpu+sSEaeuH6Asg==", - "dev": true, - "requires": { - "conventional-changelog-angular": "^5.0.12", - "conventional-changelog-atom": "^2.0.8", - "conventional-changelog-codemirror": "^2.0.8", - "conventional-changelog-conventionalcommits": "^4.5.0", - "conventional-changelog-core": "^4.2.1", - "conventional-changelog-ember": "^2.0.9", - "conventional-changelog-eslint": "^3.0.9", - "conventional-changelog-express": "^2.0.6", - "conventional-changelog-jquery": "^3.0.11", - "conventional-changelog-jshint": "^2.0.9", - "conventional-changelog-preset-loader": "^2.3.4" - } - }, - "conventional-changelog-angular": { - "version": "5.0.12", - "resolved": "https://registry.npmjs.org/conventional-changelog-angular/-/conventional-changelog-angular-5.0.12.tgz", - "integrity": "sha512-5GLsbnkR/7A89RyHLvvoExbiGbd9xKdKqDTrArnPbOqBqG/2wIosu0fHwpeIRI8Tl94MhVNBXcLJZl92ZQ5USw==", - "dev": true, - "requires": { - "compare-func": "^2.0.0", - "q": "^1.5.1" - } - }, - "conventional-changelog-atom": { - "version": "2.0.8", - "resolved": "https://registry.npmjs.org/conventional-changelog-atom/-/conventional-changelog-atom-2.0.8.tgz", - "integrity": "sha512-xo6v46icsFTK3bb7dY/8m2qvc8sZemRgdqLb/bjpBsH2UyOS8rKNTgcb5025Hri6IpANPApbXMg15QLb1LJpBw==", - "dev": true, - "requires": { - "q": "^1.5.1" - } - }, - "conventional-changelog-codemirror": { - "version": "2.0.8", - "resolved": "https://registry.npmjs.org/conventional-changelog-codemirror/-/conventional-changelog-codemirror-2.0.8.tgz", - "integrity": "sha512-z5DAsn3uj1Vfp7po3gpt2Boc+Bdwmw2++ZHa5Ak9k0UKsYAO5mH1UBTN0qSCuJZREIhX6WU4E1p3IW2oRCNzQw==", - "dev": true, - "requires": { - "q": "^1.5.1" - } - }, - "conventional-changelog-conventionalcommits": { - "version": "4.5.0", - "resolved": "https://registry.npmjs.org/conventional-changelog-conventionalcommits/-/conventional-changelog-conventionalcommits-4.5.0.tgz", - "integrity": "sha512-buge9xDvjjOxJlyxUnar/+6i/aVEVGA7EEh4OafBCXPlLUQPGbRUBhBUveWRxzvR8TEjhKEP4BdepnpG2FSZXw==", - "dev": true, - "requires": { - "compare-func": "^2.0.0", - "lodash": "^4.17.15", - "q": "^1.5.1" - } - }, - "conventional-changelog-core": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/conventional-changelog-core/-/conventional-changelog-core-4.2.1.tgz", - "integrity": "sha512-8cH8/DEoD3e5Q6aeogdR5oaaKs0+mG6+f+Om0ZYt3PNv7Zo0sQhu4bMDRsqAF+UTekTAtP1W/C41jH/fkm8Jtw==", - "dev": true, - "requires": { - "add-stream": "^1.0.0", - "conventional-changelog-writer": "^4.0.18", - "conventional-commits-parser": "^3.2.0", - "dateformat": "^3.0.0", - "get-pkg-repo": "^1.0.0", - "git-raw-commits": "2.0.0", - "git-remote-origin-url": "^2.0.0", - "git-semver-tags": "^4.1.1", - "lodash": "^4.17.15", - "normalize-package-data": "^3.0.0", - "q": "^1.5.1", - "read-pkg": "^3.0.0", - "read-pkg-up": "^3.0.0", - "shelljs": "^0.8.3", - "through2": "^4.0.0" - }, - "dependencies": { - "dateformat": { - "version": "3.0.3", - "resolved": "https://registry.npmjs.org/dateformat/-/dateformat-3.0.3.tgz", - "integrity": "sha512-jyCETtSl3VMZMWeRo7iY1FL19ges1t55hMo5yaam4Jrsm5EPL89UQkoQRyiI+Yf4k8r2ZpdngkV8hr1lIdjb3Q==", - "dev": true - }, - "find-up": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-2.1.0.tgz", - "integrity": "sha1-RdG35QbHF93UgndaK3eSCjwMV6c=", - "dev": true, - "requires": { - "locate-path": "^2.0.0" - } - }, - "hosted-git-info": { - "version": "3.0.7", - "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-3.0.7.tgz", - "integrity": "sha512-fWqc0IcuXs+BmE9orLDyVykAG9GJtGLGuZAAqgcckPgv5xad4AcXGIv8galtQvlwutxSlaMcdw7BUtq2EIvqCQ==", - "dev": true, - "requires": { - "lru-cache": "^6.0.0" - } - }, - "load-json-file": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-4.0.0.tgz", - "integrity": "sha1-L19Fq5HjMhYjT9U62rZo607AmTs=", - "dev": true, - "requires": { - "graceful-fs": "^4.1.2", - "parse-json": "^4.0.0", - "pify": "^3.0.0", - "strip-bom": "^3.0.0" - } - }, - "locate-path": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-2.0.0.tgz", - "integrity": "sha1-K1aLJl7slExtnA3pw9u7ygNUzY4=", - "dev": true, - "requires": { - "p-locate": "^2.0.0", - "path-exists": "^3.0.0" - } - }, - "normalize-package-data": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-3.0.0.tgz", - "integrity": "sha512-6lUjEI0d3v6kFrtgA/lOx4zHCWULXsFNIjHolnZCKCTLA6m/G625cdn3O7eNmT0iD3jfo6HZ9cdImGZwf21prw==", - "dev": true, - "requires": { - "hosted-git-info": "^3.0.6", - "resolve": "^1.17.0", - "semver": "^7.3.2", - "validate-npm-package-license": "^3.0.1" - } - }, - "p-limit": { - "version": "1.3.0", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-1.3.0.tgz", - "integrity": "sha512-vvcXsLAJ9Dr5rQOPk7toZQZJApBl2K4J6dANSsEuh6QI41JYcsS/qhTGa9ErIUUgK3WNQoJYvylxvjqmiqEA9Q==", - "dev": true, - "requires": { - "p-try": "^1.0.0" - } - }, - "p-locate": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-2.0.0.tgz", - "integrity": "sha1-IKAQOyIqcMj9OcwuWAaA893l7EM=", - "dev": true, - "requires": { - "p-limit": "^1.1.0" - } - }, - "p-try": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/p-try/-/p-try-1.0.0.tgz", - "integrity": "sha1-y8ec26+P1CKOE/Yh8rGiN8GyB7M=", - "dev": true - }, - "parse-json": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz", - "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=", - "dev": true, - "requires": { - "error-ex": "^1.3.1", - "json-parse-better-errors": "^1.0.1" - } - }, - "path-exists": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", - "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", - "dev": true - }, - "path-type": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/path-type/-/path-type-3.0.0.tgz", - "integrity": "sha512-T2ZUsdZFHgA3u4e5PfPbjd7HDDpxPnQb5jN0SrDsjNSuVXHJqtwTnWqG0B1jZrgmJ/7lj1EmVIByWt1gxGkWvg==", - "dev": true, - "requires": { - "pify": "^3.0.0" - } - }, - "pify": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz", - "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=", - "dev": true - }, - "read-pkg": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-3.0.0.tgz", - "integrity": "sha1-nLxoaXj+5l0WwA4rGcI3/Pbjg4k=", - "dev": true, - "requires": { - "load-json-file": "^4.0.0", - "normalize-package-data": "^2.3.2", - "path-type": "^3.0.0" - }, - "dependencies": { - "hosted-git-info": { - "version": "2.8.8", - "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", - "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==", - "dev": true - }, - "normalize-package-data": { - "version": "2.5.0", - "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", - "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", - "dev": true, - "requires": { - "hosted-git-info": "^2.1.4", - "resolve": "^1.10.0", - "semver": "2 || 3 || 4 || 5", - "validate-npm-package-license": "^3.0.1" - } - }, - "semver": { - "version": "5.7.1", - "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", - "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", - "dev": true - } - } - }, - "read-pkg-up": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-3.0.0.tgz", - "integrity": "sha1-PtSWaF26D4/hGNBpHcUfSh/5bwc=", - "dev": true, - "requires": { - "find-up": "^2.0.0", - "read-pkg": "^3.0.0" - } - }, - "readable-stream": { - "version": "3.6.0", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", - "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", - "dev": true, - "requires": { - "inherits": "^2.0.3", - "string_decoder": "^1.1.1", - "util-deprecate": "^1.0.1" - } - }, - "resolve": { - "version": "1.19.0", - "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.19.0.tgz", - "integrity": "sha512-rArEXAgsBG4UgRGcynxWIWKFvh/XZCcS8UJdHhwy91zwAvCZIbcs+vAbflgBnNjYMs/i/i+/Ux6IZhML1yPvxg==", - "dev": true, - "requires": { - "is-core-module": "^2.1.0", - "path-parse": "^1.0.6" - } - }, - "semver": { - "version": "7.3.2", - "resolved": "https://registry.npmjs.org/semver/-/semver-7.3.2.tgz", - "integrity": "sha512-OrOb32TeeambH6UrhtShmF7CRDqhL6/5XpPNp2DuRH6+9QLw/orhp72j87v8Qa1ScDkvrrBNpZcDejAirJmfXQ==", - "dev": true - }, - "strip-bom": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-3.0.0.tgz", - "integrity": "sha1-IzTBjpx1n3vdVv3vfprj1YjmjtM=", - "dev": true - }, - "through2": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/through2/-/through2-4.0.2.tgz", - "integrity": "sha512-iOqSav00cVxEEICeD7TjLB1sueEL+81Wpzp2bY17uZjZN0pWZPuo4suZ/61VujxmqSGFfgOcNuTZ85QJwNZQpw==", - "dev": true, - "requires": { - "readable-stream": "3" - } - } - } - }, - "conventional-changelog-ember": { - "version": "2.0.9", - "resolved": "https://registry.npmjs.org/conventional-changelog-ember/-/conventional-changelog-ember-2.0.9.tgz", - "integrity": "sha512-ulzIReoZEvZCBDhcNYfDIsLTHzYHc7awh+eI44ZtV5cx6LVxLlVtEmcO+2/kGIHGtw+qVabJYjdI5cJOQgXh1A==", - "dev": true, - "requires": { - "q": "^1.5.1" - } - }, - "conventional-changelog-eslint": { - "version": "3.0.9", - "resolved": "https://registry.npmjs.org/conventional-changelog-eslint/-/conventional-changelog-eslint-3.0.9.tgz", - "integrity": "sha512-6NpUCMgU8qmWmyAMSZO5NrRd7rTgErjrm4VASam2u5jrZS0n38V7Y9CzTtLT2qwz5xEChDR4BduoWIr8TfwvXA==", - "dev": true, - "requires": { - "q": "^1.5.1" - } - }, - "conventional-changelog-express": { - "version": "2.0.6", - "resolved": "https://registry.npmjs.org/conventional-changelog-express/-/conventional-changelog-express-2.0.6.tgz", - "integrity": "sha512-SDez2f3iVJw6V563O3pRtNwXtQaSmEfTCaTBPCqn0oG0mfkq0rX4hHBq5P7De2MncoRixrALj3u3oQsNK+Q0pQ==", - "dev": true, - "requires": { - "q": "^1.5.1" - } - }, - "conventional-changelog-jquery": { - "version": "3.0.11", - "resolved": "https://registry.npmjs.org/conventional-changelog-jquery/-/conventional-changelog-jquery-3.0.11.tgz", - "integrity": "sha512-x8AWz5/Td55F7+o/9LQ6cQIPwrCjfJQ5Zmfqi8thwUEKHstEn4kTIofXub7plf1xvFA2TqhZlq7fy5OmV6BOMw==", - "dev": true, - "requires": { - "q": "^1.5.1" - } - }, - "conventional-changelog-jshint": { - "version": "2.0.9", - "resolved": "https://registry.npmjs.org/conventional-changelog-jshint/-/conventional-changelog-jshint-2.0.9.tgz", - "integrity": "sha512-wMLdaIzq6TNnMHMy31hql02OEQ8nCQfExw1SE0hYL5KvU+JCTuPaDO+7JiogGT2gJAxiUGATdtYYfh+nT+6riA==", - "dev": true, - "requires": { - "compare-func": "^2.0.0", - "q": "^1.5.1" - } - }, - "conventional-changelog-preset-loader": { - "version": "2.3.4", - "resolved": "https://registry.npmjs.org/conventional-changelog-preset-loader/-/conventional-changelog-preset-loader-2.3.4.tgz", - "integrity": "sha512-GEKRWkrSAZeTq5+YjUZOYxdHq+ci4dNwHvpaBC3+ENalzFWuCWa9EZXSuZBpkr72sMdKB+1fyDV4takK1Lf58g==", - "dev": true - }, - "conventional-changelog-writer": { - "version": "4.0.18", - "resolved": "https://registry.npmjs.org/conventional-changelog-writer/-/conventional-changelog-writer-4.0.18.tgz", - "integrity": "sha512-mAQDCKyB9HsE8Ko5cCM1Jn1AWxXPYV0v8dFPabZRkvsiWUul2YyAqbIaoMKF88Zf2ffnOPSvKhboLf3fnjo5/A==", - "dev": true, - "requires": { - "compare-func": "^2.0.0", - "conventional-commits-filter": "^2.0.7", - "dateformat": "^3.0.0", - "handlebars": "^4.7.6", - "json-stringify-safe": "^5.0.1", - "lodash": "^4.17.15", - "meow": "^8.0.0", - "semver": "^6.0.0", - "split": "^1.0.0", - "through2": "^4.0.0" - }, - "dependencies": { - "camelcase": { - "version": "5.3.1", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", - "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", - "dev": true - }, - "camelcase-keys": { - "version": "6.2.2", - "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-6.2.2.tgz", - "integrity": "sha512-YrwaA0vEKazPBkn0ipTiMpSajYDSe+KjQfrjhcBMxJt/znbvlHd8Pw/Vamaz5EB4Wfhs3SUR3Z9mwRu/P3s3Yg==", - "dev": true, - "requires": { - "camelcase": "^5.3.1", - "map-obj": "^4.0.0", - "quick-lru": "^4.0.1" - } - }, - "dateformat": { - "version": "3.0.3", - "resolved": "https://registry.npmjs.org/dateformat/-/dateformat-3.0.3.tgz", - "integrity": "sha512-jyCETtSl3VMZMWeRo7iY1FL19ges1t55hMo5yaam4Jrsm5EPL89UQkoQRyiI+Yf4k8r2ZpdngkV8hr1lIdjb3Q==", - "dev": true - }, - "find-up": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", - "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", - "dev": true, - "requires": { - "locate-path": "^5.0.0", - "path-exists": "^4.0.0" - } - }, - "hosted-git-info": { - "version": "3.0.7", - "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-3.0.7.tgz", - "integrity": "sha512-fWqc0IcuXs+BmE9orLDyVykAG9GJtGLGuZAAqgcckPgv5xad4AcXGIv8galtQvlwutxSlaMcdw7BUtq2EIvqCQ==", - "dev": true, - "requires": { - "lru-cache": "^6.0.0" - } - }, - "indent-string": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-4.0.0.tgz", - "integrity": "sha512-EdDDZu4A2OyIK7Lr/2zG+w5jmbuk1DVBnEwREQvBzspBJkCEbRa8GxU1lghYcaGJCnRWibjDXlq779X1/y5xwg==", - "dev": true - }, - "map-obj": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-4.1.0.tgz", - "integrity": "sha512-glc9y00wgtwcDmp7GaE/0b0OnxpNJsVf3ael/An6Fe2Q51LLwN1er6sdomLRzz5h0+yMpiYLhWYF5R7HeqVd4g==", - "dev": true - }, - "meow": { - "version": "8.0.0", - "resolved": "https://registry.npmjs.org/meow/-/meow-8.0.0.tgz", - "integrity": "sha512-nbsTRz2fwniJBFgUkcdISq8y/q9n9VbiHYbfwklFh5V4V2uAcxtKQkDc0yCLPM/kP0d+inZBewn3zJqewHE7kg==", - "dev": true, - "requires": { - "@types/minimist": "^1.2.0", - "camelcase-keys": "^6.2.2", - "decamelize-keys": "^1.1.0", - "hard-rejection": "^2.1.0", - "minimist-options": "4.1.0", - "normalize-package-data": "^3.0.0", - "read-pkg-up": "^7.0.1", - "redent": "^3.0.0", - "trim-newlines": "^3.0.0", - "type-fest": "^0.18.0", - "yargs-parser": "^20.2.3" - } - }, - "normalize-package-data": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-3.0.0.tgz", - "integrity": "sha512-6lUjEI0d3v6kFrtgA/lOx4zHCWULXsFNIjHolnZCKCTLA6m/G625cdn3O7eNmT0iD3jfo6HZ9cdImGZwf21prw==", - "dev": true, - "requires": { - "hosted-git-info": "^3.0.6", - "resolve": "^1.17.0", - "semver": "^7.3.2", - "validate-npm-package-license": "^3.0.1" - }, - "dependencies": { - "semver": { - "version": "7.3.2", - "resolved": "https://registry.npmjs.org/semver/-/semver-7.3.2.tgz", - "integrity": "sha512-OrOb32TeeambH6UrhtShmF7CRDqhL6/5XpPNp2DuRH6+9QLw/orhp72j87v8Qa1ScDkvrrBNpZcDejAirJmfXQ==", - "dev": true - } - } - }, - "parse-json": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-5.1.0.tgz", - "integrity": "sha512-+mi/lmVVNKFNVyLXV31ERiy2CY5E1/F6QtJFEzoChPRwwngMNXRDQ9GJ5WdE2Z2P4AujsOi0/+2qHID68KwfIQ==", - "dev": true, - "requires": { - "@babel/code-frame": "^7.0.0", - "error-ex": "^1.3.1", - "json-parse-even-better-errors": "^2.3.0", - "lines-and-columns": "^1.1.6" - } - }, - "path-exists": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", - "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", - "dev": true - }, - "read-pkg": { - "version": "5.2.0", - "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-5.2.0.tgz", - "integrity": "sha512-Ug69mNOpfvKDAc2Q8DRpMjjzdtrnv9HcSMX+4VsZxD1aZ6ZzrIE7rlzXBtWTyhULSMKg076AW6WR5iZpD0JiOg==", - "dev": true, - "requires": { - "@types/normalize-package-data": "^2.4.0", - "normalize-package-data": "^2.5.0", - "parse-json": "^5.0.0", - "type-fest": "^0.6.0" - }, - "dependencies": { - "hosted-git-info": { - "version": "2.8.8", - "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", - "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==", - "dev": true - }, - "normalize-package-data": { - "version": "2.5.0", - "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", - "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", - "dev": true, - "requires": { - "hosted-git-info": "^2.1.4", - "resolve": "^1.10.0", - "semver": "2 || 3 || 4 || 5", - "validate-npm-package-license": "^3.0.1" - } - }, - "semver": { - "version": "5.7.1", - "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", - "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", - "dev": true - }, - "type-fest": { - "version": "0.6.0", - "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.6.0.tgz", - "integrity": "sha512-q+MB8nYR1KDLrgr4G5yemftpMC7/QLqVndBmEEdqzmNj5dcFOO4Oo8qlwZE3ULT3+Zim1F8Kq4cBnikNhlCMlg==", - "dev": true - } - } - }, - "read-pkg-up": { - "version": "7.0.1", - "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-7.0.1.tgz", - "integrity": "sha512-zK0TB7Xd6JpCLmlLmufqykGE+/TlOePD6qKClNW7hHDKFh/J7/7gCWGR7joEQEW1bKq3a3yUZSObOoWLFQ4ohg==", - "dev": true, - "requires": { - "find-up": "^4.1.0", - "read-pkg": "^5.2.0", - "type-fest": "^0.8.1" - }, - "dependencies": { - "type-fest": { - "version": "0.8.1", - "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.8.1.tgz", - "integrity": "sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==", - "dev": true - } - } - }, - "readable-stream": { - "version": "3.6.0", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", - "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", - "dev": true, - "requires": { - "inherits": "^2.0.3", - "string_decoder": "^1.1.1", - "util-deprecate": "^1.0.1" - } - }, - "redent": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/redent/-/redent-3.0.0.tgz", - "integrity": "sha512-6tDA8g98We0zd0GvVeMT9arEOnTw9qM03L9cJXaCjrip1OO764RDBLBfrB4cwzNGDj5OA5ioymC9GkizgWJDUg==", - "dev": true, - "requires": { - "indent-string": "^4.0.0", - "strip-indent": "^3.0.0" - } - }, - "resolve": { - "version": "1.19.0", - "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.19.0.tgz", - "integrity": "sha512-rArEXAgsBG4UgRGcynxWIWKFvh/XZCcS8UJdHhwy91zwAvCZIbcs+vAbflgBnNjYMs/i/i+/Ux6IZhML1yPvxg==", - "dev": true, - "requires": { - "is-core-module": "^2.1.0", - "path-parse": "^1.0.6" - } - }, - "strip-indent": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-3.0.0.tgz", - "integrity": "sha512-laJTa3Jb+VQpaC6DseHhF7dXVqHTfJPCRDaEbid/drOhgitgYku/letMUqOXFoWV0zIIUbjpdH2t+tYj4bQMRQ==", - "dev": true, - "requires": { - "min-indent": "^1.0.0" - } - }, - "through2": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/through2/-/through2-4.0.2.tgz", - "integrity": "sha512-iOqSav00cVxEEICeD7TjLB1sueEL+81Wpzp2bY17uZjZN0pWZPuo4suZ/61VujxmqSGFfgOcNuTZ85QJwNZQpw==", - "dev": true, - "requires": { - "readable-stream": "3" - } - }, - "trim-newlines": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-3.0.0.tgz", - "integrity": "sha512-C4+gOpvmxaSMKuEf9Qc134F1ZuOHVXKRbtEflf4NTtuuJDEIJ9p5PXsalL8SkeRw+qit1Mo+yuvMPAKwWg/1hA==", - "dev": true - }, - "type-fest": { - "version": "0.18.1", - "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.18.1.tgz", - "integrity": "sha512-OIAYXk8+ISY+qTOwkHtKqzAuxchoMiD9Udx+FSGQDuiRR+PJKJHc2NJAXlbhkGwTt/4/nKZxELY1w3ReWOL8mw==", - "dev": true - }, - "yargs-parser": { - "version": "20.2.4", - "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-20.2.4.tgz", - "integrity": "sha512-WOkpgNhPTlE73h4VFAFsOnomJVaovO8VqLDzy5saChRBFQFBoMYirowyW+Q9HB4HFF4Z7VZTiG3iSzJJA29yRA==", - "dev": true - } - } - }, - "conventional-commits-filter": { - "version": "2.0.7", - "resolved": "https://registry.npmjs.org/conventional-commits-filter/-/conventional-commits-filter-2.0.7.tgz", - "integrity": "sha512-ASS9SamOP4TbCClsRHxIHXRfcGCnIoQqkvAzCSbZzTFLfcTqJVugB0agRgsEELsqaeWgsXv513eS116wnlSSPA==", - "dev": true, - "requires": { - "lodash.ismatch": "^4.4.0", - "modify-values": "^1.0.0" - } - }, - "conventional-commits-parser": { - "version": "3.2.0", - "resolved": "https://registry.npmjs.org/conventional-commits-parser/-/conventional-commits-parser-3.2.0.tgz", - "integrity": "sha512-XmJiXPxsF0JhAKyfA2Nn+rZwYKJ60nanlbSWwwkGwLQFbugsc0gv1rzc7VbbUWAzJfR1qR87/pNgv9NgmxtBMQ==", - "dev": true, - "requires": { - "JSONStream": "^1.0.4", - "is-text-path": "^1.0.1", - "lodash": "^4.17.15", - "meow": "^8.0.0", - "split2": "^2.0.0", - "through2": "^4.0.0", - "trim-off-newlines": "^1.0.0" - }, - "dependencies": { - "camelcase": { - "version": "5.3.1", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", - "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", - "dev": true - }, - "camelcase-keys": { - "version": "6.2.2", - "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-6.2.2.tgz", - "integrity": "sha512-YrwaA0vEKazPBkn0ipTiMpSajYDSe+KjQfrjhcBMxJt/znbvlHd8Pw/Vamaz5EB4Wfhs3SUR3Z9mwRu/P3s3Yg==", - "dev": true, - "requires": { - "camelcase": "^5.3.1", - "map-obj": "^4.0.0", - "quick-lru": "^4.0.1" - } - }, - "find-up": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", - "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", - "dev": true, - "requires": { - "locate-path": "^5.0.0", - "path-exists": "^4.0.0" - } - }, - "hosted-git-info": { - "version": "3.0.7", - "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-3.0.7.tgz", - "integrity": "sha512-fWqc0IcuXs+BmE9orLDyVykAG9GJtGLGuZAAqgcckPgv5xad4AcXGIv8galtQvlwutxSlaMcdw7BUtq2EIvqCQ==", - "dev": true, - "requires": { - "lru-cache": "^6.0.0" - } - }, - "indent-string": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-4.0.0.tgz", - "integrity": "sha512-EdDDZu4A2OyIK7Lr/2zG+w5jmbuk1DVBnEwREQvBzspBJkCEbRa8GxU1lghYcaGJCnRWibjDXlq779X1/y5xwg==", - "dev": true - }, - "map-obj": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-4.1.0.tgz", - "integrity": "sha512-glc9y00wgtwcDmp7GaE/0b0OnxpNJsVf3ael/An6Fe2Q51LLwN1er6sdomLRzz5h0+yMpiYLhWYF5R7HeqVd4g==", - "dev": true - }, - "meow": { - "version": "8.0.0", - "resolved": "https://registry.npmjs.org/meow/-/meow-8.0.0.tgz", - "integrity": "sha512-nbsTRz2fwniJBFgUkcdISq8y/q9n9VbiHYbfwklFh5V4V2uAcxtKQkDc0yCLPM/kP0d+inZBewn3zJqewHE7kg==", - "dev": true, - "requires": { - "@types/minimist": "^1.2.0", - "camelcase-keys": "^6.2.2", - "decamelize-keys": "^1.1.0", - "hard-rejection": "^2.1.0", - "minimist-options": "4.1.0", - "normalize-package-data": "^3.0.0", - "read-pkg-up": "^7.0.1", - "redent": "^3.0.0", - "trim-newlines": "^3.0.0", - "type-fest": "^0.18.0", - "yargs-parser": "^20.2.3" - } - }, - "normalize-package-data": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-3.0.0.tgz", - "integrity": "sha512-6lUjEI0d3v6kFrtgA/lOx4zHCWULXsFNIjHolnZCKCTLA6m/G625cdn3O7eNmT0iD3jfo6HZ9cdImGZwf21prw==", - "dev": true, - "requires": { - "hosted-git-info": "^3.0.6", - "resolve": "^1.17.0", - "semver": "^7.3.2", - "validate-npm-package-license": "^3.0.1" - } - }, - "parse-json": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-5.1.0.tgz", - "integrity": "sha512-+mi/lmVVNKFNVyLXV31ERiy2CY5E1/F6QtJFEzoChPRwwngMNXRDQ9GJ5WdE2Z2P4AujsOi0/+2qHID68KwfIQ==", - "dev": true, - "requires": { - "@babel/code-frame": "^7.0.0", - "error-ex": "^1.3.1", - "json-parse-even-better-errors": "^2.3.0", - "lines-and-columns": "^1.1.6" - } - }, - "path-exists": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", - "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", - "dev": true - }, - "read-pkg": { - "version": "5.2.0", - "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-5.2.0.tgz", - "integrity": "sha512-Ug69mNOpfvKDAc2Q8DRpMjjzdtrnv9HcSMX+4VsZxD1aZ6ZzrIE7rlzXBtWTyhULSMKg076AW6WR5iZpD0JiOg==", - "dev": true, - "requires": { - "@types/normalize-package-data": "^2.4.0", - "normalize-package-data": "^2.5.0", - "parse-json": "^5.0.0", - "type-fest": "^0.6.0" - }, - "dependencies": { - "hosted-git-info": { - "version": "2.8.8", - "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", - "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==", - "dev": true - }, - "normalize-package-data": { - "version": "2.5.0", - "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", - "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", - "dev": true, - "requires": { - "hosted-git-info": "^2.1.4", - "resolve": "^1.10.0", - "semver": "2 || 3 || 4 || 5", - "validate-npm-package-license": "^3.0.1" - } - }, - "semver": { - "version": "5.7.1", - "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", - "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", - "dev": true - }, - "type-fest": { - "version": "0.6.0", - "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.6.0.tgz", - "integrity": "sha512-q+MB8nYR1KDLrgr4G5yemftpMC7/QLqVndBmEEdqzmNj5dcFOO4Oo8qlwZE3ULT3+Zim1F8Kq4cBnikNhlCMlg==", - "dev": true - } - } - }, - "read-pkg-up": { - "version": "7.0.1", - "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-7.0.1.tgz", - "integrity": "sha512-zK0TB7Xd6JpCLmlLmufqykGE+/TlOePD6qKClNW7hHDKFh/J7/7gCWGR7joEQEW1bKq3a3yUZSObOoWLFQ4ohg==", - "dev": true, - "requires": { - "find-up": "^4.1.0", - "read-pkg": "^5.2.0", - "type-fest": "^0.8.1" - }, - "dependencies": { - "type-fest": { - "version": "0.8.1", - "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.8.1.tgz", - "integrity": "sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==", - "dev": true - } - } - }, - "readable-stream": { - "version": "3.6.0", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", - "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", - "dev": true, - "requires": { - "inherits": "^2.0.3", - "string_decoder": "^1.1.1", - "util-deprecate": "^1.0.1" - } - }, - "redent": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/redent/-/redent-3.0.0.tgz", - "integrity": "sha512-6tDA8g98We0zd0GvVeMT9arEOnTw9qM03L9cJXaCjrip1OO764RDBLBfrB4cwzNGDj5OA5ioymC9GkizgWJDUg==", - "dev": true, - "requires": { - "indent-string": "^4.0.0", - "strip-indent": "^3.0.0" - } - }, - "resolve": { - "version": "1.19.0", - "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.19.0.tgz", - "integrity": "sha512-rArEXAgsBG4UgRGcynxWIWKFvh/XZCcS8UJdHhwy91zwAvCZIbcs+vAbflgBnNjYMs/i/i+/Ux6IZhML1yPvxg==", - "dev": true, - "requires": { - "is-core-module": "^2.1.0", - "path-parse": "^1.0.6" - } - }, - "semver": { - "version": "7.3.2", - "resolved": "https://registry.npmjs.org/semver/-/semver-7.3.2.tgz", - "integrity": "sha512-OrOb32TeeambH6UrhtShmF7CRDqhL6/5XpPNp2DuRH6+9QLw/orhp72j87v8Qa1ScDkvrrBNpZcDejAirJmfXQ==", - "dev": true - }, - "strip-indent": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-3.0.0.tgz", - "integrity": "sha512-laJTa3Jb+VQpaC6DseHhF7dXVqHTfJPCRDaEbid/drOhgitgYku/letMUqOXFoWV0zIIUbjpdH2t+tYj4bQMRQ==", - "dev": true, - "requires": { - "min-indent": "^1.0.0" - } - }, - "through2": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/through2/-/through2-4.0.2.tgz", - "integrity": "sha512-iOqSav00cVxEEICeD7TjLB1sueEL+81Wpzp2bY17uZjZN0pWZPuo4suZ/61VujxmqSGFfgOcNuTZ85QJwNZQpw==", - "dev": true, - "requires": { - "readable-stream": "3" - } - }, - "trim-newlines": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-3.0.0.tgz", - "integrity": "sha512-C4+gOpvmxaSMKuEf9Qc134F1ZuOHVXKRbtEflf4NTtuuJDEIJ9p5PXsalL8SkeRw+qit1Mo+yuvMPAKwWg/1hA==", - "dev": true - }, - "type-fest": { - "version": "0.18.1", - "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.18.1.tgz", - "integrity": "sha512-OIAYXk8+ISY+qTOwkHtKqzAuxchoMiD9Udx+FSGQDuiRR+PJKJHc2NJAXlbhkGwTt/4/nKZxELY1w3ReWOL8mw==", - "dev": true - }, - "yargs-parser": { - "version": "20.2.4", - "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-20.2.4.tgz", - "integrity": "sha512-WOkpgNhPTlE73h4VFAFsOnomJVaovO8VqLDzy5saChRBFQFBoMYirowyW+Q9HB4HFF4Z7VZTiG3iSzJJA29yRA==", - "dev": true - } - } - }, "convert-source-map": { "version": "1.6.0", "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.6.0.tgz", @@ -3850,16 +2636,6 @@ "integrity": "sha1-Z29us8OZl8LuGsOpJP1hJHSPV40=", "dev": true }, - "copy-props": { - "version": "2.0.4", - "resolved": "https://registry.npmjs.org/copy-props/-/copy-props-2.0.4.tgz", - "integrity": "sha512-7cjuUME+p+S3HZlbllgsn2CDwS+5eCCX16qBgNC4jgSTf49qR1VKy/Zhl400m0IQXl/bPGEVqncgUUMjrr4s8A==", - "dev": true, - "requires": { - "each-props": "^1.3.0", - "is-plain-object": "^2.0.1" - } - }, "core-util-is": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz", @@ -3974,40 +2750,12 @@ } } }, - "currently-unhandled": { - "version": "0.4.1", - "resolved": "https://registry.npmjs.org/currently-unhandled/-/currently-unhandled-0.4.1.tgz", - "integrity": "sha1-mI3zP+qxke95mmE2nddsF635V+o=", - "dev": true, - "requires": { - "array-find-index": "^1.0.1" - } - }, "cyclist": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/cyclist/-/cyclist-1.0.1.tgz", "integrity": "sha1-WW6WmP0MgOEgOMK4LW6xs1tiJNk=", "dev": true }, - "d": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/d/-/d-1.0.1.tgz", - "integrity": "sha512-m62ShEObQ39CfralilEQRjH6oAMtNCV1xJyEx5LpRYUVN+EviphDgUc/F3hnYbADmkiNs67Y+3ylmlG7Lnu+FA==", - "dev": true, - "requires": { - "es5-ext": "^0.10.50", - "type": "^1.0.1" - } - }, - "dargs": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/dargs/-/dargs-4.1.0.tgz", - "integrity": "sha1-A6nbtLXC8Tm/FK5T8LiipqhvThc=", - "dev": true, - "requires": { - "number-is-nan": "^1.0.0" - } - }, "dashdash": { "version": "1.14.1", "resolved": "https://registry.npmjs.org/dashdash/-/dashdash-1.14.1.tgz", @@ -4028,16 +2776,6 @@ "whatwg-url": "^7.0.0" } }, - "dateformat": { - "version": "1.0.12", - "resolved": "https://registry.npmjs.org/dateformat/-/dateformat-1.0.12.tgz", - "integrity": "sha1-nxJLZ1lMk3/3BpMuSmQsyo27/uk=", - "dev": true, - "requires": { - "get-stdin": "^4.0.1", - "meow": "^3.3.0" - } - }, "debug": { "version": "4.1.1", "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", @@ -4053,16 +2791,6 @@ "integrity": "sha1-9lNNFRSCabIDUue+4m9QH5oZEpA=", "dev": true }, - "decamelize-keys": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/decamelize-keys/-/decamelize-keys-1.1.0.tgz", - "integrity": "sha1-0XGoeTMlKAfrPLYdwcFEXQeN8tk=", - "dev": true, - "requires": { - "decamelize": "^1.1.0", - "map-obj": "^1.0.0" - } - }, "decode-uri-component": { "version": "0.2.0", "resolved": "https://registry.npmjs.org/decode-uri-component/-/decode-uri-component-0.2.0.tgz", @@ -4095,23 +2823,6 @@ "integrity": "sha512-FJ3UgI4gIl+PHZm53knsuSFpE+nESMr7M4v9QcgB7S63Kj/6WqMiFQJpBBYz1Pt+66bZpP3Q7Lye0Oo9MPKEdg==", "dev": true }, - "default-compare": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/default-compare/-/default-compare-1.0.0.tgz", - "integrity": "sha512-QWfXlM0EkAbqOCbD/6HjdwT19j7WCkMyiRhWilc4H9/5h/RzTF9gv5LYh1+CmDV5d1rki6KAWLtQale0xt20eQ==", - "dev": true, - "requires": { - "kind-of": "^5.0.2" - }, - "dependencies": { - "kind-of": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz", - "integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==", - "dev": true - } - } - }, "default-gateway": { "version": "4.2.0", "resolved": "https://registry.npmjs.org/default-gateway/-/default-gateway-4.2.0.tgz", @@ -4122,12 +2833,6 @@ "ip-regex": "^2.1.0" } }, - "default-resolution": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/default-resolution/-/default-resolution-2.0.0.tgz", - "integrity": "sha1-vLgrqnKtebQmp2cy8aga1t8m1oQ=", - "dev": true - }, "define-properties": { "version": "1.1.3", "resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.1.3.tgz", @@ -4327,50 +3032,6 @@ "webidl-conversions": "^4.0.2" } }, - "dot-prop": { - "version": "5.3.0", - "resolved": "https://registry.npmjs.org/dot-prop/-/dot-prop-5.3.0.tgz", - "integrity": "sha512-QM8q3zDe58hqUqjraQOmzZ1LIH9SWQJTlEKCH4kJ2oQvLZk7RbQXvtDM2XEq3fwkV9CCvvH4LA0AV+ogFsBM2Q==", - "dev": true, - "requires": { - "is-obj": "^2.0.0" - } - }, - "duplexer2": { - "version": "0.0.2", - "resolved": "https://registry.npmjs.org/duplexer2/-/duplexer2-0.0.2.tgz", - "integrity": "sha1-xhTc9n4vsUmVqRcR5aYX6KYKMds=", - "dev": true, - "requires": { - "readable-stream": "~1.1.9" - }, - "dependencies": { - "isarray": { - "version": "0.0.1", - "resolved": "https://registry.npmjs.org/isarray/-/isarray-0.0.1.tgz", - "integrity": "sha1-ihis/Kmo9Bd+Cav8YDiTmwXR7t8=", - "dev": true - }, - "readable-stream": { - "version": "1.1.14", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-1.1.14.tgz", - "integrity": "sha1-fPTFTvZI44EwhMY23SB54WbAgdk=", - "dev": true, - "requires": { - "core-util-is": "~1.0.0", - "inherits": "~2.0.1", - "isarray": "0.0.1", - "string_decoder": "~0.10.x" - } - }, - "string_decoder": { - "version": "0.10.31", - "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-0.10.31.tgz", - "integrity": "sha1-YuIDvEF2bGwoyfyEMB2rHFMQ+pQ=", - "dev": true - } - } - }, "duplexify": { "version": "3.7.1", "resolved": "https://registry.npmjs.org/duplexify/-/duplexify-3.7.1.tgz", @@ -4383,16 +3044,6 @@ "stream-shift": "^1.0.0" } }, - "each-props": { - "version": "1.3.2", - "resolved": "https://registry.npmjs.org/each-props/-/each-props-1.3.2.tgz", - "integrity": "sha512-vV0Hem3zAGkJAyU7JSjixeU66rwdynTAa1vofCrSA5fEln+m67Az9CcnkVD776/fsN/UjIWmBDoNRS6t6G9RfA==", - "dev": true, - "requires": { - "is-plain-object": "^2.0.1", - "object.defaults": "^1.1.0" - } - }, "ecc-jsbn": { "version": "0.1.2", "resolved": "https://registry.npmjs.org/ecc-jsbn/-/ecc-jsbn-0.1.2.tgz", @@ -4551,50 +3202,6 @@ "is-symbol": "^1.0.2" } }, - "es5-ext": { - "version": "0.10.51", - "resolved": "https://registry.npmjs.org/es5-ext/-/es5-ext-0.10.51.tgz", - "integrity": "sha512-oRpWzM2WcLHVKpnrcyB7OW8j/s67Ba04JCm0WnNv3RiABSvs7mrQlutB8DBv793gKcp0XENR8Il8WxGTlZ73gQ==", - "dev": true, - "requires": { - "es6-iterator": "~2.0.3", - "es6-symbol": "~3.1.1", - "next-tick": "^1.0.0" - } - }, - "es6-iterator": { - "version": "2.0.3", - "resolved": "https://registry.npmjs.org/es6-iterator/-/es6-iterator-2.0.3.tgz", - "integrity": "sha1-p96IkUGgWpSwhUQDstCg+/qY87c=", - "dev": true, - "requires": { - "d": "1", - "es5-ext": "^0.10.35", - "es6-symbol": "^3.1.1" - } - }, - "es6-symbol": { - "version": "3.1.2", - "resolved": "https://registry.npmjs.org/es6-symbol/-/es6-symbol-3.1.2.tgz", - "integrity": "sha512-/ZypxQsArlv+KHpGvng52/Iz8by3EQPxhmbuz8yFG89N/caTFBSbcXONDw0aMjy827gQg26XAjP4uXFvnfINmQ==", - "dev": true, - "requires": { - "d": "^1.0.1", - "es5-ext": "^0.10.51" - } - }, - "es6-weak-map": { - "version": "2.0.3", - "resolved": "https://registry.npmjs.org/es6-weak-map/-/es6-weak-map-2.0.3.tgz", - "integrity": "sha512-p5um32HOTO1kP+w7PRnB+5lQ43Z6muuMuIMffvDN8ZB4GcnjLBV6zGStpbASIMk4DCAvEaamhe2zhyCb/QXXsA==", - "dev": true, - "requires": { - "d": "1", - "es5-ext": "^0.10.46", - "es6-iterator": "^2.0.3", - "es6-symbol": "^3.1.1" - } - }, "escape-html": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", @@ -5290,16 +3897,6 @@ "pkg-dir": "^3.0.0" } }, - "find-up": { - "version": "1.1.2", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-1.1.2.tgz", - "integrity": "sha1-ay6YIrGizgpgq2TWEOzK1TyyTQ8=", - "dev": true, - "requires": { - "path-exists": "^2.0.0", - "pinkie-promise": "^2.0.0" - } - }, "findup-sync": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/findup-sync/-/findup-sync-3.0.0.tgz", @@ -5312,34 +3909,6 @@ "resolve-dir": "^1.0.1" } }, - "fined": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/fined/-/fined-1.2.0.tgz", - "integrity": "sha512-ZYDqPLGxDkDhDZBjZBb+oD1+j0rA4E0pXY50eplAAOPg2N/gUBSSk5IM1/QhPfyVo19lJ+CvXpqfvk+b2p/8Ng==", - "dev": true, - "requires": { - "expand-tilde": "^2.0.2", - "is-plain-object": "^2.0.3", - "object.defaults": "^1.1.0", - "object.pick": "^1.2.0", - "parse-filepath": "^1.0.1" - } - }, - "first-chunk-stream": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/first-chunk-stream/-/first-chunk-stream-2.0.0.tgz", - "integrity": "sha1-G97NuOCDwGZLkZRVgVd6Q6nzHXA=", - "dev": true, - "requires": { - "readable-stream": "^2.0.2" - } - }, - "flagged-respawn": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/flagged-respawn/-/flagged-respawn-1.0.1.tgz", - "integrity": "sha512-lNaHNVymajmk0OJMBn8fVUAU1BtDeKIqKoVhk4xAALB57aALg6b4W0MfJ/cUE0g9YBXy5XhSlPIpYIJ7HaY/3Q==", - "dev": true - }, "flat-cache": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/flat-cache/-/flat-cache-2.0.1.tgz", @@ -5379,15 +3948,6 @@ "integrity": "sha1-gQaNKVqBQuwKxybG4iAMMPttXoA=", "dev": true }, - "for-own": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/for-own/-/for-own-1.0.0.tgz", - "integrity": "sha1-xjMy9BXO3EsE2/5wz4NklMU8tEs=", - "dev": true, - "requires": { - "for-in": "^1.0.1" - } - }, "forever-agent": { "version": "0.6.1", "resolved": "https://registry.npmjs.org/forever-agent/-/forever-agent-0.6.1.tgz", @@ -5442,16 +4002,6 @@ "integrity": "sha512-y6OAwoSIf7FyjMIv94u+b5rdheZEjzR63GTyZJm5qh4Bi+2YgwLCcI/fPFZkL5PSixOt6ZNKm+w+Hfp/Bciwow==", "dev": true }, - "fs-mkdirp-stream": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/fs-mkdirp-stream/-/fs-mkdirp-stream-1.0.0.tgz", - "integrity": "sha1-C3gV/DIBxqaeFNuYzgmMFpNSWes=", - "dev": true, - "requires": { - "graceful-fs": "^4.1.11", - "through2": "^2.0.3" - } - }, "fs-write-stream-atomic": { "version": "1.0.10", "resolved": "https://registry.npmjs.org/fs-write-stream-atomic/-/fs-write-stream-atomic-1.0.10.tgz", @@ -6036,12 +4586,6 @@ "integrity": "sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg==", "dev": true }, - "get-caller-file": { - "version": "1.0.3", - "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-1.0.3.tgz", - "integrity": "sha512-3t6rVToeoZfYSGd8YoLFR2DJkiQrIiUrGcjvFX2mDw3bn6k2OtwHN0TNCLbBO+w8qTvimhDkv+LSscbJY1vE6w==", - "dev": true - }, "get-intrinsic": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.0.1.tgz", @@ -6067,25 +4611,6 @@ "integrity": "sha512-pjzuKtY64GYfWizNAJ0fr9VqttZkNiK2iS430LtIHzjBEr6bX8Am2zm4sW4Ro5wjWW5cAlRL1qAMTcXbjNAO2Q==", "dev": true }, - "get-pkg-repo": { - "version": "1.4.0", - "resolved": "https://registry.npmjs.org/get-pkg-repo/-/get-pkg-repo-1.4.0.tgz", - "integrity": "sha1-xztInAbYDMVTbCyFP54FIyBWly0=", - "dev": true, - "requires": { - "hosted-git-info": "^2.1.4", - "meow": "^3.3.0", - "normalize-package-data": "^2.3.0", - "parse-github-repo-url": "^1.3.0", - "through2": "^2.0.0" - } - }, - "get-stdin": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/get-stdin/-/get-stdin-4.0.1.tgz", - "integrity": "sha1-uWjGsKBDhDJJAui/Gl3zJXmkUP4=", - "dev": true - }, "get-stream": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-4.1.0.tgz", @@ -6122,464 +4647,6 @@ "assert-plus": "^1.0.0" } }, - "git-raw-commits": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/git-raw-commits/-/git-raw-commits-2.0.0.tgz", - "integrity": "sha512-w4jFEJFgKXMQJ0H0ikBk2S+4KP2VEjhCvLCNqbNRQC8BgGWgLKNCO7a9K9LI+TVT7Gfoloje502sEnctibffgg==", - "dev": true, - "requires": { - "dargs": "^4.0.1", - "lodash.template": "^4.0.2", - "meow": "^4.0.0", - "split2": "^2.0.0", - "through2": "^2.0.0" - }, - "dependencies": { - "camelcase": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz", - "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=", - "dev": true - }, - "camelcase-keys": { - "version": "4.2.0", - "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-4.2.0.tgz", - "integrity": "sha1-oqpfsa9oh1glnDLBQUJteJI7m3c=", - "dev": true, - "requires": { - "camelcase": "^4.1.0", - "map-obj": "^2.0.0", - "quick-lru": "^1.0.0" - } - }, - "find-up": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-2.1.0.tgz", - "integrity": "sha1-RdG35QbHF93UgndaK3eSCjwMV6c=", - "dev": true, - "requires": { - "locate-path": "^2.0.0" - } - }, - "indent-string": { - "version": "3.2.0", - "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-3.2.0.tgz", - "integrity": "sha1-Sl/W0nzDMvN+VBmlBNu4NxBckok=", - "dev": true - }, - "load-json-file": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-4.0.0.tgz", - "integrity": "sha1-L19Fq5HjMhYjT9U62rZo607AmTs=", - "dev": true, - "requires": { - "graceful-fs": "^4.1.2", - "parse-json": "^4.0.0", - "pify": "^3.0.0", - "strip-bom": "^3.0.0" - } - }, - "locate-path": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-2.0.0.tgz", - "integrity": "sha1-K1aLJl7slExtnA3pw9u7ygNUzY4=", - "dev": true, - "requires": { - "p-locate": "^2.0.0", - "path-exists": "^3.0.0" - } - }, - "map-obj": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-2.0.0.tgz", - "integrity": "sha1-plzSkIepJZi4eRJXpSPgISIqwfk=", - "dev": true - }, - "meow": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/meow/-/meow-4.0.1.tgz", - "integrity": "sha512-xcSBHD5Z86zaOc+781KrupuHAzeGXSLtiAOmBsiLDiPSaYSB6hdew2ng9EBAnZ62jagG9MHAOdxpDi/lWBFJ/A==", - "dev": true, - "requires": { - "camelcase-keys": "^4.0.0", - "decamelize-keys": "^1.0.0", - "loud-rejection": "^1.0.0", - "minimist": "^1.1.3", - "minimist-options": "^3.0.1", - "normalize-package-data": "^2.3.4", - "read-pkg-up": "^3.0.0", - "redent": "^2.0.0", - "trim-newlines": "^2.0.0" - } - }, - "minimist-options": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/minimist-options/-/minimist-options-3.0.2.tgz", - "integrity": "sha512-FyBrT/d0d4+uiZRbqznPXqw3IpZZG3gl3wKWiX784FycUKVwBt0uLBFkQrtE4tZOrgo78nZp2jnKz3L65T5LdQ==", - "dev": true, - "requires": { - "arrify": "^1.0.1", - "is-plain-obj": "^1.1.0" - } - }, - "p-limit": { - "version": "1.3.0", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-1.3.0.tgz", - "integrity": "sha512-vvcXsLAJ9Dr5rQOPk7toZQZJApBl2K4J6dANSsEuh6QI41JYcsS/qhTGa9ErIUUgK3WNQoJYvylxvjqmiqEA9Q==", - "dev": true, - "requires": { - "p-try": "^1.0.0" - } - }, - "p-locate": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-2.0.0.tgz", - "integrity": "sha1-IKAQOyIqcMj9OcwuWAaA893l7EM=", - "dev": true, - "requires": { - "p-limit": "^1.1.0" - } - }, - "p-try": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/p-try/-/p-try-1.0.0.tgz", - "integrity": "sha1-y8ec26+P1CKOE/Yh8rGiN8GyB7M=", - "dev": true - }, - "parse-json": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz", - "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=", - "dev": true, - "requires": { - "error-ex": "^1.3.1", - "json-parse-better-errors": "^1.0.1" - } - }, - "path-exists": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", - "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", - "dev": true - }, - "path-type": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/path-type/-/path-type-3.0.0.tgz", - "integrity": "sha512-T2ZUsdZFHgA3u4e5PfPbjd7HDDpxPnQb5jN0SrDsjNSuVXHJqtwTnWqG0B1jZrgmJ/7lj1EmVIByWt1gxGkWvg==", - "dev": true, - "requires": { - "pify": "^3.0.0" - } - }, - "pify": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz", - "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=", - "dev": true - }, - "quick-lru": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/quick-lru/-/quick-lru-1.1.0.tgz", - "integrity": "sha1-Q2CxfGETatOAeDl/8RQW4Ybc+7g=", - "dev": true - }, - "read-pkg": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-3.0.0.tgz", - "integrity": "sha1-nLxoaXj+5l0WwA4rGcI3/Pbjg4k=", - "dev": true, - "requires": { - "load-json-file": "^4.0.0", - "normalize-package-data": "^2.3.2", - "path-type": "^3.0.0" - } - }, - "read-pkg-up": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-3.0.0.tgz", - "integrity": "sha1-PtSWaF26D4/hGNBpHcUfSh/5bwc=", - "dev": true, - "requires": { - "find-up": "^2.0.0", - "read-pkg": "^3.0.0" - } - }, - "redent": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/redent/-/redent-2.0.0.tgz", - "integrity": "sha1-wbIAe0LVfrE4kHmzyDM2OdXhzKo=", - "dev": true, - "requires": { - "indent-string": "^3.0.0", - "strip-indent": "^2.0.0" - } - }, - "strip-bom": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-3.0.0.tgz", - "integrity": "sha1-IzTBjpx1n3vdVv3vfprj1YjmjtM=", - "dev": true - }, - "strip-indent": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-2.0.0.tgz", - "integrity": "sha1-XvjbKV0B5u1sv3qrlpmNeCJSe2g=", - "dev": true - }, - "trim-newlines": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-2.0.0.tgz", - "integrity": "sha1-tAPQuRvlDDMd/EuC7s6yLD3hbSA=", - "dev": true - } - } - }, - "git-remote-origin-url": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/git-remote-origin-url/-/git-remote-origin-url-2.0.0.tgz", - "integrity": "sha1-UoJlna4hBxRaERJhEq0yFuxfpl8=", - "dev": true, - "requires": { - "gitconfiglocal": "^1.0.0", - "pify": "^2.3.0" - } - }, - "git-semver-tags": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/git-semver-tags/-/git-semver-tags-4.1.1.tgz", - "integrity": "sha512-OWyMt5zBe7xFs8vglMmhM9lRQzCWL3WjHtxNNfJTMngGym7pC1kh8sP6jevfydJ6LP3ZvGxfb6ABYgPUM0mtsA==", - "dev": true, - "requires": { - "meow": "^8.0.0", - "semver": "^6.0.0" - }, - "dependencies": { - "camelcase": { - "version": "5.3.1", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", - "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", - "dev": true - }, - "camelcase-keys": { - "version": "6.2.2", - "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-6.2.2.tgz", - "integrity": "sha512-YrwaA0vEKazPBkn0ipTiMpSajYDSe+KjQfrjhcBMxJt/znbvlHd8Pw/Vamaz5EB4Wfhs3SUR3Z9mwRu/P3s3Yg==", - "dev": true, - "requires": { - "camelcase": "^5.3.1", - "map-obj": "^4.0.0", - "quick-lru": "^4.0.1" - } - }, - "find-up": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", - "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", - "dev": true, - "requires": { - "locate-path": "^5.0.0", - "path-exists": "^4.0.0" - } - }, - "hosted-git-info": { - "version": "3.0.7", - "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-3.0.7.tgz", - "integrity": "sha512-fWqc0IcuXs+BmE9orLDyVykAG9GJtGLGuZAAqgcckPgv5xad4AcXGIv8galtQvlwutxSlaMcdw7BUtq2EIvqCQ==", - "dev": true, - "requires": { - "lru-cache": "^6.0.0" - } - }, - "indent-string": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-4.0.0.tgz", - "integrity": "sha512-EdDDZu4A2OyIK7Lr/2zG+w5jmbuk1DVBnEwREQvBzspBJkCEbRa8GxU1lghYcaGJCnRWibjDXlq779X1/y5xwg==", - "dev": true - }, - "map-obj": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-4.1.0.tgz", - "integrity": "sha512-glc9y00wgtwcDmp7GaE/0b0OnxpNJsVf3ael/An6Fe2Q51LLwN1er6sdomLRzz5h0+yMpiYLhWYF5R7HeqVd4g==", - "dev": true - }, - "meow": { - "version": "8.0.0", - "resolved": "https://registry.npmjs.org/meow/-/meow-8.0.0.tgz", - "integrity": "sha512-nbsTRz2fwniJBFgUkcdISq8y/q9n9VbiHYbfwklFh5V4V2uAcxtKQkDc0yCLPM/kP0d+inZBewn3zJqewHE7kg==", - "dev": true, - "requires": { - "@types/minimist": "^1.2.0", - "camelcase-keys": "^6.2.2", - "decamelize-keys": "^1.1.0", - "hard-rejection": "^2.1.0", - "minimist-options": "4.1.0", - "normalize-package-data": "^3.0.0", - "read-pkg-up": "^7.0.1", - "redent": "^3.0.0", - "trim-newlines": "^3.0.0", - "type-fest": "^0.18.0", - "yargs-parser": "^20.2.3" - } - }, - "normalize-package-data": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-3.0.0.tgz", - "integrity": "sha512-6lUjEI0d3v6kFrtgA/lOx4zHCWULXsFNIjHolnZCKCTLA6m/G625cdn3O7eNmT0iD3jfo6HZ9cdImGZwf21prw==", - "dev": true, - "requires": { - "hosted-git-info": "^3.0.6", - "resolve": "^1.17.0", - "semver": "^7.3.2", - "validate-npm-package-license": "^3.0.1" - }, - "dependencies": { - "semver": { - "version": "7.3.2", - "resolved": "https://registry.npmjs.org/semver/-/semver-7.3.2.tgz", - "integrity": "sha512-OrOb32TeeambH6UrhtShmF7CRDqhL6/5XpPNp2DuRH6+9QLw/orhp72j87v8Qa1ScDkvrrBNpZcDejAirJmfXQ==", - "dev": true - } - } - }, - "parse-json": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-5.1.0.tgz", - "integrity": "sha512-+mi/lmVVNKFNVyLXV31ERiy2CY5E1/F6QtJFEzoChPRwwngMNXRDQ9GJ5WdE2Z2P4AujsOi0/+2qHID68KwfIQ==", - "dev": true, - "requires": { - "@babel/code-frame": "^7.0.0", - "error-ex": "^1.3.1", - "json-parse-even-better-errors": "^2.3.0", - "lines-and-columns": "^1.1.6" - } - }, - "path-exists": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", - "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", - "dev": true - }, - "read-pkg": { - "version": "5.2.0", - "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-5.2.0.tgz", - "integrity": "sha512-Ug69mNOpfvKDAc2Q8DRpMjjzdtrnv9HcSMX+4VsZxD1aZ6ZzrIE7rlzXBtWTyhULSMKg076AW6WR5iZpD0JiOg==", - "dev": true, - "requires": { - "@types/normalize-package-data": "^2.4.0", - "normalize-package-data": "^2.5.0", - "parse-json": "^5.0.0", - "type-fest": "^0.6.0" - }, - "dependencies": { - "hosted-git-info": { - "version": "2.8.8", - "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", - "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==", - "dev": true - }, - "normalize-package-data": { - "version": "2.5.0", - "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", - "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", - "dev": true, - "requires": { - "hosted-git-info": "^2.1.4", - "resolve": "^1.10.0", - "semver": "2 || 3 || 4 || 5", - "validate-npm-package-license": "^3.0.1" - } - }, - "semver": { - "version": "5.7.1", - "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", - "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", - "dev": true - }, - "type-fest": { - "version": "0.6.0", - "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.6.0.tgz", - "integrity": "sha512-q+MB8nYR1KDLrgr4G5yemftpMC7/QLqVndBmEEdqzmNj5dcFOO4Oo8qlwZE3ULT3+Zim1F8Kq4cBnikNhlCMlg==", - "dev": true - } - } - }, - "read-pkg-up": { - "version": "7.0.1", - "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-7.0.1.tgz", - "integrity": "sha512-zK0TB7Xd6JpCLmlLmufqykGE+/TlOePD6qKClNW7hHDKFh/J7/7gCWGR7joEQEW1bKq3a3yUZSObOoWLFQ4ohg==", - "dev": true, - "requires": { - "find-up": "^4.1.0", - "read-pkg": "^5.2.0", - "type-fest": "^0.8.1" - }, - "dependencies": { - "type-fest": { - "version": "0.8.1", - "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.8.1.tgz", - "integrity": "sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==", - "dev": true - } - } - }, - "redent": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/redent/-/redent-3.0.0.tgz", - "integrity": "sha512-6tDA8g98We0zd0GvVeMT9arEOnTw9qM03L9cJXaCjrip1OO764RDBLBfrB4cwzNGDj5OA5ioymC9GkizgWJDUg==", - "dev": true, - "requires": { - "indent-string": "^4.0.0", - "strip-indent": "^3.0.0" - } - }, - "resolve": { - "version": "1.19.0", - "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.19.0.tgz", - "integrity": "sha512-rArEXAgsBG4UgRGcynxWIWKFvh/XZCcS8UJdHhwy91zwAvCZIbcs+vAbflgBnNjYMs/i/i+/Ux6IZhML1yPvxg==", - "dev": true, - "requires": { - "is-core-module": "^2.1.0", - "path-parse": "^1.0.6" - } - }, - "strip-indent": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-3.0.0.tgz", - "integrity": "sha512-laJTa3Jb+VQpaC6DseHhF7dXVqHTfJPCRDaEbid/drOhgitgYku/letMUqOXFoWV0zIIUbjpdH2t+tYj4bQMRQ==", - "dev": true, - "requires": { - "min-indent": "^1.0.0" - } - }, - "trim-newlines": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-3.0.0.tgz", - "integrity": "sha512-C4+gOpvmxaSMKuEf9Qc134F1ZuOHVXKRbtEflf4NTtuuJDEIJ9p5PXsalL8SkeRw+qit1Mo+yuvMPAKwWg/1hA==", - "dev": true - }, - "type-fest": { - "version": "0.18.1", - "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.18.1.tgz", - "integrity": "sha512-OIAYXk8+ISY+qTOwkHtKqzAuxchoMiD9Udx+FSGQDuiRR+PJKJHc2NJAXlbhkGwTt/4/nKZxELY1w3ReWOL8mw==", - "dev": true - }, - "yargs-parser": { - "version": "20.2.4", - "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-20.2.4.tgz", - "integrity": "sha512-WOkpgNhPTlE73h4VFAFsOnomJVaovO8VqLDzy5saChRBFQFBoMYirowyW+Q9HB4HFF4Z7VZTiG3iSzJJA29yRA==", - "dev": true - } - } - }, - "gitconfiglocal": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/gitconfiglocal/-/gitconfiglocal-1.0.0.tgz", - "integrity": "sha1-QdBF84UaXqiPA/JMocYXgRRGS5s=", - "dev": true, - "requires": { - "ini": "^1.3.2" - } - }, "glob": { "version": "7.1.4", "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.4.tgz", @@ -6603,59 +4670,6 @@ "is-glob": "^4.0.1" } }, - "glob-stream": { - "version": "6.1.0", - "resolved": "https://registry.npmjs.org/glob-stream/-/glob-stream-6.1.0.tgz", - "integrity": "sha1-cEXJlBOz65SIjYOrRtC0BMx73eQ=", - "dev": true, - "requires": { - "extend": "^3.0.0", - "glob": "^7.1.1", - "glob-parent": "^3.1.0", - "is-negated-glob": "^1.0.0", - "ordered-read-streams": "^1.0.0", - "pumpify": "^1.3.5", - "readable-stream": "^2.1.5", - "remove-trailing-separator": "^1.0.1", - "to-absolute-glob": "^2.0.0", - "unique-stream": "^2.0.2" - }, - "dependencies": { - "glob-parent": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-3.1.0.tgz", - "integrity": "sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=", - "dev": true, - "requires": { - "is-glob": "^3.1.0", - "path-dirname": "^1.0.0" - } - }, - "is-glob": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-3.1.0.tgz", - "integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=", - "dev": true, - "requires": { - "is-extglob": "^2.1.0" - } - } - } - }, - "glob-watcher": { - "version": "5.0.3", - "resolved": "https://registry.npmjs.org/glob-watcher/-/glob-watcher-5.0.3.tgz", - "integrity": "sha512-8tWsULNEPHKQ2MR4zXuzSmqbdyV5PtwwCaWSGQ1WwHsJ07ilNeN1JB8ntxhckbnpSHaf9dXFUHzIWvm1I13dsg==", - "dev": true, - "requires": { - "anymatch": "^2.0.0", - "async-done": "^1.2.0", - "chokidar": "^2.0.0", - "is-negated-glob": "^1.0.0", - "just-debounce": "^1.0.0", - "object.defaults": "^1.1.0" - } - }, "global-modules": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/global-modules/-/global-modules-1.0.0.tgz", @@ -6699,15 +4713,6 @@ "pinkie-promise": "^2.0.0" } }, - "glogg": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/glogg/-/glogg-1.0.2.tgz", - "integrity": "sha512-5mwUoSuBk44Y4EshyiqcH95ZntbDdTQqA3QYSrxmzj28Ai0vXBGMH1ApSANH14j2sIRtqCEyg6PfsuP7ElOEDA==", - "dev": true, - "requires": { - "sparkles": "^1.0.0" - } - }, "graceful-fs": { "version": "4.2.2", "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.2.tgz", @@ -6721,359 +4726,12 @@ "dev": true, "optional": true }, - "gulp": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/gulp/-/gulp-4.0.2.tgz", - "integrity": "sha512-dvEs27SCZt2ibF29xYgmnwwCYZxdxhQ/+LFWlbAW8y7jt68L/65402Lz3+CKy0Ov4rOs+NERmDq7YlZaDqUIfA==", - "dev": true, - "requires": { - "glob-watcher": "^5.0.3", - "gulp-cli": "^2.2.0", - "undertaker": "^1.2.1", - "vinyl-fs": "^3.0.0" - }, - "dependencies": { - "gulp-cli": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/gulp-cli/-/gulp-cli-2.2.0.tgz", - "integrity": "sha512-rGs3bVYHdyJpLqR0TUBnlcZ1O5O++Zs4bA0ajm+zr3WFCfiSLjGwoCBqFs18wzN+ZxahT9DkOK5nDf26iDsWjA==", - "dev": true, - "requires": { - "ansi-colors": "^1.0.1", - "archy": "^1.0.0", - "array-sort": "^1.0.0", - "color-support": "^1.1.3", - "concat-stream": "^1.6.0", - "copy-props": "^2.0.1", - "fancy-log": "^1.3.2", - "gulplog": "^1.0.0", - "interpret": "^1.1.0", - "isobject": "^3.0.1", - "liftoff": "^3.1.0", - "matchdep": "^2.0.0", - "mute-stdout": "^1.0.0", - "pretty-hrtime": "^1.0.0", - "replace-homedir": "^1.0.0", - "semver-greatest-satisfied-range": "^1.1.0", - "v8flags": "^3.0.1", - "yargs": "^7.1.0" - } - } - } - }, - "gulp-bump": { - "version": "2.9.0", - "resolved": "https://registry.npmjs.org/gulp-bump/-/gulp-bump-2.9.0.tgz", - "integrity": "sha512-Cu+QOhwb2Jr2K6yo2u2mh4GWQRpSAMZD/z0v8FStlrOGaqML9u1On7XcyR1pS/PN3HQ9wsd/Ks6AcCQb+j3BgA==", - "dev": true, - "requires": { - "bump-regex": "^2.9.0", - "plugin-error": "^0.1.2", - "plugin-log": "^0.1.0", - "semver": "^5.3.0", - "through2": "^2.0.1" - }, - "dependencies": { - "semver": { - "version": "5.7.1", - "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", - "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", - "dev": true - } - } - }, - "gulp-conventional-changelog": { - "version": "2.0.35", - "resolved": "https://registry.npmjs.org/gulp-conventional-changelog/-/gulp-conventional-changelog-2.0.35.tgz", - "integrity": "sha512-9khc2fGUc6qWUoQYnqck6/d28lIgP+49kOyYtOIJtp6pthqikSL1UQ8n+Erg9X/z83+z9OX1HWWuVIXbpxvdkw==", - "dev": true, - "requires": { - "add-stream": "^1.0.0", - "concat-stream": "^2.0.0", - "conventional-changelog": "^3.1.24", - "fancy-log": "^1.3.2", - "object-assign": "^4.0.1", - "plugin-error": "^1.0.1", - "through2": "^4.0.0" - }, - "dependencies": { - "concat-stream": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/concat-stream/-/concat-stream-2.0.0.tgz", - "integrity": "sha512-MWufYdFw53ccGjCA+Ol7XJYpAlW6/prSMzuPOTRnJGcGzuhLn4Scrz7qf6o8bROZ514ltazcIFJZevcfbo0x7A==", - "dev": true, - "requires": { - "buffer-from": "^1.0.0", - "inherits": "^2.0.3", - "readable-stream": "^3.0.2", - "typedarray": "^0.0.6" - } - }, - "plugin-error": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/plugin-error/-/plugin-error-1.0.1.tgz", - "integrity": "sha512-L1zP0dk7vGweZME2i+EeakvUNqSrdiI3F91TwEoYiGrAfUXmVv6fJIq4g82PAXxNsWOp0J7ZqQy/3Szz0ajTxA==", - "dev": true, - "requires": { - "ansi-colors": "^1.0.1", - "arr-diff": "^4.0.0", - "arr-union": "^3.1.0", - "extend-shallow": "^3.0.2" - } - }, - "readable-stream": { - "version": "3.6.0", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", - "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", - "dev": true, - "requires": { - "inherits": "^2.0.3", - "string_decoder": "^1.1.1", - "util-deprecate": "^1.0.1" - } - }, - "through2": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/through2/-/through2-4.0.2.tgz", - "integrity": "sha512-iOqSav00cVxEEICeD7TjLB1sueEL+81Wpzp2bY17uZjZN0pWZPuo4suZ/61VujxmqSGFfgOcNuTZ85QJwNZQpw==", - "dev": true, - "requires": { - "readable-stream": "3" - } - } - } - }, - "gulp-git": { - "version": "2.9.0", - "resolved": "https://registry.npmjs.org/gulp-git/-/gulp-git-2.9.0.tgz", - "integrity": "sha512-66ZCwlCCf0YXEUedDbx76p0ii6aQ6aUHC4oSytn3UM8J6VWJKYF4PBARMIgR/POGWyYeN7hjd81Elpjn/o4+Tg==", - "dev": true, - "requires": { - "any-shell-escape": "^0.1.1", - "fancy-log": "^1.3.2", - "lodash.template": "^4.4.0", - "plugin-error": "^1.0.1", - "require-dir": "^1.0.0", - "strip-bom-stream": "^3.0.0", - "through2": "^2.0.3", - "vinyl": "^2.0.1" - }, - "dependencies": { - "plugin-error": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/plugin-error/-/plugin-error-1.0.1.tgz", - "integrity": "sha512-L1zP0dk7vGweZME2i+EeakvUNqSrdiI3F91TwEoYiGrAfUXmVv6fJIq4g82PAXxNsWOp0J7ZqQy/3Szz0ajTxA==", - "dev": true, - "requires": { - "ansi-colors": "^1.0.1", - "arr-diff": "^4.0.0", - "arr-union": "^3.1.0", - "extend-shallow": "^3.0.2" - } - } - } - }, - "gulp-tag-version": { - "version": "1.3.1", - "resolved": "https://registry.npmjs.org/gulp-tag-version/-/gulp-tag-version-1.3.1.tgz", - "integrity": "sha512-bt1LbmGeg6OaiKEdQ+hmi9KeawTXYnunDVCd9cvNoVT89KKXyZEEdR2DCSFR8zk+nunatRnSD3Zaa4R9JGC4Tw==", - "dev": true, - "requires": { - "ansi-colors": "~1.0.1", - "fancy-log": "~1.3.2", - "gulp-git": "^2.4.2", - "map-stream": "~0.1.0" - }, - "dependencies": { - "ansi-colors": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/ansi-colors/-/ansi-colors-1.0.1.tgz", - "integrity": "sha512-yopkAU0ZD/WQ56Tms3xLn6jRuX3SyUMAVi0FdmDIbmmnHW3jHiI1sQFdUl3gfVddjnrsP3Y6ywFKvCRopvoVIA==", - "dev": true, - "requires": { - "ansi-wrap": "^0.1.0" - } - } - } - }, - "gulp-util": { - "version": "3.0.8", - "resolved": "https://registry.npmjs.org/gulp-util/-/gulp-util-3.0.8.tgz", - "integrity": "sha1-AFTh50RQLifATBh8PsxQXdVLu08=", - "dev": true, - "requires": { - "array-differ": "^1.0.0", - "array-uniq": "^1.0.2", - "beeper": "^1.0.0", - "chalk": "^1.0.0", - "dateformat": "^2.0.0", - "fancy-log": "^1.1.0", - "gulplog": "^1.0.0", - "has-gulplog": "^0.1.0", - "lodash._reescape": "^3.0.0", - "lodash._reevaluate": "^3.0.0", - "lodash._reinterpolate": "^3.0.0", - "lodash.template": "^3.0.0", - "minimist": "^1.1.0", - "multipipe": "^0.1.2", - "object-assign": "^3.0.0", - "replace-ext": "0.0.1", - "through2": "^2.0.0", - "vinyl": "^0.5.0" - }, - "dependencies": { - "ansi-regex": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", - "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", - "dev": true - }, - "ansi-styles": { - "version": "2.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz", - "integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=", - "dev": true - }, - "chalk": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz", - "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=", - "dev": true, - "requires": { - "ansi-styles": "^2.2.1", - "escape-string-regexp": "^1.0.2", - "has-ansi": "^2.0.0", - "strip-ansi": "^3.0.0", - "supports-color": "^2.0.0" - } - }, - "clone": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/clone/-/clone-1.0.4.tgz", - "integrity": "sha1-2jCcwmPfFZlMaIypAheco8fNfH4=", - "dev": true - }, - "clone-stats": { - "version": "0.0.1", - "resolved": "https://registry.npmjs.org/clone-stats/-/clone-stats-0.0.1.tgz", - "integrity": "sha1-uI+UqCzzi4eR1YBG6kAprYjKmdE=", - "dev": true - }, - "dateformat": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/dateformat/-/dateformat-2.2.0.tgz", - "integrity": "sha1-QGXiATz5+5Ft39gu+1Bq1MZ2kGI=", - "dev": true - }, - "lodash.template": { - "version": "3.6.2", - "resolved": "https://registry.npmjs.org/lodash.template/-/lodash.template-3.6.2.tgz", - "integrity": "sha1-+M3sxhaaJVvpCYrosMU9N4kx0U8=", - "dev": true, - "requires": { - "lodash._basecopy": "^3.0.0", - "lodash._basetostring": "^3.0.0", - "lodash._basevalues": "^3.0.0", - "lodash._isiterateecall": "^3.0.0", - "lodash._reinterpolate": "^3.0.0", - "lodash.escape": "^3.0.0", - "lodash.keys": "^3.0.0", - "lodash.restparam": "^3.0.0", - "lodash.templatesettings": "^3.0.0" - } - }, - "lodash.templatesettings": { - "version": "3.1.1", - "resolved": "https://registry.npmjs.org/lodash.templatesettings/-/lodash.templatesettings-3.1.1.tgz", - "integrity": "sha1-+zB4RHU7Zrnxr6VOJix0UwfbqOU=", - "dev": true, - "requires": { - "lodash._reinterpolate": "^3.0.0", - "lodash.escape": "^3.0.0" - } - }, - "minimist": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", - "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", - "dev": true - }, - "object-assign": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-3.0.0.tgz", - "integrity": "sha1-m+3VygiXlJvKR+f/QIBi1Un1h/I=", - "dev": true - }, - "replace-ext": { - "version": "0.0.1", - "resolved": "https://registry.npmjs.org/replace-ext/-/replace-ext-0.0.1.tgz", - "integrity": "sha1-KbvZIHinOfC8zitO5B6DeVNSKSQ=", - "dev": true - }, - "strip-ansi": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", - "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", - "dev": true, - "requires": { - "ansi-regex": "^2.0.0" - } - }, - "supports-color": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz", - "integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=", - "dev": true - }, - "vinyl": { - "version": "0.5.3", - "resolved": "https://registry.npmjs.org/vinyl/-/vinyl-0.5.3.tgz", - "integrity": "sha1-sEVbOPxeDPMNQyUTLkYZcMIJHN4=", - "dev": true, - "requires": { - "clone": "^1.0.0", - "clone-stats": "^0.0.1", - "replace-ext": "0.0.1" - } - } - } - }, - "gulplog": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/gulplog/-/gulplog-1.0.0.tgz", - "integrity": "sha1-4oxNRdBey77YGDY86PnFkmIp/+U=", - "dev": true, - "requires": { - "glogg": "^1.0.0" - } - }, "handle-thing": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/handle-thing/-/handle-thing-2.0.1.tgz", "integrity": "sha512-9Qn4yBxelxoh2Ow62nP+Ka/kMnOXRi8BXnRaUwezLNhqelnN49xKz4F/dPP8OYLxLxq6JDtZb2i9XznUQbNPTg==", "dev": true }, - "handlebars": { - "version": "4.7.6", - "resolved": "https://registry.npmjs.org/handlebars/-/handlebars-4.7.6.tgz", - "integrity": "sha512-1f2BACcBfiwAfStCKZNrUCgqNZkGsAT7UM3kkYtXuLo0KnaVfjKOyf7PRzB6++aK9STyT1Pd2ZCPe3EGOXleXA==", - "dev": true, - "requires": { - "minimist": "^1.2.5", - "neo-async": "^2.6.0", - "source-map": "^0.6.1", - "uglify-js": "^3.1.4", - "wordwrap": "^1.0.0" - }, - "dependencies": { - "source-map": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", - "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", - "dev": true - } - } - }, "har-schema": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/har-schema/-/har-schema-2.0.0.tgz", @@ -7110,12 +4768,6 @@ } } }, - "hard-rejection": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/hard-rejection/-/hard-rejection-2.1.0.tgz", - "integrity": "sha512-VIZB+ibDhx7ObhAe7OVtoEbuP4h/MuOTHJ+J8h/eBXotJYl0fBgR72xDFCKgIh22OJZIOVNxBMWuhAr10r8HdA==", - "dev": true - }, "has": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/has/-/has-1.0.3.tgz", @@ -7148,21 +4800,6 @@ "integrity": "sha1-tdRU3CGZriJWmfNGfloH87lVuv0=", "dev": true }, - "has-gulplog": { - "version": "0.1.0", - "resolved": "https://registry.npmjs.org/has-gulplog/-/has-gulplog-0.1.0.tgz", - "integrity": "sha1-ZBTIKRNpfaUVkDl9r7EvIpZ4Ec4=", - "dev": true, - "requires": { - "sparkles": "^1.0.0" - } - }, - "has-symbols": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.0.tgz", - "integrity": "sha1-uhqPGvKg/DllD1yFA2dwQSIGO0Q=", - "dev": true - }, "has-value": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/has-value/-/has-value-1.0.0.tgz", @@ -7430,15 +5067,6 @@ "integrity": "sha1-khi5srkoojixPcT7a21XbyMUU+o=", "dev": true }, - "indent-string": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-2.1.0.tgz", - "integrity": "sha1-ji1INIdCEhtKghi3oTfppSBJ3IA=", - "dev": true, - "requires": { - "repeating": "^2.0.0" - } - }, "infer-owner": { "version": "1.0.4", "resolved": "https://registry.npmjs.org/infer-owner/-/infer-owner-1.0.4.tgz", @@ -7586,12 +5214,6 @@ "integrity": "sha512-mT34yGKMNceBQUoVn7iCDKDntA7SC6gycMAWzGx1z/CMCTV7b2AAtXlo3nRyHZ1FelRkQbQjprHSYGwzLtkVbw==", "dev": true }, - "invert-kv": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/invert-kv/-/invert-kv-1.0.0.tgz", - "integrity": "sha1-EEqOSqym09jNFXqO+L+rLXo//bY=", - "dev": true - }, "ip": { "version": "1.1.5", "resolved": "https://registry.npmjs.org/ip/-/ip-1.1.5.tgz", @@ -7610,16 +5232,6 @@ "integrity": "sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g==", "dev": true }, - "is-absolute": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/is-absolute/-/is-absolute-1.0.0.tgz", - "integrity": "sha512-dOWoqflvcydARa360Gvv18DZ/gRuHKi2NU/wU5X1ZFzdYfH29nkiNZsF3mp4OJ3H4yo9Mx8A/uAGNzpzPN3yBA==", - "dev": true, - "requires": { - "is-relative": "^1.0.0", - "is-windows": "^1.0.1" - } - }, "is-absolute-url": { "version": "3.0.3", "resolved": "https://registry.npmjs.org/is-absolute-url/-/is-absolute-url-3.0.3.tgz", @@ -7761,15 +5373,6 @@ "integrity": "sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=", "dev": true }, - "is-finite": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/is-finite/-/is-finite-1.0.2.tgz", - "integrity": "sha1-zGZ3aVYCvlUO8R6LSqYwU0K20Ko=", - "dev": true, - "requires": { - "number-is-nan": "^1.0.0" - } - }, "is-fullwidth-code-point": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz", @@ -7791,12 +5394,6 @@ "is-extglob": "^2.1.1" } }, - "is-negated-glob": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/is-negated-glob/-/is-negated-glob-1.0.0.tgz", - "integrity": "sha1-aRC8pdqMleeEtXUbl2z1oQ/uNtI=", - "dev": true - }, "is-negative-zero": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/is-negative-zero/-/is-negative-zero-2.0.0.tgz", @@ -7823,12 +5420,6 @@ } } }, - "is-obj": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/is-obj/-/is-obj-2.0.0.tgz", - "integrity": "sha512-drqDG3cbczxxEJRoOXcOjtdp1J/lyp1mNn0xaznRs8+muBhgQcrnbspox5X5fOw0HnMnbfDzvnEMEtqDEJEo8w==", - "dev": true - }, "is-path-cwd": { "version": "2.2.0", "resolved": "https://registry.npmjs.org/is-path-cwd/-/is-path-cwd-2.2.0.tgz", @@ -7853,12 +5444,6 @@ "path-is-inside": "^1.0.2" } }, - "is-plain-obj": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/is-plain-obj/-/is-plain-obj-1.1.0.tgz", - "integrity": "sha1-caUMhCnfync8kqOQpKA7OfzVHT4=", - "dev": true - }, "is-plain-object": { "version": "2.0.4", "resolved": "https://registry.npmjs.org/is-plain-object/-/is-plain-object-2.0.4.tgz", @@ -7891,15 +5476,6 @@ } } }, - "is-relative": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/is-relative/-/is-relative-1.0.0.tgz", - "integrity": "sha512-Kw/ReK0iqwKeu0MITLFuj0jbPAmEiOsIwyIXvvbfa6QfmN9pkD1M+8pdk7Rl/dTKbH34/XBFMbgD4iMJhLQbGA==", - "dev": true, - "requires": { - "is-unc-path": "^1.0.0" - } - }, "is-stream": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/is-stream/-/is-stream-1.1.0.tgz", @@ -7923,42 +5499,12 @@ } } }, - "is-text-path": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/is-text-path/-/is-text-path-1.0.1.tgz", - "integrity": "sha1-Thqg+1G/vLPpJogAE5cgLBd1tm4=", - "dev": true, - "requires": { - "text-extensions": "^1.0.0" - } - }, "is-typedarray": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/is-typedarray/-/is-typedarray-1.0.0.tgz", "integrity": "sha1-5HnICFjfDBsR3dppQPlgEfzaSpo=", "dev": true }, - "is-unc-path": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/is-unc-path/-/is-unc-path-1.0.0.tgz", - "integrity": "sha512-mrGpVd0fs7WWLfVsStvgF6iEJnbjDFZh9/emhRDcGWTduTfNHd9CHeUwH3gYIjdbwo4On6hunkztwOaAw0yllQ==", - "dev": true, - "requires": { - "unc-path-regex": "^0.1.2" - } - }, - "is-utf8": { - "version": "0.2.1", - "resolved": "https://registry.npmjs.org/is-utf8/-/is-utf8-0.2.1.tgz", - "integrity": "sha1-Sw2hRCEE0bM2NA6AeX6GXPOffXI=", - "dev": true - }, - "is-valid-glob": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/is-valid-glob/-/is-valid-glob-1.0.0.tgz", - "integrity": "sha1-Kb8+/3Ab4tTTFdusw5vDn+j2Aao=", - "dev": true - }, "is-windows": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/is-windows/-/is-windows-1.0.2.tgz", @@ -10353,12 +7899,6 @@ } } }, - "jsonparse": { - "version": "1.3.1", - "resolved": "https://registry.npmjs.org/jsonparse/-/jsonparse-1.3.1.tgz", - "integrity": "sha1-P02uSpH6wxX3EGL4UhzCOfE2YoA=", - "dev": true - }, "jsprim": { "version": "1.4.1", "resolved": "https://registry.npmjs.org/jsprim/-/jsprim-1.4.1.tgz", @@ -10371,12 +7911,6 @@ "verror": "1.10.0" } }, - "just-debounce": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/just-debounce/-/just-debounce-1.0.0.tgz", - "integrity": "sha1-h/zPrv/AtozRnVX2cilD+SnqNeo=", - "dev": true - }, "killable": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/killable/-/killable-1.0.1.tgz", @@ -10395,43 +7929,6 @@ "integrity": "sha512-eTIzlVOSUR+JxdDFepEYcBMtZ9Qqdef+rnzWdRZuMbOywu5tO2w2N7rqjoANZ5k9vywhL6Br1VRjUIgTQx4E8w==", "dev": true }, - "last-run": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/last-run/-/last-run-1.1.1.tgz", - "integrity": "sha1-RblpQsF7HHnHchmCWbqUO+v4yls=", - "dev": true, - "requires": { - "default-resolution": "^2.0.0", - "es6-weak-map": "^2.0.1" - } - }, - "lazystream": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/lazystream/-/lazystream-1.0.0.tgz", - "integrity": "sha1-9plf4PggOS9hOWvolGJAe7dxaOQ=", - "dev": true, - "requires": { - "readable-stream": "^2.0.5" - } - }, - "lcid": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/lcid/-/lcid-1.0.0.tgz", - "integrity": "sha1-MIrMr6C8SDo4Z7S28rlQYlHRuDU=", - "dev": true, - "requires": { - "invert-kv": "^1.0.0" - } - }, - "lead": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/lead/-/lead-1.0.0.tgz", - "integrity": "sha1-bxT5mje+Op3XhPVJVpDlkDRm7kI=", - "dev": true, - "requires": { - "flush-write-stream": "^1.0.2" - } - }, "leven": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/leven/-/leven-3.1.0.tgz", @@ -10448,41 +7945,12 @@ "type-check": "~0.3.2" } }, - "liftoff": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/liftoff/-/liftoff-3.1.0.tgz", - "integrity": "sha512-DlIPlJUkCV0Ips2zf2pJP0unEoT1kwYhiiPUGF3s/jtxTCjziNLoiVVh+jqWOWeFi6mmwQ5fNxvAUyPad4Dfog==", - "dev": true, - "requires": { - "extend": "^3.0.0", - "findup-sync": "^3.0.0", - "fined": "^1.0.1", - "flagged-respawn": "^1.0.0", - "is-plain-object": "^2.0.4", - "object.map": "^1.0.0", - "rechoir": "^0.6.2", - "resolve": "^1.1.7" - } - }, "lines-and-columns": { "version": "1.1.6", "resolved": "https://registry.npmjs.org/lines-and-columns/-/lines-and-columns-1.1.6.tgz", "integrity": "sha1-HADHQ7QzzQpOgHWPe2SldEDZ/wA=", "dev": true }, - "load-json-file": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-1.1.0.tgz", - "integrity": "sha1-lWkFcI1YtLq0wiYbBPWfMcmTdMA=", - "dev": true, - "requires": { - "graceful-fs": "^4.1.2", - "parse-json": "^2.2.0", - "pify": "^2.0.0", - "pinkie-promise": "^2.0.0", - "strip-bom": "^2.0.0" - } - }, "loader-runner": { "version": "2.4.0", "resolved": "https://registry.npmjs.org/loader-runner/-/loader-runner-2.4.0.tgz", @@ -10526,129 +7994,12 @@ "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, - "lodash._basecopy": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/lodash._basecopy/-/lodash._basecopy-3.0.1.tgz", - "integrity": "sha1-jaDmqHbPNEwK2KVIghEd08XHyjY=", - "dev": true - }, - "lodash._basetostring": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/lodash._basetostring/-/lodash._basetostring-3.0.1.tgz", - "integrity": "sha1-0YYdh3+CSlL2aYMtyvPuFVZqB9U=", - "dev": true - }, - "lodash._basevalues": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/lodash._basevalues/-/lodash._basevalues-3.0.0.tgz", - "integrity": "sha1-W3dXYoAr3j0yl1A+JjAIIP32Ybc=", - "dev": true - }, - "lodash._getnative": { - "version": "3.9.1", - "resolved": "https://registry.npmjs.org/lodash._getnative/-/lodash._getnative-3.9.1.tgz", - "integrity": "sha1-VwvH3t5G1hzc3mh9ZdPuy6o6r/U=", - "dev": true - }, - "lodash._isiterateecall": { - "version": "3.0.9", - "resolved": "https://registry.npmjs.org/lodash._isiterateecall/-/lodash._isiterateecall-3.0.9.tgz", - "integrity": "sha1-UgOte6Ql+uhCRg5pbbnPPmqsBXw=", - "dev": true - }, - "lodash._reescape": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/lodash._reescape/-/lodash._reescape-3.0.0.tgz", - "integrity": "sha1-Kx1vXf4HyKNVdT5fJ/rH8c3hYWo=", - "dev": true - }, - "lodash._reevaluate": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/lodash._reevaluate/-/lodash._reevaluate-3.0.0.tgz", - "integrity": "sha1-WLx0xAZklTrgsSTYBpltrKQx4u0=", - "dev": true - }, - "lodash._reinterpolate": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/lodash._reinterpolate/-/lodash._reinterpolate-3.0.0.tgz", - "integrity": "sha1-DM8tiRZq8Ds2Y8eWU4t1rG4RTZ0=", - "dev": true - }, - "lodash._root": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/lodash._root/-/lodash._root-3.0.1.tgz", - "integrity": "sha1-+6HEUkwZ7ppfgTa0YJ8BfPTe1pI=", - "dev": true - }, - "lodash.escape": { - "version": "3.2.0", - "resolved": "https://registry.npmjs.org/lodash.escape/-/lodash.escape-3.2.0.tgz", - "integrity": "sha1-mV7g3BjBtIzJLv+ucaEKq1tIdpg=", - "dev": true, - "requires": { - "lodash._root": "^3.0.0" - } - }, - "lodash.isarguments": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/lodash.isarguments/-/lodash.isarguments-3.1.0.tgz", - "integrity": "sha1-L1c9hcaiQon/AGY7SRwdM4/zRYo=", - "dev": true - }, - "lodash.isarray": { - "version": "3.0.4", - "resolved": "https://registry.npmjs.org/lodash.isarray/-/lodash.isarray-3.0.4.tgz", - "integrity": "sha1-eeTriMNqgSKvhvhEqpvNhRtfu1U=", - "dev": true - }, - "lodash.ismatch": { - "version": "4.4.0", - "resolved": "https://registry.npmjs.org/lodash.ismatch/-/lodash.ismatch-4.4.0.tgz", - "integrity": "sha1-dWy1FQyjum8RCFp4hJZF8Yj4Xzc=", - "dev": true - }, - "lodash.keys": { - "version": "3.1.2", - "resolved": "https://registry.npmjs.org/lodash.keys/-/lodash.keys-3.1.2.tgz", - "integrity": "sha1-TbwEcrFWvlCgsoaFXRvQsMZWCYo=", - "dev": true, - "requires": { - "lodash._getnative": "^3.0.0", - "lodash.isarguments": "^3.0.0", - "lodash.isarray": "^3.0.0" - } - }, - "lodash.restparam": { - "version": "3.6.1", - "resolved": "https://registry.npmjs.org/lodash.restparam/-/lodash.restparam-3.6.1.tgz", - "integrity": "sha1-k2pOMJ7zMKdkXtQUWYbIWuWyCAU=", - "dev": true - }, "lodash.sortby": { "version": "4.7.0", "resolved": "https://registry.npmjs.org/lodash.sortby/-/lodash.sortby-4.7.0.tgz", "integrity": "sha1-7dFMgk4sycHgsKG0K7UhBRakJDg=", "dev": true }, - "lodash.template": { - "version": "4.5.0", - "resolved": "https://registry.npmjs.org/lodash.template/-/lodash.template-4.5.0.tgz", - "integrity": "sha512-84vYFxIkmidUiFxidA/KjjH9pAycqW+h980j7Fuz5qxRtO9pgB7MDFTdys1N7A5mcucRiDyEq4fusljItR1T/A==", - "dev": true, - "requires": { - "lodash._reinterpolate": "^3.0.0", - "lodash.templatesettings": "^4.0.0" - } - }, - "lodash.templatesettings": { - "version": "4.2.0", - "resolved": "https://registry.npmjs.org/lodash.templatesettings/-/lodash.templatesettings-4.2.0.tgz", - "integrity": "sha512-stgLz+i3Aa9mZgnjr/O+v9ruKZsPsndy7qPZOchbqk2cnTU1ZaldKK+v7m54WoKIyxiuMZTKT2H81F8BeAc3ZQ==", - "dev": true, - "requires": { - "lodash._reinterpolate": "^3.0.0" - } - }, "loglevel": { "version": "1.7.0", "resolved": "https://registry.npmjs.org/loglevel/-/loglevel-1.7.0.tgz", @@ -10664,25 +8015,6 @@ "@sinonjs/commons": "^1.7.0" } }, - "loud-rejection": { - "version": "1.6.0", - "resolved": "https://registry.npmjs.org/loud-rejection/-/loud-rejection-1.6.0.tgz", - "integrity": "sha1-W0b4AUft7leIcPCG0Eghz5mOVR8=", - "dev": true, - "requires": { - "currently-unhandled": "^0.4.1", - "signal-exit": "^3.0.0" - } - }, - "lru-cache": { - "version": "6.0.0", - "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-6.0.0.tgz", - "integrity": "sha512-Jo6dJ04CmSjuznwJSS3pUeWmd/H0ffTlkXXgwZi+eq1UCmqQwCh+eLsYOYCwY991i2Fah4h1BEMCx4qThGbsiA==", - "dev": true, - "requires": { - "yallist": "^4.0.0" - } - }, "make-dir": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-2.1.0.tgz", @@ -10707,15 +8039,6 @@ } } }, - "make-iterator": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/make-iterator/-/make-iterator-1.0.1.tgz", - "integrity": "sha512-pxiuXh0iVEq7VM7KMIhs5gxsfxCux2URptUQaXo4iZZJxBAzTPOLE2BumO5dbfVYq/hBJFBR/a1mFDmOx5AGmw==", - "dev": true, - "requires": { - "kind-of": "^6.0.2" - } - }, "makeerror": { "version": "1.0.11", "resolved": "https://registry.npmjs.org/makeerror/-/makeerror-1.0.11.tgz", @@ -10740,18 +8063,6 @@ "integrity": "sha1-wyq9C9ZSXZsFFkW7TyasXcmKDb8=", "dev": true }, - "map-obj": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-1.0.1.tgz", - "integrity": "sha1-2TPOuSBdgr3PSIb2dCvcK03qFG0=", - "dev": true - }, - "map-stream": { - "version": "0.1.0", - "resolved": "https://registry.npmjs.org/map-stream/-/map-stream-0.1.0.tgz", - "integrity": "sha1-5WqpTEyAVaFkBKBnS3jyFffI4ZQ=", - "dev": true - }, "map-visit": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/map-visit/-/map-visit-1.0.0.tgz", @@ -10761,41 +8072,6 @@ "object-visit": "^1.0.0" } }, - "matchdep": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/matchdep/-/matchdep-2.0.0.tgz", - "integrity": "sha1-xvNINKDY28OzfCfui7yyfHd1WC4=", - "dev": true, - "requires": { - "findup-sync": "^2.0.0", - "micromatch": "^3.0.4", - "resolve": "^1.4.0", - "stack-trace": "0.0.10" - }, - "dependencies": { - "findup-sync": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/findup-sync/-/findup-sync-2.0.0.tgz", - "integrity": "sha1-kyaxSIwi0aYIhlCoaQGy2akKLLw=", - "dev": true, - "requires": { - "detect-file": "^1.0.0", - "is-glob": "^3.1.0", - "micromatch": "^3.0.4", - "resolve-dir": "^1.0.1" - } - }, - "is-glob": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-3.1.0.tgz", - "integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=", - "dev": true, - "requires": { - "is-extglob": "^2.1.0" - } - } - } - }, "md5.js": { "version": "1.3.5", "resolved": "https://registry.npmjs.org/md5.js/-/md5.js-1.3.5.tgz", @@ -10834,32 +8110,6 @@ "readable-stream": "^2.0.1" } }, - "meow": { - "version": "3.7.0", - "resolved": "https://registry.npmjs.org/meow/-/meow-3.7.0.tgz", - "integrity": "sha1-cstmi0JSKCkKu/qFaJJYcwioAfs=", - "dev": true, - "requires": { - "camelcase-keys": "^2.0.0", - "decamelize": "^1.1.2", - "loud-rejection": "^1.0.0", - "map-obj": "^1.0.1", - "minimist": "^1.1.3", - "normalize-package-data": "^2.3.4", - "object-assign": "^4.0.1", - "read-pkg-up": "^1.0.1", - "redent": "^1.0.0", - "trim-newlines": "^1.0.0" - }, - "dependencies": { - "minimist": { - "version": "1.2.5", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", - "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==", - "dev": true - } - } - }, "merge-descriptors": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz", @@ -10944,12 +8194,6 @@ "integrity": "sha512-OqbOk5oEQeAZ8WXWydlu9HJjz9WVdEIvamMCcXmuqUYjTknH/sqsWvhQ3vgwKFRR1HpjvNBKQ37nbJgYzGqGcg==", "dev": true }, - "min-indent": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/min-indent/-/min-indent-1.0.1.tgz", - "integrity": "sha512-I9jwMn07Sy/IwOj3zVkVik2JTvgpaykDZEigL6Rx6N9LbMywwUSMtxET+7lVoDLLd3O3IXwJwvuuns8UB/HeAg==", - "dev": true - }, "minimalistic-assert": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz", @@ -10977,17 +8221,6 @@ "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==", "dev": true }, - "minimist-options": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/minimist-options/-/minimist-options-4.1.0.tgz", - "integrity": "sha512-Q4r8ghd80yhO/0j1O3B2BjweX3fiHg9cdOwjJd2J76Q135c+NDxGCqdYKQ1SKBuFfgWbAUzBfvYjPUEeNgqN1A==", - "dev": true, - "requires": { - "arrify": "^1.0.1", - "is-plain-obj": "^1.1.0", - "kind-of": "^6.0.3" - } - }, "mississippi": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/mississippi/-/mississippi-3.0.0.tgz", @@ -11062,12 +8295,6 @@ "integrity": "sha512-gKLcREMhtuZRwRAfqP3RFW+TK4JqApVBtOIftVgjuABpAtpxhPGaDcfvbhNvD0B8iD1oUr/txX35NjcaY6Ns/A==", "dev": true }, - "modify-values": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/modify-values/-/modify-values-1.0.1.tgz", - "integrity": "sha512-xV2bxeN6F7oYjZWTe/YPAy6MN2M+sL4u/Rlm2AHCIVGfo2p1yGmBHQ6vHehl4bRTZBdHu3TSkWdYgkwpYzAGSw==", - "dev": true - }, "move-concurrently": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/move-concurrently/-/move-concurrently-1.0.1.tgz", @@ -11104,21 +8331,6 @@ "integrity": "sha1-iZ8R2WhuXgXLkbNdXw5jt3PPyQE=", "dev": true }, - "multipipe": { - "version": "0.1.2", - "resolved": "https://registry.npmjs.org/multipipe/-/multipipe-0.1.2.tgz", - "integrity": "sha1-Ko8t33Du1WTf8tV/HhoTfZ8FB4s=", - "dev": true, - "requires": { - "duplexer2": "0.0.2" - } - }, - "mute-stdout": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/mute-stdout/-/mute-stdout-1.0.1.tgz", - "integrity": "sha512-kDcwXR4PS7caBpuRYYBUz9iVixUk3anO3f5OYFiIPwK/20vCzKCHyKoulbiDY1S53zD2bxUpxN/IJ+TnXjfvxg==", - "dev": true - }, "mute-stream": { "version": "0.0.8", "resolved": "https://registry.npmjs.org/mute-stream/-/mute-stream-0.0.8.tgz", @@ -11169,12 +8381,6 @@ "integrity": "sha512-Yd3UES5mWCSqR+qNT93S3UoYUkqAZ9lLg8a7g9rimsWmYGK8cVToA4/sF3RrshdyV3sAGMXVUmpMYOw+dLpOuw==", "dev": true }, - "next-tick": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/next-tick/-/next-tick-1.0.0.tgz", - "integrity": "sha1-yobR/ogoFpsBICCOPchCS524NCw=", - "dev": true - }, "nice-try": { "version": "1.0.5", "resolved": "https://registry.npmjs.org/nice-try/-/nice-try-1.0.5.tgz", @@ -11299,15 +8505,6 @@ "remove-trailing-separator": "^1.0.1" } }, - "now-and-later": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/now-and-later/-/now-and-later-2.0.1.tgz", - "integrity": "sha512-KGvQ0cB70AQfg107Xvs/Fbu+dGmZoTRJp2TaPwcwQm3/7PteUyN2BCgk8KBMPGBUXZdVwyWS8fDCGFygBm19UQ==", - "dev": true, - "requires": { - "once": "^1.3.2" - } - }, "npm-run-path": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/npm-run-path/-/npm-run-path-2.0.2.tgz", @@ -11317,12 +8514,6 @@ "path-key": "^2.0.0" } }, - "number-is-nan": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/number-is-nan/-/number-is-nan-1.0.1.tgz", - "integrity": "sha1-CXtgK1NCKlIsGvuHkDGDNpQaAR0=", - "dev": true - }, "nwsapi": { "version": "2.2.0", "resolved": "https://registry.npmjs.org/nwsapi/-/nwsapi-2.2.0.tgz", @@ -11403,40 +8594,6 @@ "isobject": "^3.0.0" } }, - "object.assign": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.0.tgz", - "integrity": "sha512-exHJeq6kBKj58mqGyTQ9DFvrZC/eR6OwxzoM9YRoGBqrXYonaFyGiFMuc9VZrXf7DarreEwMpurG3dd+CNyW5w==", - "dev": true, - "requires": { - "define-properties": "^1.1.2", - "function-bind": "^1.1.1", - "has-symbols": "^1.0.0", - "object-keys": "^1.0.11" - } - }, - "object.defaults": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/object.defaults/-/object.defaults-1.1.0.tgz", - "integrity": "sha1-On+GgzS0B96gbaFtiNXNKeQ1/s8=", - "dev": true, - "requires": { - "array-each": "^1.0.1", - "array-slice": "^1.0.0", - "for-own": "^1.0.0", - "isobject": "^3.0.0" - } - }, - "object.map": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/object.map/-/object.map-1.0.1.tgz", - "integrity": "sha1-z4Plncj8wK1fQlDh94s7gb2AHTc=", - "dev": true, - "requires": { - "for-own": "^1.0.0", - "make-iterator": "^1.0.0" - } - }, "object.pick": { "version": "1.3.0", "resolved": "https://registry.npmjs.org/object.pick/-/object.pick-1.3.0.tgz", @@ -11446,16 +8603,6 @@ "isobject": "^3.0.1" } }, - "object.reduce": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/object.reduce/-/object.reduce-1.0.1.tgz", - "integrity": "sha1-b+NI8qx/oPlcpiEiZZkJaCW7A60=", - "dev": true, - "requires": { - "for-own": "^1.0.0", - "make-iterator": "^1.0.0" - } - }, "obuf": { "version": "1.1.2", "resolved": "https://registry.npmjs.org/obuf/-/obuf-1.1.2.tgz", @@ -11518,15 +8665,6 @@ "word-wrap": "~1.2.3" } }, - "ordered-read-streams": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/ordered-read-streams/-/ordered-read-streams-1.0.1.tgz", - "integrity": "sha1-d8DLN8QVJdZBZtmQ/61+xqDhNj4=", - "dev": true, - "requires": { - "readable-stream": "^2.0.1" - } - }, "original": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/original/-/original-1.0.2.tgz", @@ -11542,15 +8680,6 @@ "integrity": "sha1-hUNzx/XCMVkU/Jv8a9gjj92h7Cc=", "dev": true }, - "os-locale": { - "version": "1.4.0", - "resolved": "https://registry.npmjs.org/os-locale/-/os-locale-1.4.0.tgz", - "integrity": "sha1-IPnxeuKe00XoveWDsT0gCYA8FNk=", - "dev": true, - "requires": { - "lcid": "^1.0.0" - } - }, "os-tmpdir": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz", @@ -11659,32 +8788,6 @@ "safe-buffer": "^5.1.1" } }, - "parse-filepath": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/parse-filepath/-/parse-filepath-1.0.2.tgz", - "integrity": "sha1-pjISf1Oq89FYdvWHLz/6x2PWyJE=", - "dev": true, - "requires": { - "is-absolute": "^1.0.0", - "map-cache": "^0.2.0", - "path-root": "^0.1.1" - } - }, - "parse-github-repo-url": { - "version": "1.4.1", - "resolved": "https://registry.npmjs.org/parse-github-repo-url/-/parse-github-repo-url-1.4.1.tgz", - "integrity": "sha1-nn2LslKmy2ukJZUGC3v23z28H1A=", - "dev": true - }, - "parse-json": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-2.2.0.tgz", - "integrity": "sha1-9ID0BDTvgHQfhGkJn43qGPVaTck=", - "dev": true, - "requires": { - "error-ex": "^1.2.0" - } - }, "parse-node-version": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/parse-node-version/-/parse-node-version-1.0.1.tgz", @@ -11727,15 +8830,6 @@ "integrity": "sha1-zDPSTVJeCZpTiMAzbG4yuRYGCeA=", "dev": true }, - "path-exists": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-2.1.0.tgz", - "integrity": "sha1-D+tsZPD8UY2adU3V77YscCJ2H0s=", - "dev": true, - "requires": { - "pinkie-promise": "^2.0.0" - } - }, "path-is-absolute": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", @@ -11760,38 +8854,12 @@ "integrity": "sha512-GSmOT2EbHrINBf9SR7CDELwlJ8AENk3Qn7OikK4nFYAu3Ote2+JYNVvkpAEQm3/TLNEJFD/xZJjzyxg3KBWOzw==", "dev": true }, - "path-root": { - "version": "0.1.1", - "resolved": "https://registry.npmjs.org/path-root/-/path-root-0.1.1.tgz", - "integrity": "sha1-mkpoFMrBwM1zNgqV8yCDyOpHRbc=", - "dev": true, - "requires": { - "path-root-regex": "^0.1.0" - } - }, - "path-root-regex": { - "version": "0.1.2", - "resolved": "https://registry.npmjs.org/path-root-regex/-/path-root-regex-0.1.2.tgz", - "integrity": "sha1-v8zcjfWxLcUsi0PsONGNcsBLqW0=", - "dev": true - }, "path-to-regexp": { "version": "0.1.7", "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz", "integrity": "sha1-32BBeABfUi8V60SQ5yR6G/qmf4w=", "dev": true }, - "path-type": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/path-type/-/path-type-1.1.0.tgz", - "integrity": "sha1-WcRPfuSR2nBNpBXaWkBwuk+P5EE=", - "dev": true, - "requires": { - "graceful-fs": "^4.1.2", - "pify": "^2.0.0", - "pinkie-promise": "^2.0.0" - } - }, "pbkdf2": { "version": "3.1.1", "resolved": "https://registry.npmjs.org/pbkdf2/-/pbkdf2-3.1.1.tgz", @@ -11965,58 +9033,6 @@ } } }, - "plugin-log": { - "version": "0.1.0", - "resolved": "https://registry.npmjs.org/plugin-log/-/plugin-log-0.1.0.tgz", - "integrity": "sha1-hgSc9qsQgzOYqTHzaJy67nteEzM=", - "dev": true, - "requires": { - "chalk": "^1.1.1", - "dateformat": "^1.0.11" - }, - "dependencies": { - "ansi-regex": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", - "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", - "dev": true - }, - "ansi-styles": { - "version": "2.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz", - "integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=", - "dev": true - }, - "chalk": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz", - "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=", - "dev": true, - "requires": { - "ansi-styles": "^2.2.1", - "escape-string-regexp": "^1.0.2", - "has-ansi": "^2.0.0", - "strip-ansi": "^3.0.0", - "supports-color": "^2.0.0" - } - }, - "strip-ansi": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", - "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", - "dev": true, - "requires": { - "ansi-regex": "^2.0.0" - } - }, - "supports-color": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz", - "integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=", - "dev": true - } - } - }, "pn": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/pn/-/pn-1.1.0.tgz", @@ -12095,12 +9111,6 @@ } } }, - "pretty-hrtime": { - "version": "1.0.3", - "resolved": "https://registry.npmjs.org/pretty-hrtime/-/pretty-hrtime-1.0.3.tgz", - "integrity": "sha1-t+PqQkNaTJsnWdmeDyAesZWALuE=", - "dev": true - }, "process": { "version": "0.11.10", "resolved": "https://registry.npmjs.org/process/-/process-0.11.10.tgz", @@ -12258,12 +9268,6 @@ } } }, - "q": { - "version": "1.5.1", - "resolved": "https://registry.npmjs.org/q/-/q-1.5.1.tgz", - "integrity": "sha1-fjL3W0E4EpHQRhHxvxQQmsAGUdc=", - "dev": true - }, "qs": { "version": "6.5.2", "resolved": "https://registry.npmjs.org/qs/-/qs-6.5.2.tgz", @@ -12288,12 +9292,6 @@ "integrity": "sha512-FIqgj2EUvTa7R50u0rGsyTftzjYmv/a3hO345bZNrqabNqjtgiDMgmo4mkUjd+nzU5oF3dClKqFIPUKybUyqoQ==", "dev": true }, - "quick-lru": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/quick-lru/-/quick-lru-4.0.1.tgz", - "integrity": "sha512-ARhCpm70fzdcvNQfPoy49IaanKkTlRWF2JMzqhcJbhSFRZv7nPTvZJdcY7301IPmvW+/p0RgIWnQDLJxifsQ7g==", - "dev": true - }, "randombytes": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/randombytes/-/randombytes-2.1.0.tgz", @@ -12345,27 +9343,6 @@ "integrity": "sha512-24e6ynE2H+OKt4kqsOvNd8kBpV65zoxbA4BVsEOB3ARVWQki/DHzaUoC5KuON/BiccDaCCTZBuOcfZs70kR8bQ==", "dev": true }, - "read-pkg": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-1.1.0.tgz", - "integrity": "sha1-9f+qXs0pyzHAR0vKfXVra7KePyg=", - "dev": true, - "requires": { - "load-json-file": "^1.0.0", - "normalize-package-data": "^2.3.2", - "path-type": "^1.0.0" - } - }, - "read-pkg-up": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-1.0.1.tgz", - "integrity": "sha1-nWPBMnbAZZGNV/ACpX9AobZD+wI=", - "dev": true, - "requires": { - "find-up": "^1.0.0", - "read-pkg": "^1.0.0" - } - }, "readable-stream": { "version": "2.3.6", "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.6.tgz", @@ -12398,25 +9375,6 @@ "integrity": "sha512-v1SEYUOXXdbBZK8ZuNgO4TBjamPsiSgcFr0aP+tEKpQZK8vooEUqV6nm6Cv502mX4NF2EfsnVqtNAHG+/6Ur1Q==", "dev": true }, - "rechoir": { - "version": "0.6.2", - "resolved": "https://registry.npmjs.org/rechoir/-/rechoir-0.6.2.tgz", - "integrity": "sha1-hSBLVNuoLVdC4oyWdW70OvUOM4Q=", - "dev": true, - "requires": { - "resolve": "^1.1.6" - } - }, - "redent": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/redent/-/redent-1.0.0.tgz", - "integrity": "sha1-z5Fqsf1fHxbfsggi3W7H9zDCr94=", - "dev": true, - "requires": { - "indent-string": "^2.1.0", - "strip-indent": "^1.0.1" - } - }, "regex-not": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/regex-not/-/regex-not-1.0.2.tgz", @@ -12482,27 +9440,6 @@ "integrity": "sha512-lv0M6+TkDVniA3aD1Eg0DVpfU/booSu7Eev3TDO/mZKHBfVjgCGTV4t4buppESEYDtkArYFOxTJWv6S5C+iaNw==", "dev": true }, - "remove-bom-buffer": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/remove-bom-buffer/-/remove-bom-buffer-3.0.0.tgz", - "integrity": "sha512-8v2rWhaakv18qcvNeli2mZ/TMTL2nEyAKRvzo1WtnZBl15SHyEhrCu2/xKlJyUFKHiHgfXIyuY6g2dObJJycXQ==", - "dev": true, - "requires": { - "is-buffer": "^1.1.5", - "is-utf8": "^0.2.1" - } - }, - "remove-bom-stream": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/remove-bom-stream/-/remove-bom-stream-1.2.0.tgz", - "integrity": "sha1-BfGlk/FuQuH7kOv1nejlaVJflSM=", - "dev": true, - "requires": { - "remove-bom-buffer": "^3.0.0", - "safe-buffer": "^5.1.0", - "through2": "^2.0.3" - } - }, "remove-trailing-separator": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz", @@ -12521,32 +9458,6 @@ "integrity": "sha1-jcrkcOHIirwtYA//Sndihtp15jc=", "dev": true }, - "repeating": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/repeating/-/repeating-2.0.1.tgz", - "integrity": "sha1-UhTFOpJtNVJwdSf7q0FdvAjQbdo=", - "dev": true, - "requires": { - "is-finite": "^1.0.0" - } - }, - "replace-ext": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/replace-ext/-/replace-ext-1.0.0.tgz", - "integrity": "sha1-3mMSg3P8v3w8z6TeWkgMRaZ5WOs=", - "dev": true - }, - "replace-homedir": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/replace-homedir/-/replace-homedir-1.0.0.tgz", - "integrity": "sha1-6H9tUTuSjd6AgmDBK+f+xv9ueYw=", - "dev": true, - "requires": { - "homedir-polyfill": "^1.0.1", - "is-absolute": "^1.0.0", - "remove-trailing-separator": "^1.1.0" - } - }, "request": { "version": "2.88.2", "resolved": "https://registry.npmjs.org/request/-/request-2.88.2.tgz", @@ -12619,24 +9530,12 @@ } } }, - "require-dir": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/require-dir/-/require-dir-1.2.0.tgz", - "integrity": "sha512-LY85DTSu+heYgDqq/mK+7zFHWkttVNRXC9NKcKGyuGLdlsfbjEPrIEYdCVrx6hqnJb+xSu3Lzaoo8VnmOhhjNA==", - "dev": true - }, "require-directory": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz", "integrity": "sha1-jGStX9MNqxyXbiNE/+f3kqam30I=", "dev": true }, - "require-main-filename": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-1.0.1.tgz", - "integrity": "sha1-l/cXtp1IeE9fUmpsWqj/3aBVpNE=", - "dev": true - }, "requires-port": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/requires-port/-/requires-port-1.0.0.tgz", @@ -12685,15 +9584,6 @@ "integrity": "sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==", "dev": true }, - "resolve-options": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/resolve-options/-/resolve-options-1.1.0.tgz", - "integrity": "sha1-MrueOcBtZzONyTeMDW1gdFZq0TE=", - "dev": true, - "requires": { - "value-or-function": "^3.0.0" - } - }, "resolve-url": { "version": "0.2.1", "resolved": "https://registry.npmjs.org/resolve-url/-/resolve-url-0.2.1.tgz", @@ -12914,15 +9804,6 @@ "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==", "dev": true }, - "semver-greatest-satisfied-range": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/semver-greatest-satisfied-range/-/semver-greatest-satisfied-range-1.1.0.tgz", - "integrity": "sha1-E+jCZYq5aRywzXEJMkAoDTb3els=", - "dev": true, - "requires": { - "sver-compat": "^1.5.0" - } - }, "send": { "version": "0.17.1", "resolved": "https://registry.npmjs.org/send/-/send-0.17.1.tgz", @@ -13112,17 +9993,6 @@ "integrity": "sha1-2kL0l0DAtC2yypcoVxyxkMmO/qM=", "dev": true }, - "shelljs": { - "version": "0.8.4", - "resolved": "https://registry.npmjs.org/shelljs/-/shelljs-0.8.4.tgz", - "integrity": "sha512-7gk3UZ9kOfPLIAbslLzyWeGiEqx9e3rxwZM0KE6EL8GlGwjym9Mrlx5/p33bWTu9YG6vcS4MBxYZDHYr5lr8BQ==", - "dev": true, - "requires": { - "glob": "^7.0.0", - "interpret": "^1.0.0", - "rechoir": "^0.6.2" - } - }, "shellwords": { "version": "0.1.1", "resolved": "https://registry.npmjs.org/shellwords/-/shellwords-0.1.1.tgz", @@ -13383,12 +10253,6 @@ "integrity": "sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM=", "dev": true }, - "sparkles": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/sparkles/-/sparkles-1.0.1.tgz", - "integrity": "sha512-dSO0DDYUahUt/0/pD/Is3VIm5TGJjludZ0HVymmhYF6eNA53PVLhnUk0znSYbH8IYBuJdCE+1luR22jNLMaQdw==", - "dev": true - }, "spdx-correct": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/spdx-correct/-/spdx-correct-3.1.0.tgz", @@ -13461,15 +10325,6 @@ } } }, - "split": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/split/-/split-1.0.1.tgz", - "integrity": "sha512-mTyOoPbrivtXnwnIxZRFYRrPNtEFKlpB2fvjSnCQUiAA6qAZzqwna5envK4uk6OIeP17CsdF3rSBGYVBsU0Tkg==", - "dev": true, - "requires": { - "through": "2" - } - }, "split-string": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/split-string/-/split-string-3.1.0.tgz", @@ -13479,15 +10334,6 @@ "extend-shallow": "^3.0.0" } }, - "split2": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/split2/-/split2-2.2.0.tgz", - "integrity": "sha512-RAb22TG39LhI31MbreBgIuKiIKhVsawfTgEGqKHTK87aG+ul/PB8Sqoi3I7kVdRWiCfrKxK3uo4/YUkpNvhPbw==", - "dev": true, - "requires": { - "through2": "^2.0.2" - } - }, "sprintf-js": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/sprintf-js/-/sprintf-js-1.0.3.tgz", @@ -13520,12 +10366,6 @@ "figgy-pudding": "^3.5.1" } }, - "stack-trace": { - "version": "0.0.10", - "resolved": "https://registry.npmjs.org/stack-trace/-/stack-trace-0.0.10.tgz", - "integrity": "sha1-VHxws0fo0ytOEI6hoqFZ5f3eGcA=", - "dev": true - }, "stack-utils": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/stack-utils/-/stack-utils-1.0.3.tgz", @@ -13596,12 +10436,6 @@ "stream-shift": "^1.0.0" } }, - "stream-exhaust": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/stream-exhaust/-/stream-exhaust-1.0.2.tgz", - "integrity": "sha512-b/qaq/GlBK5xaq1yrK9/zFcyRSTNxmcZwFLGSTG0mXgZl/4Z6GgiyYOXOvY7N3eEvFRAG1bkDRz5EPGSvPYQlw==", - "dev": true - }, "stream-http": { "version": "2.8.3", "resolved": "https://registry.npmjs.org/stream-http/-/stream-http-2.8.3.tgz", @@ -13717,34 +10551,6 @@ } } }, - "strip-bom": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-2.0.0.tgz", - "integrity": "sha1-YhmoVhZSBJHzV4i9vxRHqZx+aw4=", - "dev": true, - "requires": { - "is-utf8": "^0.2.0" - } - }, - "strip-bom-buf": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/strip-bom-buf/-/strip-bom-buf-1.0.0.tgz", - "integrity": "sha1-HLRar1dTD0yvhsf3UXnSyaUd1XI=", - "dev": true, - "requires": { - "is-utf8": "^0.2.1" - } - }, - "strip-bom-stream": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/strip-bom-stream/-/strip-bom-stream-3.0.0.tgz", - "integrity": "sha1-lWvMXYRDD2klapDtgjdlzYWOFZw=", - "dev": true, - "requires": { - "first-chunk-stream": "^2.0.0", - "strip-bom-buf": "^1.0.0" - } - }, "strip-eof": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/strip-eof/-/strip-eof-1.0.0.tgz", @@ -13757,15 +10563,6 @@ "integrity": "sha512-BrpvfNAE3dcvq7ll3xVumzjKjZQ5tI1sEUIKr3Uoks0XUl45St3FlatVqef9prk4jRDzhW6WZg+3bk93y6pLjA==", "dev": true }, - "strip-indent": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-1.0.1.tgz", - "integrity": "sha1-DHlipq3vp7vUrDZkYKY4VSrhoKI=", - "dev": true, - "requires": { - "get-stdin": "^4.0.1" - } - }, "strip-json-comments": { "version": "3.0.1", "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-3.0.1.tgz", @@ -13808,16 +10605,6 @@ } } }, - "sver-compat": { - "version": "1.5.0", - "resolved": "https://registry.npmjs.org/sver-compat/-/sver-compat-1.5.0.tgz", - "integrity": "sha1-PPh9/rTQe0o/FIJ7wYaz/QxkXNg=", - "dev": true, - "requires": { - "es6-iterator": "^2.0.1", - "es6-symbol": "^3.1.1" - } - }, "symbol-tree": { "version": "3.2.4", "resolved": "https://registry.npmjs.org/symbol-tree/-/symbol-tree-3.2.4.tgz", @@ -13970,12 +10757,6 @@ "minimatch": "^3.0.4" } }, - "text-extensions": { - "version": "1.9.0", - "resolved": "https://registry.npmjs.org/text-extensions/-/text-extensions-1.9.0.tgz", - "integrity": "sha512-wiBrwC1EhBelW12Zy26JeOUkQ5mRu+5o8rpsJk5+2t+Y5vE7e842qtZDQ2g1NpX/29HdyFeJ4nSIhI47ENSxlQ==", - "dev": true - }, "text-table": { "version": "0.2.0", "resolved": "https://registry.npmjs.org/text-table/-/text-table-0.2.0.tgz", @@ -14004,16 +10785,6 @@ "xtend": "~4.0.1" } }, - "through2-filter": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/through2-filter/-/through2-filter-3.0.0.tgz", - "integrity": "sha512-jaRjI2WxN3W1V8/FMZ9HKIBXixtiqs3SQSX4/YGIiP3gL6djW48VoZq9tDqeCWs3MT8YY5wb/zli8VW8snY1CA==", - "dev": true, - "requires": { - "through2": "~2.0.0", - "xtend": "~4.0.0" - } - }, "thunky": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/thunky/-/thunky-1.1.0.tgz", @@ -14050,16 +10821,6 @@ "integrity": "sha1-I2QN17QtAEM5ERQIIOXPRA5SHdE=", "dev": true }, - "to-absolute-glob": { - "version": "2.0.2", - "resolved": "https://registry.npmjs.org/to-absolute-glob/-/to-absolute-glob-2.0.2.tgz", - "integrity": "sha1-GGX0PZ50sIItufFFt4z/fQ98hJs=", - "dev": true, - "requires": { - "is-absolute": "^1.0.0", - "is-negated-glob": "^1.0.0" - } - }, "to-arraybuffer": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz", @@ -14114,15 +10875,6 @@ "repeat-string": "^1.6.1" } }, - "to-through": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/to-through/-/to-through-2.0.0.tgz", - "integrity": "sha1-/JKtq6ByZHvAtn1rA2ZKoZUJOvY=", - "dev": true, - "requires": { - "through2": "^2.0.3" - } - }, "toidentifier": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.0.tgz", @@ -14149,18 +10901,6 @@ "punycode": "^2.1.0" } }, - "trim-newlines": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-1.0.0.tgz", - "integrity": "sha1-WIeWa7WCpFA6QetST301ARgVphM=", - "dev": true - }, - "trim-off-newlines": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/trim-off-newlines/-/trim-off-newlines-1.0.1.tgz", - "integrity": "sha1-n5up2e+odkw4dpi8v+sshI8RrbM=", - "dev": true - }, "tslib": { "version": "1.11.1", "resolved": "https://registry.npmjs.org/tslib/-/tslib-1.11.1.tgz", @@ -14188,12 +10928,6 @@ "integrity": "sha1-WuaBd/GS1EViadEIr6k/+HQ/T2Q=", "dev": true }, - "type": { - "version": "1.0.3", - "resolved": "https://registry.npmjs.org/type/-/type-1.0.3.tgz", - "integrity": "sha512-51IMtNfVcee8+9GJvj0spSuFcZHe9vSib6Xtgsny1Km9ugyz2mbS08I3rsUIRYgJohFRFU1160sgRodYz378Hg==", - "dev": true - }, "type-check": { "version": "0.3.2", "resolved": "https://registry.npmjs.org/type-check/-/type-check-0.3.2.tgz", @@ -14240,13 +10974,6 @@ "is-typedarray": "^1.0.0" } }, - "uglify-js": { - "version": "3.12.0", - "resolved": "https://registry.npmjs.org/uglify-js/-/uglify-js-3.12.0.tgz", - "integrity": "sha512-8lBMSkFZuAK7gGF8LswsXmir8eX8d2AAMOnxSDWjKBx/fBR6MypQjs78m6ML9zQVp1/hD4TBdfeMZMC7nW1TAA==", - "dev": true, - "optional": true - }, "unbzip2-stream": { "version": "1.4.3", "resolved": "https://registry.npmjs.org/unbzip2-stream/-/unbzip2-stream-1.4.3.tgz", @@ -14269,35 +10996,6 @@ } } }, - "unc-path-regex": { - "version": "0.1.2", - "resolved": "https://registry.npmjs.org/unc-path-regex/-/unc-path-regex-0.1.2.tgz", - "integrity": "sha1-5z3T17DXxe2G+6xrCufYxqadUPo=", - "dev": true - }, - "undertaker": { - "version": "1.2.1", - "resolved": "https://registry.npmjs.org/undertaker/-/undertaker-1.2.1.tgz", - "integrity": "sha512-71WxIzDkgYk9ZS+spIB8iZXchFhAdEo2YU8xYqBYJ39DIUIqziK78ftm26eecoIY49X0J2MLhG4hr18Yp6/CMA==", - "dev": true, - "requires": { - "arr-flatten": "^1.0.1", - "arr-map": "^2.0.0", - "bach": "^1.0.0", - "collection-map": "^1.0.0", - "es6-weak-map": "^2.0.1", - "last-run": "^1.1.0", - "object.defaults": "^1.0.0", - "object.reduce": "^1.0.0", - "undertaker-registry": "^1.0.0" - } - }, - "undertaker-registry": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/undertaker-registry/-/undertaker-registry-1.0.1.tgz", - "integrity": "sha1-XkvaMI5KiirlhPm5pDWaSZglzFA=", - "dev": true - }, "union-value": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/union-value/-/union-value-1.0.1.tgz", @@ -14328,16 +11026,6 @@ "imurmurhash": "^0.1.4" } }, - "unique-stream": { - "version": "2.3.1", - "resolved": "https://registry.npmjs.org/unique-stream/-/unique-stream-2.3.1.tgz", - "integrity": "sha512-2nY4TnBE70yoxHkDli7DMazpWiP7xMdCYqU2nBRO0UB+ZpEkGsSija7MvmvnZFUeC+mrgiUfcHSr3LmRFIg4+A==", - "dev": true, - "requires": { - "json-stable-stringify-without-jsonify": "^1.0.1", - "through2-filter": "^3.0.0" - } - }, "unpipe": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", @@ -14499,15 +11187,6 @@ } } }, - "v8flags": { - "version": "3.1.3", - "resolved": "https://registry.npmjs.org/v8flags/-/v8flags-3.1.3.tgz", - "integrity": "sha512-amh9CCg3ZxkzQ48Mhcb8iX7xpAfYJgePHxWMQCBWECpOSqJUXgY26ncA61UTV0BkPqfhcy6mzwCIoP4ygxpW8w==", - "dev": true, - "requires": { - "homedir-polyfill": "^1.0.1" - } - }, "validate-npm-package-license": { "version": "3.0.4", "resolved": "https://registry.npmjs.org/validate-npm-package-license/-/validate-npm-package-license-3.0.4.tgz", @@ -14518,12 +11197,6 @@ "spdx-expression-parse": "^3.0.0" } }, - "value-or-function": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/value-or-function/-/value-or-function-3.0.0.tgz", - "integrity": "sha1-HCQ6ULWVwb5Up1S/7OhWO5/42BM=", - "dev": true - }, "vary": { "version": "1.1.2", "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz", @@ -14541,60 +11214,6 @@ "extsprintf": "^1.2.0" } }, - "vinyl": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/vinyl/-/vinyl-2.2.0.tgz", - "integrity": "sha512-MBH+yP0kC/GQ5GwBqrTPTzEfiiLjta7hTtvQtbxBgTeSXsmKQRQecjibMbxIXzVT3Y9KJK+drOz1/k+vsu8Nkg==", - "dev": true, - "requires": { - "clone": "^2.1.1", - "clone-buffer": "^1.0.0", - "clone-stats": "^1.0.0", - "cloneable-readable": "^1.0.0", - "remove-trailing-separator": "^1.0.1", - "replace-ext": "^1.0.0" - } - }, - "vinyl-fs": { - "version": "3.0.3", - "resolved": "https://registry.npmjs.org/vinyl-fs/-/vinyl-fs-3.0.3.tgz", - "integrity": "sha512-vIu34EkyNyJxmP0jscNzWBSygh7VWhqun6RmqVfXePrOwi9lhvRs//dOaGOTRUQr4tx7/zd26Tk5WeSVZitgng==", - "dev": true, - "requires": { - "fs-mkdirp-stream": "^1.0.0", - "glob-stream": "^6.1.0", - "graceful-fs": "^4.0.0", - "is-valid-glob": "^1.0.0", - "lazystream": "^1.0.0", - "lead": "^1.0.0", - "object.assign": "^4.0.4", - "pumpify": "^1.3.5", - "readable-stream": "^2.3.3", - "remove-bom-buffer": "^3.0.0", - "remove-bom-stream": "^1.2.0", - "resolve-options": "^1.1.0", - "through2": "^2.0.0", - "to-through": "^2.0.0", - "value-or-function": "^3.0.0", - "vinyl": "^2.0.0", - "vinyl-sourcemap": "^1.1.0" - } - }, - "vinyl-sourcemap": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/vinyl-sourcemap/-/vinyl-sourcemap-1.1.0.tgz", - "integrity": "sha1-kqgAWTo4cDqM2xHYswCtS+Y7PhY=", - "dev": true, - "requires": { - "append-buffer": "^1.0.2", - "convert-source-map": "^1.5.0", - "graceful-fs": "^4.1.6", - "normalize-path": "^2.1.1", - "now-and-later": "^2.0.0", - "remove-bom-buffer": "^3.0.0", - "vinyl": "^2.0.0" - } - }, "vm-browserify": { "version": "1.1.2", "resolved": "https://registry.npmjs.org/vm-browserify/-/vm-browserify-1.1.2.tgz", @@ -14959,8 +11578,7 @@ }, "minimist": { "version": "1.2.0", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", - "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=", + "resolved": "", "dev": true }, "os-locale": { @@ -15460,24 +12078,12 @@ "isexe": "^2.0.0" } }, - "which-module": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/which-module/-/which-module-1.0.0.tgz", - "integrity": "sha1-u6Y8qGGUiZT/MHc2CJ47lgJsKk8=", - "dev": true - }, "word-wrap": { "version": "1.2.3", "resolved": "https://registry.npmjs.org/word-wrap/-/word-wrap-1.2.3.tgz", "integrity": "sha512-Hz/mrNwitNRh/HUAtM/VT/5VH+ygD6DV7mYKZAtHOrbs8U7lvPS6xf7EJKMF0uW1KJCl0H701g3ZGus+muE5vQ==", "dev": true }, - "wordwrap": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/wordwrap/-/wordwrap-1.0.0.tgz", - "integrity": "sha1-J1hIEIkUVqQXHI0CJkQa3pDLyus=", - "dev": true - }, "worker-farm": { "version": "1.7.0", "resolved": "https://registry.npmjs.org/worker-farm/-/worker-farm-1.7.0.tgz", @@ -15487,53 +12093,6 @@ "errno": "~0.1.7" } }, - "wrap-ansi": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-2.1.0.tgz", - "integrity": "sha1-2Pw9KE3QV5T+hJc8rs3Rz4JP3YU=", - "dev": true, - "requires": { - "string-width": "^1.0.1", - "strip-ansi": "^3.0.1" - }, - "dependencies": { - "ansi-regex": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", - "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", - "dev": true - }, - "is-fullwidth-code-point": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz", - "integrity": "sha1-754xOG8DGn8NZDr4L95QxFfvAMs=", - "dev": true, - "requires": { - "number-is-nan": "^1.0.0" - } - }, - "string-width": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/string-width/-/string-width-1.0.2.tgz", - "integrity": "sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=", - "dev": true, - "requires": { - "code-point-at": "^1.0.0", - "is-fullwidth-code-point": "^1.0.0", - "strip-ansi": "^3.0.0" - } - }, - "strip-ansi": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", - "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", - "dev": true, - "requires": { - "ansi-regex": "^2.0.0" - } - } - } - }, "wrappy": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", @@ -15585,85 +12144,6 @@ "integrity": "sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ==", "dev": true }, - "y18n": { - "version": "3.2.1", - "resolved": "https://registry.npmjs.org/y18n/-/y18n-3.2.1.tgz", - "integrity": "sha1-bRX7qITAhnnA136I53WegR4H+kE=", - "dev": true - }, - "yallist": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/yallist/-/yallist-4.0.0.tgz", - "integrity": "sha512-3wdGidZyq5PB084XLES5TpOSRA3wjXAlIWMhum2kRcv/41Sn2emQ0dycQW4uZXLejwKvg6EsvbdlVL+FYEct7A==", - "dev": true - }, - "yargs": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/yargs/-/yargs-7.1.0.tgz", - "integrity": "sha1-a6MY6xaWFyf10oT46gA+jWFU0Mg=", - "dev": true, - "requires": { - "camelcase": "^3.0.0", - "cliui": "^3.2.0", - "decamelize": "^1.1.1", - "get-caller-file": "^1.0.1", - "os-locale": "^1.4.0", - "read-pkg-up": "^1.0.1", - "require-directory": "^2.1.1", - "require-main-filename": "^1.0.1", - "set-blocking": "^2.0.0", - "string-width": "^1.0.2", - "which-module": "^1.0.0", - "y18n": "^3.2.1", - "yargs-parser": "^5.0.0" - }, - "dependencies": { - "ansi-regex": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", - "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", - "dev": true - }, - "is-fullwidth-code-point": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz", - "integrity": "sha1-754xOG8DGn8NZDr4L95QxFfvAMs=", - "dev": true, - "requires": { - "number-is-nan": "^1.0.0" - } - }, - "string-width": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/string-width/-/string-width-1.0.2.tgz", - "integrity": "sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=", - "dev": true, - "requires": { - "code-point-at": "^1.0.0", - "is-fullwidth-code-point": "^1.0.0", - "strip-ansi": "^3.0.0" - } - }, - "strip-ansi": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", - "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", - "dev": true, - "requires": { - "ansi-regex": "^2.0.0" - } - } - } - }, - "yargs-parser": { - "version": "5.0.0", - "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-5.0.0.tgz", - "integrity": "sha1-J17PDX/+Bcd+ZOfIbkzZS/DhIoo=", - "dev": true, - "requires": { - "camelcase": "^3.0.0" - } - }, "yauzl": { "version": "2.10.0", "resolved": "https://registry.npmjs.org/yauzl/-/yauzl-2.10.0.tgz", diff --git a/package.json b/package.json index e296ed4..c4f87e6 100644 --- a/package.json +++ b/package.json @@ -21,17 +21,12 @@ ], "devDependencies": { "eslint": "^6.8.0", - "gulp": "^4.0.2", - "gulp-bump": "^2.6.1", - "gulp-conventional-changelog": "^2.0.35", - "gulp-tag-version": "^1.3.0", - "gulp-util": "^3.0.8", "jest": "^25.1.0", "jest-worker": "^24.9.0", "json-stringify-pretty-compact": "^2.0.0", + "puppeteer-core": "^5.5.0", "run-sequence": "^2.2.1", "webpack": "^4.44.2", - "puppeteer-core": "^5.5.0", "webpack-cli": "^3.3.11", "webpack-dev-server": "^3.11.0" }, @@ -40,7 +35,7 @@ "build": "webpack --mode=production & webpack --mode=production --env.MINIMIZE", "build-alpha": "webpack --mode=production --env.ALPHA & webpack --mode=production --env.MINIMIZE --env.ALPHA", "build-examples": "webpack --config webpack.examples.config.js --mode=production --env.ALPHA & webpack --config webpack.examples.config.js --mode=production --env.MINIMIZE --env.ALPHA", - "lint": "eslint 'src/**/*.js' 'demo/js/Demo.js' 'demo/js/Compare.js' 'examples/*.js' 'webpack.*.js' 'Gulpfile.js'", + "lint": "eslint 'src/**/*.js' 'demo/js/Demo.js' 'demo/js/Compare.js' 'examples/*.js' 'webpack.*.js'", "doc": "gulp doc", "test": "npm run test-node", "test-all": "jest", From 341c2472950177ee4ff790295d66e597cda030bf Mon Sep 17 00:00:00 2001 From: liabru Date: Wed, 25 Nov 2020 23:17:10 +0000 Subject: [PATCH 06/23] added release scripts --- .gitignore | 1 + package.json | 9 +++++++-- 2 files changed, 8 insertions(+), 2 deletions(-) diff --git a/.gitignore b/.gitignore index baa4e68..f87756c 100644 --- a/.gitignore +++ b/.gitignore @@ -3,6 +3,7 @@ node_modules npm-debug.log doc matter-doc-theme +RELEASE.md build/matter-dev.js build/matter-dev.min.js demo/js/lib/matter-dev.js diff --git a/package.json b/package.json index c4f87e6..2aea997 100644 --- a/package.json +++ b/package.json @@ -20,6 +20,7 @@ "rigid body physics" ], "devDependencies": { + "conventional-changelog-cli": "^2.1.1", "eslint": "^6.8.0", "jest": "^25.1.0", "jest-worker": "^24.9.0", @@ -36,13 +37,17 @@ "build-alpha": "webpack --mode=production --env.ALPHA & webpack --mode=production --env.MINIMIZE --env.ALPHA", "build-examples": "webpack --config webpack.examples.config.js --mode=production --env.ALPHA & webpack --config webpack.examples.config.js --mode=production --env.MINIMIZE --env.ALPHA", "lint": "eslint 'src/**/*.js' 'demo/js/Demo.js' 'demo/js/Compare.js' 'examples/*.js' 'webpack.*.js'", - "doc": "gulp doc", + "doc": "yuidoc --config yuidoc.json --project-version $npm_package_version", "test": "npm run test-node", "test-all": "jest", "test-save": "SAVE=true npm run test-node", "test-watch": "npm run test-node -- --watch", "test-node": "jest ./test/Examples.spec.js", - "test-browser": "jest ./test/Browser.spec.js" + "test-browser": "jest ./test/Browser.spec.js", + "changelog": "conventional-changelog -i CHANGELOG.md -s -r", + "release": "npm version --no-git-tag-version", + "preversion": "git checkout -b master && npm run lint && SAVE=true npm run test-all", + "version": "git checkout -b release/$npm_package_version && npm run build" }, "dependencies": {}, "files": [ From 864452db046f507c0412901c0cd93316acaa47f8 Mon Sep 17 00:00:00 2001 From: liabru Date: Sat, 5 Dec 2020 23:06:02 +0000 Subject: [PATCH 07/23] changed docs build config --- .gitignore | 2 +- yuidoc.json | 2 +- 2 files changed, 2 insertions(+), 2 deletions(-) diff --git a/.gitignore b/.gitignore index f87756c..cbb5b49 100644 --- a/.gitignore +++ b/.gitignore @@ -1,7 +1,7 @@ .idea node_modules npm-debug.log -doc +docs matter-doc-theme RELEASE.md build/matter-dev.js diff --git a/yuidoc.json b/yuidoc.json index d163574..203db10 100644 --- a/yuidoc.json +++ b/yuidoc.json @@ -4,7 +4,7 @@ "url": "http://brm.io/matter-js/", "options": { "linkNatives": true, - "outdir": "doc/build", + "outdir": "docs", "themedir": "matter-doc-theme", "paths": "src" } From fe80478725ea2673dd29619ce59c23d373c78a4f Mon Sep 17 00:00:00 2001 From: liabru Date: Sat, 5 Dec 2020 23:32:47 +0000 Subject: [PATCH 08/23] added examples to dev server bundle and commit built examples --- .gitignore | 1 - demo/index.html | 48 +- demo/js/Examples.js | 5705 +++++++++++++++++++++++++++++++++++++++++++ demo/js/Server.js | 3 + webpack.config.js | 4 +- 5 files changed, 5714 insertions(+), 47 deletions(-) create mode 100644 demo/js/Examples.js create mode 100644 demo/js/Server.js diff --git a/.gitignore b/.gitignore index cbb5b49..1b9e401 100644 --- a/.gitignore +++ b/.gitignore @@ -7,7 +7,6 @@ RELEASE.md build/matter-dev.js build/matter-dev.min.js demo/js/lib/matter-dev.js -demo/js/Examples.js demo/js/Examples.min.js examples/build test/browser/diffs diff --git a/demo/index.html b/demo/index.html index b6898cf..17d9eb3 100644 --- a/demo/index.html +++ b/demo/index.html @@ -16,6 +16,9 @@ + + + @@ -28,51 +31,6 @@ - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - diff --git a/examples/avalanche.js b/examples/avalanche.js index f22dfa4..b79b525 100644 --- a/examples/avalanche.js +++ b/examples/avalanche.js @@ -41,13 +41,13 @@ Example.avalanche = function() { var stack = Composites.stack(20, 20, 20, 5, 0, 0, function(x, y) { return Bodies.circle(x, y, Common.random(10, 20), { friction: 0.00001, restitution: 0.5, density: 0.001 }); }); - + World.add(world, stack); World.add(world, [ - Bodies.rectangle(200, 150, 700, 20, { isStatic: true, angle: Math.PI * 0.06 }), - Bodies.rectangle(500, 350, 700, 20, { isStatic: true, angle: -Math.PI * 0.06 }), - Bodies.rectangle(340, 580, 700, 20, { isStatic: true, angle: Math.PI * 0.04 }) + Bodies.rectangle(200, 150, 700, 20, { isStatic: true, angle: Math.PI * 0.06, render: { fillStyle: '#060a19' } }), + Bodies.rectangle(500, 350, 700, 20, { isStatic: true, angle: -Math.PI * 0.06, render: { fillStyle: '#060a19' } }), + Bodies.rectangle(340, 580, 700, 20, { isStatic: true, angle: Math.PI * 0.04, render: { fillStyle: '#060a19' } }) ]); // add mouse control diff --git a/examples/ballPool.js b/examples/ballPool.js index 356bbaf..f6ac267 100644 --- a/examples/ballPool.js +++ b/examples/ballPool.js @@ -39,7 +39,7 @@ Example.ballPool = function() { // add bodies World.add(world, [ - Bodies.rectangle(400, 600, 1200, 50.5, { isStatic: true }) + Bodies.rectangle(400, 600, 1200, 50.5, { isStatic: true, render: { fillStyle: '#060a19' } }) ]); var stack = Composites.stack(100, 0, 10, 8, 10, 10, function(x, y) { diff --git a/examples/bridge.js b/examples/bridge.js index d15777f..e77f58a 100644 --- a/examples/bridge.js +++ b/examples/bridge.js @@ -44,7 +44,7 @@ Example.bridge = function() { density: 0.005, frictionAir: 0.05, render: { - fillStyle: '#575375' + fillStyle: '#060a19' } }); }); diff --git a/examples/car.js b/examples/car.js index 597ae01..76fb5b6 100644 --- a/examples/car.js +++ b/examples/car.js @@ -48,9 +48,9 @@ Example.car = function() { World.add(world, Composites.car(350, 300, 150 * scale, 30 * scale, 30 * scale)); World.add(world, [ - Bodies.rectangle(200, 150, 400, 20, { isStatic: true, angle: Math.PI * 0.06 }), - Bodies.rectangle(500, 350, 650, 20, { isStatic: true, angle: -Math.PI * 0.06 }), - Bodies.rectangle(300, 560, 600, 20, { isStatic: true, angle: Math.PI * 0.04 }) + Bodies.rectangle(200, 150, 400, 20, { isStatic: true, angle: Math.PI * 0.06, render: { fillStyle: '#060a19' }}), + Bodies.rectangle(500, 350, 650, 20, { isStatic: true, angle: -Math.PI * 0.06, render: { fillStyle: '#060a19' }}), + Bodies.rectangle(300, 560, 600, 20, { isStatic: true, angle: Math.PI * 0.04, render: { fillStyle: '#060a19' }}) ]); // add mouse control diff --git a/examples/catapult.js b/examples/catapult.js index e58edad..2ebfb55 100644 --- a/examples/catapult.js +++ b/examples/catapult.js @@ -48,9 +48,9 @@ Example.catapult = function() { World.add(world, [ stack, catapult, - Bodies.rectangle(400, 600, 800, 50.5, { isStatic: true }), - Bodies.rectangle(250, 555, 20, 50, { isStatic: true }), - Bodies.rectangle(400, 535, 20, 80, { isStatic: true, collisionFilter: { group: group } }), + Bodies.rectangle(400, 600, 800, 50.5, { isStatic: true, render: { fillStyle: '#060a19' } }), + Bodies.rectangle(250, 555, 20, 50, { isStatic: true, render: { fillStyle: '#060a19' } }), + Bodies.rectangle(400, 535, 20, 80, { isStatic: true, collisionFilter: { group: group }, render: { fillStyle: '#060a19' } }), Bodies.circle(560, 100, 50, { density: 0.005 }), Constraint.create({ bodyA: catapult, diff --git a/examples/cloth.js b/examples/cloth.js index 10d4066..da6e163 100644 --- a/examples/cloth.js +++ b/examples/cloth.js @@ -43,8 +43,8 @@ Example.cloth = function() { World.add(world, [ cloth, - Bodies.circle(300, 500, 80, { isStatic: true }), - Bodies.rectangle(500, 480, 80, 80, { isStatic: true }), + Bodies.circle(300, 500, 80, { isStatic: true, render: { fillStyle: '#060a19' }}), + Bodies.rectangle(500, 480, 80, 80, { isStatic: true, render: { fillStyle: '#060a19' }}), Bodies.rectangle(400, 609, 800, 50, { isStatic: true }) ]); diff --git a/examples/collisionFiltering.js b/examples/collisionFiltering.js index f1f2e2f..67e5bf1 100644 --- a/examples/collisionFiltering.js +++ b/examples/collisionFiltering.js @@ -23,8 +23,7 @@ Example.collisionFiltering = function() { options: { width: 800, height: 600, - wireframes: false, - background: '#111' + wireframes: false } }); @@ -40,9 +39,9 @@ Example.collisionFiltering = function() { greenCategory = 0x0004, blueCategory = 0x0008; - var redColor = '#C44D58', - blueColor = '#4ECDC4', - greenColor = '#C7F464'; + var colorA = '#f55a3c', + colorB = '#063e7b', + colorC = '#f5d259'; // add floor World.add(world, Bodies.rectangle(400, 600, 900, 50, { @@ -57,14 +56,14 @@ Example.collisionFiltering = function() { World.add(world, Composites.stack(275, 100, 5, 9, 10, 10, function(x, y, column, row) { var category = redCategory, - color = redColor; + color = colorA; if (row > 5) { category = blueCategory; - color = blueColor; + color = colorB; } else if (row > 2) { category = greenCategory; - color = greenColor; + color = colorC; } return Bodies.circle(x, y, 20, { @@ -87,7 +86,7 @@ Example.collisionFiltering = function() { mask: defaultCategory | greenCategory }, render: { - fillStyle: greenColor + fillStyle: colorC } }) ); @@ -99,7 +98,7 @@ Example.collisionFiltering = function() { mask: defaultCategory | redCategory }, render: { - fillStyle: redColor + fillStyle: colorA } }) ); @@ -111,7 +110,7 @@ Example.collisionFiltering = function() { mask: defaultCategory | blueCategory }, render: { - fillStyle: blueColor + fillStyle: colorB } }) ); diff --git a/examples/concave.js b/examples/concave.js index 0a25135..3289a49 100644 --- a/examples/concave.js +++ b/examples/concave.js @@ -47,7 +47,7 @@ Example.concave = function() { horseShoe = Vertices.fromPath('35 7 19 17 14 38 14 58 25 79 45 85 65 84 65 66 46 67 34 59 30 44 33 29 45 23 66 23 66 7 53 7'); var stack = Composites.stack(50, 50, 6, 4, 10, 10, function(x, y) { - var color = Common.choose(['#556270', '#4ECDC4', '#C7F464', '#FF6B6B', '#C44D58']); + var color = Common.choose(['#f19648', '#f5d259', '#f55a3c', '#063e7b', '#ececd1']); return Bodies.fromVertices(x, y, Common.choose([arrow, chevron, star, horseShoe]), { render: { fillStyle: color, diff --git a/examples/doublePendulum.js b/examples/doublePendulum.js index a847bdb..dd84a0f 100644 --- a/examples/doublePendulum.js +++ b/examples/doublePendulum.js @@ -26,8 +26,7 @@ Example.doublePendulum = function() { options: { width: 800, height: 600, - wireframes: false, - background: '#0f0f13' + wireframes: false } }); @@ -54,9 +53,6 @@ Example.doublePendulum = function() { }); }); - pendulum.bodies[0].render.strokeStyle = '#4a485b'; - pendulum.bodies[1].render.strokeStyle = '#4a485b'; - world.gravity.scale = 0.002; Composites.chain(pendulum, 0.45, 0, -0.45, 0, { diff --git a/examples/friction.js b/examples/friction.js index 1284b73..7502b73 100644 --- a/examples/friction.js +++ b/examples/friction.js @@ -40,17 +40,17 @@ Example.friction = function() { ]); World.add(world, [ - Bodies.rectangle(300, 180, 700, 20, { isStatic: true, angle: Math.PI * 0.06 }), + Bodies.rectangle(300, 180, 700, 20, { isStatic: true, angle: Math.PI * 0.06, render: { fillStyle: '#060a19' } }), Bodies.rectangle(300, 70, 40, 40, { friction: 0.001 }) ]); World.add(world, [ - Bodies.rectangle(300, 350, 700, 20, { isStatic: true, angle: Math.PI * 0.06 }), + Bodies.rectangle(300, 350, 700, 20, { isStatic: true, angle: Math.PI * 0.06, render: { fillStyle: '#060a19' } }), Bodies.rectangle(300, 250, 40, 40, { friction: 0.0005 }) ]); World.add(world, [ - Bodies.rectangle(300, 520, 700, 20, { isStatic: true, angle: Math.PI * 0.06 }), + Bodies.rectangle(300, 520, 700, 20, { isStatic: true, angle: Math.PI * 0.06, render: { fillStyle: '#060a19' } }), Bodies.rectangle(300, 430, 40, 40, { friction: 0 }) ]); diff --git a/examples/manipulation.js b/examples/manipulation.js index f69eb81..8c407cb 100644 --- a/examples/manipulation.js +++ b/examples/manipulation.js @@ -35,15 +35,15 @@ Example.manipulation = function() { Runner.run(runner, engine); // add bodies - var bodyA = Bodies.rectangle(100, 200, 50, 50, { isStatic: true }), + var bodyA = Bodies.rectangle(100, 200, 50, 50, { isStatic: true, render: { fillStyle: '#060a19' } }), bodyB = Bodies.rectangle(200, 200, 50, 50), bodyC = Bodies.rectangle(300, 200, 50, 50), bodyD = Bodies.rectangle(400, 200, 50, 50), bodyE = Bodies.rectangle(550, 200, 50, 50), bodyF = Bodies.rectangle(700, 200, 50, 50), - bodyG = Bodies.circle(400, 100, 25), - partA = Bodies.rectangle(600, 200, 120, 50), - partB = Bodies.rectangle(660, 200, 50, 190), + bodyG = Bodies.circle(400, 100, 25, { render: { fillStyle: '#060a19' } }), + partA = Bodies.rectangle(600, 200, 120, 50, { render: { fillStyle: '#060a19' } }), + partB = Bodies.rectangle(660, 200, 50, 190, { render: { fillStyle: '#060a19' } }), compound = Body.create({ parts: [partA, partB], isStatic: true diff --git a/examples/ragdoll.js b/examples/ragdoll.js index 1a717f8..a7ea8dd 100644 --- a/examples/ragdoll.js +++ b/examples/ragdoll.js @@ -27,8 +27,7 @@ Example.ragdoll = function() { options: { width: 800, height: 600, - showAngleIndicator: true, - background: '#0f0f13' + showAngleIndicator: true } }); @@ -45,7 +44,9 @@ Example.ragdoll = function() { return Bodies.rectangle(x - 50, y + column * 50, 100, 1000, { isStatic: true, render: { - fillStyle: '#222' + fillStyle: '#060a19', + strokeStyle: '#ffffff', + lineWidth: 1 } }); }); @@ -55,7 +56,7 @@ Example.ragdoll = function() { var sides = Math.round(Common.random(1, 8)), options = { render: { - fillStyle: Common.choose(['#006BA6', '#0496FF', '#D81159', '#8F2D56']) + fillStyle: Common.choose(['#f19648', '#f5d259', '#f55a3c', '#063e7b', '#ececd1']) } }; diff --git a/examples/sensors.js b/examples/sensors.js index ff92caa..a034b9b 100644 --- a/examples/sensors.js +++ b/examples/sensors.js @@ -21,8 +21,7 @@ Example.sensors = function() { options: { width: 800, height: 600, - wireframes: false, - background: '#111' + wireframes: false } }); @@ -33,14 +32,14 @@ Example.sensors = function() { Runner.run(runner, engine); // add bodies - var redColor = '#C44D58', - greenColor = '#C7F464'; + var colorA = '#f55a3c', + colorB = '#f5d259'; var collider = Bodies.rectangle(400, 300, 500, 50, { isSensor: true, isStatic: true, render: { - strokeStyle: redColor, + strokeStyle: colorA, fillStyle: 'transparent', lineWidth: 1 } @@ -48,11 +47,11 @@ Example.sensors = function() { World.add(world, [ collider, - Bodies.rectangle(400, 620, 800, 50, { + Bodies.rectangle(400, 600, 800, 50, { isStatic: true, render: { - fillStyle: 'transparent', - lineWidth: 1 + fillStyle: '#060a19', + lineWidth: 0 } }) ]); @@ -60,7 +59,7 @@ Example.sensors = function() { World.add(world, Bodies.circle(400, 40, 30, { render: { - strokeStyle: greenColor, + strokeStyle: colorB, fillStyle: 'transparent', lineWidth: 1 } @@ -74,9 +73,9 @@ Example.sensors = function() { var pair = pairs[i]; if (pair.bodyA === collider) { - pair.bodyB.render.strokeStyle = redColor; + pair.bodyB.render.strokeStyle = colorA; } else if (pair.bodyB === collider) { - pair.bodyA.render.strokeStyle = redColor; + pair.bodyA.render.strokeStyle = colorA; } } }); @@ -88,9 +87,9 @@ Example.sensors = function() { var pair = pairs[i]; if (pair.bodyA === collider) { - pair.bodyB.render.strokeStyle = greenColor; + pair.bodyB.render.strokeStyle = colorB; } else if (pair.bodyB === collider) { - pair.bodyA.render.strokeStyle = greenColor; + pair.bodyA.render.strokeStyle = colorB; } } }); diff --git a/examples/slingshot.js b/examples/slingshot.js index 49344e1..df2f6f3 100644 --- a/examples/slingshot.js +++ b/examples/slingshot.js @@ -34,7 +34,7 @@ Example.slingshot = function() { Runner.run(runner, engine); // add bodies - var ground = Bodies.rectangle(395, 600, 815, 50, { isStatic: true }), + var ground = Bodies.rectangle(395, 600, 815, 50, { isStatic: true, render: { fillStyle: '#060a19' } }), rockOptions = { density: 0.004 }, rock = Bodies.polygon(170, 450, 8, 20, rockOptions), anchor = { x: 170, y: 450 }, @@ -48,7 +48,7 @@ Example.slingshot = function() { return Bodies.rectangle(x, y, 25, 40); }); - var ground2 = Bodies.rectangle(610, 250, 200, 20, { isStatic: true }); + var ground2 = Bodies.rectangle(610, 250, 200, 20, { isStatic: true, render: { fillStyle: '#060a19' } }); var pyramid2 = Composites.pyramid(550, 0, 5, 10, 0, 0, function(x, y) { return Bodies.rectangle(x, y, 25, 40); diff --git a/examples/sprites.js b/examples/sprites.js index 7c6bee8..1bdbba5 100644 --- a/examples/sprites.js +++ b/examples/sprites.js @@ -22,7 +22,6 @@ Example.sprites = function() { options: { width: 800, height: 600, - background: '#0f0f13', showAngleIndicator: false, wireframes: false } diff --git a/examples/staticFriction.js b/examples/staticFriction.js index adc9d4d..3366c5d 100644 --- a/examples/staticFriction.js +++ b/examples/staticFriction.js @@ -34,7 +34,7 @@ Example.staticFriction = function() { Runner.run(runner, engine); // add bodies - var body = Bodies.rectangle(400, 500, 200, 60, { isStatic: true, chamfer: 10 }), + var body = Bodies.rectangle(400, 500, 200, 60, { isStatic: true, chamfer: 10, render: { fillStyle: '#060a19' } }), size = 50, counter = -1; diff --git a/examples/svg.js b/examples/svg.js index 4569576..41b5764 100644 --- a/examples/svg.js +++ b/examples/svg.js @@ -45,7 +45,7 @@ Example.svg = function() { (function(i) { $.get('./svg/' + svgs[i] + '.svg').done(function(data) { var vertexSets = [], - color = Common.choose(['#556270', '#4ECDC4', '#C7F464', '#FF6B6B', '#C44D58']); + color = Common.choose(['#f19648', '#f5d259', '#f55a3c', '#063e7b', '#ececd1']); $(data).find('path').each(function(i, path) { var points = Svg.pathToVertices(path, 30); @@ -65,7 +65,7 @@ Example.svg = function() { $.get('./svg/svg.svg').done(function(data) { var vertexSets = [], - color = Common.choose(['#556270', '#4ECDC4', '#C7F464', '#FF6B6B', '#C44D58']); + color = Common.choose(['#f19648', '#f5d259', '#f55a3c', '#063e7b', '#ececd1']); $(data).find('path').each(function(i, path) { vertexSets.push(Svg.pathToVertices(path, 30)); diff --git a/examples/terrain.js b/examples/terrain.js index d9ebfa2..f6f54af 100644 --- a/examples/terrain.js +++ b/examples/terrain.js @@ -47,8 +47,8 @@ Example.terrain = function() { terrain = Bodies.fromVertices(400, 350, vertexSets, { isStatic: true, render: { - fillStyle: '#2e2b44', - strokeStyle: '#2e2b44', + fillStyle: '#060a19', + strokeStyle: '#060a19', lineWidth: 1 } }, true); From ac3da073ed80acff698f339ec34499826061a4f5 Mon Sep 17 00:00:00 2001 From: liabru Date: Thu, 24 Dec 2020 17:19:52 +0000 Subject: [PATCH 17/23] update package lock --- package-lock.json | 6706 +++++++++++++++++++++++++-------------------- 1 file changed, 3741 insertions(+), 2965 deletions(-) diff --git a/package-lock.json b/package-lock.json index e7968df..ebcd1a8 100644 --- a/package-lock.json +++ b/package-lock.json @@ -5,104 +5,88 @@ "requires": true, "dependencies": { "@babel/code-frame": { - "version": "7.5.5", - "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.5.5.tgz", - "integrity": "sha512-27d4lZoomVyo51VegxI20xZPuSHusqbQag/ztrBC7wegWoQ1nLREPVSKSW8byhTlzTKyNE4ifaTA6lCp7JjpFw==", + "version": "7.12.11", + "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.12.11.tgz", + "integrity": "sha512-Zt1yodBx1UcyiePMSkWnU4hPqhwq7hGi2nFL1LeA3EUl+q2LQx16MISgJ0+z7dnmgvP9QtIleuETGOiOH1RcIw==", "dev": true, "requires": { - "@babel/highlight": "^7.0.0" + "@babel/highlight": "^7.10.4" } }, "@babel/core": { - "version": "7.12.9", - "resolved": "https://registry.npmjs.org/@babel/core/-/core-7.12.9.tgz", - "integrity": "sha512-gTXYh3M5wb7FRXQy+FErKFAv90BnlOuNn1QkCK2lREoPAjrQCO49+HVSrFoe5uakFAF5eenS75KbO2vQiLrTMQ==", + "version": "7.12.10", + "resolved": "https://registry.npmjs.org/@babel/core/-/core-7.12.10.tgz", + "integrity": "sha512-eTAlQKq65zHfkHZV0sIVODCPGVgoo1HdBlbSLi9CqOzuZanMv2ihzY+4paiKr1mH+XmYESMAmJ/dpZ68eN6d8w==", "dev": true, "requires": { "@babel/code-frame": "^7.10.4", - "@babel/generator": "^7.12.5", + "@babel/generator": "^7.12.10", "@babel/helper-module-transforms": "^7.12.1", "@babel/helpers": "^7.12.5", - "@babel/parser": "^7.12.7", + "@babel/parser": "^7.12.10", "@babel/template": "^7.12.7", - "@babel/traverse": "^7.12.9", - "@babel/types": "^7.12.7", + "@babel/traverse": "^7.12.10", + "@babel/types": "^7.12.10", "convert-source-map": "^1.7.0", "debug": "^4.1.0", "gensync": "^1.0.0-beta.1", "json5": "^2.1.2", "lodash": "^4.17.19", - "resolve": "^1.3.2", "semver": "^5.4.1", "source-map": "^0.5.0" }, "dependencies": { - "@babel/code-frame": { - "version": "7.10.4", - "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", - "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", - "dev": true, - "requires": { - "@babel/highlight": "^7.10.4" - } - }, - "@babel/highlight": { - "version": "7.10.4", - "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", - "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", - "dev": true, - "requires": { - "@babel/helper-validator-identifier": "^7.10.4", - "chalk": "^2.0.0", - "js-tokens": "^4.0.0" - } - }, - "convert-source-map": { - "version": "1.7.0", - "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.7.0.tgz", - "integrity": "sha512-4FJkXzKXEDB1snCFZlLP4gpC3JILicCpGbzG9f9G7tGqGCzETQ2hWPrcinA9oU4wtf2biUaEH5065UnMeR33oA==", - "dev": true, - "requires": { - "safe-buffer": "~5.1.1" - } - }, "semver": { "version": "5.7.1", "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", "dev": true + }, + "source-map": { + "version": "0.5.7", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz", + "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=", + "dev": true } } }, "@babel/generator": { - "version": "7.12.5", - "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.12.5.tgz", - "integrity": "sha512-m16TQQJ8hPt7E+OS/XVQg/7U184MLXtvuGbCdA7na61vha+ImkyyNM/9DDA0unYCVZn3ZOhng+qz48/KBOT96A==", + "version": "7.12.11", + "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.12.11.tgz", + "integrity": "sha512-Ggg6WPOJtSi8yYQvLVjG8F/TlpWDlKx0OpS4Kt+xMQPs5OaGYWy+v1A+1TvxI6sAMGZpKWWoAQ1DaeQbImlItA==", "dev": true, "requires": { - "@babel/types": "^7.12.5", + "@babel/types": "^7.12.11", "jsesc": "^2.5.1", "source-map": "^0.5.0" + }, + "dependencies": { + "source-map": { + "version": "0.5.7", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz", + "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=", + "dev": true + } } }, "@babel/helper-function-name": { - "version": "7.10.4", - "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", - "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", + "version": "7.12.11", + "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.12.11.tgz", + "integrity": "sha512-AtQKjtYNolKNi6nNNVLQ27CP6D9oFR6bq/HPYSizlzbp7uC1M59XJe8L+0uXjbIaZaUJF99ruHqVGiKXU/7ybA==", "dev": true, "requires": { - "@babel/helper-get-function-arity": "^7.10.4", - "@babel/template": "^7.10.4", - "@babel/types": "^7.10.4" + "@babel/helper-get-function-arity": "^7.12.10", + "@babel/template": "^7.12.7", + "@babel/types": "^7.12.11" } }, "@babel/helper-get-function-arity": { - "version": "7.10.4", - "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", - "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", + "version": "7.12.10", + "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.12.10.tgz", + "integrity": "sha512-mm0n5BPjR06wh9mPQaDdXWDoll/j5UpCAPl1x8fS71GHm7HA6Ua2V4ylG1Ju8lvcTOietbPNNPaSilKj+pj+Ag==", "dev": true, "requires": { - "@babel/types": "^7.10.4" + "@babel/types": "^7.12.10" } }, "@babel/helper-member-expression-to-functions": { @@ -141,12 +125,12 @@ } }, "@babel/helper-optimise-call-expression": { - "version": "7.12.7", - "resolved": "https://registry.npmjs.org/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.12.7.tgz", - "integrity": "sha512-I5xc9oSJ2h59OwyUqjv95HRyzxj53DAubUERgQMrpcCEYQyToeHA+NEcUEsVWB4j53RDeskeBJ0SgRAYHDBckw==", + "version": "7.12.10", + "resolved": "https://registry.npmjs.org/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.12.10.tgz", + "integrity": "sha512-4tpbU0SrSTjjt65UMWSrUOPZTsgvPgGG4S8QSTNHacKzpS51IVWGDj0yCwyeZND/i+LSN2g/O63jEXEWm49sYQ==", "dev": true, "requires": { - "@babel/types": "^7.12.7" + "@babel/types": "^7.12.10" } }, "@babel/helper-plugin-utils": { @@ -156,15 +140,15 @@ "dev": true }, "@babel/helper-replace-supers": { - "version": "7.12.5", - "resolved": "https://registry.npmjs.org/@babel/helper-replace-supers/-/helper-replace-supers-7.12.5.tgz", - "integrity": "sha512-5YILoed0ZyIpF4gKcpZitEnXEJ9UoDRki1Ey6xz46rxOzfNMAhVIJMoune1hmPVxh40LRv1+oafz7UsWX+vyWA==", + "version": "7.12.11", + "resolved": "https://registry.npmjs.org/@babel/helper-replace-supers/-/helper-replace-supers-7.12.11.tgz", + "integrity": "sha512-q+w1cqmhL7R0FNzth/PLLp2N+scXEK/L2AHbXUyydxp828F4FEa5WcVoqui9vFRiHDQErj9Zof8azP32uGVTRA==", "dev": true, "requires": { - "@babel/helper-member-expression-to-functions": "^7.12.1", - "@babel/helper-optimise-call-expression": "^7.10.4", - "@babel/traverse": "^7.12.5", - "@babel/types": "^7.12.5" + "@babel/helper-member-expression-to-functions": "^7.12.7", + "@babel/helper-optimise-call-expression": "^7.12.10", + "@babel/traverse": "^7.12.10", + "@babel/types": "^7.12.11" } }, "@babel/helper-simple-access": { @@ -177,18 +161,18 @@ } }, "@babel/helper-split-export-declaration": { - "version": "7.11.0", - "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz", - "integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==", + "version": "7.12.11", + "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.12.11.tgz", + "integrity": "sha512-LsIVN8j48gHgwzfocYUSkO/hjYAOJqlpJEc7tGXcIm4cubjVUf8LGW6eWRyxEu7gA25q02p0rQUWoCI33HNS5g==", "dev": true, "requires": { - "@babel/types": "^7.11.0" + "@babel/types": "^7.12.11" } }, "@babel/helper-validator-identifier": { - "version": "7.10.4", - "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.10.4.tgz", - "integrity": "sha512-3U9y+43hz7ZM+rzG24Qe2mufW5KhvFg/NhnNph+i9mgCtdTCtMJuI1TMkrIUiK7Ix4PYlRF9I5dhqaLYA/ADXw==", + "version": "7.12.11", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.12.11.tgz", + "integrity": "sha512-np/lG3uARFybkoHokJUmf1QfEvRVCPbmQeUQpKow5cQ3xWrV9i3rUHodKDJPQfTVX61qKi+UdYk8kik84n7XOw==", "dev": true }, "@babel/helpers": { @@ -203,20 +187,20 @@ } }, "@babel/highlight": { - "version": "7.5.0", - "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.5.0.tgz", - "integrity": "sha512-7dV4eu9gBxoM0dAnj/BCFDW9LFU0zvTrkq0ugM7pnHEgguOEeOz1so2ZghEdzviYzQEED0r4EAgpsBChKy1TRQ==", + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", + "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", "dev": true, "requires": { + "@babel/helper-validator-identifier": "^7.10.4", "chalk": "^2.0.0", - "esutils": "^2.0.2", "js-tokens": "^4.0.0" } }, "@babel/parser": { - "version": "7.12.7", - "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.12.7.tgz", - "integrity": "sha512-oWR02Ubp4xTLCAqPRiNIuMVgNO5Aif/xpXtabhzW2HWUD47XJsAB4Zd/Rg30+XeQA3juXigV7hlquOTmwqLiwg==", + "version": "7.12.11", + "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.12.11.tgz", + "integrity": "sha512-N3UxG+uuF4CMYoNj8AhnbAcJF0PiuJ9KHuy1lQmkYsxTer/MAH9UBNHsBoAX/4s6NvlDD047No8mYVGGzLL4hg==", "dev": true }, "@babel/plugin-syntax-async-generators": { @@ -327,76 +311,40 @@ "@babel/code-frame": "^7.10.4", "@babel/parser": "^7.12.7", "@babel/types": "^7.12.7" - }, - "dependencies": { - "@babel/code-frame": { - "version": "7.10.4", - "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", - "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", - "dev": true, - "requires": { - "@babel/highlight": "^7.10.4" - } - }, - "@babel/highlight": { - "version": "7.10.4", - "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", - "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", - "dev": true, - "requires": { - "@babel/helper-validator-identifier": "^7.10.4", - "chalk": "^2.0.0", - "js-tokens": "^4.0.0" - } - } } }, "@babel/traverse": { - "version": "7.12.9", - "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.12.9.tgz", - "integrity": "sha512-iX9ajqnLdoU1s1nHt36JDI9KG4k+vmI8WgjK5d+aDTwQbL2fUnzedNedssA645Ede3PM2ma1n8Q4h2ohwXgMXw==", + "version": "7.12.12", + "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.12.12.tgz", + "integrity": "sha512-s88i0X0lPy45RrLM8b9mz8RPH5FqO9G9p7ti59cToE44xFm1Q+Pjh5Gq4SXBbtb88X7Uy7pexeqRIQDDMNkL0w==", "dev": true, "requires": { - "@babel/code-frame": "^7.10.4", - "@babel/generator": "^7.12.5", - "@babel/helper-function-name": "^7.10.4", - "@babel/helper-split-export-declaration": "^7.11.0", - "@babel/parser": "^7.12.7", - "@babel/types": "^7.12.7", + "@babel/code-frame": "^7.12.11", + "@babel/generator": "^7.12.11", + "@babel/helper-function-name": "^7.12.11", + "@babel/helper-split-export-declaration": "^7.12.11", + "@babel/parser": "^7.12.11", + "@babel/types": "^7.12.12", "debug": "^4.1.0", "globals": "^11.1.0", "lodash": "^4.17.19" }, "dependencies": { - "@babel/code-frame": { - "version": "7.10.4", - "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", - "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", - "dev": true, - "requires": { - "@babel/highlight": "^7.10.4" - } - }, - "@babel/highlight": { - "version": "7.10.4", - "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", - "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", - "dev": true, - "requires": { - "@babel/helper-validator-identifier": "^7.10.4", - "chalk": "^2.0.0", - "js-tokens": "^4.0.0" - } + "globals": { + "version": "11.12.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", + "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", + "dev": true } } }, "@babel/types": { - "version": "7.12.7", - "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.12.7.tgz", - "integrity": "sha512-MNyI92qZq6jrQkXvtIiykvl4WtoRrVV9MPn+ZfsoEENjiWcBQ3ZSHrkxnJWgWtLX3XXqX5hrSQ+X69wkmesXuQ==", + "version": "7.12.12", + "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.12.12.tgz", + "integrity": "sha512-lnIX7piTxOH22xE7fDXDbSHg9MM1/6ORnafpJmov5rs0kX5g4BZxeXNJLXsMRiO0U5Rb8/FvMS6xlTnTHvxonQ==", "dev": true, "requires": { - "@babel/helper-validator-identifier": "^7.10.4", + "@babel/helper-validator-identifier": "^7.12.11", "lodash": "^4.17.19", "to-fast-properties": "^2.0.0" } @@ -415,14 +363,6 @@ "requires": { "exec-sh": "^0.3.2", "minimist": "^1.2.0" - }, - "dependencies": { - "minimist": { - "version": "1.2.5", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", - "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==", - "dev": true - } } }, "@istanbuljs/load-nyc-config": { @@ -438,61 +378,6 @@ "resolve-from": "^5.0.0" }, "dependencies": { - "camelcase": { - "version": "5.3.1", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", - "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", - "dev": true - }, - "find-up": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", - "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", - "dev": true, - "requires": { - "locate-path": "^5.0.0", - "path-exists": "^4.0.0" - } - }, - "locate-path": { - "version": "5.0.0", - "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-5.0.0.tgz", - "integrity": "sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==", - "dev": true, - "requires": { - "p-locate": "^4.1.0" - } - }, - "p-limit": { - "version": "2.3.0", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.3.0.tgz", - "integrity": "sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==", - "dev": true, - "requires": { - "p-try": "^2.0.0" - } - }, - "p-locate": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-4.1.0.tgz", - "integrity": "sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==", - "dev": true, - "requires": { - "p-limit": "^2.2.0" - } - }, - "p-try": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", - "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", - "dev": true - }, - "path-exists": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", - "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", - "dev": true - }, "resolve-from": { "version": "5.0.0", "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-5.0.0.tgz", @@ -571,6 +456,111 @@ } } }, + "@jest/core": { + "version": "25.5.4", + "resolved": "https://registry.npmjs.org/@jest/core/-/core-25.5.4.tgz", + "integrity": "sha512-3uSo7laYxF00Dg/DMgbn4xMJKmDdWvZnf89n8Xj/5/AeQ2dOQmn6b6Hkj/MleyzZWXpwv+WSdYWl4cLsy2JsoA==", + "dev": true, + "requires": { + "@jest/console": "^25.5.0", + "@jest/reporters": "^25.5.1", + "@jest/test-result": "^25.5.0", + "@jest/transform": "^25.5.1", + "@jest/types": "^25.5.0", + "ansi-escapes": "^4.2.1", + "chalk": "^3.0.0", + "exit": "^0.1.2", + "graceful-fs": "^4.2.4", + "jest-changed-files": "^25.5.0", + "jest-config": "^25.5.4", + "jest-haste-map": "^25.5.1", + "jest-message-util": "^25.5.0", + "jest-regex-util": "^25.2.6", + "jest-resolve": "^25.5.1", + "jest-resolve-dependencies": "^25.5.4", + "jest-runner": "^25.5.4", + "jest-runtime": "^25.5.4", + "jest-snapshot": "^25.5.1", + "jest-util": "^25.5.0", + "jest-validate": "^25.5.0", + "jest-watcher": "^25.5.0", + "micromatch": "^4.0.2", + "p-each-series": "^2.1.0", + "realpath-native": "^2.0.0", + "rimraf": "^3.0.0", + "slash": "^3.0.0", + "strip-ansi": "^6.0.0" + }, + "dependencies": { + "ansi-styles": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "dev": true, + "requires": { + "color-convert": "^2.0.1" + } + }, + "chalk": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-3.0.0.tgz", + "integrity": "sha512-4D3B6Wf41KOYRFdszmDqMCGq5VV/uMAB273JILmO+3jAlh8X4qDtdtgCR3fxtbLEMzSx22QdhnDcJvu2u1fVwg==", + "dev": true, + "requires": { + "ansi-styles": "^4.1.0", + "supports-color": "^7.1.0" + } + }, + "color-convert": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", + "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", + "dev": true, + "requires": { + "color-name": "~1.1.4" + } + }, + "color-name": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", + "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", + "dev": true + }, + "has-flag": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", + "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", + "dev": true + }, + "rimraf": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz", + "integrity": "sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==", + "dev": true, + "requires": { + "glob": "^7.1.3" + } + }, + "strip-ansi": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", + "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", + "dev": true, + "requires": { + "ansi-regex": "^5.0.0" + } + }, + "supports-color": { + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", + "dev": true, + "requires": { + "has-flag": "^4.0.0" + } + } + } + }, "@jest/environment": { "version": "25.5.0", "resolved": "https://registry.npmjs.org/@jest/environment/-/environment-25.5.0.tgz", @@ -673,12 +663,6 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", @@ -695,12 +679,6 @@ "supports-color": "^7.0.0" } }, - "source-map": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", - "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", - "dev": true - }, "supports-color": { "version": "7.2.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", @@ -721,20 +699,6 @@ "callsites": "^3.0.0", "graceful-fs": "^4.2.4", "source-map": "^0.6.0" - }, - "dependencies": { - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - }, - "source-map": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", - "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", - "dev": true - } } }, "@jest/test-result": { @@ -760,14 +724,6 @@ "jest-haste-map": "^25.5.1", "jest-runner": "^25.5.4", "jest-runtime": "^25.5.4" - }, - "dependencies": { - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - } } }, "@jest/transform": { @@ -803,15 +759,6 @@ "color-convert": "^2.0.1" } }, - "braces": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", - "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", - "dev": true, - "requires": { - "fill-range": "^7.0.1" - } - }, "chalk": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/chalk/-/chalk-3.0.0.tgz", @@ -837,49 +784,12 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, - "fill-range": { - "version": "7.0.1", - "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", - "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", - "dev": true, - "requires": { - "to-regex-range": "^5.0.1" - } - }, - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", "dev": true }, - "is-number": { - "version": "7.0.0", - "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", - "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", - "dev": true - }, - "micromatch": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.2.tgz", - "integrity": "sha512-y7FpHSbMUMoyPbYUSzO6PaZ6FyRnQOpHuKwbo1G+Knck95XVU4QAiKdGEnj5wwoS7PlOgthX/09u5iFJ+aYf5Q==", - "dev": true, - "requires": { - "braces": "^3.0.1", - "picomatch": "^2.0.5" - } - }, - "source-map": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", - "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", - "dev": true - }, "supports-color": { "version": "7.2.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", @@ -888,15 +798,6 @@ "requires": { "has-flag": "^4.0.0" } - }, - "to-regex-range": { - "version": "5.0.1", - "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", - "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", - "dev": true, - "requires": { - "is-number": "^7.0.0" - } } } }, @@ -1005,20 +906,14 @@ } }, "@types/babel__traverse": { - "version": "7.0.15", - "resolved": "https://registry.npmjs.org/@types/babel__traverse/-/babel__traverse-7.0.15.tgz", - "integrity": "sha512-Pzh9O3sTK8V6I1olsXpCfj2k/ygO2q1X0vhhnDrEQyYLHZesWz+zMZMVcwXLCYf0U36EtmyYaFGPfXlTtDHe3A==", + "version": "7.11.0", + "resolved": "https://registry.npmjs.org/@types/babel__traverse/-/babel__traverse-7.11.0.tgz", + "integrity": "sha512-kSjgDMZONiIfSH1Nxcr5JIRMwUetDki63FSQfpTCz8ogF3Ulqm8+mr5f78dUYs6vMiB6gBusQqfQmBvHZj/lwg==", "dev": true, "requires": { "@babel/types": "^7.3.0" } }, - "@types/color-name": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/@types/color-name/-/color-name-1.1.1.tgz", - "integrity": "sha512-rr+OQyAjxze7GgWrSaJwydHStIhHq2lvY3BOC2Mj7KnzI7XK0Uw1TOOdI9lDoajEbSWLiYgoo4f1R51erQfhPQ==", - "dev": true - }, "@types/glob": { "version": "7.1.3", "resolved": "https://registry.npmjs.org/@types/glob/-/glob-7.1.3.tgz", @@ -1069,10 +964,16 @@ "integrity": "sha512-tHq6qdbT9U1IRSGf14CL0pUlULksvY9OZ+5eEgl1N7t+OA3tGvNpxJCzuKQlsNgCVwbAs670L1vcVQi8j9HjnA==", "dev": true }, + "@types/minimist": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/@types/minimist/-/minimist-1.2.1.tgz", + "integrity": "sha512-fZQQafSREFyuZcdWFAExYjBiCL7AUCdgsk80iO0q4yihYYdcIiH28CcuPTGFgLOCC8RlW49GSQxdHwZP+I7CNg==", + "dev": true + }, "@types/node": { - "version": "13.9.0", - "resolved": "https://registry.npmjs.org/@types/node/-/node-13.9.0.tgz", - "integrity": "sha512-0ARSQootUG1RljH2HncpsY2TJBfGQIKOOi7kxzUY6z54ePu/ZD+wJA8zI2Q6v8rol2qpG/rvqsReco8zNMPvhQ==", + "version": "14.14.15", + "resolved": "https://registry.npmjs.org/@types/node/-/node-14.14.15.tgz", + "integrity": "sha512-BPnZFSU+n+48jF8Z4cPaI0P2uH83EgsrzCsvs8vRZOqtVWllBlCxwiOLg/+uzV5MtLwouHYuVSIzdpF6/0MBfw==", "dev": true }, "@types/normalize-package-data": { @@ -1094,18 +995,18 @@ "dev": true }, "@types/yargs": { - "version": "15.0.10", - "resolved": "https://registry.npmjs.org/@types/yargs/-/yargs-15.0.10.tgz", - "integrity": "sha512-z8PNtlhrj7eJNLmrAivM7rjBESG6JwC5xP3RVk12i/8HVP7Xnx/sEmERnRImyEuUaJfO942X0qMOYsoupaJbZQ==", + "version": "15.0.12", + "resolved": "https://registry.npmjs.org/@types/yargs/-/yargs-15.0.12.tgz", + "integrity": "sha512-f+fD/fQAo3BCbCDlrUpznF1A5Zp9rB0noS5vnoormHSIPFKL0Z2DcUJ3Gxp5ytH4uLRNxy7AwYUC9exZzqGMAw==", "dev": true, "requires": { "@types/yargs-parser": "*" } }, "@types/yargs-parser": { - "version": "15.0.0", - "resolved": "https://registry.npmjs.org/@types/yargs-parser/-/yargs-parser-15.0.0.tgz", - "integrity": "sha512-FA/BWv8t8ZWJ+gEOnLLd8ygxH/2UFbAvgEonyfN6yWGLKc7zVjbpl2Y4CTjid9h2RfgPP6SEt6uHwEOply00yw==", + "version": "20.2.0", + "resolved": "https://registry.npmjs.org/@types/yargs-parser/-/yargs-parser-20.2.0.tgz", + "integrity": "sha512-37RSHht+gzzgYeobbG+KWryeAW8J33Nhr69cjTqSYymXVZEN9NbRYWoYlRtDhHKPVT1FyNKwaTPC1NynKZpzRA==", "dev": true }, "@types/yauzl": { @@ -1305,6 +1206,16 @@ "integrity": "sha512-NuHqBY1PB/D8xU6s/thBgOAiAP7HOYDQ32+BFZILJ8ivkUkAHQnWfn6WhL79Owj1qmUnoN/YPhktdIoucipkAQ==", "dev": true }, + "JSONStream": { + "version": "1.3.5", + "resolved": "https://registry.npmjs.org/JSONStream/-/JSONStream-1.3.5.tgz", + "integrity": "sha512-E+iruNOY8VV9s4JEbe1aNEm6MiszPRr/UfcHMz0TQh1BXSxHK+ASV1R6W4HpjBhSeS+54PIsAMCBmwD06LLsqQ==", + "dev": true, + "requires": { + "jsonparse": "^1.2.0", + "through": ">=2.2.7 <3" + } + }, "abab": { "version": "2.0.5", "resolved": "https://registry.npmjs.org/abab/-/abab-2.0.5.tgz", @@ -1322,9 +1233,9 @@ } }, "acorn": { - "version": "7.1.1", - "resolved": "https://registry.npmjs.org/acorn/-/acorn-7.1.1.tgz", - "integrity": "sha512-add7dgA5ppRPxCFJoAGfMDi7PIBXq1RtGo7BhbLaxwrXPOmw8gq48Y9ozT01hUKy9byMjlR20EJhu5zlkErEkg==", + "version": "7.4.1", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-7.4.1.tgz", + "integrity": "sha512-nQyp0o1/mNdbTO1PO6kHkwSrmgZ0MT/jCCpNiwbUjGoRN4dlBhqJtoQuCnEOKzgTVwg0ZWiCoQy6SxMebQVh8A==", "dev": true }, "acorn-globals": { @@ -1346,9 +1257,9 @@ } }, "acorn-jsx": { - "version": "5.2.0", - "resolved": "https://registry.npmjs.org/acorn-jsx/-/acorn-jsx-5.2.0.tgz", - "integrity": "sha512-HiUX/+K2YpkpJ+SzBffkM/AQ2YE03S0U1kjTLVpoJdhZMOWy8qvXVN9JdLqv2QsaQ6MPYQIuNmwD8zOiYUofLQ==", + "version": "5.3.1", + "resolved": "https://registry.npmjs.org/acorn-jsx/-/acorn-jsx-5.3.1.tgz", + "integrity": "sha512-K0Ptm/47OKfQRpNQ2J/oIN/3QYiK6FwW+eJbILhsdxh2WTLdl+30o8aGdTbm5JbffpFFAg/g+zi1E+jvJha5ng==", "dev": true }, "acorn-walk": { @@ -1357,6 +1268,12 @@ "integrity": "sha512-7evsyfH1cLOCdAzZAd43Cic04yKydNx0cF+7tiA19p1XnLLPU4dpCQOqpjqwokFe//vS0QqfqqjCS2JkiIs0cA==", "dev": true }, + "add-stream": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/add-stream/-/add-stream-1.0.0.tgz", + "integrity": "sha1-anmQQ3ynNtXhKI25K9MmbV9csqo=", + "dev": true + }, "agent-base": { "version": "5.1.1", "resolved": "https://registry.npmjs.org/agent-base/-/agent-base-5.1.1.tgz", @@ -1364,12 +1281,12 @@ "dev": true }, "ajv": { - "version": "6.10.2", - "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.10.2.tgz", - "integrity": "sha512-TXtUUEYHuaTEbLZWIKUr5pmBuhDLy+8KYtPYdcV8qC+pOZL+NKqYwvWSRrVXHn+ZmRRAu8vJTAznH7Oag6RVRw==", + "version": "6.12.6", + "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.6.tgz", + "integrity": "sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==", "dev": true, "requires": { - "fast-deep-equal": "^2.0.1", + "fast-deep-equal": "^3.1.1", "fast-json-stable-stringify": "^2.0.0", "json-schema-traverse": "^0.4.1", "uri-js": "^4.2.2" @@ -1387,6 +1304,12 @@ "integrity": "sha512-5p6WTN0DdTGVQk6VjcEju19IgaHudalcfabD7yhDGeA6bcQnmL+CpveLJq/3hvfwd1aof6L386Ougkx6RfyMIQ==", "dev": true }, + "ansi-colors": { + "version": "3.2.4", + "resolved": "https://registry.npmjs.org/ansi-colors/-/ansi-colors-3.2.4.tgz", + "integrity": "sha512-hHUXGagefjN2iRrID63xckIvotOXOojhQKWIPUZ4mNUZ9nLZW+7FMNoE1lOkEhNWYsx/7ysGIuJYCiMAA9FnrA==", + "dev": true + }, "ansi-cyan": { "version": "0.1.1", "resolved": "https://registry.npmjs.org/ansi-cyan/-/ansi-cyan-0.1.1.tgz", @@ -1459,13 +1382,13 @@ "dev": true }, "anymatch": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz", - "integrity": "sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==", + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.1.tgz", + "integrity": "sha512-mM8522psRCqzV+6LhomX5wgp25YVibjh8Wj23I5RPkPppSVSjyKD2A2mBJmWGa+KN7f2D6LNh9jkBCeyLktzjg==", "dev": true, "requires": { - "micromatch": "^3.1.4", - "normalize-path": "^2.1.1" + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" } }, "aproba": { @@ -1507,12 +1430,30 @@ "integrity": "sha1-jCpe8kcv2ep0KwTHenUJO6J1fJM=", "dev": true }, + "array-find-index": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/array-find-index/-/array-find-index-1.0.2.tgz", + "integrity": "sha1-3wEKoSh+Fku9pvlyOwqWoexBh6E=", + "dev": true + }, "array-flatten": { "version": "2.1.2", "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-2.1.2.tgz", "integrity": "sha512-hNfzcOV8W4NdualtqBFPyVO+54DSJuZGY9qT4pRroB6S9e3iiido2ISIC5h9R2sPJ8H3FHCIiEnsv1lPXO3KtQ==", "dev": true }, + "array-ify": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/array-ify/-/array-ify-1.0.0.tgz", + "integrity": "sha1-nlKHYrSpBmrRY6aWKjZEGOlibs4=", + "dev": true + }, + "array-slice": { + "version": "0.2.3", + "resolved": "https://registry.npmjs.org/array-slice/-/array-slice-0.2.3.tgz", + "integrity": "sha1-3Tz7gO15c6dRF82sabC5nshhhvU=", + "dev": true + }, "array-union": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/array-union/-/array-union-1.0.2.tgz", @@ -1534,6 +1475,12 @@ "integrity": "sha1-qJS3XUvE9s1nnvMkSp/Y9Gri1Cg=", "dev": true }, + "arrify": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/arrify/-/arrify-1.0.1.tgz", + "integrity": "sha1-iYUI2iIm84DfkEcoRWhJwVAaSw0=", + "dev": true + }, "asn1": { "version": "0.2.4", "resolved": "https://registry.npmjs.org/asn1/-/asn1-0.2.4.tgz", @@ -1703,12 +1650,6 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", @@ -1868,10 +1809,21 @@ "dev": true }, "binary-extensions": { - "version": "1.13.1", - "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-1.13.1.tgz", - "integrity": "sha512-Un7MIEDdUC5gNpcGDV97op1Ywk748MpHcFTHoYs6qnj1Z3j7I53VG3nwZhKzoBZmbdRNnb6WRdFlwl7tSDuZGw==", - "dev": true + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.1.0.tgz", + "integrity": "sha512-1Yj8h9Q+QDF5FzhMs/c9+6UntbD5MkRfRwac8DoEm9ZfUBZ7tZ55YcGVAzEe4bXsdQHEk+s9S5wsOKVdZrw0tQ==", + "dev": true, + "optional": true + }, + "bindings": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/bindings/-/bindings-1.5.0.tgz", + "integrity": "sha512-p2q/t/mhvuOj/UeLlV6566GD/guowlr0hHxClI0W9m7MWYkL1F0hLo+0Aexs9HSPCtR1SXQ0TD3MMKrXZajbiQ==", + "dev": true, + "optional": true, + "requires": { + "file-uri-to-path": "1.0.0" + } }, "bl": { "version": "4.0.3", @@ -1882,29 +1834,6 @@ "buffer": "^5.5.0", "inherits": "^2.0.4", "readable-stream": "^3.4.0" - }, - "dependencies": { - "buffer": { - "version": "5.7.1", - "resolved": "https://registry.npmjs.org/buffer/-/buffer-5.7.1.tgz", - "integrity": "sha512-EHcyIPBQ4BSGlvjB16k5KgAJ27CIsHY/2JBmCRReo48y9rQ3MaUzWX3KVlBa4U7MyX02HdVj0K7C3WaB3ju7FQ==", - "dev": true, - "requires": { - "base64-js": "^1.3.1", - "ieee754": "^1.1.13" - } - }, - "readable-stream": { - "version": "3.6.0", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", - "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", - "dev": true, - "requires": { - "inherits": "^2.0.3", - "string_decoder": "^1.1.1", - "util-deprecate": "^1.0.1" - } - } } }, "bluebird": { @@ -1991,32 +1920,12 @@ } }, "braces": { - "version": "2.3.2", - "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz", - "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==", + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", + "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", "dev": true, "requires": { - "arr-flatten": "^1.1.0", - "array-unique": "^0.3.2", - "extend-shallow": "^2.0.1", - "fill-range": "^4.0.0", - "isobject": "^3.0.1", - "repeat-element": "^1.1.2", - "snapdragon": "^0.8.1", - "snapdragon-node": "^2.0.1", - "split-string": "^3.0.2", - "to-regex": "^3.0.1" - }, - "dependencies": { - "extend-shallow": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", - "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", - "dev": true, - "requires": { - "is-extendable": "^0.1.0" - } - } + "fill-range": "^7.0.1" } }, "brorand": { @@ -2110,25 +2019,6 @@ "parse-asn1": "^5.1.5", "readable-stream": "^3.6.0", "safe-buffer": "^5.2.0" - }, - "dependencies": { - "readable-stream": { - "version": "3.6.0", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", - "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", - "dev": true, - "requires": { - "inherits": "^2.0.3", - "string_decoder": "^1.1.1", - "util-deprecate": "^1.0.1" - } - }, - "safe-buffer": { - "version": "5.2.1", - "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", - "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==", - "dev": true - } } }, "browserify-zlib": { @@ -2150,14 +2040,13 @@ } }, "buffer": { - "version": "4.9.2", - "resolved": "https://registry.npmjs.org/buffer/-/buffer-4.9.2.tgz", - "integrity": "sha512-xq+q3SRMOxGivLhBNaUdC64hDTQwejJ+H0T/NB1XMtTVEwNTrfFF3gAxiyW0Bu/xWEGhjVKgUcMhCrUy2+uCWg==", + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/buffer/-/buffer-5.7.1.tgz", + "integrity": "sha512-EHcyIPBQ4BSGlvjB16k5KgAJ27CIsHY/2JBmCRReo48y9rQ3MaUzWX3KVlBa4U7MyX02HdVj0K7C3WaB3ju7FQ==", "dev": true, "requires": { - "base64-js": "^1.0.2", - "ieee754": "^1.1.4", - "isarray": "^1.0.0" + "base64-js": "^1.3.1", + "ieee754": "^1.1.13" } }, "buffer-crc32": { @@ -2228,12 +2117,6 @@ "yallist": "^3.0.2" } }, - "y18n": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz", - "integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==", - "dev": true - }, "yallist": { "version": "3.1.1", "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", @@ -2275,6 +2158,23 @@ "integrity": "sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==", "dev": true }, + "camelcase": { + "version": "5.3.1", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", + "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", + "dev": true + }, + "camelcase-keys": { + "version": "6.2.2", + "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-6.2.2.tgz", + "integrity": "sha512-YrwaA0vEKazPBkn0ipTiMpSajYDSe+KjQfrjhcBMxJt/znbvlHd8Pw/Vamaz5EB4Wfhs3SUR3Z9mwRu/P3s3Yg==", + "dev": true, + "requires": { + "camelcase": "^5.3.1", + "map-obj": "^4.0.0", + "quick-lru": "^4.0.1" + } + }, "capture-exit": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/capture-exit/-/capture-exit-2.0.0.tgz", @@ -2308,51 +2208,28 @@ "dev": true }, "chokidar": { - "version": "2.1.8", - "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-2.1.8.tgz", - "integrity": "sha512-ZmZUazfOzf0Nve7duiCKD23PFSCs4JPoYyccjUFF3aQkQadqBhfzhjkwBH2mNOG9cTBwhamM37EIsIkZw3nRgg==", + "version": "3.4.3", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.4.3.tgz", + "integrity": "sha512-DtM3g7juCXQxFVSNPNByEC2+NImtBuxQQvWlHunpJIS5Ocr0lG306cC7FCi7cEA0fzmybPUIl4txBIobk1gGOQ==", "dev": true, + "optional": true, "requires": { - "anymatch": "^2.0.0", - "async-each": "^1.0.1", - "braces": "^2.3.2", - "fsevents": "^1.2.7", - "glob-parent": "^3.1.0", - "inherits": "^2.0.3", - "is-binary-path": "^1.0.0", - "is-glob": "^4.0.0", - "normalize-path": "^3.0.0", - "path-is-absolute": "^1.0.0", - "readdirp": "^2.2.1", - "upath": "^1.1.1" + "anymatch": "~3.1.1", + "braces": "~3.0.2", + "fsevents": "~2.1.2", + "glob-parent": "~5.1.0", + "is-binary-path": "~2.1.0", + "is-glob": "~4.0.1", + "normalize-path": "~3.0.0", + "readdirp": "~3.5.0" }, "dependencies": { - "glob-parent": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-3.1.0.tgz", - "integrity": "sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=", + "fsevents": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.1.3.tgz", + "integrity": "sha512-Auw9a4AxqWpa9GUfj370BMPzzyncfBABW8Mab7BGWBYDj4Isgq+cDKtx0i6u9jcX9pQDnswsaaOTgTmA5pEjuQ==", "dev": true, - "requires": { - "is-glob": "^3.1.0", - "path-dirname": "^1.0.0" - }, - "dependencies": { - "is-glob": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-3.1.0.tgz", - "integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=", - "dev": true, - "requires": { - "is-extglob": "^2.1.0" - } - } - } - }, - "normalize-path": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", - "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", - "dev": true + "optional": true } } }, @@ -2420,11 +2297,33 @@ } }, "cli-width": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/cli-width/-/cli-width-2.2.0.tgz", - "integrity": "sha1-/xnt6Kml5XkyQUewwR8PvLq+1jk=", + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/cli-width/-/cli-width-3.0.0.tgz", + "integrity": "sha512-FxqpkPPwu1HjuN93Omfm4h8uIanXofW0RxVEW3k5RKx+mJJYSthzNhp32Kzxxy3YAEZ/Dc/EWN1vZRY0+kOhbw==", "dev": true }, + "cliui": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/cliui/-/cliui-6.0.0.tgz", + "integrity": "sha512-t6wbgtoCXvAzst7QgXxJYqPt0usEfbgQdftEPbLL/cvv6HPE5VgvqCuAIDR0NgU52ds6rFwqrgakNLrHEjCbrQ==", + "dev": true, + "requires": { + "string-width": "^4.2.0", + "strip-ansi": "^6.0.0", + "wrap-ansi": "^6.2.0" + }, + "dependencies": { + "strip-ansi": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", + "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", + "dev": true, + "requires": { + "ansi-regex": "^5.0.0" + } + } + } + }, "co": { "version": "4.6.0", "resolved": "https://registry.npmjs.org/co/-/co-4.6.0.tgz", @@ -2489,6 +2388,16 @@ "integrity": "sha1-3dgA2gxmEnOTzKWVDqloo6rxJTs=", "dev": true }, + "compare-func": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/compare-func/-/compare-func-2.0.0.tgz", + "integrity": "sha512-zHig5N+tPWARooBnb0Zx1MFcdfpyJrfTJ3Y5L+IFvUm8rM74hHz66z0gw0x4tijh5CorKkKUCnW82R2vmpeCRA==", + "dev": true, + "requires": { + "array-ify": "^1.0.0", + "dot-prop": "^5.1.0" + } + }, "component-emitter": { "version": "1.3.0", "resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.3.0.tgz", @@ -2502,14 +2411,6 @@ "dev": true, "requires": { "mime-db": ">= 1.43.0 < 2" - }, - "dependencies": { - "mime-db": { - "version": "1.45.0", - "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.45.0.tgz", - "integrity": "sha512-CkqLUxUk15hofLoLyljJSrukZi8mAtgd+yE5uO4tqRZsdsAJKv0O+rFMhVDRJgozy+yG6md5KwuXhD4ocIoP+w==", - "dev": true - } } }, "compression": { @@ -2541,6 +2442,12 @@ "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=", "dev": true + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true } } }, @@ -2560,6 +2467,38 @@ "inherits": "^2.0.3", "readable-stream": "^2.2.2", "typedarray": "^0.0.6" + }, + "dependencies": { + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + } } }, "connect-history-api-fallback": { @@ -2587,6 +2526,14 @@ "dev": true, "requires": { "safe-buffer": "5.1.2" + }, + "dependencies": { + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + } } }, "content-type": { @@ -2595,13 +2542,210 @@ "integrity": "sha512-hIP3EEPs8tB9AT1L+NUqtwOAps4mk2Zob89MWXMHjHWg9milF/j4osnnQLXBCBFBk/tvIG/tUc9mOUJiPBhPXA==", "dev": true }, + "conventional-changelog": { + "version": "3.1.24", + "resolved": "https://registry.npmjs.org/conventional-changelog/-/conventional-changelog-3.1.24.tgz", + "integrity": "sha512-ed6k8PO00UVvhExYohroVPXcOJ/K1N0/drJHx/faTH37OIZthlecuLIRX/T6uOp682CAoVoFpu+sSEaeuH6Asg==", + "dev": true, + "requires": { + "conventional-changelog-angular": "^5.0.12", + "conventional-changelog-atom": "^2.0.8", + "conventional-changelog-codemirror": "^2.0.8", + "conventional-changelog-conventionalcommits": "^4.5.0", + "conventional-changelog-core": "^4.2.1", + "conventional-changelog-ember": "^2.0.9", + "conventional-changelog-eslint": "^3.0.9", + "conventional-changelog-express": "^2.0.6", + "conventional-changelog-jquery": "^3.0.11", + "conventional-changelog-jshint": "^2.0.9", + "conventional-changelog-preset-loader": "^2.3.4" + } + }, + "conventional-changelog-angular": { + "version": "5.0.12", + "resolved": "https://registry.npmjs.org/conventional-changelog-angular/-/conventional-changelog-angular-5.0.12.tgz", + "integrity": "sha512-5GLsbnkR/7A89RyHLvvoExbiGbd9xKdKqDTrArnPbOqBqG/2wIosu0fHwpeIRI8Tl94MhVNBXcLJZl92ZQ5USw==", + "dev": true, + "requires": { + "compare-func": "^2.0.0", + "q": "^1.5.1" + } + }, + "conventional-changelog-atom": { + "version": "2.0.8", + "resolved": "https://registry.npmjs.org/conventional-changelog-atom/-/conventional-changelog-atom-2.0.8.tgz", + "integrity": "sha512-xo6v46icsFTK3bb7dY/8m2qvc8sZemRgdqLb/bjpBsH2UyOS8rKNTgcb5025Hri6IpANPApbXMg15QLb1LJpBw==", + "dev": true, + "requires": { + "q": "^1.5.1" + } + }, + "conventional-changelog-cli": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/conventional-changelog-cli/-/conventional-changelog-cli-2.1.1.tgz", + "integrity": "sha512-xMGQdKJ+4XFDDgfX5aK7UNFduvJMbvF5BB+g0OdVhA3rYdYyhctrIE2Al+WYdZeKTdg9YzMWF2iFPT8MupIwng==", + "dev": true, + "requires": { + "add-stream": "^1.0.0", + "conventional-changelog": "^3.1.24", + "lodash": "^4.17.15", + "meow": "^8.0.0", + "tempfile": "^3.0.0" + } + }, + "conventional-changelog-codemirror": { + "version": "2.0.8", + "resolved": "https://registry.npmjs.org/conventional-changelog-codemirror/-/conventional-changelog-codemirror-2.0.8.tgz", + "integrity": "sha512-z5DAsn3uj1Vfp7po3gpt2Boc+Bdwmw2++ZHa5Ak9k0UKsYAO5mH1UBTN0qSCuJZREIhX6WU4E1p3IW2oRCNzQw==", + "dev": true, + "requires": { + "q": "^1.5.1" + } + }, + "conventional-changelog-conventionalcommits": { + "version": "4.5.0", + "resolved": "https://registry.npmjs.org/conventional-changelog-conventionalcommits/-/conventional-changelog-conventionalcommits-4.5.0.tgz", + "integrity": "sha512-buge9xDvjjOxJlyxUnar/+6i/aVEVGA7EEh4OafBCXPlLUQPGbRUBhBUveWRxzvR8TEjhKEP4BdepnpG2FSZXw==", + "dev": true, + "requires": { + "compare-func": "^2.0.0", + "lodash": "^4.17.15", + "q": "^1.5.1" + } + }, + "conventional-changelog-core": { + "version": "4.2.1", + "resolved": "https://registry.npmjs.org/conventional-changelog-core/-/conventional-changelog-core-4.2.1.tgz", + "integrity": "sha512-8cH8/DEoD3e5Q6aeogdR5oaaKs0+mG6+f+Om0ZYt3PNv7Zo0sQhu4bMDRsqAF+UTekTAtP1W/C41jH/fkm8Jtw==", + "dev": true, + "requires": { + "add-stream": "^1.0.0", + "conventional-changelog-writer": "^4.0.18", + "conventional-commits-parser": "^3.2.0", + "dateformat": "^3.0.0", + "get-pkg-repo": "^1.0.0", + "git-raw-commits": "2.0.0", + "git-remote-origin-url": "^2.0.0", + "git-semver-tags": "^4.1.1", + "lodash": "^4.17.15", + "normalize-package-data": "^3.0.0", + "q": "^1.5.1", + "read-pkg": "^3.0.0", + "read-pkg-up": "^3.0.0", + "shelljs": "^0.8.3", + "through2": "^4.0.0" + } + }, + "conventional-changelog-ember": { + "version": "2.0.9", + "resolved": "https://registry.npmjs.org/conventional-changelog-ember/-/conventional-changelog-ember-2.0.9.tgz", + "integrity": "sha512-ulzIReoZEvZCBDhcNYfDIsLTHzYHc7awh+eI44ZtV5cx6LVxLlVtEmcO+2/kGIHGtw+qVabJYjdI5cJOQgXh1A==", + "dev": true, + "requires": { + "q": "^1.5.1" + } + }, + "conventional-changelog-eslint": { + "version": "3.0.9", + "resolved": "https://registry.npmjs.org/conventional-changelog-eslint/-/conventional-changelog-eslint-3.0.9.tgz", + "integrity": "sha512-6NpUCMgU8qmWmyAMSZO5NrRd7rTgErjrm4VASam2u5jrZS0n38V7Y9CzTtLT2qwz5xEChDR4BduoWIr8TfwvXA==", + "dev": true, + "requires": { + "q": "^1.5.1" + } + }, + "conventional-changelog-express": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/conventional-changelog-express/-/conventional-changelog-express-2.0.6.tgz", + "integrity": "sha512-SDez2f3iVJw6V563O3pRtNwXtQaSmEfTCaTBPCqn0oG0mfkq0rX4hHBq5P7De2MncoRixrALj3u3oQsNK+Q0pQ==", + "dev": true, + "requires": { + "q": "^1.5.1" + } + }, + "conventional-changelog-jquery": { + "version": "3.0.11", + "resolved": "https://registry.npmjs.org/conventional-changelog-jquery/-/conventional-changelog-jquery-3.0.11.tgz", + "integrity": "sha512-x8AWz5/Td55F7+o/9LQ6cQIPwrCjfJQ5Zmfqi8thwUEKHstEn4kTIofXub7plf1xvFA2TqhZlq7fy5OmV6BOMw==", + "dev": true, + "requires": { + "q": "^1.5.1" + } + }, + "conventional-changelog-jshint": { + "version": "2.0.9", + "resolved": "https://registry.npmjs.org/conventional-changelog-jshint/-/conventional-changelog-jshint-2.0.9.tgz", + "integrity": "sha512-wMLdaIzq6TNnMHMy31hql02OEQ8nCQfExw1SE0hYL5KvU+JCTuPaDO+7JiogGT2gJAxiUGATdtYYfh+nT+6riA==", + "dev": true, + "requires": { + "compare-func": "^2.0.0", + "q": "^1.5.1" + } + }, + "conventional-changelog-preset-loader": { + "version": "2.3.4", + "resolved": "https://registry.npmjs.org/conventional-changelog-preset-loader/-/conventional-changelog-preset-loader-2.3.4.tgz", + "integrity": "sha512-GEKRWkrSAZeTq5+YjUZOYxdHq+ci4dNwHvpaBC3+ENalzFWuCWa9EZXSuZBpkr72sMdKB+1fyDV4takK1Lf58g==", + "dev": true + }, + "conventional-changelog-writer": { + "version": "4.0.18", + "resolved": "https://registry.npmjs.org/conventional-changelog-writer/-/conventional-changelog-writer-4.0.18.tgz", + "integrity": "sha512-mAQDCKyB9HsE8Ko5cCM1Jn1AWxXPYV0v8dFPabZRkvsiWUul2YyAqbIaoMKF88Zf2ffnOPSvKhboLf3fnjo5/A==", + "dev": true, + "requires": { + "compare-func": "^2.0.0", + "conventional-commits-filter": "^2.0.7", + "dateformat": "^3.0.0", + "handlebars": "^4.7.6", + "json-stringify-safe": "^5.0.1", + "lodash": "^4.17.15", + "meow": "^8.0.0", + "semver": "^6.0.0", + "split": "^1.0.0", + "through2": "^4.0.0" + } + }, + "conventional-commits-filter": { + "version": "2.0.7", + "resolved": "https://registry.npmjs.org/conventional-commits-filter/-/conventional-commits-filter-2.0.7.tgz", + "integrity": "sha512-ASS9SamOP4TbCClsRHxIHXRfcGCnIoQqkvAzCSbZzTFLfcTqJVugB0agRgsEELsqaeWgsXv513eS116wnlSSPA==", + "dev": true, + "requires": { + "lodash.ismatch": "^4.4.0", + "modify-values": "^1.0.0" + } + }, + "conventional-commits-parser": { + "version": "3.2.0", + "resolved": "https://registry.npmjs.org/conventional-commits-parser/-/conventional-commits-parser-3.2.0.tgz", + "integrity": "sha512-XmJiXPxsF0JhAKyfA2Nn+rZwYKJ60nanlbSWwwkGwLQFbugsc0gv1rzc7VbbUWAzJfR1qR87/pNgv9NgmxtBMQ==", + "dev": true, + "requires": { + "JSONStream": "^1.0.4", + "is-text-path": "^1.0.1", + "lodash": "^4.17.15", + "meow": "^8.0.0", + "split2": "^2.0.0", + "through2": "^4.0.0", + "trim-off-newlines": "^1.0.0" + } + }, "convert-source-map": { - "version": "1.6.0", - "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.6.0.tgz", - "integrity": "sha512-eFu7XigvxdZ1ETfbgPBohgyQ/Z++C0eEhTor0qRwBw9unw+L0/6V8wkSuGgzdThkiS5lSpdptOQPD8Ak40a+7A==", + "version": "1.7.0", + "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.7.0.tgz", + "integrity": "sha512-4FJkXzKXEDB1snCFZlLP4gpC3JILicCpGbzG9f9G7tGqGCzETQ2hWPrcinA9oU4wtf2biUaEH5065UnMeR33oA==", "dev": true, "requires": { "safe-buffer": "~5.1.1" + }, + "dependencies": { + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + } } }, "cookie": { @@ -2750,12 +2894,30 @@ } } }, + "currently-unhandled": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/currently-unhandled/-/currently-unhandled-0.4.1.tgz", + "integrity": "sha1-mI3zP+qxke95mmE2nddsF635V+o=", + "dev": true, + "requires": { + "array-find-index": "^1.0.1" + } + }, "cyclist": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/cyclist/-/cyclist-1.0.1.tgz", "integrity": "sha1-WW6WmP0MgOEgOMK4LW6xs1tiJNk=", "dev": true }, + "dargs": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/dargs/-/dargs-4.1.0.tgz", + "integrity": "sha1-A6nbtLXC8Tm/FK5T8LiipqhvThc=", + "dev": true, + "requires": { + "number-is-nan": "^1.0.0" + } + }, "dashdash": { "version": "1.14.1", "resolved": "https://registry.npmjs.org/dashdash/-/dashdash-1.14.1.tgz", @@ -2776,13 +2938,19 @@ "whatwg-url": "^7.0.0" } }, + "dateformat": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/dateformat/-/dateformat-3.0.3.tgz", + "integrity": "sha512-jyCETtSl3VMZMWeRo7iY1FL19ges1t55hMo5yaam4Jrsm5EPL89UQkoQRyiI+Yf4k8r2ZpdngkV8hr1lIdjb3Q==", + "dev": true + }, "debug": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", - "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "version": "4.3.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.1.tgz", + "integrity": "sha512-doEwdvm4PCeK4K3RQN2ZC2BYUBaxwLARCqZmMjtF8a51J2Rb0xpVloFRnCODwqjpwnAoao4pelN8l3RJdv3gRQ==", "dev": true, "requires": { - "ms": "^2.1.1" + "ms": "2.1.2" } }, "decamelize": { @@ -2791,6 +2959,24 @@ "integrity": "sha1-9lNNFRSCabIDUue+4m9QH5oZEpA=", "dev": true }, + "decamelize-keys": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/decamelize-keys/-/decamelize-keys-1.1.0.tgz", + "integrity": "sha1-0XGoeTMlKAfrPLYdwcFEXQeN8tk=", + "dev": true, + "requires": { + "decamelize": "^1.1.0", + "map-obj": "^1.0.0" + }, + "dependencies": { + "map-obj": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-1.0.1.tgz", + "integrity": "sha1-2TPOuSBdgr3PSIb2dCvcK03qFG0=", + "dev": true + } + } + }, "decode-uri-component": { "version": "0.2.0", "resolved": "https://registry.npmjs.org/decode-uri-component/-/decode-uri-component-0.2.0.tgz", @@ -3032,6 +3218,15 @@ "webidl-conversions": "^4.0.2" } }, + "dot-prop": { + "version": "5.3.0", + "resolved": "https://registry.npmjs.org/dot-prop/-/dot-prop-5.3.0.tgz", + "integrity": "sha512-QM8q3zDe58hqUqjraQOmzZ1LIH9SWQJTlEKCH4kJ2oQvLZk7RbQXvtDM2XEq3fwkV9CCvvH4LA0AV+ogFsBM2Q==", + "dev": true, + "requires": { + "is-obj": "^2.0.0" + } + }, "duplexify": { "version": "3.7.1", "resolved": "https://registry.npmjs.org/duplexify/-/duplexify-3.7.1.tgz", @@ -3042,6 +3237,38 @@ "inherits": "^2.0.1", "readable-stream": "^2.0.0", "stream-shift": "^1.0.0" + }, + "dependencies": { + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + } } }, "ecc-jsbn": { @@ -3084,9 +3311,9 @@ } }, "emoji-regex": { - "version": "7.0.3", - "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-7.0.3.tgz", - "integrity": "sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA==", + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz", + "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==", "dev": true }, "emojis-list": { @@ -3102,9 +3329,9 @@ "dev": true }, "end-of-stream": { - "version": "1.4.1", - "resolved": "https://registry.npmjs.org/end-of-stream/-/end-of-stream-1.4.1.tgz", - "integrity": "sha512-1MkrZNvWTKCaigbn+W15elq2BB/L22nqrSY5DKlo3X6+vclJm8Bb5djXJBmEX6fS3+zCh/F4VBK5Z2KxJt4s2Q==", + "version": "1.4.4", + "resolved": "https://registry.npmjs.org/end-of-stream/-/end-of-stream-1.4.4.tgz", + "integrity": "sha512-+uw1inIHVPQoaVuHzRyXd21icM+cnt4CzD5rW+NC1wjOUSTOs+Te7FOv7AhN7vS9x/oIyhLP5PR1H+phQAHu5Q==", "dev": true, "requires": { "once": "^1.4.0" @@ -3130,13 +3357,43 @@ "errno": "^0.1.3", "readable-stream": "^2.0.1" } + }, + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } } } }, "errno": { - "version": "0.1.7", - "resolved": "https://registry.npmjs.org/errno/-/errno-0.1.7.tgz", - "integrity": "sha512-MfrRBDWzIWifgq6tJj60gkAwtLNb6sQPlcFrSOflcP1aFmmruKQ2wRnze/8V6kgyz7H3FF8Npzv78mZ7XLLflg==", + "version": "0.1.8", + "resolved": "https://registry.npmjs.org/errno/-/errno-0.1.8.tgz", + "integrity": "sha512-dJ6oBr5SQ1VSd9qkk7ByRgb/1SH4JZjCHSW/mr63/QcXO9zLVxvJ6Oy13nio03rxpSnVDDjFor75SjVeZWPW/A==", "dev": true, "requires": { "prr": "~1.0.1" @@ -3152,9 +3409,9 @@ } }, "es-abstract": { - "version": "1.18.0-next.1", - "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.18.0-next.1.tgz", - "integrity": "sha512-I4UGspA0wpZXWENrdA0uHbnhte683t3qT/1VFH9aX2dA5PPSf6QW5HHXf5HImaqPmjXaVeVk4RGWnaylmV7uAA==", + "version": "1.17.7", + "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.17.7.tgz", + "integrity": "sha512-VBl/gnfcJ7OercKA9MVaegWsBHFjV492syMudcnQZvt/Dw8ezpcOHYZXa/J96O8vx+g4x65YKhxOwDUh63aS5g==", "dev": true, "requires": { "es-to-primitive": "^1.2.1", @@ -3162,33 +3419,12 @@ "has": "^1.0.3", "has-symbols": "^1.0.1", "is-callable": "^1.2.2", - "is-negative-zero": "^2.0.0", "is-regex": "^1.1.1", "object-inspect": "^1.8.0", "object-keys": "^1.1.1", "object.assign": "^4.1.1", "string.prototype.trimend": "^1.0.1", "string.prototype.trimstart": "^1.0.1" - }, - "dependencies": { - "has-symbols": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz", - "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", - "dev": true - }, - "object.assign": { - "version": "4.1.2", - "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.2.tgz", - "integrity": "sha512-ixT2L5THXsApyiUPYKmW+2EHpXXe5Ii3M+f4e+aJFAHao5amFRW6J0OO6c/LU8Be47utCx2GL89hxGB6XSmKuQ==", - "dev": true, - "requires": { - "call-bind": "^1.0.0", - "define-properties": "^1.1.3", - "has-symbols": "^1.0.1", - "object-keys": "^1.1.1" - } - } } }, "es-to-primitive": { @@ -3225,15 +3461,6 @@ "esutils": "^2.0.2", "optionator": "^0.8.1", "source-map": "~0.6.1" - }, - "dependencies": { - "source-map": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", - "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", - "dev": true, - "optional": true - } } }, "eslint": { @@ -3279,40 +3506,15 @@ "table": "^5.2.3", "text-table": "^0.2.0", "v8-compile-cache": "^2.0.3" - }, - "dependencies": { - "globals": { - "version": "12.4.0", - "resolved": "https://registry.npmjs.org/globals/-/globals-12.4.0.tgz", - "integrity": "sha512-BWICuzzDvDoH54NHKCseDanAhE3CeDorgDL5MT6LMXXj2WCnd9UC2szdk4AWLfjdgNBCXLUanXYcpBBKOSWGwg==", - "dev": true, - "requires": { - "type-fest": "^0.8.1" - } - }, - "optionator": { - "version": "0.8.3", - "resolved": "https://registry.npmjs.org/optionator/-/optionator-0.8.3.tgz", - "integrity": "sha512-+IW9pACdk3XWmmTXG8m3upGUJst5XRGzxMRjXzAuJ1XnIFNvfhjjIuYkDvysnPQ7qzqVzLt78BCruntqRhWQbA==", - "dev": true, - "requires": { - "deep-is": "~0.1.3", - "fast-levenshtein": "~2.0.6", - "levn": "~0.3.0", - "prelude-ls": "~1.1.2", - "type-check": "~0.3.2", - "word-wrap": "~1.2.3" - } - } } }, "eslint-scope": { - "version": "5.0.0", - "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-5.0.0.tgz", - "integrity": "sha512-oYrhJW7S0bxAFDvWqzvMPRm6pcgcnWc4QnofCAqRTRfQC0JcwenzGglTtsLyIuuWFfkqDG9vz67cnttSd53djw==", + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-5.1.1.tgz", + "integrity": "sha512-2NxwbF/hZ0KpepYN0cNbo+FN6XoK7GaHlQhgx/hIZl6Va0bF45RQOOwhLIy8lQDbuCiadSLCBnH2CFYquit5bw==", "dev": true, "requires": { - "esrecurse": "^4.1.0", + "esrecurse": "^4.3.0", "estraverse": "^4.1.1" } }, @@ -3326,18 +3528,18 @@ } }, "eslint-visitor-keys": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/eslint-visitor-keys/-/eslint-visitor-keys-1.1.0.tgz", - "integrity": "sha512-8y9YjtM1JBJU/A9Kc+SbaOV4y29sSWckBwMHa+FGtVj5gN/sbnKDf6xJUl+8g7FAij9LVaP8C24DUiH/f/2Z9A==", + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/eslint-visitor-keys/-/eslint-visitor-keys-1.3.0.tgz", + "integrity": "sha512-6J72N8UNa462wa/KFODt/PJ3IU60SDpC3QXC1Hjc1BXXpfL2C9R5+AU7jhe0F6GREqVMh4Juu+NY7xn+6dipUQ==", "dev": true }, "espree": { - "version": "6.2.0", - "resolved": "https://registry.npmjs.org/espree/-/espree-6.2.0.tgz", - "integrity": "sha512-Xs8airJ7RQolnDIbLtRutmfvSsAe0xqMMAantCN/GMoqf81TFbeI1T7Jpd56qYu1uuh32dOG5W/X9uO+ghPXzA==", + "version": "6.2.1", + "resolved": "https://registry.npmjs.org/espree/-/espree-6.2.1.tgz", + "integrity": "sha512-ysCxRQY3WaXJz9tdbWOwuWr5Y/XrPTGX9Kiz3yoUXwW0VZ4w30HTkQLaGx/+ttFjF8i+ACbArnB4ce68a9m5hw==", "dev": true, "requires": { - "acorn": "^7.1.0", + "acorn": "^7.1.1", "acorn-jsx": "^5.2.0", "eslint-visitor-keys": "^1.1.0" } @@ -3349,21 +3551,37 @@ "dev": true }, "esquery": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/esquery/-/esquery-1.1.0.tgz", - "integrity": "sha512-MxYW9xKmROWF672KqjO75sszsA8Mxhw06YFeS5VHlB98KDHbOSurm3ArsjO60Eaf3QmGMCP1yn+0JQkNLo/97Q==", + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/esquery/-/esquery-1.3.1.tgz", + "integrity": "sha512-olpvt9QG0vniUBZspVRN6lwB7hOZoTRtT+jzR+tS4ffYx2mzbw+z0XCOk44aaLYKApNX5nMm+E+P6o25ip/DHQ==", "dev": true, "requires": { - "estraverse": "^4.0.0" + "estraverse": "^5.1.0" + }, + "dependencies": { + "estraverse": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-5.2.0.tgz", + "integrity": "sha512-BxbNGGNm0RyRYvUdHpIwv9IWzeM9XClbOxwoATuFdOE7ZE6wHL+HQ5T8hoPM+zHvmKzzsEqhgy0GrQ5X13afiQ==", + "dev": true + } } }, "esrecurse": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.2.1.tgz", - "integrity": "sha512-64RBB++fIOAXPw3P9cy89qfMlvZEXZkqqJkjqqXIvzP5ezRZjW+lPWjw35UX/3EhUPFYbg5ER4JYgDw4007/DQ==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.3.0.tgz", + "integrity": "sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==", "dev": true, "requires": { - "estraverse": "^4.1.0" + "estraverse": "^5.2.0" + }, + "dependencies": { + "estraverse": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-5.2.0.tgz", + "integrity": "sha512-BxbNGGNm0RyRYvUdHpIwv9IWzeM9XClbOxwoATuFdOE7ZE6wHL+HQ5T8hoPM+zHvmKzzsEqhgy0GrQ5X13afiQ==", + "dev": true + } } }, "estraverse": { @@ -3605,6 +3823,12 @@ "resolved": "https://registry.npmjs.org/qs/-/qs-6.7.0.tgz", "integrity": "sha512-VCdBRNFTX1fyE7Nb6FYoURo/SPe62QCaAyzJvUjwRaIsc+NePBEniHlvxFmmX56+HZphIGtV0XeCirBtpDrTyQ==", "dev": true + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true } } }, @@ -3731,16 +3955,6 @@ "requires": { "pump": "^3.0.0" } - }, - "pump": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz", - "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", - "dev": true, - "requires": { - "end-of-stream": "^1.1.0", - "once": "^1.3.1" - } } } }, @@ -3763,15 +3977,15 @@ } }, "fast-deep-equal": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-2.0.1.tgz", - "integrity": "sha1-ewUhjd+WZ79/Nwv3/bLLFf3Qqkk=", + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz", + "integrity": "sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==", "dev": true }, "fast-json-stable-stringify": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz", - "integrity": "sha1-1RQsDK7msRifh9OnYREGT4bIu/I=", + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz", + "integrity": "sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==", "dev": true }, "fast-levenshtein": { @@ -3831,27 +4045,20 @@ "flat-cache": "^2.0.1" } }, + "file-uri-to-path": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/file-uri-to-path/-/file-uri-to-path-1.0.0.tgz", + "integrity": "sha512-0Zt+s3L7Vf1biwWZ29aARiVYLx7iMGnEUl9x33fbB/j3jR81u/O2LbqK+Bm1CDSNDKVtJ/YjwY7TUd5SkeLQLw==", + "dev": true, + "optional": true + }, "fill-range": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz", - "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=", + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", + "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", "dev": true, "requires": { - "extend-shallow": "^2.0.1", - "is-number": "^3.0.0", - "repeat-string": "^1.6.1", - "to-regex-range": "^2.1.0" - }, - "dependencies": { - "extend-shallow": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", - "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", - "dev": true, - "requires": { - "is-extendable": "^0.1.0" - } - } + "to-regex-range": "^5.0.1" } }, "finalhandler": { @@ -3895,6 +4102,83 @@ "commondir": "^1.0.1", "make-dir": "^2.0.0", "pkg-dir": "^3.0.0" + }, + "dependencies": { + "find-up": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-3.0.0.tgz", + "integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==", + "dev": true, + "requires": { + "locate-path": "^3.0.0" + } + }, + "locate-path": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz", + "integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==", + "dev": true, + "requires": { + "p-locate": "^3.0.0", + "path-exists": "^3.0.0" + } + }, + "make-dir": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-2.1.0.tgz", + "integrity": "sha512-LS9X+dc8KLxXCb8dni79fLIIUA5VyZoyjSMCwTluaXA0o27cCK0bhXkpgw+sTXVpPy/lSO57ilRixqk0vDmtRA==", + "dev": true, + "requires": { + "pify": "^4.0.1", + "semver": "^5.6.0" + } + }, + "p-locate": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz", + "integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==", + "dev": true, + "requires": { + "p-limit": "^2.0.0" + } + }, + "path-exists": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", + "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", + "dev": true + }, + "pify": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/pify/-/pify-4.0.1.tgz", + "integrity": "sha512-uB80kBFb/tfd68bVleG9T5GGsGPjJrLAUpR5PZIrhBnIaRTQRjqdJSsIKkOP6OAIFbj7GOrcudc5pNjZ+geV2g==", + "dev": true + }, + "pkg-dir": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-3.0.0.tgz", + "integrity": "sha512-/E57AYkoeQ25qkxMj5PBOVgF8Kiu/h7cYS30Z5+R7WaiCCBfLq58ZI/dSeaEKb9WVJV5n/03QwrN3IeWIFllvw==", + "dev": true, + "requires": { + "find-up": "^3.0.0" + } + }, + "semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "dev": true + } + } + }, + "find-up": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", + "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", + "dev": true, + "requires": { + "locate-path": "^5.0.0", + "path-exists": "^4.0.0" } }, "findup-sync": { @@ -3907,6 +4191,111 @@ "is-glob": "^4.0.0", "micromatch": "^3.0.4", "resolve-dir": "^1.0.1" + }, + "dependencies": { + "braces": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz", + "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==", + "dev": true, + "requires": { + "arr-flatten": "^1.1.0", + "array-unique": "^0.3.2", + "extend-shallow": "^2.0.1", + "fill-range": "^4.0.0", + "isobject": "^3.0.1", + "repeat-element": "^1.1.2", + "snapdragon": "^0.8.1", + "snapdragon-node": "^2.0.1", + "split-string": "^3.0.2", + "to-regex": "^3.0.1" + }, + "dependencies": { + "extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dev": true, + "requires": { + "is-extendable": "^0.1.0" + } + } + } + }, + "fill-range": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz", + "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=", + "dev": true, + "requires": { + "extend-shallow": "^2.0.1", + "is-number": "^3.0.0", + "repeat-string": "^1.6.1", + "to-regex-range": "^2.1.0" + }, + "dependencies": { + "extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dev": true, + "requires": { + "is-extendable": "^0.1.0" + } + } + } + }, + "is-number": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", + "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", + "dev": true, + "requires": { + "kind-of": "^3.0.2" + }, + "dependencies": { + "kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dev": true, + "requires": { + "is-buffer": "^1.1.5" + } + } + } + }, + "micromatch": { + "version": "3.1.10", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz", + "integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==", + "dev": true, + "requires": { + "arr-diff": "^4.0.0", + "array-unique": "^0.3.2", + "braces": "^2.3.1", + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "extglob": "^2.0.4", + "fragment-cache": "^0.2.1", + "kind-of": "^6.0.2", + "nanomatch": "^1.2.9", + "object.pick": "^1.3.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.2" + } + }, + "to-regex-range": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz", + "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=", + "dev": true, + "requires": { + "is-number": "^3.0.0", + "repeat-string": "^1.6.1" + } + } } }, "flat-cache": { @@ -3921,9 +4310,9 @@ } }, "flatted": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/flatted/-/flatted-2.0.1.tgz", - "integrity": "sha512-a1hQMktqW9Nmqr5aktAux3JMNqaucxGcjtjWnZLHX7yyPCmlSV3M54nGYbqT8K+0GhF3NBgmJCc3ma+WOgX8Jg==", + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/flatted/-/flatted-2.0.2.tgz", + "integrity": "sha512-r5wGx7YeOwNWNlCA0wQ86zKyDLMQr+/RB8xy74M4hTphfmjlijTSSXGuH8rnvKZnfT9i+75zmd8jcKdMR4O6jA==", "dev": true }, "flush-write-stream": { @@ -3934,12 +4323,44 @@ "requires": { "inherits": "^2.0.3", "readable-stream": "^2.3.6" + }, + "dependencies": { + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + } } }, "follow-redirects": { - "version": "1.13.0", - "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.13.0.tgz", - "integrity": "sha512-aq6gF1BEKje4a9i9+5jimNFIpq4Q1WiwBToeRK5NvZBd/TRsmW8BsJfOEGkr76TbOyPVD3OVDN910EcUNtRYEA==", + "version": "1.13.1", + "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.13.1.tgz", + "integrity": "sha512-SSG5xmZh1mkPGyKzjZP8zLjltIfpW32Y5QpdNJyjcfGxK3qo3NDDkZOZSFiGn1A6SclQxY9GzEwAHQ3dmYRWpg==", "dev": true }, "for-in": { @@ -3994,6 +4415,38 @@ "requires": { "inherits": "^2.0.1", "readable-stream": "^2.0.0" + }, + "dependencies": { + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + } } }, "fs-constants": { @@ -4012,428 +4465,13 @@ "iferr": "^0.1.5", "imurmurhash": "^0.1.4", "readable-stream": "1 || 2" - } - }, - "fs.realpath": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", - "integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8=", - "dev": true - }, - "fsevents": { - "version": "1.2.9", - "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-1.2.9.tgz", - "integrity": "sha512-oeyj2H3EjjonWcFjD5NvZNE9Rqe4UW+nQBU2HNeKw0koVLEFIhtyETyAakeAM3de7Z/SW5kcA+fZUait9EApnw==", - "dev": true, - "optional": true, - "requires": { - "nan": "^2.12.1", - "node-pre-gyp": "^0.12.0" }, "dependencies": { - "abbrev": { - "version": "1.1.1", - "bundled": true, - "dev": true, - "optional": true - }, - "ansi-regex": { - "version": "2.1.1", - "bundled": true, - "dev": true, - "optional": true - }, - "aproba": { - "version": "1.2.0", - "bundled": true, - "dev": true, - "optional": true - }, - "are-we-there-yet": { - "version": "1.1.5", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "delegates": "^1.0.0", - "readable-stream": "^2.0.6" - } - }, - "balanced-match": { - "version": "1.0.0", - "bundled": true, - "dev": true, - "optional": true - }, - "brace-expansion": { - "version": "1.1.11", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "balanced-match": "^1.0.0", - "concat-map": "0.0.1" - } - }, - "chownr": { - "version": "1.1.1", - "bundled": true, - "dev": true, - "optional": true - }, - "code-point-at": { - "version": "1.1.0", - "bundled": true, - "dev": true, - "optional": true - }, - "concat-map": { - "version": "0.0.1", - "bundled": true, - "dev": true, - "optional": true - }, - "console-control-strings": { - "version": "1.1.0", - "bundled": true, - "dev": true, - "optional": true - }, - "core-util-is": { - "version": "1.0.2", - "bundled": true, - "dev": true, - "optional": true - }, - "debug": { - "version": "4.1.1", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "ms": "^2.1.1" - } - }, - "deep-extend": { - "version": "0.6.0", - "bundled": true, - "dev": true, - "optional": true - }, - "delegates": { - "version": "1.0.0", - "bundled": true, - "dev": true, - "optional": true - }, - "detect-libc": { - "version": "1.0.3", - "bundled": true, - "dev": true, - "optional": true - }, - "fs-minipass": { - "version": "1.2.5", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "minipass": "^2.2.1" - } - }, - "fs.realpath": { - "version": "1.0.0", - "bundled": true, - "dev": true, - "optional": true - }, - "gauge": { - "version": "2.7.4", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "aproba": "^1.0.3", - "console-control-strings": "^1.0.0", - "has-unicode": "^2.0.0", - "object-assign": "^4.1.0", - "signal-exit": "^3.0.0", - "string-width": "^1.0.1", - "strip-ansi": "^3.0.1", - "wide-align": "^1.1.0" - } - }, - "glob": { - "version": "7.1.3", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "fs.realpath": "^1.0.0", - "inflight": "^1.0.4", - "inherits": "2", - "minimatch": "^3.0.4", - "once": "^1.3.0", - "path-is-absolute": "^1.0.0" - } - }, - "has-unicode": { - "version": "2.0.1", - "bundled": true, - "dev": true, - "optional": true - }, - "iconv-lite": { - "version": "0.4.24", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "safer-buffer": ">= 2.1.2 < 3" - } - }, - "ignore-walk": { - "version": "3.0.1", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "minimatch": "^3.0.4" - } - }, - "inflight": { - "version": "1.0.6", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "once": "^1.3.0", - "wrappy": "1" - } - }, - "inherits": { - "version": "2.0.3", - "bundled": true, - "dev": true, - "optional": true - }, - "ini": { - "version": "1.3.5", - "bundled": true, - "dev": true, - "optional": true - }, - "is-fullwidth-code-point": { - "version": "1.0.0", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "number-is-nan": "^1.0.0" - } - }, - "isarray": { - "version": "1.0.0", - "bundled": true, - "dev": true, - "optional": true - }, - "minimatch": { - "version": "3.0.4", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "brace-expansion": "^1.1.7" - } - }, - "minimist": { - "version": "0.0.8", - "bundled": true, - "dev": true, - "optional": true - }, - "minipass": { - "version": "2.3.5", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "safe-buffer": "^5.1.2", - "yallist": "^3.0.0" - } - }, - "minizlib": { - "version": "1.2.1", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "minipass": "^2.2.1" - } - }, - "mkdirp": { - "version": "0.5.1", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "minimist": "0.0.8" - } - }, - "ms": { - "version": "2.1.1", - "bundled": true, - "dev": true, - "optional": true - }, - "needle": { - "version": "2.3.0", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "debug": "^4.1.0", - "iconv-lite": "^0.4.4", - "sax": "^1.2.4" - } - }, - "node-pre-gyp": { - "version": "0.12.0", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "detect-libc": "^1.0.2", - "mkdirp": "^0.5.1", - "needle": "^2.2.1", - "nopt": "^4.0.1", - "npm-packlist": "^1.1.6", - "npmlog": "^4.0.2", - "rc": "^1.2.7", - "rimraf": "^2.6.1", - "semver": "^5.3.0", - "tar": "^4" - } - }, - "nopt": { - "version": "4.0.1", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "abbrev": "1", - "osenv": "^0.1.4" - } - }, - "npm-bundled": { - "version": "1.0.6", - "bundled": true, - "dev": true, - "optional": true - }, - "npm-packlist": { - "version": "1.4.1", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "ignore-walk": "^3.0.1", - "npm-bundled": "^1.0.1" - } - }, - "npmlog": { - "version": "4.1.2", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "are-we-there-yet": "~1.1.2", - "console-control-strings": "~1.1.0", - "gauge": "~2.7.3", - "set-blocking": "~2.0.0" - } - }, - "number-is-nan": { - "version": "1.0.1", - "bundled": true, - "dev": true, - "optional": true - }, - "object-assign": { - "version": "4.1.1", - "bundled": true, - "dev": true, - "optional": true - }, - "once": { - "version": "1.4.0", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "wrappy": "1" - } - }, - "os-homedir": { - "version": "1.0.2", - "bundled": true, - "dev": true, - "optional": true - }, - "os-tmpdir": { - "version": "1.0.2", - "bundled": true, - "dev": true, - "optional": true - }, - "osenv": { - "version": "0.1.5", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "os-homedir": "^1.0.0", - "os-tmpdir": "^1.0.0" - } - }, - "path-is-absolute": { - "version": "1.0.1", - "bundled": true, - "dev": true, - "optional": true - }, - "process-nextick-args": { - "version": "2.0.0", - "bundled": true, - "dev": true, - "optional": true - }, - "rc": { - "version": "1.2.8", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "deep-extend": "^0.6.0", - "ini": "~1.3.0", - "minimist": "^1.2.0", - "strip-json-comments": "~2.0.1" - }, - "dependencies": { - "minimist": { - "version": "1.2.0", - "bundled": true, - "dev": true, - "optional": true - } - } - }, "readable-stream": { - "version": "2.3.6", - "bundled": true, + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", "dev": true, - "optional": true, "requires": { "core-util-is": "~1.0.0", "inherits": "~2.0.3", @@ -4444,130 +4482,36 @@ "util-deprecate": "~1.0.1" } }, - "rimraf": { - "version": "2.6.3", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "glob": "^7.1.3" - } - }, "safe-buffer": { "version": "5.1.2", - "bundled": true, - "dev": true, - "optional": true - }, - "safer-buffer": { - "version": "2.1.2", - "bundled": true, - "dev": true, - "optional": true - }, - "sax": { - "version": "1.2.4", - "bundled": true, - "dev": true, - "optional": true - }, - "semver": { - "version": "5.7.0", - "bundled": true, - "dev": true, - "optional": true - }, - "set-blocking": { - "version": "2.0.0", - "bundled": true, - "dev": true, - "optional": true - }, - "signal-exit": { - "version": "3.0.2", - "bundled": true, - "dev": true, - "optional": true - }, - "string-width": { - "version": "1.0.2", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "code-point-at": "^1.0.0", - "is-fullwidth-code-point": "^1.0.0", - "strip-ansi": "^3.0.0" - } + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true }, "string_decoder": { "version": "1.1.1", - "bundled": true, + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", "dev": true, - "optional": true, "requires": { "safe-buffer": "~5.1.0" } - }, - "strip-ansi": { - "version": "3.0.1", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "ansi-regex": "^2.0.0" - } - }, - "strip-json-comments": { - "version": "2.0.1", - "bundled": true, - "dev": true, - "optional": true - }, - "tar": { - "version": "4.4.8", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "chownr": "^1.1.1", - "fs-minipass": "^1.2.5", - "minipass": "^2.3.4", - "minizlib": "^1.1.1", - "mkdirp": "^0.5.0", - "safe-buffer": "^5.1.2", - "yallist": "^3.0.2" - } - }, - "util-deprecate": { - "version": "1.0.2", - "bundled": true, - "dev": true, - "optional": true - }, - "wide-align": { - "version": "1.1.3", - "bundled": true, - "dev": true, - "optional": true, - "requires": { - "string-width": "^1.0.2 || 2" - } - }, - "wrappy": { - "version": "1.0.2", - "bundled": true, - "dev": true, - "optional": true - }, - "yallist": { - "version": "3.0.3", - "bundled": true, - "dev": true, - "optional": true } } }, + "fs.realpath": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", + "integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8=", + "dev": true + }, + "fsevents": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.2.1.tgz", + "integrity": "sha512-bTLYHSeC0UH/EFXS9KqWnXuOl/wHK5Z/d+ghd5AsFMYN7wIGkUCOJyzy88+wJKkZPGON8u4Z9f6U4FdgURE9qA==", + "dev": true, + "optional": true + }, "function-bind": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz", @@ -4586,23 +4530,21 @@ "integrity": "sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg==", "dev": true }, + "get-caller-file": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz", + "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==", + "dev": true + }, "get-intrinsic": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.0.1.tgz", - "integrity": "sha512-ZnWP+AmS1VUaLgTRy47+zKtjTxz+0xMpx3I52i+aalBK1QP19ggLF3Db89KJX7kjfOfP2eoa01qc++GwPgufPg==", + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.0.2.tgz", + "integrity": "sha512-aeX0vrFm21ILl3+JpFFRNe9aUvp6VFZb2/CTbgLb8j75kOhvoNYjt9d8KA/tJG4gSo8nzEDedRl0h7vDmBYRVg==", "dev": true, "requires": { "function-bind": "^1.1.1", "has": "^1.0.3", "has-symbols": "^1.0.1" - }, - "dependencies": { - "has-symbols": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz", - "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", - "dev": true - } } }, "get-package-type": { @@ -4611,6 +4553,205 @@ "integrity": "sha512-pjzuKtY64GYfWizNAJ0fr9VqttZkNiK2iS430LtIHzjBEr6bX8Am2zm4sW4Ro5wjWW5cAlRL1qAMTcXbjNAO2Q==", "dev": true }, + "get-pkg-repo": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/get-pkg-repo/-/get-pkg-repo-1.4.0.tgz", + "integrity": "sha1-xztInAbYDMVTbCyFP54FIyBWly0=", + "dev": true, + "requires": { + "hosted-git-info": "^2.1.4", + "meow": "^3.3.0", + "normalize-package-data": "^2.3.0", + "parse-github-repo-url": "^1.3.0", + "through2": "^2.0.0" + }, + "dependencies": { + "camelcase": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-2.1.1.tgz", + "integrity": "sha1-fB0W1nmhu+WcoCys7PsBHiAfWh8=", + "dev": true + }, + "camelcase-keys": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-2.1.0.tgz", + "integrity": "sha1-MIvur/3ygRkFHvodkyITyRuPkuc=", + "dev": true, + "requires": { + "camelcase": "^2.0.0", + "map-obj": "^1.0.0" + } + }, + "find-up": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-1.1.2.tgz", + "integrity": "sha1-ay6YIrGizgpgq2TWEOzK1TyyTQ8=", + "dev": true, + "requires": { + "path-exists": "^2.0.0", + "pinkie-promise": "^2.0.0" + } + }, + "hosted-git-info": { + "version": "2.8.8", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", + "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==", + "dev": true + }, + "indent-string": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-2.1.0.tgz", + "integrity": "sha1-ji1INIdCEhtKghi3oTfppSBJ3IA=", + "dev": true, + "requires": { + "repeating": "^2.0.0" + } + }, + "map-obj": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-1.0.1.tgz", + "integrity": "sha1-2TPOuSBdgr3PSIb2dCvcK03qFG0=", + "dev": true + }, + "meow": { + "version": "3.7.0", + "resolved": "https://registry.npmjs.org/meow/-/meow-3.7.0.tgz", + "integrity": "sha1-cstmi0JSKCkKu/qFaJJYcwioAfs=", + "dev": true, + "requires": { + "camelcase-keys": "^2.0.0", + "decamelize": "^1.1.2", + "loud-rejection": "^1.0.0", + "map-obj": "^1.0.1", + "minimist": "^1.1.3", + "normalize-package-data": "^2.3.4", + "object-assign": "^4.0.1", + "read-pkg-up": "^1.0.1", + "redent": "^1.0.0", + "trim-newlines": "^1.0.0" + } + }, + "normalize-package-data": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", + "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", + "dev": true, + "requires": { + "hosted-git-info": "^2.1.4", + "resolve": "^1.10.0", + "semver": "2 || 3 || 4 || 5", + "validate-npm-package-license": "^3.0.1" + } + }, + "path-exists": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-2.1.0.tgz", + "integrity": "sha1-D+tsZPD8UY2adU3V77YscCJ2H0s=", + "dev": true, + "requires": { + "pinkie-promise": "^2.0.0" + } + }, + "read-pkg": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-1.1.0.tgz", + "integrity": "sha1-9f+qXs0pyzHAR0vKfXVra7KePyg=", + "dev": true, + "requires": { + "load-json-file": "^1.0.0", + "normalize-package-data": "^2.3.2", + "path-type": "^1.0.0" + } + }, + "read-pkg-up": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-1.0.1.tgz", + "integrity": "sha1-nWPBMnbAZZGNV/ACpX9AobZD+wI=", + "dev": true, + "requires": { + "find-up": "^1.0.0", + "read-pkg": "^1.0.0" + } + }, + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "redent": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/redent/-/redent-1.0.0.tgz", + "integrity": "sha1-z5Fqsf1fHxbfsggi3W7H9zDCr94=", + "dev": true, + "requires": { + "indent-string": "^2.1.0", + "strip-indent": "^1.0.1" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, + "semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "dev": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + }, + "strip-indent": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-1.0.1.tgz", + "integrity": "sha1-DHlipq3vp7vUrDZkYKY4VSrhoKI=", + "dev": true, + "requires": { + "get-stdin": "^4.0.1" + } + }, + "through2": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/through2/-/through2-2.0.5.tgz", + "integrity": "sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ==", + "dev": true, + "requires": { + "readable-stream": "~2.3.6", + "xtend": "~4.0.1" + } + }, + "trim-newlines": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-1.0.0.tgz", + "integrity": "sha1-WIeWa7WCpFA6QetST301ARgVphM=", + "dev": true + } + } + }, + "get-stdin": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/get-stdin/-/get-stdin-4.0.1.tgz", + "integrity": "sha1-uWjGsKBDhDJJAui/Gl3zJXmkUP4=", + "dev": true + }, "get-stream": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-4.1.0.tgz", @@ -4618,18 +4759,6 @@ "dev": true, "requires": { "pump": "^3.0.0" - }, - "dependencies": { - "pump": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz", - "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", - "dev": true, - "requires": { - "end-of-stream": "^1.1.0", - "once": "^1.3.1" - } - } } }, "get-value": { @@ -4647,10 +4776,202 @@ "assert-plus": "^1.0.0" } }, + "git-raw-commits": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/git-raw-commits/-/git-raw-commits-2.0.0.tgz", + "integrity": "sha512-w4jFEJFgKXMQJ0H0ikBk2S+4KP2VEjhCvLCNqbNRQC8BgGWgLKNCO7a9K9LI+TVT7Gfoloje502sEnctibffgg==", + "dev": true, + "requires": { + "dargs": "^4.0.1", + "lodash.template": "^4.0.2", + "meow": "^4.0.0", + "split2": "^2.0.0", + "through2": "^2.0.0" + }, + "dependencies": { + "camelcase": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz", + "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=", + "dev": true + }, + "camelcase-keys": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-4.2.0.tgz", + "integrity": "sha1-oqpfsa9oh1glnDLBQUJteJI7m3c=", + "dev": true, + "requires": { + "camelcase": "^4.1.0", + "map-obj": "^2.0.0", + "quick-lru": "^1.0.0" + } + }, + "hosted-git-info": { + "version": "2.8.8", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", + "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==", + "dev": true + }, + "indent-string": { + "version": "3.2.0", + "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-3.2.0.tgz", + "integrity": "sha1-Sl/W0nzDMvN+VBmlBNu4NxBckok=", + "dev": true + }, + "map-obj": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-2.0.0.tgz", + "integrity": "sha1-plzSkIepJZi4eRJXpSPgISIqwfk=", + "dev": true + }, + "meow": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/meow/-/meow-4.0.1.tgz", + "integrity": "sha512-xcSBHD5Z86zaOc+781KrupuHAzeGXSLtiAOmBsiLDiPSaYSB6hdew2ng9EBAnZ62jagG9MHAOdxpDi/lWBFJ/A==", + "dev": true, + "requires": { + "camelcase-keys": "^4.0.0", + "decamelize-keys": "^1.0.0", + "loud-rejection": "^1.0.0", + "minimist": "^1.1.3", + "minimist-options": "^3.0.1", + "normalize-package-data": "^2.3.4", + "read-pkg-up": "^3.0.0", + "redent": "^2.0.0", + "trim-newlines": "^2.0.0" + } + }, + "minimist-options": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/minimist-options/-/minimist-options-3.0.2.tgz", + "integrity": "sha512-FyBrT/d0d4+uiZRbqznPXqw3IpZZG3gl3wKWiX784FycUKVwBt0uLBFkQrtE4tZOrgo78nZp2jnKz3L65T5LdQ==", + "dev": true, + "requires": { + "arrify": "^1.0.1", + "is-plain-obj": "^1.1.0" + } + }, + "normalize-package-data": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", + "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", + "dev": true, + "requires": { + "hosted-git-info": "^2.1.4", + "resolve": "^1.10.0", + "semver": "2 || 3 || 4 || 5", + "validate-npm-package-license": "^3.0.1" + } + }, + "quick-lru": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/quick-lru/-/quick-lru-1.1.0.tgz", + "integrity": "sha1-Q2CxfGETatOAeDl/8RQW4Ybc+7g=", + "dev": true + }, + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "redent": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/redent/-/redent-2.0.0.tgz", + "integrity": "sha1-wbIAe0LVfrE4kHmzyDM2OdXhzKo=", + "dev": true, + "requires": { + "indent-string": "^3.0.0", + "strip-indent": "^2.0.0" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, + "semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "dev": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + }, + "strip-indent": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-2.0.0.tgz", + "integrity": "sha1-XvjbKV0B5u1sv3qrlpmNeCJSe2g=", + "dev": true + }, + "through2": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/through2/-/through2-2.0.5.tgz", + "integrity": "sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ==", + "dev": true, + "requires": { + "readable-stream": "~2.3.6", + "xtend": "~4.0.1" + } + }, + "trim-newlines": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-2.0.0.tgz", + "integrity": "sha1-tAPQuRvlDDMd/EuC7s6yLD3hbSA=", + "dev": true + } + } + }, + "git-remote-origin-url": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/git-remote-origin-url/-/git-remote-origin-url-2.0.0.tgz", + "integrity": "sha1-UoJlna4hBxRaERJhEq0yFuxfpl8=", + "dev": true, + "requires": { + "gitconfiglocal": "^1.0.0", + "pify": "^2.3.0" + } + }, + "git-semver-tags": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/git-semver-tags/-/git-semver-tags-4.1.1.tgz", + "integrity": "sha512-OWyMt5zBe7xFs8vglMmhM9lRQzCWL3WjHtxNNfJTMngGym7pC1kh8sP6jevfydJ6LP3ZvGxfb6ABYgPUM0mtsA==", + "dev": true, + "requires": { + "meow": "^8.0.0", + "semver": "^6.0.0" + } + }, + "gitconfiglocal": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/gitconfiglocal/-/gitconfiglocal-1.0.0.tgz", + "integrity": "sha1-QdBF84UaXqiPA/JMocYXgRRGS5s=", + "dev": true, + "requires": { + "ini": "^1.3.2" + } + }, "glob": { - "version": "7.1.4", - "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.4.tgz", - "integrity": "sha512-hkLPepehmnKk41pUGm3sYxoFs/umurYfYJCerbXEyFIWcAzvpipAgVkBqqT9RBKMGjnq6kMuyYwha6csxbiM1A==", + "version": "7.1.6", + "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.6.tgz", + "integrity": "sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA==", "dev": true, "requires": { "fs.realpath": "^1.0.0", @@ -4662,23 +4983,34 @@ } }, "glob-parent": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.0.tgz", - "integrity": "sha512-qjtRgnIVmOfnKUE3NJAQEdk+lKrxfw8t5ke7SXtfMTHcjsBfOfWXCQfdb30zfDoZQ2IRSIiidmjtbHZPZ++Ihw==", + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.1.tgz", + "integrity": "sha512-FnI+VGOpnlGHWZxthPGR+QhR78fuiK0sNLkHQv+bL9fQi57lNNdquIbna/WrfROrolq8GK5Ek6BiMwqL/voRYQ==", "dev": true, "requires": { "is-glob": "^4.0.1" } }, "global-modules": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/global-modules/-/global-modules-1.0.0.tgz", - "integrity": "sha512-sKzpEkf11GpOFuw0Zzjzmt4B4UZwjOcG757PPvrfhxcLFbq0wpsgpOqxpxtxFiCG4DtG93M6XRVbF2oGdev7bg==", + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/global-modules/-/global-modules-2.0.0.tgz", + "integrity": "sha512-NGbfmJBp9x8IxyJSd1P+otYK8vonoJactOogrVfFRIAEY1ukil8RSKDz2Yo7wh1oihl51l/r6W4epkeKJHqL8A==", "dev": true, "requires": { - "global-prefix": "^1.0.1", - "is-windows": "^1.0.1", - "resolve-dir": "^1.0.0" + "global-prefix": "^3.0.0" + }, + "dependencies": { + "global-prefix": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/global-prefix/-/global-prefix-3.0.0.tgz", + "integrity": "sha512-awConJSVCHVGND6x3tmMaKcQvwXLhjdkmomy2W+Goaui8YPgYgXJZewhg3fWC+DlfqqQuWg8AwqjGTD2nAPVWg==", + "dev": true, + "requires": { + "ini": "^1.3.5", + "kind-of": "^6.0.2", + "which": "^1.3.1" + } + } } }, "global-prefix": { @@ -4695,10 +5027,21 @@ } }, "globals": { - "version": "11.12.0", - "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", - "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", - "dev": true + "version": "12.4.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-12.4.0.tgz", + "integrity": "sha512-BWICuzzDvDoH54NHKCseDanAhE3CeDorgDL5MT6LMXXj2WCnd9UC2szdk4AWLfjdgNBCXLUanXYcpBBKOSWGwg==", + "dev": true, + "requires": { + "type-fest": "^0.8.1" + }, + "dependencies": { + "type-fest": { + "version": "0.8.1", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.8.1.tgz", + "integrity": "sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==", + "dev": true + } + } }, "globby": { "version": "6.1.0", @@ -4714,9 +5057,9 @@ } }, "graceful-fs": { - "version": "4.2.2", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.2.tgz", - "integrity": "sha512-IItsdsea19BoLC7ELy13q1iJFNmd7ofZH5+X/pJr90/nRoPEX0DJo1dHDbgtYWOhJhcCgMDTOw84RZ72q6lB+Q==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", "dev": true }, "growly": { @@ -4732,6 +5075,19 @@ "integrity": "sha512-9Qn4yBxelxoh2Ow62nP+Ka/kMnOXRi8BXnRaUwezLNhqelnN49xKz4F/dPP8OYLxLxq6JDtZb2i9XznUQbNPTg==", "dev": true }, + "handlebars": { + "version": "4.7.6", + "resolved": "https://registry.npmjs.org/handlebars/-/handlebars-4.7.6.tgz", + "integrity": "sha512-1f2BACcBfiwAfStCKZNrUCgqNZkGsAT7UM3kkYtXuLo0KnaVfjKOyf7PRzB6++aK9STyT1Pd2ZCPe3EGOXleXA==", + "dev": true, + "requires": { + "minimist": "^1.2.5", + "neo-async": "^2.6.0", + "source-map": "^0.6.1", + "uglify-js": "^3.1.4", + "wordwrap": "^1.0.0" + } + }, "har-schema": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/har-schema/-/har-schema-2.0.0.tgz", @@ -4746,28 +5102,14 @@ "requires": { "ajv": "^6.12.3", "har-schema": "^2.0.0" - }, - "dependencies": { - "ajv": { - "version": "6.12.6", - "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.6.tgz", - "integrity": "sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==", - "dev": true, - "requires": { - "fast-deep-equal": "^3.1.1", - "fast-json-stable-stringify": "^2.0.0", - "json-schema-traverse": "^0.4.1", - "uri-js": "^4.2.2" - } - }, - "fast-deep-equal": { - "version": "3.1.3", - "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz", - "integrity": "sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==", - "dev": true - } } }, + "hard-rejection": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/hard-rejection/-/hard-rejection-2.1.0.tgz", + "integrity": "sha512-VIZB+ibDhx7ObhAe7OVtoEbuP4h/MuOTHJ+J8h/eBXotJYl0fBgR72xDFCKgIh22OJZIOVNxBMWuhAr10r8HdA==", + "dev": true + }, "has": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/has/-/has-1.0.3.tgz", @@ -4800,6 +5142,12 @@ "integrity": "sha1-tdRU3CGZriJWmfNGfloH87lVuv0=", "dev": true }, + "has-symbols": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz", + "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", + "dev": true + }, "has-value": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/has-value/-/has-value-1.0.0.tgz", @@ -4821,6 +5169,26 @@ "kind-of": "^4.0.0" }, "dependencies": { + "is-number": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", + "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", + "dev": true, + "requires": { + "kind-of": "^3.0.2" + }, + "dependencies": { + "kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dev": true, + "requires": { + "is-buffer": "^1.1.5" + } + } + } + }, "kind-of": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-4.0.0.tgz", @@ -4841,25 +5209,6 @@ "inherits": "^2.0.4", "readable-stream": "^3.6.0", "safe-buffer": "^5.2.0" - }, - "dependencies": { - "readable-stream": { - "version": "3.6.0", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", - "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", - "dev": true, - "requires": { - "inherits": "^2.0.3", - "string_decoder": "^1.1.1", - "util-deprecate": "^1.0.1" - } - }, - "safe-buffer": { - "version": "5.2.1", - "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", - "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==", - "dev": true - } } }, "hash.js": { @@ -4893,10 +5242,13 @@ } }, "hosted-git-info": { - "version": "2.8.4", - "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.4.tgz", - "integrity": "sha512-pzXIvANXEFrc5oFFXRMkbLPQ2rXRoDERwDLyrcUxGhaZhgP54BBSl9Oheh7Vv0T090cszWBxPjkQQ5Sq1PbBRQ==", - "dev": true + "version": "3.0.7", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-3.0.7.tgz", + "integrity": "sha512-fWqc0IcuXs+BmE9orLDyVykAG9GJtGLGuZAAqgcckPgv5xad4AcXGIv8galtQvlwutxSlaMcdw7BUtq2EIvqCQ==", + "dev": true, + "requires": { + "lru-cache": "^6.0.0" + } }, "hpack.js": { "version": "2.1.6", @@ -4908,6 +5260,38 @@ "obuf": "^1.0.0", "readable-stream": "^2.0.1", "wbuf": "^1.1.0" + }, + "dependencies": { + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + } } }, "html-encoding-sniffer": { @@ -4920,9 +5304,9 @@ } }, "html-entities": { - "version": "1.3.1", - "resolved": "https://registry.npmjs.org/html-entities/-/html-entities-1.3.1.tgz", - "integrity": "sha512-rhE/4Z3hIhzHAUKbW8jVcCyuT5oJCXXqhN/6mXXVCpzTmvJnoH2HL/bt3EZ6p55jbFJBeAe1ZNpL5BugLujxNA==", + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/html-entities/-/html-entities-1.4.0.tgz", + "integrity": "sha512-8nxjcBcd8wovbeKx7h3wTji4e6+rhaVuPNpMqwWgnHh+N9ToqsCs6XztWRBPQ+UtzsoMAdKZtUENoVzU/EMtZA==", "dev": true }, "html-escaper": { @@ -4979,6 +5363,111 @@ "is-glob": "^4.0.0", "lodash": "^4.17.11", "micromatch": "^3.1.10" + }, + "dependencies": { + "braces": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz", + "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==", + "dev": true, + "requires": { + "arr-flatten": "^1.1.0", + "array-unique": "^0.3.2", + "extend-shallow": "^2.0.1", + "fill-range": "^4.0.0", + "isobject": "^3.0.1", + "repeat-element": "^1.1.2", + "snapdragon": "^0.8.1", + "snapdragon-node": "^2.0.1", + "split-string": "^3.0.2", + "to-regex": "^3.0.1" + }, + "dependencies": { + "extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dev": true, + "requires": { + "is-extendable": "^0.1.0" + } + } + } + }, + "fill-range": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz", + "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=", + "dev": true, + "requires": { + "extend-shallow": "^2.0.1", + "is-number": "^3.0.0", + "repeat-string": "^1.6.1", + "to-regex-range": "^2.1.0" + }, + "dependencies": { + "extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dev": true, + "requires": { + "is-extendable": "^0.1.0" + } + } + } + }, + "is-number": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", + "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", + "dev": true, + "requires": { + "kind-of": "^3.0.2" + }, + "dependencies": { + "kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dev": true, + "requires": { + "is-buffer": "^1.1.5" + } + } + } + }, + "micromatch": { + "version": "3.1.10", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz", + "integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==", + "dev": true, + "requires": { + "arr-diff": "^4.0.0", + "array-unique": "^0.3.2", + "braces": "^2.3.1", + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "extglob": "^2.0.4", + "fragment-cache": "^0.2.1", + "kind-of": "^6.0.2", + "nanomatch": "^1.2.9", + "object.pick": "^1.3.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.2" + } + }, + "to-regex-range": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz", + "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=", + "dev": true, + "requires": { + "is-number": "^3.0.0", + "repeat-string": "^1.6.1" + } + } } }, "http-signature": { @@ -5042,9 +5531,9 @@ "dev": true }, "import-fresh": { - "version": "3.2.1", - "resolved": "https://registry.npmjs.org/import-fresh/-/import-fresh-3.2.1.tgz", - "integrity": "sha512-6e1q1cnWP2RXD9/keSkxHScg508CdXqXWgWBaETNhyuBFz+kUZlKboh+ISK+bU++DmbHimVBrOz/zzPe0sZ3sQ==", + "version": "3.3.0", + "resolved": "https://registry.npmjs.org/import-fresh/-/import-fresh-3.3.0.tgz", + "integrity": "sha512-veYYhQa+D1QBKznvhUHxb8faxlrwUnxseDAbAp457E0wLNio2bOSKnjYDhMj+YiAq61xrMGhQk9iXVk5FzgQMw==", "dev": true, "requires": { "parent-module": "^1.0.0", @@ -5052,13 +5541,13 @@ } }, "import-local": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/import-local/-/import-local-2.0.0.tgz", - "integrity": "sha512-b6s04m3O+s3CGSbqDIyP4R6aAwAeYlVq9+WUWep6iHa8ETRf9yei1U48C5MmfJmV9AiLYYBKPMq/W+/WRpQmCQ==", + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/import-local/-/import-local-3.0.2.tgz", + "integrity": "sha512-vjL3+w0oulAVZ0hBHnxa/Nm5TAurf9YLQJDhqRZyqb+VKGOB6LU8t9H1Nr5CIo16vh9XfJTOoHwU0B71S557gA==", "dev": true, "requires": { - "pkg-dir": "^3.0.0", - "resolve-cwd": "^2.0.0" + "pkg-dir": "^4.2.0", + "resolve-cwd": "^3.0.0" } }, "imurmurhash": { @@ -5067,6 +5556,12 @@ "integrity": "sha1-khi5srkoojixPcT7a21XbyMUU+o=", "dev": true }, + "indent-string": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-4.0.0.tgz", + "integrity": "sha512-EdDDZu4A2OyIK7Lr/2zG+w5jmbuk1DVBnEwREQvBzspBJkCEbRa8GxU1lghYcaGJCnRWibjDXlq779X1/y5xwg==", + "dev": true + }, "infer-owner": { "version": "1.0.4", "resolved": "https://registry.npmjs.org/infer-owner/-/infer-owner-1.0.4.tgz", @@ -5090,61 +5585,45 @@ "dev": true }, "ini": { - "version": "1.3.5", - "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.5.tgz", - "integrity": "sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==", + "version": "1.3.8", + "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.8.tgz", + "integrity": "sha512-JV/yugV2uzW5iMRSiZAyDtQd+nxtUnjeLt0acNdw98kKLrvuRVyB80tsREOE7yvGVgalhZ6RNXCmEHkUKBKxew==", "dev": true }, "inquirer": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/inquirer/-/inquirer-7.1.0.tgz", - "integrity": "sha512-5fJMWEmikSYu0nv/flMc475MhGbB7TSPd/2IpFV4I4rMklboCH2rQjYY5kKiYGHqUF9gvaambupcJFFG9dvReg==", + "version": "7.3.3", + "resolved": "https://registry.npmjs.org/inquirer/-/inquirer-7.3.3.tgz", + "integrity": "sha512-JG3eIAj5V9CwcGvuOmoo6LB9kbAYT8HXffUl6memuszlwDC/qvFAJw49XJ5NROSFNPxp3iQg1GqkFhaY/CR0IA==", "dev": true, "requires": { "ansi-escapes": "^4.2.1", - "chalk": "^3.0.0", + "chalk": "^4.1.0", "cli-cursor": "^3.1.0", - "cli-width": "^2.0.0", + "cli-width": "^3.0.0", "external-editor": "^3.0.3", "figures": "^3.0.0", - "lodash": "^4.17.15", + "lodash": "^4.17.19", "mute-stream": "0.0.8", "run-async": "^2.4.0", - "rxjs": "^6.5.3", + "rxjs": "^6.6.0", "string-width": "^4.1.0", "strip-ansi": "^6.0.0", "through": "^2.3.6" }, "dependencies": { - "ansi-escapes": { - "version": "4.3.1", - "resolved": "https://registry.npmjs.org/ansi-escapes/-/ansi-escapes-4.3.1.tgz", - "integrity": "sha512-JWF7ocqNrp8u9oqpgV+wH5ftbt+cfvv+PTjOvKLT3AdYly/LmORARfEVT1iyjwN+4MqE5UmVKoAdIBqeoCHgLA==", - "dev": true, - "requires": { - "type-fest": "^0.11.0" - } - }, - "ansi-regex": { - "version": "5.0.0", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.0.tgz", - "integrity": "sha512-bY6fj56OUQ0hU1KjFNDQuJFezqKdrAyFdIevADiqrWHwSlbmBNMHp5ak2f40Pm8JTFyM2mqxkG6ngkHO11f/lg==", - "dev": true - }, "ansi-styles": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", - "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, "requires": { - "@types/color-name": "^1.1.1", "color-convert": "^2.0.1" } }, "chalk": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/chalk/-/chalk-3.0.0.tgz", - "integrity": "sha512-4D3B6Wf41KOYRFdszmDqMCGq5VV/uMAB273JILmO+3jAlh8X4qDtdtgCR3fxtbLEMzSx22QdhnDcJvu2u1fVwg==", + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-4.1.0.tgz", + "integrity": "sha512-qwx12AxXe2Q5xQ43Ac//I6v5aXTipYrSESdOgzrN+9XjgEpyjpKuvSGaN4qE93f7TQTlerQQ8S+EQ0EyDoVL1A==", "dev": true, "requires": { "ansi-styles": "^4.1.0", @@ -5182,19 +5661,13 @@ } }, "supports-color": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.1.0.tgz", - "integrity": "sha512-oRSIpR8pxT1Wr2FquTNnGet79b3BWljqOuoW/h4oBhxJ/HUbX5nX6JSruTkvXDCFMwDPvsaTTbvMLKZWSy0R5g==", + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, "requires": { "has-flag": "^4.0.0" } - }, - "type-fest": { - "version": "0.11.0", - "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.11.0.tgz", - "integrity": "sha512-OdjXJxnCN1AvyLSzeKIgXTXxV+99ZuXl3Hpo9XpJAv9MBcHrrJOQ5kV7ypXOuQie+AmWG25hLbiKdwYTifzcfQ==", - "dev": true } } }, @@ -5209,9 +5682,9 @@ } }, "interpret": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/interpret/-/interpret-1.2.0.tgz", - "integrity": "sha512-mT34yGKMNceBQUoVn7iCDKDntA7SC6gycMAWzGx1z/CMCTV7b2AAtXlo3nRyHZ1FelRkQbQjprHSYGwzLtkVbw==", + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/interpret/-/interpret-1.4.0.tgz", + "integrity": "sha512-agE4QfB2Lkp9uICn7BAqoscw4SZP9kTE2hxiFI3jBPmXJfdqiahTbUuKGsMoN2GtqL9AxhYioAcVvgsb1HvRbA==", "dev": true }, "ip": { @@ -5259,10 +5732,13 @@ } }, "is-arguments": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/is-arguments/-/is-arguments-1.0.4.tgz", - "integrity": "sha512-xPh0Rmt8NE65sNzvyUmWgI1tz3mKq74lGA0mL8LYZcoIzKOzDh6HmrYm3d18k60nHerC8A9Km8kYu87zfSFnLA==", - "dev": true + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/is-arguments/-/is-arguments-1.1.0.tgz", + "integrity": "sha512-1Ij4lOMPl/xB5kBDn7I+b2ttPMKa8szhEIrXDuXQD/oe3HJLTLhqhgGspwgyGd6MOywBUqVvYicF72lkgDnIHg==", + "dev": true, + "requires": { + "call-bind": "^1.0.0" + } }, "is-arrayish": { "version": "0.2.1", @@ -5271,12 +5747,13 @@ "dev": true }, "is-binary-path": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-1.0.1.tgz", - "integrity": "sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=", + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", + "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", "dev": true, + "optional": true, "requires": { - "binary-extensions": "^1.0.0" + "binary-extensions": "^2.0.0" } }, "is-buffer": { @@ -5301,9 +5778,9 @@ } }, "is-core-module": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.1.0.tgz", - "integrity": "sha512-YcV7BgVMRFRua2FqQzKtTDMz8iCuLEyGKjr70q8Zm1yy2qKcurbFEd79PAdHV77oL3NrAaOVQIbMmiHQCHB7ZA==", + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.2.0.tgz", + "integrity": "sha512-XRAfAdyyY5F5cOXn7hYQDqh2Xmii+DEfIcQGxK/uNwMHhIkPWO0g8msXcbzLe+MpGoR951MlqM/2iIlU4vKDdQ==", "dev": true, "requires": { "has": "^1.0.3" @@ -5373,10 +5850,16 @@ "integrity": "sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=", "dev": true }, + "is-finite": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/is-finite/-/is-finite-1.1.0.tgz", + "integrity": "sha512-cdyMtqX/BOqqNBBiKlIVkytNHm49MtMlYyn1zxzvJKWmFMlGzm+ry5BBfYyeY9YmNKbRSo/o7OX9w9ale0wg3w==", + "dev": true + }, "is-fullwidth-code-point": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz", - "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=", + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", + "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==", "dev": true }, "is-generator-fn": { @@ -5394,31 +5877,17 @@ "is-extglob": "^2.1.1" } }, - "is-negative-zero": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/is-negative-zero/-/is-negative-zero-2.0.0.tgz", - "integrity": "sha1-lVOxIbD6wohp2p7UWeIMdUN4hGE=", + "is-number": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", + "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", "dev": true }, - "is-number": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", - "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", - "dev": true, - "requires": { - "kind-of": "^3.0.2" - }, - "dependencies": { - "kind-of": { - "version": "3.2.2", - "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", - "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", - "dev": true, - "requires": { - "is-buffer": "^1.1.5" - } - } - } + "is-obj": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-obj/-/is-obj-2.0.0.tgz", + "integrity": "sha512-drqDG3cbczxxEJRoOXcOjtdp1J/lyp1mNn0xaznRs8+muBhgQcrnbspox5X5fOw0HnMnbfDzvnEMEtqDEJEo8w==", + "dev": true }, "is-path-cwd": { "version": "2.2.0", @@ -5444,6 +5913,12 @@ "path-is-inside": "^1.0.2" } }, + "is-plain-obj": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/is-plain-obj/-/is-plain-obj-1.1.0.tgz", + "integrity": "sha1-caUMhCnfync8kqOQpKA7OfzVHT4=", + "dev": true + }, "is-plain-object": { "version": "2.0.4", "resolved": "https://registry.npmjs.org/is-plain-object/-/is-plain-object-2.0.4.tgz", @@ -5453,12 +5928,6 @@ "isobject": "^3.0.1" } }, - "is-promise": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/is-promise/-/is-promise-2.1.0.tgz", - "integrity": "sha1-eaKp7OfwlugPNtKy87wWwf9L8/o=", - "dev": true - }, "is-regex": { "version": "1.1.1", "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.1.1.tgz", @@ -5466,14 +5935,6 @@ "dev": true, "requires": { "has-symbols": "^1.0.1" - }, - "dependencies": { - "has-symbols": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz", - "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", - "dev": true - } } }, "is-stream": { @@ -5489,14 +5950,15 @@ "dev": true, "requires": { "has-symbols": "^1.0.1" - }, - "dependencies": { - "has-symbols": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz", - "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", - "dev": true - } + } + }, + "is-text-path": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-text-path/-/is-text-path-1.0.1.tgz", + "integrity": "sha1-Thqg+1G/vLPpJogAE5cgLBd1tm4=", + "dev": true, + "requires": { + "text-extensions": "^1.0.0" } }, "is-typedarray": { @@ -5505,6 +5967,12 @@ "integrity": "sha1-5HnICFjfDBsR3dppQPlgEfzaSpo=", "dev": true }, + "is-utf8": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/is-utf8/-/is-utf8-0.2.1.tgz", + "integrity": "sha1-Sw2hRCEE0bM2NA6AeX6GXPOffXI=", + "dev": true + }, "is-windows": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/is-windows/-/is-windows-1.0.2.tgz", @@ -5512,10 +5980,14 @@ "dev": true }, "is-wsl": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-1.1.0.tgz", - "integrity": "sha1-HxbkqiKwTRM2tmGIpmrzxgDDpm0=", - "dev": true + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-2.2.0.tgz", + "integrity": "sha512-fKzAra0rGJUUBwGBgNkHZuToZcn+TtXHpeCgmkMJMMYx1sQDYaCSyjJBSCa2nH1DGm7s3n1oBnohoVTBaN7Lww==", + "dev": true, + "optional": true, + "requires": { + "is-docker": "^2.0.0" + } }, "isarray": { "version": "1.0.0", @@ -5576,15 +6048,6 @@ "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", "dev": true }, - "make-dir": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", - "integrity": "sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==", - "dev": true, - "requires": { - "semver": "^6.0.0" - } - }, "supports-color": { "version": "7.2.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", @@ -5605,14 +6068,6 @@ "debug": "^4.1.1", "istanbul-lib-coverage": "^3.0.0", "source-map": "^0.6.1" - }, - "dependencies": { - "source-map": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", - "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", - "dev": true - } } }, "istanbul-reports": { @@ -5626,144 +6081,16 @@ } }, "jest": { - "version": "25.1.0", - "resolved": "https://registry.npmjs.org/jest/-/jest-25.1.0.tgz", - "integrity": "sha512-FV6jEruneBhokkt9MQk0WUFoNTwnF76CLXtwNMfsc0um0TlB/LG2yxUd0KqaFjEJ9laQmVWQWS0sG/t2GsuI0w==", + "version": "25.5.4", + "resolved": "https://registry.npmjs.org/jest/-/jest-25.5.4.tgz", + "integrity": "sha512-hHFJROBTqZahnO+X+PMtT6G2/ztqAZJveGqz//FnWWHurizkD05PQGzRZOhF3XP6z7SJmL+5tCfW8qV06JypwQ==", "dev": true, "requires": { - "@jest/core": "^25.1.0", + "@jest/core": "^25.5.4", "import-local": "^3.0.2", - "jest-cli": "^25.1.0" + "jest-cli": "^25.5.4" }, "dependencies": { - "@jest/core": { - "version": "25.5.4", - "resolved": "https://registry.npmjs.org/@jest/core/-/core-25.5.4.tgz", - "integrity": "sha512-3uSo7laYxF00Dg/DMgbn4xMJKmDdWvZnf89n8Xj/5/AeQ2dOQmn6b6Hkj/MleyzZWXpwv+WSdYWl4cLsy2JsoA==", - "dev": true, - "requires": { - "@jest/console": "^25.5.0", - "@jest/reporters": "^25.5.1", - "@jest/test-result": "^25.5.0", - "@jest/transform": "^25.5.1", - "@jest/types": "^25.5.0", - "ansi-escapes": "^4.2.1", - "chalk": "^3.0.0", - "exit": "^0.1.2", - "graceful-fs": "^4.2.4", - "jest-changed-files": "^25.5.0", - "jest-config": "^25.5.4", - "jest-haste-map": "^25.5.1", - "jest-message-util": "^25.5.0", - "jest-regex-util": "^25.2.6", - "jest-resolve": "^25.5.1", - "jest-resolve-dependencies": "^25.5.4", - "jest-runner": "^25.5.4", - "jest-runtime": "^25.5.4", - "jest-snapshot": "^25.5.1", - "jest-util": "^25.5.0", - "jest-validate": "^25.5.0", - "jest-watcher": "^25.5.0", - "micromatch": "^4.0.2", - "p-each-series": "^2.1.0", - "realpath-native": "^2.0.0", - "rimraf": "^3.0.0", - "slash": "^3.0.0", - "strip-ansi": "^6.0.0" - }, - "dependencies": { - "@jest/test-result": { - "version": "25.5.0", - "resolved": "https://registry.npmjs.org/@jest/test-result/-/test-result-25.5.0.tgz", - "integrity": "sha512-oV+hPJgXN7IQf/fHWkcS99y0smKLU2czLBJ9WA0jHITLst58HpQMtzSYxzaBvYc6U5U6jfoMthqsUlUlbRXs0A==", - "dev": true, - "requires": { - "@jest/console": "^25.5.0", - "@jest/types": "^25.5.0", - "@types/istanbul-lib-coverage": "^2.0.0", - "collect-v8-coverage": "^1.0.0" - } - }, - "@jest/types": { - "version": "25.5.0", - "resolved": "https://registry.npmjs.org/@jest/types/-/types-25.5.0.tgz", - "integrity": "sha512-OXD0RgQ86Tu3MazKo8bnrkDRaDXXMGUqd+kTtLtK1Zb7CRzQcaSRPPPV37SvYTdevXEBVxe0HXylEjs8ibkmCw==", - "dev": true, - "requires": { - "@types/istanbul-lib-coverage": "^2.0.0", - "@types/istanbul-reports": "^1.1.1", - "@types/yargs": "^15.0.0", - "chalk": "^3.0.0" - } - }, - "exit": { - "version": "0.1.2", - "resolved": "https://registry.npmjs.org/exit/-/exit-0.1.2.tgz", - "integrity": "sha1-BjJjj42HfMghB9MKD/8aF8uhzQw=", - "dev": true - }, - "jest-config": { - "version": "25.5.4", - "resolved": "https://registry.npmjs.org/jest-config/-/jest-config-25.5.4.tgz", - "integrity": "sha512-SZwR91SwcdK6bz7Gco8qL7YY2sx8tFJYzvg216DLihTWf+LKY/DoJXpM9nTzYakSyfblbqeU48p/p7Jzy05Atg==", - "dev": true, - "requires": { - "@babel/core": "^7.1.0", - "@jest/test-sequencer": "^25.5.4", - "@jest/types": "^25.5.0", - "babel-jest": "^25.5.1", - "chalk": "^3.0.0", - "deepmerge": "^4.2.2", - "glob": "^7.1.1", - "graceful-fs": "^4.2.4", - "jest-environment-jsdom": "^25.5.0", - "jest-environment-node": "^25.5.0", - "jest-get-type": "^25.2.6", - "jest-jasmine2": "^25.5.4", - "jest-regex-util": "^25.2.6", - "jest-resolve": "^25.5.1", - "jest-util": "^25.5.0", - "jest-validate": "^25.5.0", - "micromatch": "^4.0.2", - "pretty-format": "^25.5.0", - "realpath-native": "^2.0.0" - } - }, - "jest-util": { - "version": "25.5.0", - "resolved": "https://registry.npmjs.org/jest-util/-/jest-util-25.5.0.tgz", - "integrity": "sha512-KVlX+WWg1zUTB9ktvhsg2PXZVdkI1NBevOJSkTKYAyXyH4QSvh+Lay/e/v+bmaFfrkfx43xD8QTfgobzlEXdIA==", - "dev": true, - "requires": { - "@jest/types": "^25.5.0", - "chalk": "^3.0.0", - "graceful-fs": "^4.2.4", - "is-ci": "^2.0.0", - "make-dir": "^3.0.0" - } - }, - "jest-validate": { - "version": "25.5.0", - "resolved": "https://registry.npmjs.org/jest-validate/-/jest-validate-25.5.0.tgz", - "integrity": "sha512-okUFKqhZIpo3jDdtUXUZ2LxGUZJIlfdYBvZb1aczzxrlyMlqdnnws9MOxezoLGhSaFc2XYaHNReNQfj5zPIWyQ==", - "dev": true, - "requires": { - "@jest/types": "^25.5.0", - "camelcase": "^5.3.1", - "chalk": "^3.0.0", - "jest-get-type": "^25.2.6", - "leven": "^3.1.0", - "pretty-format": "^25.5.0" - } - }, - "realpath-native": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/realpath-native/-/realpath-native-2.0.0.tgz", - "integrity": "sha512-v1SEYUOXXdbBZK8ZuNgO4TBjamPsiSgcFr0aP+tEKpQZK8vooEUqV6nm6Cv502mX4NF2EfsnVqtNAHG+/6Ur1Q==", - "dev": true - } - } - }, "ansi-styles": { "version": "4.3.0", "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", @@ -5773,21 +6100,6 @@ "color-convert": "^2.0.1" } }, - "braces": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", - "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", - "dev": true, - "requires": { - "fill-range": "^7.0.1" - } - }, - "camelcase": { - "version": "5.3.1", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", - "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", - "dev": true - }, "chalk": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/chalk/-/chalk-3.0.0.tgz", @@ -5798,17 +6110,6 @@ "supports-color": "^7.1.0" } }, - "cliui": { - "version": "6.0.0", - "resolved": "https://registry.npmjs.org/cliui/-/cliui-6.0.0.tgz", - "integrity": "sha512-t6wbgtoCXvAzst7QgXxJYqPt0usEfbgQdftEPbLL/cvv6HPE5VgvqCuAIDR0NgU52ds6rFwqrgakNLrHEjCbrQ==", - "dev": true, - "requires": { - "string-width": "^4.2.0", - "strip-ansi": "^6.0.0", - "wrap-ansi": "^6.2.0" - } - }, "color-convert": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", @@ -5824,59 +6125,12 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, - "fill-range": { - "version": "7.0.1", - "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", - "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", - "dev": true, - "requires": { - "to-regex-range": "^5.0.1" - } - }, - "find-up": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", - "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", - "dev": true, - "requires": { - "locate-path": "^5.0.0", - "path-exists": "^4.0.0" - } - }, - "get-caller-file": { - "version": "2.0.5", - "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz", - "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==", - "dev": true - }, - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", "dev": true }, - "import-local": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/import-local/-/import-local-3.0.2.tgz", - "integrity": "sha512-vjL3+w0oulAVZ0hBHnxa/Nm5TAurf9YLQJDhqRZyqb+VKGOB6LU8t9H1Nr5CIo16vh9XfJTOoHwU0B71S557gA==", - "dev": true, - "requires": { - "pkg-dir": "^4.2.0", - "resolve-cwd": "^3.0.0" - } - }, - "is-number": { - "version": "7.0.0", - "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", - "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", - "dev": true - }, "jest-cli": { "version": "25.5.4", "resolved": "https://registry.npmjs.org/jest-cli/-/jest-cli-25.5.4.tgz", @@ -5897,124 +6151,6 @@ "prompts": "^2.0.1", "realpath-native": "^2.0.0", "yargs": "^15.3.1" - }, - "dependencies": { - "prompts": { - "version": "2.4.0", - "resolved": "https://registry.npmjs.org/prompts/-/prompts-2.4.0.tgz", - "integrity": "sha512-awZAKrk3vN6CroQukBL+R9051a4R3zCZBlJm/HBfrSZ8iTpYix3VX1vU4mveiLpiwmOJT4wokTF9m6HUk4KqWQ==", - "dev": true, - "requires": { - "kleur": "^3.0.3", - "sisteransi": "^1.0.5" - } - } - } - }, - "locate-path": { - "version": "5.0.0", - "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-5.0.0.tgz", - "integrity": "sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==", - "dev": true, - "requires": { - "p-locate": "^4.1.0" - } - }, - "make-dir": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", - "integrity": "sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==", - "dev": true, - "requires": { - "semver": "^6.0.0" - } - }, - "micromatch": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.2.tgz", - "integrity": "sha512-y7FpHSbMUMoyPbYUSzO6PaZ6FyRnQOpHuKwbo1G+Knck95XVU4QAiKdGEnj5wwoS7PlOgthX/09u5iFJ+aYf5Q==", - "dev": true, - "requires": { - "braces": "^3.0.1", - "picomatch": "^2.0.5" - } - }, - "p-limit": { - "version": "2.2.2", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.2.2.tgz", - "integrity": "sha512-WGR+xHecKTr7EbUEhyLSh5Dube9JtdiG78ufaeLxTgpudf/20KqyMioIUZJAezlTIi6evxuoUs9YXc11cU+yzQ==", - "dev": true, - "requires": { - "p-try": "^2.0.0" - } - }, - "p-locate": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-4.1.0.tgz", - "integrity": "sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==", - "dev": true, - "requires": { - "p-limit": "^2.2.0" - } - }, - "p-try": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", - "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", - "dev": true - }, - "path-exists": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", - "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", - "dev": true - }, - "pkg-dir": { - "version": "4.2.0", - "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-4.2.0.tgz", - "integrity": "sha512-HRDzbaKjC+AOWVXxAU/x54COGeIv9eb+6CkDSQoNTt4XyWoIJvuPsXizxu/Fr23EiekbtZwmh1IcIG/l/a10GQ==", - "dev": true, - "requires": { - "find-up": "^4.0.0" - } - }, - "require-main-filename": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", - "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==", - "dev": true - }, - "resolve-cwd": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/resolve-cwd/-/resolve-cwd-3.0.0.tgz", - "integrity": "sha512-OrZaX2Mb+rJCpH/6CpSqt9xFVpN++x01XnN2ie9g6P5/3xelLAkXWVADpdz1IHD/KFfEXyE6V0U01OQ3UO2rEg==", - "dev": true, - "requires": { - "resolve-from": "^5.0.0" - } - }, - "resolve-from": { - "version": "5.0.0", - "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-5.0.0.tgz", - "integrity": "sha512-qYg9KP24dD5qka9J47d0aVky0N+b4fTU89LN9iDnjB5waksiC49rvMB0PrUJQGoTmH50XPiqOvAjDfaijGxYZw==", - "dev": true - }, - "rimraf": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz", - "integrity": "sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==", - "dev": true, - "requires": { - "glob": "^7.1.3" - } - }, - "strip-ansi": { - "version": "6.0.0", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", - "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", - "dev": true, - "requires": { - "ansi-regex": "^5.0.0" } }, "supports-color": { @@ -6025,67 +6161,6 @@ "requires": { "has-flag": "^4.0.0" } - }, - "to-regex-range": { - "version": "5.0.1", - "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", - "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", - "dev": true, - "requires": { - "is-number": "^7.0.0" - } - }, - "which-module": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz", - "integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho=", - "dev": true - }, - "wrap-ansi": { - "version": "6.2.0", - "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-6.2.0.tgz", - "integrity": "sha512-r6lPcBGxZXlIcymEu7InxDMhdW0KDxpLgoFLcguasxCaJ/SOIZwINatK9KY/tf+ZrlywOKU0UDj3ATXUBfxJXA==", - "dev": true, - "requires": { - "ansi-styles": "^4.0.0", - "string-width": "^4.1.0", - "strip-ansi": "^6.0.0" - } - }, - "y18n": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz", - "integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==", - "dev": true - }, - "yargs": { - "version": "15.4.1", - "resolved": "https://registry.npmjs.org/yargs/-/yargs-15.4.1.tgz", - "integrity": "sha512-aePbxDmcYW++PaqBsJ+HYUFwCdv4LVvdnhBy78E57PIor8/OVvhMrADFFEDh8DHDFRv/O9i3lPhsENjO7QX0+A==", - "dev": true, - "requires": { - "cliui": "^6.0.0", - "decamelize": "^1.2.0", - "find-up": "^4.1.0", - "get-caller-file": "^2.0.1", - "require-directory": "^2.1.1", - "require-main-filename": "^2.0.0", - "set-blocking": "^2.0.0", - "string-width": "^4.2.0", - "which-module": "^2.0.0", - "y18n": "^4.0.0", - "yargs-parser": "^18.1.2" - } - }, - "yargs-parser": { - "version": "18.1.3", - "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-18.1.3.tgz", - "integrity": "sha512-o50j0JeToy/4K6OZcaQmW6lyXXKhq7csREXcDwk2omFPJEwUNOVtJKvmDr9EI1fAJZUyZcRF7kxGBWmRXudrCQ==", - "dev": true, - "requires": { - "camelcase": "^5.0.0", - "decamelize": "^1.2.0" - } } } }, @@ -6165,16 +6240,6 @@ "integrity": "sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==", "dev": true }, - "pump": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz", - "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", - "dev": true, - "requires": { - "end-of-stream": "^1.1.0", - "once": "^1.3.1" - } - }, "shebang-command": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-2.0.0.tgz", @@ -6237,15 +6302,6 @@ "color-convert": "^2.0.1" } }, - "braces": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", - "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", - "dev": true, - "requires": { - "fill-range": "^7.0.1" - } - }, "chalk": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/chalk/-/chalk-3.0.0.tgz", @@ -6271,43 +6327,12 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, - "fill-range": { - "version": "7.0.1", - "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", - "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", - "dev": true, - "requires": { - "to-regex-range": "^5.0.1" - } - }, - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", "dev": true }, - "is-number": { - "version": "7.0.0", - "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", - "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", - "dev": true - }, - "micromatch": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.2.tgz", - "integrity": "sha512-y7FpHSbMUMoyPbYUSzO6PaZ6FyRnQOpHuKwbo1G+Knck95XVU4QAiKdGEnj5wwoS7PlOgthX/09u5iFJ+aYf5Q==", - "dev": true, - "requires": { - "braces": "^3.0.1", - "picomatch": "^2.0.5" - } - }, "supports-color": { "version": "7.2.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", @@ -6316,15 +6341,6 @@ "requires": { "has-flag": "^4.0.0" } - }, - "to-regex-range": { - "version": "5.0.1", - "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", - "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", - "dev": true, - "requires": { - "is-number": "^7.0.0" - } } } }, @@ -6519,59 +6535,12 @@ "which": "^2.0.2" }, "dependencies": { - "anymatch": { - "version": "3.1.1", - "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.1.tgz", - "integrity": "sha512-mM8522psRCqzV+6LhomX5wgp25YVibjh8Wj23I5RPkPppSVSjyKD2A2mBJmWGa+KN7f2D6LNh9jkBCeyLktzjg==", - "dev": true, - "requires": { - "normalize-path": "^3.0.0", - "picomatch": "^2.0.4" - } - }, - "braces": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", - "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", - "dev": true, - "requires": { - "fill-range": "^7.0.1" - } - }, - "fill-range": { - "version": "7.0.1", - "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", - "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", - "dev": true, - "requires": { - "to-regex-range": "^5.0.1" - } - }, - "fsevents": { - "version": "2.2.1", - "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.2.1.tgz", - "integrity": "sha512-bTLYHSeC0UH/EFXS9KqWnXuOl/wHK5Z/d+ghd5AsFMYN7wIGkUCOJyzy88+wJKkZPGON8u4Z9f6U4FdgURE9qA==", - "dev": true, - "optional": true - }, - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", "dev": true }, - "is-number": { - "version": "7.0.0", - "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", - "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", - "dev": true - }, "jest-worker": { "version": "25.5.0", "resolved": "https://registry.npmjs.org/jest-worker/-/jest-worker-25.5.0.tgz", @@ -6582,22 +6551,6 @@ "supports-color": "^7.0.0" } }, - "micromatch": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.2.tgz", - "integrity": "sha512-y7FpHSbMUMoyPbYUSzO6PaZ6FyRnQOpHuKwbo1G+Knck95XVU4QAiKdGEnj5wwoS7PlOgthX/09u5iFJ+aYf5Q==", - "dev": true, - "requires": { - "braces": "^3.0.1", - "picomatch": "^2.0.5" - } - }, - "normalize-path": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", - "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", - "dev": true - }, "supports-color": { "version": "7.2.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", @@ -6607,15 +6560,6 @@ "has-flag": "^4.0.0" } }, - "to-regex-range": { - "version": "5.0.1", - "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", - "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", - "dev": true, - "requires": { - "is-number": "^7.0.0" - } - }, "which": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/which/-/which-2.0.2.tgz", @@ -6801,15 +6745,6 @@ "color-convert": "^2.0.1" } }, - "braces": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", - "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", - "dev": true, - "requires": { - "fill-range": "^7.0.1" - } - }, "chalk": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/chalk/-/chalk-3.0.0.tgz", @@ -6835,43 +6770,12 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, - "fill-range": { - "version": "7.0.1", - "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", - "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", - "dev": true, - "requires": { - "to-regex-range": "^5.0.1" - } - }, - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", "dev": true }, - "is-number": { - "version": "7.0.0", - "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", - "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", - "dev": true - }, - "micromatch": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.2.tgz", - "integrity": "sha512-y7FpHSbMUMoyPbYUSzO6PaZ6FyRnQOpHuKwbo1G+Knck95XVU4QAiKdGEnj5wwoS7PlOgthX/09u5iFJ+aYf5Q==", - "dev": true, - "requires": { - "braces": "^3.0.1", - "picomatch": "^2.0.5" - } - }, "supports-color": { "version": "7.2.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", @@ -6880,15 +6784,6 @@ "requires": { "has-flag": "^4.0.0" } - }, - "to-regex-range": { - "version": "5.0.1", - "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", - "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", - "dev": true, - "requires": { - "is-number": "^7.0.0" - } } } }, @@ -6964,79 +6859,30 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, - "find-up": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", - "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", - "dev": true, - "requires": { - "locate-path": "^5.0.0", - "path-exists": "^4.0.0" - } - }, - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", "dev": true }, - "locate-path": { - "version": "5.0.0", - "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-5.0.0.tgz", - "integrity": "sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==", - "dev": true, - "requires": { - "p-locate": "^4.1.0" - } - }, - "p-limit": { - "version": "2.3.0", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.3.0.tgz", - "integrity": "sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==", - "dev": true, - "requires": { - "p-try": "^2.0.0" - } - }, - "p-locate": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-4.1.0.tgz", - "integrity": "sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==", - "dev": true, - "requires": { - "p-limit": "^2.2.0" - } - }, - "p-try": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", - "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", + "hosted-git-info": { + "version": "2.8.8", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", + "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==", "dev": true }, - "parse-json": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-5.1.0.tgz", - "integrity": "sha512-+mi/lmVVNKFNVyLXV31ERiy2CY5E1/F6QtJFEzoChPRwwngMNXRDQ9GJ5WdE2Z2P4AujsOi0/+2qHID68KwfIQ==", + "normalize-package-data": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", + "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", "dev": true, "requires": { - "@babel/code-frame": "^7.0.0", - "error-ex": "^1.3.1", - "json-parse-even-better-errors": "^2.3.0", - "lines-and-columns": "^1.1.6" + "hosted-git-info": "^2.1.4", + "resolve": "^1.10.0", + "semver": "2 || 3 || 4 || 5", + "validate-npm-package-license": "^3.0.1" } }, - "path-exists": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", - "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", - "dev": true - }, "read-pkg": { "version": "5.2.0", "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-5.2.0.tgz", @@ -7068,15 +6914,11 @@ "type-fest": "^0.8.1" } }, - "resolve": { - "version": "1.19.0", - "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.19.0.tgz", - "integrity": "sha512-rArEXAgsBG4UgRGcynxWIWKFvh/XZCcS8UJdHhwy91zwAvCZIbcs+vAbflgBnNjYMs/i/i+/Ux6IZhML1yPvxg==", - "dev": true, - "requires": { - "is-core-module": "^2.1.0", - "path-parse": "^1.0.6" - } + "semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "dev": true }, "supports-color": { "version": "7.2.0", @@ -7086,6 +6928,12 @@ "requires": { "has-flag": "^4.0.0" } + }, + "type-fest": { + "version": "0.8.1", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.8.1.tgz", + "integrity": "sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==", + "dev": true } } }, @@ -7161,12 +7009,6 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", @@ -7237,12 +7079,6 @@ "color-convert": "^2.0.1" } }, - "camelcase": { - "version": "5.3.1", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", - "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", - "dev": true - }, "chalk": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/chalk/-/chalk-3.0.0.tgz", @@ -7253,17 +7089,6 @@ "supports-color": "^7.1.0" } }, - "cliui": { - "version": "6.0.0", - "resolved": "https://registry.npmjs.org/cliui/-/cliui-6.0.0.tgz", - "integrity": "sha512-t6wbgtoCXvAzst7QgXxJYqPt0usEfbgQdftEPbLL/cvv6HPE5VgvqCuAIDR0NgU52ds6rFwqrgakNLrHEjCbrQ==", - "dev": true, - "requires": { - "string-width": "^4.2.0", - "strip-ansi": "^6.0.0", - "wrap-ansi": "^6.2.0" - } - }, "color-convert": { "version": "2.0.1", "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", @@ -7279,88 +7104,12 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, - "find-up": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", - "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", - "dev": true, - "requires": { - "locate-path": "^5.0.0", - "path-exists": "^4.0.0" - } - }, - "get-caller-file": { - "version": "2.0.5", - "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz", - "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==", - "dev": true - }, - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", "dev": true }, - "locate-path": { - "version": "5.0.0", - "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-5.0.0.tgz", - "integrity": "sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==", - "dev": true, - "requires": { - "p-locate": "^4.1.0" - } - }, - "p-limit": { - "version": "2.3.0", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.3.0.tgz", - "integrity": "sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==", - "dev": true, - "requires": { - "p-try": "^2.0.0" - } - }, - "p-locate": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-4.1.0.tgz", - "integrity": "sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==", - "dev": true, - "requires": { - "p-limit": "^2.2.0" - } - }, - "p-try": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", - "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", - "dev": true - }, - "path-exists": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", - "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", - "dev": true - }, - "require-main-filename": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", - "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==", - "dev": true - }, - "strip-ansi": { - "version": "6.0.0", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", - "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", - "dev": true, - "requires": { - "ansi-regex": "^5.0.0" - } - }, "strip-bom": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-4.0.0.tgz", @@ -7375,58 +7124,6 @@ "requires": { "has-flag": "^4.0.0" } - }, - "which-module": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz", - "integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho=", - "dev": true - }, - "wrap-ansi": { - "version": "6.2.0", - "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-6.2.0.tgz", - "integrity": "sha512-r6lPcBGxZXlIcymEu7InxDMhdW0KDxpLgoFLcguasxCaJ/SOIZwINatK9KY/tf+ZrlywOKU0UDj3ATXUBfxJXA==", - "dev": true, - "requires": { - "ansi-styles": "^4.0.0", - "string-width": "^4.1.0", - "strip-ansi": "^6.0.0" - } - }, - "y18n": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz", - "integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==", - "dev": true - }, - "yargs": { - "version": "15.4.1", - "resolved": "https://registry.npmjs.org/yargs/-/yargs-15.4.1.tgz", - "integrity": "sha512-aePbxDmcYW++PaqBsJ+HYUFwCdv4LVvdnhBy78E57PIor8/OVvhMrADFFEDh8DHDFRv/O9i3lPhsENjO7QX0+A==", - "dev": true, - "requires": { - "cliui": "^6.0.0", - "decamelize": "^1.2.0", - "find-up": "^4.1.0", - "get-caller-file": "^2.0.1", - "require-directory": "^2.1.1", - "require-main-filename": "^2.0.0", - "set-blocking": "^2.0.0", - "string-width": "^4.2.0", - "which-module": "^2.0.0", - "y18n": "^4.0.0", - "yargs-parser": "^18.1.2" - } - }, - "yargs-parser": { - "version": "18.1.3", - "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-18.1.3.tgz", - "integrity": "sha512-o50j0JeToy/4K6OZcaQmW6lyXXKhq7csREXcDwk2omFPJEwUNOVtJKvmDr9EI1fAJZUyZcRF7kxGBWmRXudrCQ==", - "dev": true, - "requires": { - "camelcase": "^5.0.0", - "decamelize": "^1.2.0" - } } } }, @@ -7437,14 +7134,6 @@ "dev": true, "requires": { "graceful-fs": "^4.2.4" - }, - "dependencies": { - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - } } }, "jest-snapshot": { @@ -7504,27 +7193,12 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", "dev": true }, - "make-dir": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", - "integrity": "sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==", - "dev": true, - "requires": { - "semver": "^6.0.0" - } - }, "supports-color": { "version": "7.2.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", @@ -7583,27 +7257,12 @@ "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", "dev": true }, - "graceful-fs": { - "version": "4.2.4", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", - "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==", - "dev": true - }, "has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", "dev": true }, - "make-dir": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", - "integrity": "sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==", - "dev": true, - "requires": { - "semver": "^6.0.0" - } - }, "supports-color": { "version": "7.2.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", @@ -7638,12 +7297,6 @@ "color-convert": "^2.0.1" } }, - "camelcase": { - "version": "5.3.1", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", - "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", - "dev": true - }, "chalk": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/chalk/-/chalk-3.0.0.tgz", @@ -7779,9 +7432,9 @@ "dev": true }, "js-yaml": { - "version": "3.13.1", - "resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-3.13.1.tgz", - "integrity": "sha512-YfbcO7jXDdyj0DGxYVSlSeQNHbD7XPWvrVWeVUujrQEoZzWJIRrCPoyk6kL6IAjAG2IolMK4T0hNUe0HOUs5Jw==", + "version": "3.14.1", + "resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-3.14.1.tgz", + "integrity": "sha512-okMH7OXXJ7YrN9Ok3/SXrnu4iX9yOk+25nqX4imS2npuvTYDmo/QEZoqwZkYaIDk3jVvBOTOIEgEhaLOynBS9g==", "dev": true, "requires": { "argparse": "^1.0.7", @@ -7889,16 +7542,14 @@ "dev": true, "requires": { "minimist": "^1.2.5" - }, - "dependencies": { - "minimist": { - "version": "1.2.5", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", - "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==", - "dev": true - } } }, + "jsonparse": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/jsonparse/-/jsonparse-1.3.1.tgz", + "integrity": "sha1-P02uSpH6wxX3EGL4UhzCOfE2YoA=", + "dev": true + }, "jsprim": { "version": "1.4.1", "resolved": "https://registry.npmjs.org/jsprim/-/jsprim-1.4.1.tgz", @@ -7951,6 +7602,30 @@ "integrity": "sha1-HADHQ7QzzQpOgHWPe2SldEDZ/wA=", "dev": true }, + "load-json-file": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-1.1.0.tgz", + "integrity": "sha1-lWkFcI1YtLq0wiYbBPWfMcmTdMA=", + "dev": true, + "requires": { + "graceful-fs": "^4.1.2", + "parse-json": "^2.2.0", + "pify": "^2.0.0", + "pinkie-promise": "^2.0.0", + "strip-bom": "^2.0.0" + }, + "dependencies": { + "parse-json": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-2.2.0.tgz", + "integrity": "sha1-9ID0BDTvgHQfhGkJn43qGPVaTck=", + "dev": true, + "requires": { + "error-ex": "^1.2.0" + } + } + } + }, "loader-runner": { "version": "2.4.0", "resolved": "https://registry.npmjs.org/loader-runner/-/loader-runner-2.4.0.tgz", @@ -7994,16 +7669,47 @@ "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==", "dev": true }, + "lodash._reinterpolate": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/lodash._reinterpolate/-/lodash._reinterpolate-3.0.0.tgz", + "integrity": "sha1-DM8tiRZq8Ds2Y8eWU4t1rG4RTZ0=", + "dev": true + }, + "lodash.ismatch": { + "version": "4.4.0", + "resolved": "https://registry.npmjs.org/lodash.ismatch/-/lodash.ismatch-4.4.0.tgz", + "integrity": "sha1-dWy1FQyjum8RCFp4hJZF8Yj4Xzc=", + "dev": true + }, "lodash.sortby": { "version": "4.7.0", "resolved": "https://registry.npmjs.org/lodash.sortby/-/lodash.sortby-4.7.0.tgz", "integrity": "sha1-7dFMgk4sycHgsKG0K7UhBRakJDg=", "dev": true }, + "lodash.template": { + "version": "4.5.0", + "resolved": "https://registry.npmjs.org/lodash.template/-/lodash.template-4.5.0.tgz", + "integrity": "sha512-84vYFxIkmidUiFxidA/KjjH9pAycqW+h980j7Fuz5qxRtO9pgB7MDFTdys1N7A5mcucRiDyEq4fusljItR1T/A==", + "dev": true, + "requires": { + "lodash._reinterpolate": "^3.0.0", + "lodash.templatesettings": "^4.0.0" + } + }, + "lodash.templatesettings": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/lodash.templatesettings/-/lodash.templatesettings-4.2.0.tgz", + "integrity": "sha512-stgLz+i3Aa9mZgnjr/O+v9ruKZsPsndy7qPZOchbqk2cnTU1ZaldKK+v7m54WoKIyxiuMZTKT2H81F8BeAc3ZQ==", + "dev": true, + "requires": { + "lodash._reinterpolate": "^3.0.0" + } + }, "loglevel": { - "version": "1.7.0", - "resolved": "https://registry.npmjs.org/loglevel/-/loglevel-1.7.0.tgz", - "integrity": "sha512-i2sY04nal5jDcagM3FMfG++T69GEEM8CYuOfeOIvmXzOIcwE9a/CJPR0MFM97pYMj/u10lzz7/zd7+qwhrBTqQ==", + "version": "1.7.1", + "resolved": "https://registry.npmjs.org/loglevel/-/loglevel-1.7.1.tgz", + "integrity": "sha512-Hesni4s5UkWkwCGJMQGAh71PaLUmKFM60dHvq0zi/vDhhrzuk+4GgNbTXJ12YYQJn6ZKBDNIjYcuQGKudvqrIw==", "dev": true }, "lolex": { @@ -8015,28 +7721,32 @@ "@sinonjs/commons": "^1.7.0" } }, - "make-dir": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-2.1.0.tgz", - "integrity": "sha512-LS9X+dc8KLxXCb8dni79fLIIUA5VyZoyjSMCwTluaXA0o27cCK0bhXkpgw+sTXVpPy/lSO57ilRixqk0vDmtRA==", + "loud-rejection": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/loud-rejection/-/loud-rejection-1.6.0.tgz", + "integrity": "sha1-W0b4AUft7leIcPCG0Eghz5mOVR8=", "dev": true, "requires": { - "pify": "^4.0.1", - "semver": "^5.6.0" - }, - "dependencies": { - "pify": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/pify/-/pify-4.0.1.tgz", - "integrity": "sha512-uB80kBFb/tfd68bVleG9T5GGsGPjJrLAUpR5PZIrhBnIaRTQRjqdJSsIKkOP6OAIFbj7GOrcudc5pNjZ+geV2g==", - "dev": true - }, - "semver": { - "version": "5.7.1", - "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", - "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", - "dev": true - } + "currently-unhandled": "^0.4.1", + "signal-exit": "^3.0.0" + } + }, + "lru-cache": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-6.0.0.tgz", + "integrity": "sha512-Jo6dJ04CmSjuznwJSS3pUeWmd/H0ffTlkXXgwZi+eq1UCmqQwCh+eLsYOYCwY991i2Fah4h1BEMCx4qThGbsiA==", + "dev": true, + "requires": { + "yallist": "^4.0.0" + } + }, + "make-dir": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", + "integrity": "sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==", + "dev": true, + "requires": { + "semver": "^6.0.0" } }, "makeerror": { @@ -8048,21 +7758,18 @@ "tmpl": "1.0.x" } }, - "map-age-cleaner": { - "version": "0.1.3", - "resolved": "https://registry.npmjs.org/map-age-cleaner/-/map-age-cleaner-0.1.3.tgz", - "integrity": "sha512-bJzx6nMoP6PDLPBFmg7+xRKeFZvFboMrGlxmNj9ClvX53KrmvM5bXFXEWjbz4cz1AFn+jWJ9z/DJSz7hrs0w3w==", - "dev": true, - "requires": { - "p-defer": "^1.0.0" - } - }, "map-cache": { "version": "0.2.2", "resolved": "https://registry.npmjs.org/map-cache/-/map-cache-0.2.2.tgz", "integrity": "sha1-wyq9C9ZSXZsFFkW7TyasXcmKDb8=", "dev": true }, + "map-obj": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-4.1.0.tgz", + "integrity": "sha512-glc9y00wgtwcDmp7GaE/0b0OnxpNJsVf3ael/An6Fe2Q51LLwN1er6sdomLRzz5h0+yMpiYLhWYF5R7HeqVd4g==", + "dev": true + }, "map-visit": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/map-visit/-/map-visit-1.0.0.tgz", @@ -8089,17 +7796,6 @@ "integrity": "sha1-hxDXrwqmJvj/+hzgAWhUUmMlV0g=", "dev": true }, - "mem": { - "version": "4.3.0", - "resolved": "https://registry.npmjs.org/mem/-/mem-4.3.0.tgz", - "integrity": "sha512-qX2bG48pTqYRVmDB37rn/6PT7LcR8T7oAX3bf99u1Tt1nzxYfxkgqDwUwolPlXweM0XzBOBFzSx4kfp7KP1s/w==", - "dev": true, - "requires": { - "map-age-cleaner": "^0.1.1", - "mimic-fn": "^2.0.0", - "p-is-promise": "^2.0.0" - } - }, "memory-fs": { "version": "0.4.1", "resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.4.1.tgz", @@ -8108,6 +7804,122 @@ "requires": { "errno": "^0.1.3", "readable-stream": "^2.0.1" + }, + "dependencies": { + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + } + } + }, + "meow": { + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/meow/-/meow-8.0.0.tgz", + "integrity": "sha512-nbsTRz2fwniJBFgUkcdISq8y/q9n9VbiHYbfwklFh5V4V2uAcxtKQkDc0yCLPM/kP0d+inZBewn3zJqewHE7kg==", + "dev": true, + "requires": { + "@types/minimist": "^1.2.0", + "camelcase-keys": "^6.2.2", + "decamelize-keys": "^1.1.0", + "hard-rejection": "^2.1.0", + "minimist-options": "4.1.0", + "normalize-package-data": "^3.0.0", + "read-pkg-up": "^7.0.1", + "redent": "^3.0.0", + "trim-newlines": "^3.0.0", + "type-fest": "^0.18.0", + "yargs-parser": "^20.2.3" + }, + "dependencies": { + "hosted-git-info": { + "version": "2.8.8", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", + "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==", + "dev": true + }, + "read-pkg": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-5.2.0.tgz", + "integrity": "sha512-Ug69mNOpfvKDAc2Q8DRpMjjzdtrnv9HcSMX+4VsZxD1aZ6ZzrIE7rlzXBtWTyhULSMKg076AW6WR5iZpD0JiOg==", + "dev": true, + "requires": { + "@types/normalize-package-data": "^2.4.0", + "normalize-package-data": "^2.5.0", + "parse-json": "^5.0.0", + "type-fest": "^0.6.0" + }, + "dependencies": { + "normalize-package-data": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", + "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", + "dev": true, + "requires": { + "hosted-git-info": "^2.1.4", + "resolve": "^1.10.0", + "semver": "2 || 3 || 4 || 5", + "validate-npm-package-license": "^3.0.1" + } + }, + "type-fest": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.6.0.tgz", + "integrity": "sha512-q+MB8nYR1KDLrgr4G5yemftpMC7/QLqVndBmEEdqzmNj5dcFOO4Oo8qlwZE3ULT3+Zim1F8Kq4cBnikNhlCMlg==", + "dev": true + } + } + }, + "read-pkg-up": { + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-7.0.1.tgz", + "integrity": "sha512-zK0TB7Xd6JpCLmlLmufqykGE+/TlOePD6qKClNW7hHDKFh/J7/7gCWGR7joEQEW1bKq3a3yUZSObOoWLFQ4ohg==", + "dev": true, + "requires": { + "find-up": "^4.1.0", + "read-pkg": "^5.2.0", + "type-fest": "^0.8.1" + }, + "dependencies": { + "type-fest": { + "version": "0.8.1", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.8.1.tgz", + "integrity": "sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==", + "dev": true + } + } + }, + "semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "dev": true + } } }, "merge-descriptors": { @@ -8129,24 +7941,13 @@ "dev": true }, "micromatch": { - "version": "3.1.10", - "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz", - "integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==", + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.2.tgz", + "integrity": "sha512-y7FpHSbMUMoyPbYUSzO6PaZ6FyRnQOpHuKwbo1G+Knck95XVU4QAiKdGEnj5wwoS7PlOgthX/09u5iFJ+aYf5Q==", "dev": true, "requires": { - "arr-diff": "^4.0.0", - "array-unique": "^0.3.2", - "braces": "^2.3.1", - "define-property": "^2.0.2", - "extend-shallow": "^3.0.2", - "extglob": "^2.0.4", - "fragment-cache": "^0.2.1", - "kind-of": "^6.0.2", - "nanomatch": "^1.2.9", - "object.pick": "^1.3.0", - "regex-not": "^1.0.0", - "snapdragon": "^0.8.1", - "to-regex": "^3.0.2" + "braces": "^3.0.1", + "picomatch": "^2.0.5" } }, "miller-rabin": { @@ -8174,18 +7975,18 @@ "dev": true }, "mime-db": { - "version": "1.40.0", - "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.40.0.tgz", - "integrity": "sha512-jYdeOMPy9vnxEqFRRo6ZvTZ8d9oPb+k18PKoYNYUe2stVEBPPwsln/qWzdbmaIvnhZ9v2P+CuecK+fpUfsV2mA==", + "version": "1.44.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.44.0.tgz", + "integrity": "sha512-/NOTfLrsPBVeH7YtFPgsVWveuL+4SjjYxaQ1xtM1KMFj7HdxlBlxeyNLzhyJVx7r4rZGJAZ/6lkKCitSc/Nmpg==", "dev": true }, "mime-types": { - "version": "2.1.24", - "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.24.tgz", - "integrity": "sha512-WaFHS3MCl5fapm3oLxU4eYDw77IQM2ACcxQ9RIxfaC3ooc6PFuBMGZZsYpvoXS5D5QTWPieo1jjLdAm3TBP3cQ==", + "version": "2.1.27", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.27.tgz", + "integrity": "sha512-JIhqnCasI9yD+SsmkquHBxTSEuZdQX5BuQnS2Vc7puQQQ+8yiP5AY5uWhpdv4YL4VM5c6iliiYWPgJ/nJQLp7w==", "dev": true, "requires": { - "mime-db": "1.40.0" + "mime-db": "1.44.0" } }, "mimic-fn": { @@ -8194,6 +7995,12 @@ "integrity": "sha512-OqbOk5oEQeAZ8WXWydlu9HJjz9WVdEIvamMCcXmuqUYjTknH/sqsWvhQ3vgwKFRR1HpjvNBKQ37nbJgYzGqGcg==", "dev": true }, + "min-indent": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/min-indent/-/min-indent-1.0.1.tgz", + "integrity": "sha512-I9jwMn07Sy/IwOj3zVkVik2JTvgpaykDZEigL6Rx6N9LbMywwUSMtxET+7lVoDLLd3O3IXwJwvuuns8UB/HeAg==", + "dev": true + }, "minimalistic-assert": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz", @@ -8221,6 +8028,17 @@ "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==", "dev": true }, + "minimist-options": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/minimist-options/-/minimist-options-4.1.0.tgz", + "integrity": "sha512-Q4r8ghd80yhO/0j1O3B2BjweX3fiHg9cdOwjJd2J76Q135c+NDxGCqdYKQ1SKBuFfgWbAUzBfvYjPUEeNgqN1A==", + "dev": true, + "requires": { + "arrify": "^1.0.1", + "is-plain-obj": "^1.1.0", + "kind-of": "^6.0.3" + } + }, "mississippi": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/mississippi/-/mississippi-3.0.0.tgz", @@ -8239,14 +8057,44 @@ "through2": "^2.0.0" }, "dependencies": { - "pump": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz", - "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", "dev": true, "requires": { - "end-of-stream": "^1.1.0", - "once": "^1.3.1" + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + }, + "through2": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/through2/-/through2-2.0.5.tgz", + "integrity": "sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ==", + "dev": true, + "requires": { + "readable-stream": "~2.3.6", + "xtend": "~4.0.1" } } } @@ -8279,14 +8127,6 @@ "dev": true, "requires": { "minimist": "^1.2.5" - }, - "dependencies": { - "minimist": { - "version": "1.2.5", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", - "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==", - "dev": true - } } }, "mkdirp-classic": { @@ -8295,6 +8135,12 @@ "integrity": "sha512-gKLcREMhtuZRwRAfqP3RFW+TK4JqApVBtOIftVgjuABpAtpxhPGaDcfvbhNvD0B8iD1oUr/txX35NjcaY6Ns/A==", "dev": true }, + "modify-values": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/modify-values/-/modify-values-1.0.1.tgz", + "integrity": "sha512-xV2bxeN6F7oYjZWTe/YPAy6MN2M+sL4u/Rlm2AHCIVGfo2p1yGmBHQ6vHehl4bRTZBdHu3TSkWdYgkwpYzAGSw==", + "dev": true + }, "move-concurrently": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/move-concurrently/-/move-concurrently-1.0.1.tgz", @@ -8338,9 +8184,9 @@ "dev": true }, "nan": { - "version": "2.14.0", - "resolved": "https://registry.npmjs.org/nan/-/nan-2.14.0.tgz", - "integrity": "sha512-INOFj37C7k3AfaNTtX8RhsTw7qRy7eLET14cROi9+5HAVbbHuIWUHEauBv5qT4Av2tWasiTY1Jw6puUNqRJXQg==", + "version": "2.14.2", + "resolved": "https://registry.npmjs.org/nan/-/nan-2.14.2.tgz", + "integrity": "sha512-M2ufzIiINKCuDfBSAUr1vWQ+vuVcA9kqx8JJUsbQi6yf1uGRyb7HfpdfUr5qLXf3B/t8dPvcjhKMmlfnP47EzQ==", "dev": true, "optional": true }, @@ -8436,11 +8282,54 @@ "vm-browserify": "^1.0.1" }, "dependencies": { + "buffer": { + "version": "4.9.2", + "resolved": "https://registry.npmjs.org/buffer/-/buffer-4.9.2.tgz", + "integrity": "sha512-xq+q3SRMOxGivLhBNaUdC64hDTQwejJ+H0T/NB1XMtTVEwNTrfFF3gAxiyW0Bu/xWEGhjVKgUcMhCrUy2+uCWg==", + "dev": true, + "requires": { + "base64-js": "^1.0.2", + "ieee754": "^1.1.4", + "isarray": "^1.0.0" + } + }, "punycode": { "version": "1.4.1", "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz", "integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4=", "dev": true + }, + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + }, + "dependencies": { + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + } + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true } } }, @@ -8462,48 +8351,36 @@ "semver": "^6.3.0", "shellwords": "^0.1.1", "which": "^1.3.1" - }, - "dependencies": { - "is-wsl": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-2.2.0.tgz", - "integrity": "sha512-fKzAra0rGJUUBwGBgNkHZuToZcn+TtXHpeCgmkMJMMYx1sQDYaCSyjJBSCa2nH1DGm7s3n1oBnohoVTBaN7Lww==", - "dev": true, - "optional": true, - "requires": { - "is-docker": "^2.0.0" - } - } } }, "normalize-package-data": { - "version": "2.5.0", - "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", - "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-3.0.0.tgz", + "integrity": "sha512-6lUjEI0d3v6kFrtgA/lOx4zHCWULXsFNIjHolnZCKCTLA6m/G625cdn3O7eNmT0iD3jfo6HZ9cdImGZwf21prw==", "dev": true, "requires": { - "hosted-git-info": "^2.1.4", - "resolve": "^1.10.0", - "semver": "2 || 3 || 4 || 5", + "hosted-git-info": "^3.0.6", + "resolve": "^1.17.0", + "semver": "^7.3.2", "validate-npm-package-license": "^3.0.1" }, "dependencies": { "semver": { - "version": "5.7.1", - "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", - "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", - "dev": true + "version": "7.3.4", + "resolved": "https://registry.npmjs.org/semver/-/semver-7.3.4.tgz", + "integrity": "sha512-tCfb2WLjqFAtXn4KEdxIhalnRtoKFN7nAwj0B3ZXCbQloV2tq5eDbcTmT68JJD3nRJq24/XgxtQKFIpQdtvmVw==", + "dev": true, + "requires": { + "lru-cache": "^6.0.0" + } } } }, "normalize-path": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-2.1.1.tgz", - "integrity": "sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=", - "dev": true, - "requires": { - "remove-trailing-separator": "^1.0.1" - } + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", + "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", + "dev": true }, "npm-run-path": { "version": "2.0.2", @@ -8514,6 +8391,12 @@ "path-key": "^2.0.0" } }, + "number-is-nan": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/number-is-nan/-/number-is-nan-1.0.1.tgz", + "integrity": "sha1-CXtgK1NCKlIsGvuHkDGDNpQaAR0=", + "dev": true + }, "nwsapi": { "version": "2.2.0", "resolved": "https://registry.npmjs.org/nwsapi/-/nwsapi-2.2.0.tgz", @@ -8564,19 +8447,19 @@ } }, "object-inspect": { - "version": "1.8.0", - "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.8.0.tgz", - "integrity": "sha512-jLdtEOB112fORuypAyl/50VRVIBIdVQOSUUGQHzJ4xBSbit81zRarz7GThkEFZy1RceYrWYcPcBFPQwHyAc1gA==", + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.9.0.tgz", + "integrity": "sha512-i3Bp9iTqwhaLZBxGkRfo5ZbE07BQRT7MGu8+nNgwW9ItGp1TzCTw2DLEoWwjClxBjOFI/hWljTAmYGCEwmtnOw==", "dev": true }, "object-is": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/object-is/-/object-is-1.1.3.tgz", - "integrity": "sha512-teyqLvFWzLkq5B9ki8FVWA902UER2qkxmdA4nLf+wjOLAWgxzCWZNCxpDq9MvE8MmhWNr+I8w3BN49Vx36Y6Xg==", + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/object-is/-/object-is-1.1.4.tgz", + "integrity": "sha512-1ZvAZ4wlF7IyPVOcE1Omikt7UpaFlOQq0HlSti+ZvDH3UiD2brwGMwDbyV43jao2bKJ+4+WdPJHSd7kgzKYVqg==", "dev": true, "requires": { - "define-properties": "^1.1.3", - "es-abstract": "^1.18.0-next.1" + "call-bind": "^1.0.0", + "define-properties": "^1.1.3" } }, "object-keys": { @@ -8594,6 +8477,18 @@ "isobject": "^3.0.0" } }, + "object.assign": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.2.tgz", + "integrity": "sha512-ixT2L5THXsApyiUPYKmW+2EHpXXe5Ii3M+f4e+aJFAHao5amFRW6J0OO6c/LU8Be47utCx2GL89hxGB6XSmKuQ==", + "dev": true, + "requires": { + "call-bind": "^1.0.0", + "define-properties": "^1.1.3", + "has-symbols": "^1.0.1", + "object-keys": "^1.1.1" + } + }, "object.pick": { "version": "1.3.0", "resolved": "https://registry.npmjs.org/object.pick/-/object.pick-1.3.0.tgz", @@ -8634,9 +8529,9 @@ } }, "onetime": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/onetime/-/onetime-5.1.0.tgz", - "integrity": "sha512-5NcSkPHhwTVFIQN+TUqXoS5+dlElHXdpAWu9I0HP20YOtIi+aZ0Ct82jdlILDxjLEAWwvm+qj1m6aEtsDVmm6Q==", + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/onetime/-/onetime-5.1.2.tgz", + "integrity": "sha512-kbpaSSGJTWdAY5KPVeMOKXSrPtr8C8C7wodJbcsd51jRnmD+GZu8Y0VoU6Dm5Z4vWr0Ig/1NKuWRKf7j5aaYSg==", "dev": true, "requires": { "mimic-fn": "^2.1.0" @@ -8649,6 +8544,14 @@ "dev": true, "requires": { "is-wsl": "^1.1.0" + }, + "dependencies": { + "is-wsl": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-1.1.0.tgz", + "integrity": "sha1-HxbkqiKwTRM2tmGIpmrzxgDDpm0=", + "dev": true + } } }, "optionator": { @@ -8686,12 +8589,6 @@ "integrity": "sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=", "dev": true }, - "p-defer": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/p-defer/-/p-defer-1.0.0.tgz", - "integrity": "sha1-n26xgvbJqozXQwBKfU+WsZaw+ww=", - "dev": true - }, "p-each-series": { "version": "2.2.0", "resolved": "https://registry.npmjs.org/p-each-series/-/p-each-series-2.2.0.tgz", @@ -8704,12 +8601,6 @@ "integrity": "sha1-P7z7FbiZpEEjs0ttzBi3JDNqLK4=", "dev": true }, - "p-is-promise": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/p-is-promise/-/p-is-promise-2.1.0.tgz", - "integrity": "sha512-Y3W0wlRPK8ZMRbNq97l4M5otioeA5lm1z7bkNkxCka8HSPjR0xRWmpCmc9utiaLP9Jb1eD8BgeIxTW4AIF45Pg==", - "dev": true - }, "p-limit": { "version": "2.3.0", "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.3.0.tgz", @@ -8764,6 +8655,38 @@ "cyclist": "^1.0.1", "inherits": "^2.0.3", "readable-stream": "^2.1.5" + }, + "dependencies": { + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + } } }, "parent-module": { @@ -8788,6 +8711,24 @@ "safe-buffer": "^5.1.1" } }, + "parse-github-repo-url": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/parse-github-repo-url/-/parse-github-repo-url-1.4.1.tgz", + "integrity": "sha1-nn2LslKmy2ukJZUGC3v23z28H1A=", + "dev": true + }, + "parse-json": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-5.1.0.tgz", + "integrity": "sha512-+mi/lmVVNKFNVyLXV31ERiy2CY5E1/F6QtJFEzoChPRwwngMNXRDQ9GJ5WdE2Z2P4AujsOi0/+2qHID68KwfIQ==", + "dev": true, + "requires": { + "@babel/code-frame": "^7.0.0", + "error-ex": "^1.3.1", + "json-parse-even-better-errors": "^2.3.0", + "lines-and-columns": "^1.1.6" + } + }, "parse-node-version": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/parse-node-version/-/parse-node-version-1.0.1.tgz", @@ -8830,6 +8771,12 @@ "integrity": "sha1-zDPSTVJeCZpTiMAzbG4yuRYGCeA=", "dev": true }, + "path-exists": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", + "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", + "dev": true + }, "path-is-absolute": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", @@ -8860,6 +8807,17 @@ "integrity": "sha1-32BBeABfUi8V60SQ5yR6G/qmf4w=", "dev": true }, + "path-type": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/path-type/-/path-type-1.1.0.tgz", + "integrity": "sha1-WcRPfuSR2nBNpBXaWkBwuk+P5EE=", + "dev": true, + "requires": { + "graceful-fs": "^4.1.2", + "pify": "^2.0.0", + "pinkie-promise": "^2.0.0" + } + }, "pbkdf2": { "version": "3.1.1", "resolved": "https://registry.npmjs.org/pbkdf2/-/pbkdf2-3.1.1.tgz", @@ -8922,63 +8880,12 @@ } }, "pkg-dir": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-3.0.0.tgz", - "integrity": "sha512-/E57AYkoeQ25qkxMj5PBOVgF8Kiu/h7cYS30Z5+R7WaiCCBfLq58ZI/dSeaEKb9WVJV5n/03QwrN3IeWIFllvw==", + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-4.2.0.tgz", + "integrity": "sha512-HRDzbaKjC+AOWVXxAU/x54COGeIv9eb+6CkDSQoNTt4XyWoIJvuPsXizxu/Fr23EiekbtZwmh1IcIG/l/a10GQ==", "dev": true, "requires": { - "find-up": "^3.0.0" - }, - "dependencies": { - "find-up": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-3.0.0.tgz", - "integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==", - "dev": true, - "requires": { - "locate-path": "^3.0.0" - } - }, - "locate-path": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz", - "integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==", - "dev": true, - "requires": { - "p-locate": "^3.0.0", - "path-exists": "^3.0.0" - } - }, - "p-limit": { - "version": "2.2.1", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.2.1.tgz", - "integrity": "sha512-85Tk+90UCVWvbDavCLKPOLC9vvY8OwEX/RtKF+/1OADJMVlFfEHOiMTPVyxg7mk/dKa+ipdHm0OUkTvCpMTuwg==", - "dev": true, - "requires": { - "p-try": "^2.0.0" - } - }, - "p-locate": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz", - "integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==", - "dev": true, - "requires": { - "p-limit": "^2.0.0" - } - }, - "p-try": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", - "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", - "dev": true - }, - "path-exists": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", - "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", - "dev": true - } + "find-up": "^4.0.0" } }, "plugin-error": { @@ -9010,12 +8917,6 @@ "integrity": "sha1-IPnqtexw9cfSFbEHexw5Fh0pLH0=", "dev": true }, - "array-slice": { - "version": "0.2.3", - "resolved": "https://registry.npmjs.org/array-slice/-/array-slice-0.2.3.tgz", - "integrity": "sha1-3Tz7gO15c6dRF82sabC5nshhhvU=", - "dev": true - }, "extend-shallow": { "version": "1.1.4", "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-1.1.4.tgz", @@ -9135,6 +9036,16 @@ "integrity": "sha1-mEcocL8igTL8vdhoEputEsPAKeM=", "dev": true }, + "prompts": { + "version": "2.4.0", + "resolved": "https://registry.npmjs.org/prompts/-/prompts-2.4.0.tgz", + "integrity": "sha512-awZAKrk3vN6CroQukBL+R9051a4R3zCZBlJm/HBfrSZ8iTpYix3VX1vU4mveiLpiwmOJT4wokTF9m6HUk4KqWQ==", + "dev": true, + "requires": { + "kleur": "^3.0.3", + "sisteransi": "^1.0.5" + } + }, "proxy-addr": { "version": "2.0.6", "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.6.tgz", @@ -9186,9 +9097,9 @@ } }, "pump": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/pump/-/pump-2.0.1.tgz", - "integrity": "sha512-ruPMNRkN3MHP1cWJc9OWr+T/xDP0jhXYCLfJcBuX54hhfIBnaQmAUMfDcG4DM5UMWByBbJY69QSphm3jtDKIkA==", + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz", + "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", "dev": true, "requires": { "end-of-stream": "^1.1.0", @@ -9204,6 +9115,18 @@ "duplexify": "^3.6.0", "inherits": "^2.0.3", "pump": "^2.0.0" + }, + "dependencies": { + "pump": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/pump/-/pump-2.0.1.tgz", + "integrity": "sha512-ruPMNRkN3MHP1cWJc9OWr+T/xDP0jhXYCLfJcBuX54hhfIBnaQmAUMfDcG4DM5UMWByBbJY69QSphm3jtDKIkA==", + "dev": true, + "requires": { + "end-of-stream": "^1.1.0", + "once": "^1.3.1" + } + } } }, "punycode": { @@ -9232,31 +9155,6 @@ "ws": "^7.2.3" }, "dependencies": { - "find-up": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", - "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", - "dev": true, - "requires": { - "locate-path": "^5.0.0", - "path-exists": "^4.0.0" - } - }, - "path-exists": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", - "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", - "dev": true - }, - "pkg-dir": { - "version": "4.2.0", - "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-4.2.0.tgz", - "integrity": "sha512-HRDzbaKjC+AOWVXxAU/x54COGeIv9eb+6CkDSQoNTt4XyWoIJvuPsXizxu/Fr23EiekbtZwmh1IcIG/l/a10GQ==", - "dev": true, - "requires": { - "find-up": "^4.0.0" - } - }, "rimraf": { "version": "3.0.2", "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz", @@ -9268,6 +9166,12 @@ } } }, + "q": { + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/q/-/q-1.5.1.tgz", + "integrity": "sha1-fjL3W0E4EpHQRhHxvxQQmsAGUdc=", + "dev": true + }, "qs": { "version": "6.5.2", "resolved": "https://registry.npmjs.org/qs/-/qs-6.5.2.tgz", @@ -9292,6 +9196,12 @@ "integrity": "sha512-FIqgj2EUvTa7R50u0rGsyTftzjYmv/a3hO345bZNrqabNqjtgiDMgmo4mkUjd+nzU5oF3dClKqFIPUKybUyqoQ==", "dev": true }, + "quick-lru": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/quick-lru/-/quick-lru-4.0.1.tgz", + "integrity": "sha512-ARhCpm70fzdcvNQfPoy49IaanKkTlRWF2JMzqhcJbhSFRZv7nPTvZJdcY7301IPmvW+/p0RgIWnQDLJxifsQ7g==", + "dev": true + }, "randombytes": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/randombytes/-/randombytes-2.1.0.tgz", @@ -9343,30 +9253,166 @@ "integrity": "sha512-24e6ynE2H+OKt4kqsOvNd8kBpV65zoxbA4BVsEOB3ARVWQki/DHzaUoC5KuON/BiccDaCCTZBuOcfZs70kR8bQ==", "dev": true }, - "readable-stream": { - "version": "2.3.6", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.6.tgz", - "integrity": "sha512-tQtKA9WIAhBF3+VLAseyMqZeBjW0AHJoxOtYqSUZNJxauErmLbVm2FW1y+J/YA9dUrAC39ITejlZWhVIwawkKw==", + "read-pkg": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-3.0.0.tgz", + "integrity": "sha1-nLxoaXj+5l0WwA4rGcI3/Pbjg4k=", "dev": true, "requires": { - "core-util-is": "~1.0.0", - "inherits": "~2.0.3", - "isarray": "~1.0.0", - "process-nextick-args": "~2.0.0", - "safe-buffer": "~5.1.1", - "string_decoder": "~1.1.1", - "util-deprecate": "~1.0.1" + "load-json-file": "^4.0.0", + "normalize-package-data": "^2.3.2", + "path-type": "^3.0.0" + }, + "dependencies": { + "hosted-git-info": { + "version": "2.8.8", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", + "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==", + "dev": true + }, + "load-json-file": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-4.0.0.tgz", + "integrity": "sha1-L19Fq5HjMhYjT9U62rZo607AmTs=", + "dev": true, + "requires": { + "graceful-fs": "^4.1.2", + "parse-json": "^4.0.0", + "pify": "^3.0.0", + "strip-bom": "^3.0.0" + } + }, + "normalize-package-data": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", + "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", + "dev": true, + "requires": { + "hosted-git-info": "^2.1.4", + "resolve": "^1.10.0", + "semver": "2 || 3 || 4 || 5", + "validate-npm-package-license": "^3.0.1" + } + }, + "parse-json": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz", + "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=", + "dev": true, + "requires": { + "error-ex": "^1.3.1", + "json-parse-better-errors": "^1.0.1" + } + }, + "path-type": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/path-type/-/path-type-3.0.0.tgz", + "integrity": "sha512-T2ZUsdZFHgA3u4e5PfPbjd7HDDpxPnQb5jN0SrDsjNSuVXHJqtwTnWqG0B1jZrgmJ/7lj1EmVIByWt1gxGkWvg==", + "dev": true, + "requires": { + "pify": "^3.0.0" + } + }, + "pify": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz", + "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=", + "dev": true + }, + "semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "dev": true + }, + "strip-bom": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-3.0.0.tgz", + "integrity": "sha1-IzTBjpx1n3vdVv3vfprj1YjmjtM=", + "dev": true + } + } + }, + "read-pkg-up": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-3.0.0.tgz", + "integrity": "sha1-PtSWaF26D4/hGNBpHcUfSh/5bwc=", + "dev": true, + "requires": { + "find-up": "^2.0.0", + "read-pkg": "^3.0.0" + }, + "dependencies": { + "find-up": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-2.1.0.tgz", + "integrity": "sha1-RdG35QbHF93UgndaK3eSCjwMV6c=", + "dev": true, + "requires": { + "locate-path": "^2.0.0" + } + }, + "locate-path": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-2.0.0.tgz", + "integrity": "sha1-K1aLJl7slExtnA3pw9u7ygNUzY4=", + "dev": true, + "requires": { + "p-locate": "^2.0.0", + "path-exists": "^3.0.0" + } + }, + "p-limit": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-1.3.0.tgz", + "integrity": "sha512-vvcXsLAJ9Dr5rQOPk7toZQZJApBl2K4J6dANSsEuh6QI41JYcsS/qhTGa9ErIUUgK3WNQoJYvylxvjqmiqEA9Q==", + "dev": true, + "requires": { + "p-try": "^1.0.0" + } + }, + "p-locate": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-2.0.0.tgz", + "integrity": "sha1-IKAQOyIqcMj9OcwuWAaA893l7EM=", + "dev": true, + "requires": { + "p-limit": "^1.1.0" + } + }, + "p-try": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/p-try/-/p-try-1.0.0.tgz", + "integrity": "sha1-y8ec26+P1CKOE/Yh8rGiN8GyB7M=", + "dev": true + }, + "path-exists": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", + "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", + "dev": true + } + } + }, + "readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "dev": true, + "requires": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" } }, "readdirp": { - "version": "2.2.1", - "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-2.2.1.tgz", - "integrity": "sha512-1JU/8q+VgFZyxwrJ+SVIOsh+KywWGpds3NTqikiKpDMZWScmAYyKIgqkO+ARvNWJfXeXR1zxz7aHF4u4CyH6vQ==", + "version": "3.5.0", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.5.0.tgz", + "integrity": "sha512-cMhu7c/8rdhkHXWsY+osBhfSy0JikwpHK/5+imo+LpeasTF8ouErHrlYkwT0++njiyuDvc7OFY5T3ukvZ8qmFQ==", "dev": true, + "optional": true, "requires": { - "graceful-fs": "^4.1.11", - "micromatch": "^3.1.10", - "readable-stream": "^2.0.2" + "picomatch": "^2.2.1" } }, "realpath-native": { @@ -9375,6 +9421,25 @@ "integrity": "sha512-v1SEYUOXXdbBZK8ZuNgO4TBjamPsiSgcFr0aP+tEKpQZK8vooEUqV6nm6Cv502mX4NF2EfsnVqtNAHG+/6Ur1Q==", "dev": true }, + "rechoir": { + "version": "0.6.2", + "resolved": "https://registry.npmjs.org/rechoir/-/rechoir-0.6.2.tgz", + "integrity": "sha1-hSBLVNuoLVdC4oyWdW70OvUOM4Q=", + "dev": true, + "requires": { + "resolve": "^1.1.6" + } + }, + "redent": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/redent/-/redent-3.0.0.tgz", + "integrity": "sha512-6tDA8g98We0zd0GvVeMT9arEOnTw9qM03L9cJXaCjrip1OO764RDBLBfrB4cwzNGDj5OA5ioymC9GkizgWJDUg==", + "dev": true, + "requires": { + "indent-string": "^4.0.0", + "strip-indent": "^3.0.0" + } + }, "regex-not": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/regex-not/-/regex-not-1.0.2.tgz", @@ -9393,45 +9458,6 @@ "requires": { "define-properties": "^1.1.3", "es-abstract": "^1.17.0-next.1" - }, - "dependencies": { - "es-abstract": { - "version": "1.17.7", - "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.17.7.tgz", - "integrity": "sha512-VBl/gnfcJ7OercKA9MVaegWsBHFjV492syMudcnQZvt/Dw8ezpcOHYZXa/J96O8vx+g4x65YKhxOwDUh63aS5g==", - "dev": true, - "requires": { - "es-to-primitive": "^1.2.1", - "function-bind": "^1.1.1", - "has": "^1.0.3", - "has-symbols": "^1.0.1", - "is-callable": "^1.2.2", - "is-regex": "^1.1.1", - "object-inspect": "^1.8.0", - "object-keys": "^1.1.1", - "object.assign": "^4.1.1", - "string.prototype.trimend": "^1.0.1", - "string.prototype.trimstart": "^1.0.1" - } - }, - "has-symbols": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz", - "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", - "dev": true - }, - "object.assign": { - "version": "4.1.2", - "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.2.tgz", - "integrity": "sha512-ixT2L5THXsApyiUPYKmW+2EHpXXe5Ii3M+f4e+aJFAHao5amFRW6J0OO6c/LU8Be47utCx2GL89hxGB6XSmKuQ==", - "dev": true, - "requires": { - "call-bind": "^1.0.0", - "define-properties": "^1.1.3", - "has-symbols": "^1.0.1", - "object-keys": "^1.1.1" - } - } } }, "regexpp": { @@ -9458,6 +9484,15 @@ "integrity": "sha1-jcrkcOHIirwtYA//Sndihtp15jc=", "dev": true }, + "repeating": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/repeating/-/repeating-2.0.1.tgz", + "integrity": "sha1-UhTFOpJtNVJwdSf7q0FdvAjQbdo=", + "dev": true, + "requires": { + "is-finite": "^1.0.0" + } + }, "request": { "version": "2.88.2", "resolved": "https://registry.npmjs.org/request/-/request-2.88.2.tgz", @@ -9536,6 +9571,12 @@ "integrity": "sha1-jGStX9MNqxyXbiNE/+f3kqam30I=", "dev": true }, + "require-main-filename": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", + "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==", + "dev": true + }, "requires-port": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/requires-port/-/requires-port-1.0.0.tgz", @@ -9543,27 +9584,28 @@ "dev": true }, "resolve": { - "version": "1.12.0", - "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.12.0.tgz", - "integrity": "sha512-B/dOmuoAik5bKcD6s6nXDCjzUKnaDvdkRyAk6rsmsKLipWj4797iothd7jmmUhWTfinVMU+wc56rYKsit2Qy4w==", + "version": "1.19.0", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.19.0.tgz", + "integrity": "sha512-rArEXAgsBG4UgRGcynxWIWKFvh/XZCcS8UJdHhwy91zwAvCZIbcs+vAbflgBnNjYMs/i/i+/Ux6IZhML1yPvxg==", "dev": true, "requires": { + "is-core-module": "^2.1.0", "path-parse": "^1.0.6" } }, "resolve-cwd": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/resolve-cwd/-/resolve-cwd-2.0.0.tgz", - "integrity": "sha1-AKn3OHVW4nA46uIyyqNypqWbZlo=", + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/resolve-cwd/-/resolve-cwd-3.0.0.tgz", + "integrity": "sha512-OrZaX2Mb+rJCpH/6CpSqt9xFVpN++x01XnN2ie9g6P5/3xelLAkXWVADpdz1IHD/KFfEXyE6V0U01OQ3UO2rEg==", "dev": true, "requires": { - "resolve-from": "^3.0.0" + "resolve-from": "^5.0.0" }, "dependencies": { "resolve-from": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-3.0.0.tgz", - "integrity": "sha1-six699nWiBvItuZTM17rywoYh0g=", + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-5.0.0.tgz", + "integrity": "sha512-qYg9KP24dD5qka9J47d0aVky0N+b4fTU89LN9iDnjB5waksiC49rvMB0PrUJQGoTmH50XPiqOvAjDfaijGxYZw==", "dev": true } } @@ -9576,6 +9618,19 @@ "requires": { "expand-tilde": "^2.0.0", "global-modules": "^1.0.0" + }, + "dependencies": { + "global-modules": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/global-modules/-/global-modules-1.0.0.tgz", + "integrity": "sha512-sKzpEkf11GpOFuw0Zzjzmt4B4UZwjOcG757PPvrfhxcLFbq0wpsgpOqxpxtxFiCG4DtG93M6XRVbF2oGdev7bg==", + "dev": true, + "requires": { + "global-prefix": "^1.0.1", + "is-windows": "^1.0.1", + "resolve-dir": "^1.0.0" + } + } } }, "resolve-from": { @@ -9638,13 +9693,10 @@ "dev": true }, "run-async": { - "version": "2.4.0", - "resolved": "https://registry.npmjs.org/run-async/-/run-async-2.4.0.tgz", - "integrity": "sha512-xJTbh/d7Lm7SBhc1tNvTpeCHaEzoyxPrqNlvSdMfBTYwaY++UJFyXUOxAtsRUXjlqOfj8luNaR9vjCh4KeV+pg==", - "dev": true, - "requires": { - "is-promise": "^2.1.0" - } + "version": "2.4.1", + "resolved": "https://registry.npmjs.org/run-async/-/run-async-2.4.1.tgz", + "integrity": "sha512-tvVnVv01b8c1RrA6Ep7JkStj85Guv/YrMcwqYQnwjsAS2cTmmPGBBjAjpCW7RrSodNSoE2/qg9O4bceNvUuDgQ==", + "dev": true }, "run-queue": { "version": "1.0.3", @@ -9709,18 +9761,18 @@ } }, "rxjs": { - "version": "6.5.4", - "resolved": "https://registry.npmjs.org/rxjs/-/rxjs-6.5.4.tgz", - "integrity": "sha512-naMQXcgEo3csAEGvw/NydRA0fuS2nDZJiw1YUWFKU7aPPAPGZEsD4Iimit96qwCieH6y614MCLYwdkrWx7z/7Q==", + "version": "6.6.3", + "resolved": "https://registry.npmjs.org/rxjs/-/rxjs-6.6.3.tgz", + "integrity": "sha512-trsQc+xYYXZ3urjOiJOuCOa5N3jAZ3eiSpQB5hIT8zGlL2QfnHLJ2r7GMkBGuIausdJN1OneaI6gQlsqNHHmZQ==", "dev": true, "requires": { "tslib": "^1.9.0" } }, "safe-buffer": { - "version": "5.1.2", - "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", - "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==", "dev": true }, "safe-regex": { @@ -9755,11 +9807,127 @@ "walker": "~1.0.5" }, "dependencies": { - "minimist": { - "version": "1.2.5", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", - "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==", - "dev": true + "anymatch": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz", + "integrity": "sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==", + "dev": true, + "requires": { + "micromatch": "^3.1.4", + "normalize-path": "^2.1.1" + } + }, + "braces": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz", + "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==", + "dev": true, + "requires": { + "arr-flatten": "^1.1.0", + "array-unique": "^0.3.2", + "extend-shallow": "^2.0.1", + "fill-range": "^4.0.0", + "isobject": "^3.0.1", + "repeat-element": "^1.1.2", + "snapdragon": "^0.8.1", + "snapdragon-node": "^2.0.1", + "split-string": "^3.0.2", + "to-regex": "^3.0.1" + }, + "dependencies": { + "extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dev": true, + "requires": { + "is-extendable": "^0.1.0" + } + } + } + }, + "fill-range": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz", + "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=", + "dev": true, + "requires": { + "extend-shallow": "^2.0.1", + "is-number": "^3.0.0", + "repeat-string": "^1.6.1", + "to-regex-range": "^2.1.0" + }, + "dependencies": { + "extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dev": true, + "requires": { + "is-extendable": "^0.1.0" + } + } + } + }, + "is-number": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", + "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", + "dev": true, + "requires": { + "kind-of": "^3.0.2" + }, + "dependencies": { + "kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dev": true, + "requires": { + "is-buffer": "^1.1.5" + } + } + } + }, + "micromatch": { + "version": "3.1.10", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz", + "integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==", + "dev": true, + "requires": { + "arr-diff": "^4.0.0", + "array-unique": "^0.3.2", + "braces": "^2.3.1", + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "extglob": "^2.0.4", + "fragment-cache": "^0.2.1", + "kind-of": "^6.0.2", + "nanomatch": "^1.2.9", + "object.pick": "^1.3.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.2" + } + }, + "normalize-path": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-2.1.1.tgz", + "integrity": "sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=", + "dev": true, + "requires": { + "remove-trailing-separator": "^1.0.1" + } + }, + "to-regex-range": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz", + "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=", + "dev": true, + "requires": { + "is-number": "^3.0.0", + "repeat-string": "^1.6.1" + } } } }, @@ -9993,6 +10161,17 @@ "integrity": "sha1-2kL0l0DAtC2yypcoVxyxkMmO/qM=", "dev": true }, + "shelljs": { + "version": "0.8.4", + "resolved": "https://registry.npmjs.org/shelljs/-/shelljs-0.8.4.tgz", + "integrity": "sha512-7gk3UZ9kOfPLIAbslLzyWeGiEqx9e3rxwZM0KE6EL8GlGwjym9Mrlx5/p33bWTu9YG6vcS4MBxYZDHYr5lr8BQ==", + "dev": true, + "requires": { + "glob": "^7.0.0", + "interpret": "^1.0.0", + "rechoir": "^0.6.2" + } + }, "shellwords": { "version": "0.1.1", "resolved": "https://registry.npmjs.org/shellwords/-/shellwords-0.1.1.tgz", @@ -10001,9 +10180,9 @@ "optional": true }, "signal-exit": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.2.tgz", - "integrity": "sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=", + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.3.tgz", + "integrity": "sha512-VUJ49FC8U1OxwZLxIbTTrDvLnf/6TDgxZcK8wxR8zs13xpx7xbG60ndBlhNrFi2EMuFRoeDoJO7wthSLq42EjA==", "dev": true }, "sisteransi": { @@ -10027,6 +10206,14 @@ "ansi-styles": "^3.2.0", "astral-regex": "^1.0.0", "is-fullwidth-code-point": "^2.0.0" + }, + "dependencies": { + "is-fullwidth-code-point": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz", + "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=", + "dev": true + } } }, "snapdragon": { @@ -10077,6 +10264,12 @@ "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=", "dev": true + }, + "source-map": { + "version": "0.5.7", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz", + "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=", + "dev": true } } }, @@ -10160,14 +10353,6 @@ "faye-websocket": "^0.10.0", "uuid": "^3.4.0", "websocket-driver": "0.6.5" - }, - "dependencies": { - "uuid": { - "version": "3.4.0", - "resolved": "https://registry.npmjs.org/uuid/-/uuid-3.4.0.tgz", - "integrity": "sha512-HjSDRw6gZE5JMggctHBcjVak08+KEVhSIiDzFnT9S9aegmp85S/bReBVTb4QTFaRNptJ9kuYaNhnbNEOkbKb/A==", - "dev": true - } } }, "sockjs-client": { @@ -10211,18 +10396,18 @@ "dev": true }, "source-map": { - "version": "0.5.7", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz", - "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=", + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", "dev": true }, "source-map-resolve": { - "version": "0.5.2", - "resolved": "https://registry.npmjs.org/source-map-resolve/-/source-map-resolve-0.5.2.tgz", - "integrity": "sha512-MjqsvNwyz1s0k81Goz/9vRBe9SZdB09Bdw+/zYyO+3CuPk6fouTaxscHkgtE8jKvf01kVfl8riHzERQ/kefaSA==", + "version": "0.5.3", + "resolved": "https://registry.npmjs.org/source-map-resolve/-/source-map-resolve-0.5.3.tgz", + "integrity": "sha512-Htz+RnsXWk5+P2slx5Jh3Q66vhQj1Cllm0zvnaY98+NFx+Dv2CF/f5O/t8x+KaNdrdIAsruNzoh/KpialbqAnw==", "dev": true, "requires": { - "atob": "^2.1.1", + "atob": "^2.1.2", "decode-uri-component": "^0.2.0", "resolve-url": "^0.2.1", "source-map-url": "^0.4.0", @@ -10230,21 +10415,13 @@ } }, "source-map-support": { - "version": "0.5.13", - "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.13.tgz", - "integrity": "sha512-SHSKFHadjVA5oR4PPqhtAVdcBWwRYVd6g6cAXnIbRiIwc2EhPrTuKUBdSLvlEKyIP3GCf89fltvcZiP9MMFA1w==", + "version": "0.5.19", + "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.19.tgz", + "integrity": "sha512-Wonm7zOCIJzBGQdB+thsPar0kYuCIzYvxZwlBa87yi/Mdjv7Tip2cyVbLj5o0cFPN4EVkuTwb3GDDyUx2DGnGw==", "dev": true, "requires": { "buffer-from": "^1.0.0", "source-map": "^0.6.0" - }, - "dependencies": { - "source-map": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", - "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", - "dev": true - } } }, "source-map-url": { @@ -10254,9 +10431,9 @@ "dev": true }, "spdx-correct": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/spdx-correct/-/spdx-correct-3.1.0.tgz", - "integrity": "sha512-lr2EZCctC2BNR7j7WzJ2FpDznxky1sjfxvvYEyzxNyb6lZXHODmEoJeFu4JupYlkfha1KZpJyoqiJ7pgA1qq8Q==", + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/spdx-correct/-/spdx-correct-3.1.1.tgz", + "integrity": "sha512-cOYcUWwhCuHCXi49RhFRCyJEK3iPj1Ziz9DpViV3tbZOwXD49QzIN3MpOLJNxh2qwq2lJJZaKMVw9qNi4jTC0w==", "dev": true, "requires": { "spdx-expression-parse": "^3.0.0", @@ -10264,15 +10441,15 @@ } }, "spdx-exceptions": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/spdx-exceptions/-/spdx-exceptions-2.2.0.tgz", - "integrity": "sha512-2XQACfElKi9SlVb1CYadKDXvoajPgBVPn/gOQLrTvHdElaVhr7ZEbqJaRnJLVNeaI4cMEAgVCeBMKF6MWRDCRA==", + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/spdx-exceptions/-/spdx-exceptions-2.3.0.tgz", + "integrity": "sha512-/tTrYOC7PPI1nUAgx34hUpqXuyJG+DTHJTnIULG4rDygi4xu/tfgmq1e1cIRwRzwZgo4NLySi+ricLkZkw4i5A==", "dev": true }, "spdx-expression-parse": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/spdx-expression-parse/-/spdx-expression-parse-3.0.0.tgz", - "integrity": "sha512-Yg6D3XpRD4kkOmTpdgbUiEJFKghJH03fiC1OPll5h/0sO6neh2jqRDVHOQ4o/LMea0tgCkbMgea5ip/e+MkWyg==", + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/spdx-expression-parse/-/spdx-expression-parse-3.0.1.tgz", + "integrity": "sha512-cbqHunsQWnJNE6KhVSMsMeH5H/L9EpymbzqTQ3uLwNCLZ1Q481oWaofqH7nO6V07xlXwY6PhQdQ2IedWx/ZK4Q==", "dev": true, "requires": { "spdx-exceptions": "^2.1.0", @@ -10280,9 +10457,9 @@ } }, "spdx-license-ids": { - "version": "3.0.5", - "resolved": "https://registry.npmjs.org/spdx-license-ids/-/spdx-license-ids-3.0.5.tgz", - "integrity": "sha512-J+FWzZoynJEXGphVIS+XEh3kFSjZX/1i9gFBaWQcB+/tmpe2qUsSBABpcxqxnAxFdiUFEgAX1bjYGQvIZmoz9Q==", + "version": "3.0.7", + "resolved": "https://registry.npmjs.org/spdx-license-ids/-/spdx-license-ids-3.0.7.tgz", + "integrity": "sha512-U+MTEOO0AiDzxwFvoa4JVnMV6mZlJKk2sBLt90s7G0Gd0Mlknc7kxEn3nuDPNZRta7O2uy8oLcZLVT+4sqNZHQ==", "dev": true }, "spdy": { @@ -10310,19 +10487,15 @@ "obuf": "^1.1.2", "readable-stream": "^3.0.6", "wbuf": "^1.7.3" - }, - "dependencies": { - "readable-stream": { - "version": "3.6.0", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", - "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", - "dev": true, - "requires": { - "inherits": "^2.0.3", - "string_decoder": "^1.1.1", - "util-deprecate": "^1.0.1" - } - } + } + }, + "split": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/split/-/split-1.0.1.tgz", + "integrity": "sha512-mTyOoPbrivtXnwnIxZRFYRrPNtEFKlpB2fvjSnCQUiAA6qAZzqwna5envK4uk6OIeP17CsdF3rSBGYVBsU0Tkg==", + "dev": true, + "requires": { + "through": "2" } }, "split-string": { @@ -10334,6 +10507,57 @@ "extend-shallow": "^3.0.0" } }, + "split2": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/split2/-/split2-2.2.0.tgz", + "integrity": "sha512-RAb22TG39LhI31MbreBgIuKiIKhVsawfTgEGqKHTK87aG+ul/PB8Sqoi3I7kVdRWiCfrKxK3uo4/YUkpNvhPbw==", + "dev": true, + "requires": { + "through2": "^2.0.2" + }, + "dependencies": { + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + }, + "through2": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/through2/-/through2-2.0.5.tgz", + "integrity": "sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ==", + "dev": true, + "requires": { + "readable-stream": "~2.3.6", + "xtend": "~4.0.1" + } + } + } + }, "sprintf-js": { "version": "1.0.3", "resolved": "https://registry.npmjs.org/sprintf-js/-/sprintf-js-1.0.3.tgz", @@ -10367,9 +10591,9 @@ } }, "stack-utils": { - "version": "1.0.3", - "resolved": "https://registry.npmjs.org/stack-utils/-/stack-utils-1.0.3.tgz", - "integrity": "sha512-WldO+YmqhEpjp23eHZRhOT1NQF51STsbxZ+/AdpFD+EhheFxAe5d0WoK4DQVJkSHacPrJJX3OqRAl9CgHf78pg==", + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/stack-utils/-/stack-utils-1.0.4.tgz", + "integrity": "sha512-IPDJfugEGbfizBwBZRZ3xpccMdRyP5lqsBWXGQWimVjua/ccLCeMOAVjlc1R7LxFjo5sEDhyNIXd8mo/AiDS9w==", "dev": true, "requires": { "escape-string-regexp": "^2.0.0" @@ -10424,6 +10648,38 @@ "requires": { "inherits": "~2.0.1", "readable-stream": "^2.0.2" + }, + "dependencies": { + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + } } }, "stream-each": { @@ -10447,12 +10703,44 @@ "readable-stream": "^2.3.6", "to-arraybuffer": "^1.0.0", "xtend": "^4.0.0" + }, + "dependencies": { + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + } } }, "stream-shift": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/stream-shift/-/stream-shift-1.0.0.tgz", - "integrity": "sha1-1cdSgl5TZ+eG944Y5EXqIjoVWVI=", + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/stream-shift/-/stream-shift-1.0.1.tgz", + "integrity": "sha512-AiisoFqQ0vbGcZgQPY1cdP2I76glaVA/RauYR4G4thNFgkTqr90yXTo4LYX60Jl+sIlPNHHdGSwo01AvbKUSVQ==", "dev": true }, "string-length": { @@ -10476,24 +10764,6 @@ "strip-ansi": "^6.0.0" }, "dependencies": { - "ansi-regex": { - "version": "5.0.0", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.0.tgz", - "integrity": "sha512-bY6fj56OUQ0hU1KjFNDQuJFezqKdrAyFdIevADiqrWHwSlbmBNMHp5ak2f40Pm8JTFyM2mqxkG6ngkHO11f/lg==", - "dev": true - }, - "emoji-regex": { - "version": "8.0.0", - "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz", - "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==", - "dev": true - }, - "is-fullwidth-code-point": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", - "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==", - "dev": true - }, "strip-ansi": { "version": "6.0.0", "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", @@ -10526,12 +10796,12 @@ } }, "string_decoder": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", - "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.3.0.tgz", + "integrity": "sha512-hkRX8U1WjJFd8LsDJ2yQ/wWWxaopEsABU1XfkM8A+j0+85JAGppt16cr1Whg6KIbb4okU6Mql6BOj+uup/wKeA==", "dev": true, "requires": { - "safe-buffer": "~5.1.0" + "safe-buffer": "~5.2.0" } }, "strip-ansi": { @@ -10551,6 +10821,15 @@ } } }, + "strip-bom": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-2.0.0.tgz", + "integrity": "sha1-YhmoVhZSBJHzV4i9vxRHqZx+aw4=", + "dev": true, + "requires": { + "is-utf8": "^0.2.0" + } + }, "strip-eof": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/strip-eof/-/strip-eof-1.0.0.tgz", @@ -10563,10 +10842,19 @@ "integrity": "sha512-BrpvfNAE3dcvq7ll3xVumzjKjZQ5tI1sEUIKr3Uoks0XUl45St3FlatVqef9prk4jRDzhW6WZg+3bk93y6pLjA==", "dev": true }, + "strip-indent": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-3.0.0.tgz", + "integrity": "sha512-laJTa3Jb+VQpaC6DseHhF7dXVqHTfJPCRDaEbid/drOhgitgYku/letMUqOXFoWV0zIIUbjpdH2t+tYj4bQMRQ==", + "dev": true, + "requires": { + "min-indent": "^1.0.0" + } + }, "strip-json-comments": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-3.0.1.tgz", - "integrity": "sha512-VTyMAUfdm047mwKl+u79WIdrZxtFtn+nBxHeb844XBQ9uMNTuTHdx2hc5RiAJYqwTj3wc/xe5HLSdJSkJ+WfZw==", + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-3.1.1.tgz", + "integrity": "sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==", "dev": true }, "supports-color": { @@ -10623,6 +10911,18 @@ "string-width": "^3.0.0" }, "dependencies": { + "emoji-regex": { + "version": "7.0.3", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-7.0.3.tgz", + "integrity": "sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA==", + "dev": true + }, + "is-fullwidth-code-point": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz", + "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=", + "dev": true + }, "string-width": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/string-width/-/string-width-3.1.0.tgz", @@ -10652,18 +10952,6 @@ "mkdirp-classic": "^0.5.2", "pump": "^3.0.0", "tar-stream": "^2.1.4" - }, - "dependencies": { - "pump": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz", - "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", - "dev": true, - "requires": { - "end-of-stream": "^1.1.0", - "once": "^1.3.1" - } - } } }, "tar-stream": { @@ -10677,19 +10965,22 @@ "fs-constants": "^1.0.0", "inherits": "^2.0.3", "readable-stream": "^3.1.1" - }, - "dependencies": { - "readable-stream": { - "version": "3.6.0", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", - "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", - "dev": true, - "requires": { - "inherits": "^2.0.3", - "string_decoder": "^1.1.1", - "util-deprecate": "^1.0.1" - } - } + } + }, + "temp-dir": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/temp-dir/-/temp-dir-2.0.0.tgz", + "integrity": "sha512-aoBAniQmmwtcKp/7BzsH8Cxzv8OL736p7v1ihGb5e9DJ9kTwGWHrQrVB5+lfVDzfGrdRzXch+ig7LHaY1JTOrg==", + "dev": true + }, + "tempfile": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/tempfile/-/tempfile-3.0.0.tgz", + "integrity": "sha512-uNFCg478XovRi85iD42egu+eSFUmmka750Jy7L5tfHI5hQKKtbPnxaSaXAbBqCDYrw3wx4tXjKwci4/QmsZJxw==", + "dev": true, + "requires": { + "temp-dir": "^2.0.0", + "uuid": "^3.3.2" } }, "terminal-link": { @@ -10711,14 +11002,6 @@ "commander": "^2.20.0", "source-map": "~0.6.1", "source-map-support": "~0.5.12" - }, - "dependencies": { - "source-map": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", - "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", - "dev": true - } } }, "terser-webpack-plugin": { @@ -10738,10 +11021,10 @@ "worker-farm": "^1.7.0" }, "dependencies": { - "source-map": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", - "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "is-wsl": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-1.1.0.tgz", + "integrity": "sha1-HxbkqiKwTRM2tmGIpmrzxgDDpm0=", "dev": true } } @@ -10757,6 +11040,12 @@ "minimatch": "^3.0.4" } }, + "text-extensions": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/text-extensions/-/text-extensions-1.9.0.tgz", + "integrity": "sha512-wiBrwC1EhBelW12Zy26JeOUkQ5mRu+5o8rpsJk5+2t+Y5vE7e842qtZDQ2g1NpX/29HdyFeJ4nSIhI47ENSxlQ==", + "dev": true + }, "text-table": { "version": "0.2.0", "resolved": "https://registry.npmjs.org/text-table/-/text-table-0.2.0.tgz", @@ -10776,13 +11065,12 @@ "dev": true }, "through2": { - "version": "2.0.5", - "resolved": "https://registry.npmjs.org/through2/-/through2-2.0.5.tgz", - "integrity": "sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ==", + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/through2/-/through2-4.0.2.tgz", + "integrity": "sha512-iOqSav00cVxEEICeD7TjLB1sueEL+81Wpzp2bY17uZjZN0pWZPuo4suZ/61VujxmqSGFfgOcNuTZ85QJwNZQpw==", "dev": true, "requires": { - "readable-stream": "~2.3.6", - "xtend": "~4.0.1" + "readable-stream": "3" } }, "thunky": { @@ -10866,13 +11154,12 @@ } }, "to-regex-range": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz", - "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=", + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", + "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", "dev": true, "requires": { - "is-number": "^3.0.0", - "repeat-string": "^1.6.1" + "is-number": "^7.0.0" } }, "toidentifier": { @@ -10901,10 +11188,22 @@ "punycode": "^2.1.0" } }, + "trim-newlines": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-3.0.0.tgz", + "integrity": "sha512-C4+gOpvmxaSMKuEf9Qc134F1ZuOHVXKRbtEflf4NTtuuJDEIJ9p5PXsalL8SkeRw+qit1Mo+yuvMPAKwWg/1hA==", + "dev": true + }, + "trim-off-newlines": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/trim-off-newlines/-/trim-off-newlines-1.0.1.tgz", + "integrity": "sha1-n5up2e+odkw4dpi8v+sshI8RrbM=", + "dev": true + }, "tslib": { - "version": "1.11.1", - "resolved": "https://registry.npmjs.org/tslib/-/tslib-1.11.1.tgz", - "integrity": "sha512-aZW88SY8kQbU7gpV19lN24LtXh/yD4ZZg6qieAJDDg+YBsJcSmLGK9QpnUjAKVG/xefmvJGd1WUmfpT/g6AJGA==", + "version": "1.14.1", + "resolved": "https://registry.npmjs.org/tslib/-/tslib-1.14.1.tgz", + "integrity": "sha512-Xni35NKzjgMrwevysHTCArtLDpPvye8zV/0E4EyYn43P7/7qvQwPh9BGkHewbMulVntbigmcT7rdX3BNo9wRJg==", "dev": true }, "tty-browserify": { @@ -10944,9 +11243,9 @@ "dev": true }, "type-fest": { - "version": "0.8.1", - "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.8.1.tgz", - "integrity": "sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==", + "version": "0.18.1", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.18.1.tgz", + "integrity": "sha512-OIAYXk8+ISY+qTOwkHtKqzAuxchoMiD9Udx+FSGQDuiRR+PJKJHc2NJAXlbhkGwTt/4/nKZxELY1w3ReWOL8mw==", "dev": true }, "type-is": { @@ -10974,6 +11273,13 @@ "is-typedarray": "^1.0.0" } }, + "uglify-js": { + "version": "3.12.3", + "resolved": "https://registry.npmjs.org/uglify-js/-/uglify-js-3.12.3.tgz", + "integrity": "sha512-feZzR+kIcSVuLi3s/0x0b2Tx4Iokwqt+8PJM7yRHKuldg4MLdam4TCFeICv+lgDtuYiCtdmrtIP+uN9LWvDasw==", + "dev": true, + "optional": true + }, "unbzip2-stream": { "version": "1.4.3", "resolved": "https://registry.npmjs.org/unbzip2-stream/-/unbzip2-stream-1.4.3.tgz", @@ -10982,18 +11288,6 @@ "requires": { "buffer": "^5.2.1", "through": "^2.3.8" - }, - "dependencies": { - "buffer": { - "version": "5.7.1", - "resolved": "https://registry.npmjs.org/buffer/-/buffer-5.7.1.tgz", - "integrity": "sha512-EHcyIPBQ4BSGlvjB16k5KgAJ27CIsHY/2JBmCRReo48y9rQ3MaUzWX3KVlBa4U7MyX02HdVj0K7C3WaB3ju7FQ==", - "dev": true, - "requires": { - "base64-js": "^1.3.1", - "ieee754": "^1.1.13" - } - } } }, "union-value": { @@ -11079,9 +11373,9 @@ "dev": true }, "uri-js": { - "version": "4.2.2", - "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.2.2.tgz", - "integrity": "sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==", + "version": "4.4.0", + "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.4.0.tgz", + "integrity": "sha512-B0yRTzYdUCCn9n+F4+Gh4yIDtMQcaJsmYBDsTSG8g/OejKBodLQ2IHfN3bM7jUsRXndopT7OIXWdYqc1fjmV6g==", "dev": true, "requires": { "punycode": "^2.1.0" @@ -11157,15 +11451,15 @@ "dev": true }, "uuid": { - "version": "3.3.3", - "resolved": "https://registry.npmjs.org/uuid/-/uuid-3.3.3.tgz", - "integrity": "sha512-pW0No1RGHgzlpHJO1nsVrHKpOEIxkGg1xB+v0ZmdNH5OAeAwzAVrCnI2/6Mtx+Uys6iaylxa+D3g4j63IKKjSQ==", + "version": "3.4.0", + "resolved": "https://registry.npmjs.org/uuid/-/uuid-3.4.0.tgz", + "integrity": "sha512-HjSDRw6gZE5JMggctHBcjVak08+KEVhSIiDzFnT9S9aegmp85S/bReBVTb4QTFaRNptJ9kuYaNhnbNEOkbKb/A==", "dev": true }, "v8-compile-cache": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/v8-compile-cache/-/v8-compile-cache-2.1.0.tgz", - "integrity": "sha512-usZBT3PW+LOjM25wbqIlZwPeJV+3OSz3M1k1Ws8snlW39dZyYL9lOGC5FgPVHfk0jKmjiDV8Z0mIbVQPiwFs7g==", + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/v8-compile-cache/-/v8-compile-cache-2.2.0.tgz", + "integrity": "sha512-gTpR5XQNKFwOd4clxfnhaqvfqMpqEwr4tOtCyz4MtYZX2JYhfr1JvBFKdS+7K/9rfpZR3VLX+YWBbKoxCgS43Q==", "dev": true }, "v8-to-istanbul": { @@ -11259,114 +11553,6 @@ "graceful-fs": "^4.1.2", "neo-async": "^2.5.0", "watchpack-chokidar2": "^2.0.1" - }, - "dependencies": { - "anymatch": { - "version": "3.1.1", - "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.1.tgz", - "integrity": "sha512-mM8522psRCqzV+6LhomX5wgp25YVibjh8Wj23I5RPkPppSVSjyKD2A2mBJmWGa+KN7f2D6LNh9jkBCeyLktzjg==", - "dev": true, - "optional": true, - "requires": { - "normalize-path": "^3.0.0", - "picomatch": "^2.0.4" - } - }, - "binary-extensions": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.1.0.tgz", - "integrity": "sha512-1Yj8h9Q+QDF5FzhMs/c9+6UntbD5MkRfRwac8DoEm9ZfUBZ7tZ55YcGVAzEe4bXsdQHEk+s9S5wsOKVdZrw0tQ==", - "dev": true, - "optional": true - }, - "braces": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", - "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", - "dev": true, - "optional": true, - "requires": { - "fill-range": "^7.0.1" - } - }, - "chokidar": { - "version": "3.4.3", - "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.4.3.tgz", - "integrity": "sha512-DtM3g7juCXQxFVSNPNByEC2+NImtBuxQQvWlHunpJIS5Ocr0lG306cC7FCi7cEA0fzmybPUIl4txBIobk1gGOQ==", - "dev": true, - "optional": true, - "requires": { - "anymatch": "~3.1.1", - "braces": "~3.0.2", - "fsevents": "~2.1.2", - "glob-parent": "~5.1.0", - "is-binary-path": "~2.1.0", - "is-glob": "~4.0.1", - "normalize-path": "~3.0.0", - "readdirp": "~3.5.0" - } - }, - "fill-range": { - "version": "7.0.1", - "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", - "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", - "dev": true, - "optional": true, - "requires": { - "to-regex-range": "^5.0.1" - } - }, - "fsevents": { - "version": "2.1.3", - "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.1.3.tgz", - "integrity": "sha512-Auw9a4AxqWpa9GUfj370BMPzzyncfBABW8Mab7BGWBYDj4Isgq+cDKtx0i6u9jcX9pQDnswsaaOTgTmA5pEjuQ==", - "dev": true, - "optional": true - }, - "is-binary-path": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", - "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", - "dev": true, - "optional": true, - "requires": { - "binary-extensions": "^2.0.0" - } - }, - "is-number": { - "version": "7.0.0", - "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", - "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", - "dev": true, - "optional": true - }, - "normalize-path": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", - "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", - "dev": true, - "optional": true - }, - "readdirp": { - "version": "3.5.0", - "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.5.0.tgz", - "integrity": "sha512-cMhu7c/8rdhkHXWsY+osBhfSy0JikwpHK/5+imo+LpeasTF8ouErHrlYkwT0++njiyuDvc7OFY5T3ukvZ8qmFQ==", - "dev": true, - "optional": true, - "requires": { - "picomatch": "^2.2.1" - } - }, - "to-regex-range": { - "version": "5.0.1", - "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", - "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", - "dev": true, - "optional": true, - "requires": { - "is-number": "^7.0.0" - } - } } }, "watchpack-chokidar2": { @@ -11377,6 +11563,259 @@ "optional": true, "requires": { "chokidar": "^2.1.8" + }, + "dependencies": { + "anymatch": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz", + "integrity": "sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==", + "dev": true, + "optional": true, + "requires": { + "micromatch": "^3.1.4", + "normalize-path": "^2.1.1" + }, + "dependencies": { + "normalize-path": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-2.1.1.tgz", + "integrity": "sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=", + "dev": true, + "optional": true, + "requires": { + "remove-trailing-separator": "^1.0.1" + } + } + } + }, + "binary-extensions": { + "version": "1.13.1", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-1.13.1.tgz", + "integrity": "sha512-Un7MIEDdUC5gNpcGDV97op1Ywk748MpHcFTHoYs6qnj1Z3j7I53VG3nwZhKzoBZmbdRNnb6WRdFlwl7tSDuZGw==", + "dev": true, + "optional": true + }, + "braces": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz", + "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==", + "dev": true, + "optional": true, + "requires": { + "arr-flatten": "^1.1.0", + "array-unique": "^0.3.2", + "extend-shallow": "^2.0.1", + "fill-range": "^4.0.0", + "isobject": "^3.0.1", + "repeat-element": "^1.1.2", + "snapdragon": "^0.8.1", + "snapdragon-node": "^2.0.1", + "split-string": "^3.0.2", + "to-regex": "^3.0.1" + }, + "dependencies": { + "extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dev": true, + "optional": true, + "requires": { + "is-extendable": "^0.1.0" + } + } + } + }, + "chokidar": { + "version": "2.1.8", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-2.1.8.tgz", + "integrity": "sha512-ZmZUazfOzf0Nve7duiCKD23PFSCs4JPoYyccjUFF3aQkQadqBhfzhjkwBH2mNOG9cTBwhamM37EIsIkZw3nRgg==", + "dev": true, + "optional": true, + "requires": { + "anymatch": "^2.0.0", + "async-each": "^1.0.1", + "braces": "^2.3.2", + "fsevents": "^1.2.7", + "glob-parent": "^3.1.0", + "inherits": "^2.0.3", + "is-binary-path": "^1.0.0", + "is-glob": "^4.0.0", + "normalize-path": "^3.0.0", + "path-is-absolute": "^1.0.0", + "readdirp": "^2.2.1", + "upath": "^1.1.1" + } + }, + "fill-range": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz", + "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=", + "dev": true, + "optional": true, + "requires": { + "extend-shallow": "^2.0.1", + "is-number": "^3.0.0", + "repeat-string": "^1.6.1", + "to-regex-range": "^2.1.0" + }, + "dependencies": { + "extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dev": true, + "optional": true, + "requires": { + "is-extendable": "^0.1.0" + } + } + } + }, + "fsevents": { + "version": "1.2.13", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-1.2.13.tgz", + "integrity": "sha512-oWb1Z6mkHIskLzEJ/XWX0srkpkTQ7vaopMQkyaEIoq0fmtFVxOthb8cCxeT+p3ynTdkk/RZwbgG4brR5BeWECw==", + "dev": true, + "optional": true, + "requires": { + "bindings": "^1.5.0", + "nan": "^2.12.1" + } + }, + "glob-parent": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-3.1.0.tgz", + "integrity": "sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=", + "dev": true, + "optional": true, + "requires": { + "is-glob": "^3.1.0", + "path-dirname": "^1.0.0" + }, + "dependencies": { + "is-glob": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-3.1.0.tgz", + "integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=", + "dev": true, + "optional": true, + "requires": { + "is-extglob": "^2.1.0" + } + } + } + }, + "is-binary-path": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-1.0.1.tgz", + "integrity": "sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=", + "dev": true, + "optional": true, + "requires": { + "binary-extensions": "^1.0.0" + } + }, + "is-number": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", + "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", + "dev": true, + "optional": true, + "requires": { + "kind-of": "^3.0.2" + }, + "dependencies": { + "kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dev": true, + "optional": true, + "requires": { + "is-buffer": "^1.1.5" + } + } + } + }, + "micromatch": { + "version": "3.1.10", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz", + "integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==", + "dev": true, + "optional": true, + "requires": { + "arr-diff": "^4.0.0", + "array-unique": "^0.3.2", + "braces": "^2.3.1", + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "extglob": "^2.0.4", + "fragment-cache": "^0.2.1", + "kind-of": "^6.0.2", + "nanomatch": "^1.2.9", + "object.pick": "^1.3.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.2" + } + }, + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "optional": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "readdirp": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-2.2.1.tgz", + "integrity": "sha512-1JU/8q+VgFZyxwrJ+SVIOsh+KywWGpds3NTqikiKpDMZWScmAYyKIgqkO+ARvNWJfXeXR1zxz7aHF4u4CyH6vQ==", + "dev": true, + "optional": true, + "requires": { + "graceful-fs": "^4.1.11", + "micromatch": "^3.1.10", + "readable-stream": "^2.0.2" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true, + "optional": true + }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "optional": true, + "requires": { + "safe-buffer": "~5.1.0" + } + }, + "to-regex-range": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz", + "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=", + "dev": true, + "optional": true, + "requires": { + "is-number": "^3.0.0", + "repeat-string": "^1.6.1" + } + } } }, "wbuf": { @@ -11431,6 +11870,35 @@ "integrity": "sha512-XtGIhXwF8YM8bJhGxG5kXgjkEuNGLTkoYqVE+KMR+aspr4KGYmKYg7yUe3KghyQ9yheNwLnjmzh/7+gfDBmHCQ==", "dev": true }, + "braces": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz", + "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==", + "dev": true, + "requires": { + "arr-flatten": "^1.1.0", + "array-unique": "^0.3.2", + "extend-shallow": "^2.0.1", + "fill-range": "^4.0.0", + "isobject": "^3.0.1", + "repeat-element": "^1.1.2", + "snapdragon": "^0.8.1", + "snapdragon-node": "^2.0.1", + "split-string": "^3.0.2", + "to-regex": "^3.0.1" + }, + "dependencies": { + "extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dev": true, + "requires": { + "is-extendable": "^0.1.0" + } + } + } + }, "eslint-scope": { "version": "4.0.3", "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-4.0.3.tgz", @@ -11440,34 +11908,102 @@ "esrecurse": "^4.1.0", "estraverse": "^4.1.1" } + }, + "fill-range": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz", + "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=", + "dev": true, + "requires": { + "extend-shallow": "^2.0.1", + "is-number": "^3.0.0", + "repeat-string": "^1.6.1", + "to-regex-range": "^2.1.0" + }, + "dependencies": { + "extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dev": true, + "requires": { + "is-extendable": "^0.1.0" + } + } + } + }, + "is-number": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", + "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", + "dev": true, + "requires": { + "kind-of": "^3.0.2" + }, + "dependencies": { + "kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dev": true, + "requires": { + "is-buffer": "^1.1.5" + } + } + } + }, + "micromatch": { + "version": "3.1.10", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz", + "integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==", + "dev": true, + "requires": { + "arr-diff": "^4.0.0", + "array-unique": "^0.3.2", + "braces": "^2.3.1", + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "extglob": "^2.0.4", + "fragment-cache": "^0.2.1", + "kind-of": "^6.0.2", + "nanomatch": "^1.2.9", + "object.pick": "^1.3.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.2" + } + }, + "to-regex-range": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz", + "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=", + "dev": true, + "requires": { + "is-number": "^3.0.0", + "repeat-string": "^1.6.1" + } } } }, "webpack-cli": { - "version": "3.3.11", - "resolved": "https://registry.npmjs.org/webpack-cli/-/webpack-cli-3.3.11.tgz", - "integrity": "sha512-dXlfuml7xvAFwYUPsrtQAA9e4DOe58gnzSxhgrO/ZM/gyXTBowrsYeubyN4mqGhYdpXMFNyQ6emjJS9M7OBd4g==", + "version": "3.3.12", + "resolved": "https://registry.npmjs.org/webpack-cli/-/webpack-cli-3.3.12.tgz", + "integrity": "sha512-NVWBaz9k839ZH/sinurM+HcDvJOTXwSjYp1ku+5XKeOC03z8v5QitnK/x+lAxGXFyhdayoIf/GOpv85z3/xPag==", "dev": true, "requires": { - "chalk": "2.4.2", - "cross-spawn": "6.0.5", - "enhanced-resolve": "4.1.0", - "findup-sync": "3.0.0", - "global-modules": "2.0.0", - "import-local": "2.0.0", - "interpret": "1.2.0", - "loader-utils": "1.2.3", - "supports-color": "6.1.0", - "v8-compile-cache": "2.0.3", - "yargs": "13.2.4" + "chalk": "^2.4.2", + "cross-spawn": "^6.0.5", + "enhanced-resolve": "^4.1.1", + "findup-sync": "^3.0.0", + "global-modules": "^2.0.0", + "import-local": "^2.0.0", + "interpret": "^1.4.0", + "loader-utils": "^1.4.0", + "supports-color": "^6.1.0", + "v8-compile-cache": "^2.1.1", + "yargs": "^13.3.2" }, "dependencies": { - "camelcase": { - "version": "5.3.1", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", - "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", - "dev": true - }, "cliui": { "version": "5.0.0", "resolved": "https://registry.npmjs.org/cliui/-/cliui-5.0.0.tgz", @@ -11479,23 +12015,12 @@ "wrap-ansi": "^5.1.0" } }, - "emojis-list": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-2.1.0.tgz", - "integrity": "sha1-TapNnbAPmBmIDHn6RXrlsJof04k=", + "emoji-regex": { + "version": "7.0.3", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-7.0.3.tgz", + "integrity": "sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA==", "dev": true }, - "enhanced-resolve": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.1.0.tgz", - "integrity": "sha512-F/7vkyTtyc/llOIn8oWclcB25KdRaiPBpZYDgJHgh/UHtpgT2p2eldQgtQnLtUvfMKPKxbRaQM/hHkvLHt1Vng==", - "dev": true, - "requires": { - "graceful-fs": "^4.1.2", - "memory-fs": "^0.4.0", - "tapable": "^1.0.0" - } - }, "find-up": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/find-up/-/find-up-3.0.0.tgz", @@ -11505,67 +12030,22 @@ "locate-path": "^3.0.0" } }, - "get-caller-file": { - "version": "2.0.5", - "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz", - "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==", + "import-local": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/import-local/-/import-local-2.0.0.tgz", + "integrity": "sha512-b6s04m3O+s3CGSbqDIyP4R6aAwAeYlVq9+WUWep6iHa8ETRf9yei1U48C5MmfJmV9AiLYYBKPMq/W+/WRpQmCQ==", + "dev": true, + "requires": { + "pkg-dir": "^3.0.0", + "resolve-cwd": "^2.0.0" + } + }, + "is-fullwidth-code-point": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz", + "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=", "dev": true }, - "global-modules": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/global-modules/-/global-modules-2.0.0.tgz", - "integrity": "sha512-NGbfmJBp9x8IxyJSd1P+otYK8vonoJactOogrVfFRIAEY1ukil8RSKDz2Yo7wh1oihl51l/r6W4epkeKJHqL8A==", - "dev": true, - "requires": { - "global-prefix": "^3.0.0" - } - }, - "global-prefix": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/global-prefix/-/global-prefix-3.0.0.tgz", - "integrity": "sha512-awConJSVCHVGND6x3tmMaKcQvwXLhjdkmomy2W+Goaui8YPgYgXJZewhg3fWC+DlfqqQuWg8AwqjGTD2nAPVWg==", - "dev": true, - "requires": { - "ini": "^1.3.5", - "kind-of": "^6.0.2", - "which": "^1.3.1" - } - }, - "invert-kv": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/invert-kv/-/invert-kv-2.0.0.tgz", - "integrity": "sha512-wPVv/y/QQ/Uiirj/vh3oP+1Ww+AWehmi1g5fFWGPF6IpCBCDVrhgHRMvrLfdYcwDh3QJbGXDW4JAuzxElLSqKA==", - "dev": true - }, - "json5": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", - "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", - "dev": true, - "requires": { - "minimist": "^1.2.0" - } - }, - "lcid": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/lcid/-/lcid-2.0.0.tgz", - "integrity": "sha512-avPEb8P8EGnwXKClwsNUgryVjllcRqtMYa49NTsbQagYuT1DcXnl1915oxWjoyGrXR6zH/Y0Zc96xWsPcoDKeA==", - "dev": true, - "requires": { - "invert-kv": "^2.0.0" - } - }, - "loader-utils": { - "version": "1.2.3", - "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.2.3.tgz", - "integrity": "sha512-fkpz8ejdnEMG3s37wGL07iSBDg99O9D5yflE9RGNH3hRdx9SOwYfnGYdZOUIZitN8E+E2vkq3MUMYMvPYl5ZZA==", - "dev": true, - "requires": { - "big.js": "^5.2.2", - "emojis-list": "^2.0.0", - "json5": "^1.0.1" - } - }, "locate-path": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz", @@ -11576,31 +12056,6 @@ "path-exists": "^3.0.0" } }, - "minimist": { - "version": "1.2.0", - "resolved": "", - "dev": true - }, - "os-locale": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/os-locale/-/os-locale-3.1.0.tgz", - "integrity": "sha512-Z8l3R4wYWM40/52Z+S265okfFj8Kt2cC2MKY+xNi3kFs+XGI7WXu/I309QQQYbRW4ijiZ+yxs9pqEhJh0DqW3Q==", - "dev": true, - "requires": { - "execa": "^1.0.0", - "lcid": "^2.0.0", - "mem": "^4.0.0" - } - }, - "p-limit": { - "version": "2.2.2", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.2.2.tgz", - "integrity": "sha512-WGR+xHecKTr7EbUEhyLSh5Dube9JtdiG78ufaeLxTgpudf/20KqyMioIUZJAezlTIi6evxuoUs9YXc11cU+yzQ==", - "dev": true, - "requires": { - "p-try": "^2.0.0" - } - }, "p-locate": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz", @@ -11610,22 +12065,34 @@ "p-limit": "^2.0.0" } }, - "p-try": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", - "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", - "dev": true - }, "path-exists": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", "dev": true }, - "require-main-filename": { + "pkg-dir": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-3.0.0.tgz", + "integrity": "sha512-/E57AYkoeQ25qkxMj5PBOVgF8Kiu/h7cYS30Z5+R7WaiCCBfLq58ZI/dSeaEKb9WVJV5n/03QwrN3IeWIFllvw==", + "dev": true, + "requires": { + "find-up": "^3.0.0" + } + }, + "resolve-cwd": { "version": "2.0.0", - "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", - "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==", + "resolved": "https://registry.npmjs.org/resolve-cwd/-/resolve-cwd-2.0.0.tgz", + "integrity": "sha1-AKn3OHVW4nA46uIyyqNypqWbZlo=", + "dev": true, + "requires": { + "resolve-from": "^3.0.0" + } + }, + "resolve-from": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-3.0.0.tgz", + "integrity": "sha1-six699nWiBvItuZTM17rywoYh0g=", "dev": true }, "string-width": { @@ -11648,18 +12115,6 @@ "has-flag": "^3.0.0" } }, - "v8-compile-cache": { - "version": "2.0.3", - "resolved": "https://registry.npmjs.org/v8-compile-cache/-/v8-compile-cache-2.0.3.tgz", - "integrity": "sha512-CNmdbwQMBjwr9Gsmohvm0pbL954tJrNzf6gWL3K+QMQf00PF7ERGrEiLgjuU3mKreLC2MeGhUsNV9ybTbLgd3w==", - "dev": true - }, - "which-module": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz", - "integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho=", - "dev": true - }, "wrap-ansi": { "version": "5.1.0", "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-5.1.0.tgz", @@ -11671,29 +12126,22 @@ "strip-ansi": "^5.0.0" } }, - "y18n": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz", - "integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==", - "dev": true - }, "yargs": { - "version": "13.2.4", - "resolved": "https://registry.npmjs.org/yargs/-/yargs-13.2.4.tgz", - "integrity": "sha512-HG/DWAJa1PAnHT9JAhNa8AbAv3FPaiLzioSjCcmuXXhP8MlpHO5vwls4g4j6n30Z74GVQj8Xa62dWVx1QCGklg==", + "version": "13.3.2", + "resolved": "https://registry.npmjs.org/yargs/-/yargs-13.3.2.tgz", + "integrity": "sha512-AX3Zw5iPruN5ie6xGRIDgqkT+ZhnRlZMLMHAs8tg7nRruy2Nb+i5o9bwghAogtM08q1dpr2LVoS8KSTMYpWXUw==", "dev": true, "requires": { "cliui": "^5.0.0", "find-up": "^3.0.0", "get-caller-file": "^2.0.1", - "os-locale": "^3.1.0", "require-directory": "^2.1.1", "require-main-filename": "^2.0.0", "set-blocking": "^2.0.0", "string-width": "^3.0.0", "which-module": "^2.0.0", "y18n": "^4.0.0", - "yargs-parser": "^13.1.0" + "yargs-parser": "^13.1.2" } }, "yargs-parser": { @@ -11709,9 +12157,9 @@ } }, "webpack-dev-middleware": { - "version": "3.7.2", - "resolved": "https://registry.npmjs.org/webpack-dev-middleware/-/webpack-dev-middleware-3.7.2.tgz", - "integrity": "sha512-1xC42LxbYoqLNAhV6YzTYacicgMZQTqRd27Sim9wn5hJrX3I5nxYy1SxSd4+gjUFsz1dQFj+yEe6zEVmSkeJjw==", + "version": "3.7.3", + "resolved": "https://registry.npmjs.org/webpack-dev-middleware/-/webpack-dev-middleware-3.7.3.tgz", + "integrity": "sha512-djelc/zGiz9nZj/U7PTBi2ViorGJXEWo/3ltkPbDyxCXhhEXkW0ce99falaok4TPj+AsxLiXJR0EBOb0zh9fKQ==", "dev": true, "requires": { "memory-fs": "^0.4.1", @@ -11722,9 +12170,9 @@ }, "dependencies": { "mime": { - "version": "2.4.6", - "resolved": "https://registry.npmjs.org/mime/-/mime-2.4.6.tgz", - "integrity": "sha512-RZKhC3EmpBchfTGBVb8fb+RL2cWyw/32lshnsETttkBAyAUXSGHxbEJWWRXc751DrIxG1q04b8QwMbAwkRPpUA==", + "version": "2.4.7", + "resolved": "https://registry.npmjs.org/mime/-/mime-2.4.7.tgz", + "integrity": "sha512-dhNd1uA2u397uQk3Nv5LM4lm93WYDUXFn3Fu291FJerns4jyTudqhIWe4W04YLy7Uk1tm1Ore04NpjRvQp/NPA==", "dev": true } } @@ -11776,12 +12224,82 @@ "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", "dev": true }, - "camelcase": { - "version": "5.3.1", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", - "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", + "anymatch": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz", + "integrity": "sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==", + "dev": true, + "requires": { + "micromatch": "^3.1.4", + "normalize-path": "^2.1.1" + }, + "dependencies": { + "normalize-path": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-2.1.1.tgz", + "integrity": "sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=", + "dev": true, + "requires": { + "remove-trailing-separator": "^1.0.1" + } + } + } + }, + "binary-extensions": { + "version": "1.13.1", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-1.13.1.tgz", + "integrity": "sha512-Un7MIEDdUC5gNpcGDV97op1Ywk748MpHcFTHoYs6qnj1Z3j7I53VG3nwZhKzoBZmbdRNnb6WRdFlwl7tSDuZGw==", "dev": true }, + "braces": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz", + "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==", + "dev": true, + "requires": { + "arr-flatten": "^1.1.0", + "array-unique": "^0.3.2", + "extend-shallow": "^2.0.1", + "fill-range": "^4.0.0", + "isobject": "^3.0.1", + "repeat-element": "^1.1.2", + "snapdragon": "^0.8.1", + "snapdragon-node": "^2.0.1", + "split-string": "^3.0.2", + "to-regex": "^3.0.1" + }, + "dependencies": { + "extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dev": true, + "requires": { + "is-extendable": "^0.1.0" + } + } + } + }, + "chokidar": { + "version": "2.1.8", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-2.1.8.tgz", + "integrity": "sha512-ZmZUazfOzf0Nve7duiCKD23PFSCs4JPoYyccjUFF3aQkQadqBhfzhjkwBH2mNOG9cTBwhamM37EIsIkZw3nRgg==", + "dev": true, + "requires": { + "anymatch": "^2.0.0", + "async-each": "^1.0.1", + "braces": "^2.3.2", + "fsevents": "^1.2.7", + "glob-parent": "^3.1.0", + "inherits": "^2.0.3", + "is-binary-path": "^1.0.0", + "is-glob": "^4.0.0", + "normalize-path": "^3.0.0", + "path-is-absolute": "^1.0.0", + "readdirp": "^2.2.1", + "upath": "^1.1.1" + } + }, "cliui": { "version": "5.0.0", "resolved": "https://registry.npmjs.org/cliui/-/cliui-5.0.0.tgz", @@ -11810,6 +12328,35 @@ } } }, + "emoji-regex": { + "version": "7.0.3", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-7.0.3.tgz", + "integrity": "sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA==", + "dev": true + }, + "fill-range": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz", + "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=", + "dev": true, + "requires": { + "extend-shallow": "^2.0.1", + "is-number": "^3.0.0", + "repeat-string": "^1.6.1", + "to-regex-range": "^2.1.0" + }, + "dependencies": { + "extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dev": true, + "requires": { + "is-extendable": "^0.1.0" + } + } + } + }, "find-up": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/find-up/-/find-up-3.0.0.tgz", @@ -11819,12 +12366,83 @@ "locate-path": "^3.0.0" } }, - "get-caller-file": { - "version": "2.0.5", - "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz", - "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==", + "fsevents": { + "version": "1.2.13", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-1.2.13.tgz", + "integrity": "sha512-oWb1Z6mkHIskLzEJ/XWX0srkpkTQ7vaopMQkyaEIoq0fmtFVxOthb8cCxeT+p3ynTdkk/RZwbgG4brR5BeWECw==", + "dev": true, + "optional": true, + "requires": { + "bindings": "^1.5.0", + "nan": "^2.12.1" + } + }, + "glob-parent": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-3.1.0.tgz", + "integrity": "sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=", + "dev": true, + "requires": { + "is-glob": "^3.1.0", + "path-dirname": "^1.0.0" + }, + "dependencies": { + "is-glob": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-3.1.0.tgz", + "integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=", + "dev": true, + "requires": { + "is-extglob": "^2.1.0" + } + } + } + }, + "import-local": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/import-local/-/import-local-2.0.0.tgz", + "integrity": "sha512-b6s04m3O+s3CGSbqDIyP4R6aAwAeYlVq9+WUWep6iHa8ETRf9yei1U48C5MmfJmV9AiLYYBKPMq/W+/WRpQmCQ==", + "dev": true, + "requires": { + "pkg-dir": "^3.0.0", + "resolve-cwd": "^2.0.0" + } + }, + "is-binary-path": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-1.0.1.tgz", + "integrity": "sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=", + "dev": true, + "requires": { + "binary-extensions": "^1.0.0" + } + }, + "is-fullwidth-code-point": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz", + "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=", "dev": true }, + "is-number": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", + "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", + "dev": true, + "requires": { + "kind-of": "^3.0.2" + }, + "dependencies": { + "kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dev": true, + "requires": { + "is-buffer": "^1.1.5" + } + } + } + }, "locate-path": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz", @@ -11835,6 +12453,27 @@ "path-exists": "^3.0.0" } }, + "micromatch": { + "version": "3.1.10", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz", + "integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==", + "dev": true, + "requires": { + "arr-diff": "^4.0.0", + "array-unique": "^0.3.2", + "braces": "^2.3.1", + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "extglob": "^2.0.4", + "fragment-cache": "^0.2.1", + "kind-of": "^6.0.2", + "nanomatch": "^1.2.9", + "object.pick": "^1.3.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.2" + } + }, "p-locate": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz", @@ -11850,23 +12489,62 @@ "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", "dev": true }, - "require-main-filename": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", - "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==", - "dev": true - }, - "schema-utils": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", - "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", + "pkg-dir": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-3.0.0.tgz", + "integrity": "sha512-/E57AYkoeQ25qkxMj5PBOVgF8Kiu/h7cYS30Z5+R7WaiCCBfLq58ZI/dSeaEKb9WVJV5n/03QwrN3IeWIFllvw==", "dev": true, "requires": { - "ajv": "^6.1.0", - "ajv-errors": "^1.0.0", - "ajv-keywords": "^3.1.0" + "find-up": "^3.0.0" } }, + "readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "requires": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "readdirp": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-2.2.1.tgz", + "integrity": "sha512-1JU/8q+VgFZyxwrJ+SVIOsh+KywWGpds3NTqikiKpDMZWScmAYyKIgqkO+ARvNWJfXeXR1zxz7aHF4u4CyH6vQ==", + "dev": true, + "requires": { + "graceful-fs": "^4.1.11", + "micromatch": "^3.1.10", + "readable-stream": "^2.0.2" + } + }, + "resolve-cwd": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/resolve-cwd/-/resolve-cwd-2.0.0.tgz", + "integrity": "sha1-AKn3OHVW4nA46uIyyqNypqWbZlo=", + "dev": true, + "requires": { + "resolve-from": "^3.0.0" + } + }, + "resolve-from": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-3.0.0.tgz", + "integrity": "sha1-six699nWiBvItuZTM17rywoYh0g=", + "dev": true + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "dev": true + }, "string-width": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/string-width/-/string-width-3.1.0.tgz", @@ -11895,6 +12573,15 @@ } } }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dev": true, + "requires": { + "safe-buffer": "~5.1.0" + } + }, "strip-ansi": { "version": "3.0.1", "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", @@ -11913,11 +12600,15 @@ "has-flag": "^3.0.0" } }, - "which-module": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz", - "integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho=", - "dev": true + "to-regex-range": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz", + "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=", + "dev": true, + "requires": { + "is-number": "^3.0.0", + "repeat-string": "^1.6.1" + } }, "wrap-ansi": { "version": "5.1.0", @@ -11956,12 +12647,6 @@ "async-limiter": "~1.0.0" } }, - "y18n": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz", - "integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==", - "dev": true - }, "yargs": { "version": "13.3.2", "resolved": "https://registry.npmjs.org/yargs/-/yargs-13.3.2.tgz", @@ -12000,14 +12685,6 @@ "requires": { "ansi-colors": "^3.0.0", "uuid": "^3.3.2" - }, - "dependencies": { - "ansi-colors": { - "version": "3.2.4", - "resolved": "https://registry.npmjs.org/ansi-colors/-/ansi-colors-3.2.4.tgz", - "integrity": "sha512-hHUXGagefjN2iRrID63xckIvotOXOojhQKWIPUZ4mNUZ9nLZW+7FMNoE1lOkEhNWYsx/7ysGIuJYCiMAA9FnrA==", - "dev": true - } } }, "webpack-sources": { @@ -12018,14 +12695,6 @@ "requires": { "source-list-map": "^2.0.0", "source-map": "~0.6.1" - }, - "dependencies": { - "source-map": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", - "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", - "dev": true - } } }, "websocket-driver": { @@ -12078,12 +12747,24 @@ "isexe": "^2.0.0" } }, + "which-module": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz", + "integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho=", + "dev": true + }, "word-wrap": { "version": "1.2.3", "resolved": "https://registry.npmjs.org/word-wrap/-/word-wrap-1.2.3.tgz", "integrity": "sha512-Hz/mrNwitNRh/HUAtM/VT/5VH+ygD6DV7mYKZAtHOrbs8U7lvPS6xf7EJKMF0uW1KJCl0H701g3ZGus+muE5vQ==", "dev": true }, + "wordwrap": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/wordwrap/-/wordwrap-1.0.0.tgz", + "integrity": "sha1-J1hIEIkUVqQXHI0CJkQa3pDLyus=", + "dev": true + }, "worker-farm": { "version": "1.7.0", "resolved": "https://registry.npmjs.org/worker-farm/-/worker-farm-1.7.0.tgz", @@ -12093,6 +12774,52 @@ "errno": "~0.1.7" } }, + "wrap-ansi": { + "version": "6.2.0", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-6.2.0.tgz", + "integrity": "sha512-r6lPcBGxZXlIcymEu7InxDMhdW0KDxpLgoFLcguasxCaJ/SOIZwINatK9KY/tf+ZrlywOKU0UDj3ATXUBfxJXA==", + "dev": true, + "requires": { + "ansi-styles": "^4.0.0", + "string-width": "^4.1.0", + "strip-ansi": "^6.0.0" + }, + "dependencies": { + "ansi-styles": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "dev": true, + "requires": { + "color-convert": "^2.0.1" + } + }, + "color-convert": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", + "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", + "dev": true, + "requires": { + "color-name": "~1.1.4" + } + }, + "color-name": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", + "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", + "dev": true + }, + "strip-ansi": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", + "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", + "dev": true, + "requires": { + "ansi-regex": "^5.0.0" + } + } + } + }, "wrappy": { "version": "1.0.2", "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", @@ -12121,9 +12848,9 @@ } }, "ws": { - "version": "7.4.0", - "resolved": "https://registry.npmjs.org/ws/-/ws-7.4.0.tgz", - "integrity": "sha512-kyFwXuV/5ymf+IXhS6f0+eAFvydbaBW3zjpT6hUdAh/hbVjTIB5EHBGi0bPoCLSK2wcuz3BrEkB9LrYv1Nm4NQ==", + "version": "7.4.1", + "resolved": "https://registry.npmjs.org/ws/-/ws-7.4.1.tgz", + "integrity": "sha512-pTsP8UAfhy3sk1lSk/O/s4tjD0CRwvMnzvwr4OKGX7ZvqZtUyx4KIJB5JWbkykPoc55tixMGgTNoh3k4FkNGFQ==", "dev": true }, "xml-name-validator": { @@ -12144,6 +12871,55 @@ "integrity": "sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ==", "dev": true }, + "y18n": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.1.tgz", + "integrity": "sha512-wNcy4NvjMYL8gogWWYAO7ZFWFfHcbdbE57tZO8e4cbpj8tfUcwrwqSl3ad8HxpYWCdXcJUCeKKZS62Av1affwQ==", + "dev": true + }, + "yallist": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-4.0.0.tgz", + "integrity": "sha512-3wdGidZyq5PB084XLES5TpOSRA3wjXAlIWMhum2kRcv/41Sn2emQ0dycQW4uZXLejwKvg6EsvbdlVL+FYEct7A==", + "dev": true + }, + "yargs": { + "version": "15.4.1", + "resolved": "https://registry.npmjs.org/yargs/-/yargs-15.4.1.tgz", + "integrity": "sha512-aePbxDmcYW++PaqBsJ+HYUFwCdv4LVvdnhBy78E57PIor8/OVvhMrADFFEDh8DHDFRv/O9i3lPhsENjO7QX0+A==", + "dev": true, + "requires": { + "cliui": "^6.0.0", + "decamelize": "^1.2.0", + "find-up": "^4.1.0", + "get-caller-file": "^2.0.1", + "require-directory": "^2.1.1", + "require-main-filename": "^2.0.0", + "set-blocking": "^2.0.0", + "string-width": "^4.2.0", + "which-module": "^2.0.0", + "y18n": "^4.0.0", + "yargs-parser": "^18.1.2" + }, + "dependencies": { + "yargs-parser": { + "version": "18.1.3", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-18.1.3.tgz", + "integrity": "sha512-o50j0JeToy/4K6OZcaQmW6lyXXKhq7csREXcDwk2omFPJEwUNOVtJKvmDr9EI1fAJZUyZcRF7kxGBWmRXudrCQ==", + "dev": true, + "requires": { + "camelcase": "^5.0.0", + "decamelize": "^1.2.0" + } + } + } + }, + "yargs-parser": { + "version": "20.2.4", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-20.2.4.tgz", + "integrity": "sha512-WOkpgNhPTlE73h4VFAFsOnomJVaovO8VqLDzy5saChRBFQFBoMYirowyW+Q9HB4HFF4Z7VZTiG3iSzJJA29yRA==", + "dev": true + }, "yauzl": { "version": "2.10.0", "resolved": "https://registry.npmjs.org/yauzl/-/yauzl-2.10.0.tgz", From 7288532988442e229bbce1270191c73232f90afb Mon Sep 17 00:00:00 2001 From: liabru Date: Sat, 26 Dec 2020 22:44:24 +0000 Subject: [PATCH 18/23] release 0.15.0 (#946) --- CHANGELOG.md | 54 + RELEASE.md | 42 + build/matter.js | 13740 ++++++++++++++++++++++-------------------- build/matter.min.js | 102 +- demo/js/Examples.js | 122 +- package-lock.json | 2 +- package.json | 2 +- 7 files changed, 7255 insertions(+), 6809 deletions(-) create mode 100644 RELEASE.md diff --git a/CHANGELOG.md b/CHANGELOG.md index 3e3f202..63a3891 100644 --- a/CHANGELOG.md +++ b/CHANGELOG.md @@ -1,3 +1,57 @@ +## 0.15.0 (2020-12-24) + +* add window global, stub require and handle bad values in test tools ([497ac80](https://github.com/liabru/matter-js/commit/497ac80)) +* added Body.setCentre, closes #684, closes #461, closes #679 ([2ec247b](https://github.com/liabru/matter-js/commit/2ec247b)), closes [#684](https://github.com/liabru/matter-js/issues/684) [#461](https://github.com/liabru/matter-js/issues/461) [#679](https://github.com/liabru/matter-js/issues/679) +* added browser tests ([ceb7cd5](https://github.com/liabru/matter-js/commit/ceb7cd5)) +* Added build comparison tools and tests ([b7c938a](https://github.com/liabru/matter-js/commit/b7c938a)) +* added check for window in Common.now ([9ef9d02](https://github.com/liabru/matter-js/commit/9ef9d02)) +* added comparison output file option to test tools ([45aae25](https://github.com/liabru/matter-js/commit/45aae25)) +* Added config and test files to lint ([21e4ea6](https://github.com/liabru/matter-js/commit/21e4ea6)) +* added Constraint.pointAWorld and Constraint.pointBWorld ([3c32969](https://github.com/liabru/matter-js/commit/3c32969)) +* added examples to dev server bundle and commit built examples ([fe80478](https://github.com/liabru/matter-js/commit/fe80478)) +* added module export to examples ([f9ea799](https://github.com/liabru/matter-js/commit/f9ea799)) +* added overlap metric to test tools ([3fd674d](https://github.com/liabru/matter-js/commit/3fd674d)) +* added release scripts ([341c247](https://github.com/liabru/matter-js/commit/341c247)) +* added tag push to release task ([060283b](https://github.com/liabru/matter-js/commit/060283b)) +* added timing to engine snapshot ([e0cdbb8](https://github.com/liabru/matter-js/commit/e0cdbb8)) +* Added watch content base to dev server ([f471d4e](https://github.com/liabru/matter-js/commit/f471d4e)) +* added webpack build script ([046013e](https://github.com/liabru/matter-js/commit/046013e)) +* changed alpha build configuration ([182c84a](https://github.com/liabru/matter-js/commit/182c84a)) +* changed demo to auto populate examples with sourceLink and init ([5b0d34b](https://github.com/liabru/matter-js/commit/5b0d34b)) +* changed demo to serve without sub-directory ([823bbc0](https://github.com/liabru/matter-js/commit/823bbc0)) +* changed docs build config ([864452d](https://github.com/liabru/matter-js/commit/864452d)) +* changed example tests to use jest ([104d319](https://github.com/liabru/matter-js/commit/104d319)) +* fix decomp import in Bodies.fromVertices ([94e9614](https://github.com/liabru/matter-js/commit/94e9614)) +* fix decomp require ([0af1645](https://github.com/liabru/matter-js/commit/0af1645)) +* fix issues with render pixel ratio, closes #686, closes #687 ([d577477](https://github.com/liabru/matter-js/commit/d577477)), closes [#686](https://github.com/liabru/matter-js/issues/686) [#687](https://github.com/liabru/matter-js/issues/687) +* fix lint ([5a0079d](https://github.com/liabru/matter-js/commit/5a0079d)) +* fix lint issues ([9ca21c1](https://github.com/liabru/matter-js/commit/9ca21c1)) +* fix path to build in test worker ([fcdb4fa](https://github.com/liabru/matter-js/commit/fcdb4fa)) +* fix preversion script ([c368c14](https://github.com/liabru/matter-js/commit/c368c14)) +* fix terrain example module export ([4a967ec](https://github.com/liabru/matter-js/commit/4a967ec)) +* Fix typo in docs ([c486635](https://github.com/liabru/matter-js/commit/c486635)) +* fixed plugins in compare ([82bb415](https://github.com/liabru/matter-js/commit/82bb415)) +* implemented threaded comparison testing ([285d70d](https://github.com/liabru/matter-js/commit/285d70d)) +* Optimized Body's hidden class ([b3220cf](https://github.com/liabru/matter-js/commit/b3220cf)) +* Optimized Events.trigger method when no event is emitted ([b17cb48](https://github.com/liabru/matter-js/commit/b17cb48)) +* remove gulp ([6a28090](https://github.com/liabru/matter-js/commit/6a28090)) +* remove old demo libs ([13c7eb5](https://github.com/liabru/matter-js/commit/13c7eb5)) +* removed unused gulp release tasks ([e5a7311](https://github.com/liabru/matter-js/commit/e5a7311)) +* removed yuidocjs dev dependency ([ee848d2](https://github.com/liabru/matter-js/commit/ee848d2)) +* Set loose build version on dev server ([1fcf292](https://github.com/liabru/matter-js/commit/1fcf292)) +* update build script ([90abab6](https://github.com/liabru/matter-js/commit/90abab6)) +* update default render theme ([d258411](https://github.com/liabru/matter-js/commit/d258411)) +* update demo and example render styles ([6dd5ec5](https://github.com/liabru/matter-js/commit/6dd5ec5)) +* update dependencies ([e1e058c](https://github.com/liabru/matter-js/commit/e1e058c)) ([5f5b8a1](https://github.com/liabru/matter-js/commit/5f5b8a1)) +* update examples build config and scripts ([69afb11](https://github.com/liabru/matter-js/commit/69afb11)) +* update package lock ([ac3da07](https://github.com/liabru/matter-js/commit/ac3da07)) +* updated build scripts ([6b698ea](https://github.com/liabru/matter-js/commit/6b698ea)) +* updated ci ([288b9cd](https://github.com/liabru/matter-js/commit/288b9cd)) +* updated docs ([50cf171](https://github.com/liabru/matter-js/commit/50cf171)) +* updated readme ([ea5c012](https://github.com/liabru/matter-js/commit/ea5c012)) ([61b1963](https://github.com/liabru/matter-js/commit/61b1963)) + + + ## 0.14.2 (2018-06-11) diff --git a/RELEASE.md b/RELEASE.md new file mode 100644 index 0000000..a334688 --- /dev/null +++ b/RELEASE.md @@ -0,0 +1,42 @@ +## ▲.● matter.js `0.15.0` + +Release notes for `0.15.0`. See the release [readme](https://github.com/liabru/matter-js/blob/0.15.0/README.md) for further information. + +### Highlights ✺ + +- __Optimised performance up to ~30% boost vs. `0.14.2`__ ([#528](https://github.com/liabru/matter-js/pull/528)) ([#522](https://github.com/liabru/matter-js/pull/522)) ([#553](https://github.com/liabru/matter-js/pull/553)) +- Added `Body.setCentre` ([2ec247b](https://github.com/liabru/matter-js/commit/2ec247b)) +- Added `Constraint.pointAWorld` and `Constraint.pointBWorld` ([3c32969](https://github.com/liabru/matter-js/commit/3c32969)) +- Changed default colour scheme ([d258411](https://github.com/liabru/matter-js/commit/d258411)) ([6dd5ec5](https://github.com/liabru/matter-js/commit/6dd5ec5)) +- Fixed issues with decomp require ([0af1645](https://github.com/liabru/matter-js/commit/0af1645)) +- Fixed issues with render pixel ratio ([d577477](https://github.com/liabru/matter-js/commit/d577477)) + +### Changes ✲ + +See the release [compare page](https://github.com/liabru/matter-js/compare/0.14.2...0.15.0) and the [changelog](https://github.com/liabru/matter-js/blob/0.15.0/CHANGELOG.md) for a detailed list of all changes. + +### Comparison ⎄ + +Differences in behaviour, quality and performance against the previous release `0.14.2`. For more information see [comparison method](https://github.com/liabru/matter-js/pull/794). + +```ocaml +Output comparison of 41 examples against matter-js@0.14.2 build on last run + +Similarity 100% Performance +33.6% Overlap +0.00% + +airFriction · · avalanche · · ballPool · · bridge · · broadphase · · car · · +catapult · · chains · · circleStack · · cloth · · collisionFiltering · · +compositeManipulation · · compound · · compoundStack · · concave · · constraints · · +doublePendulum · · events · · friction · · gravity · · gyro · · +manipulation · · mixed · · newtonsCradle · · pyramid · · ragdoll · · +raycasting · · restitution · · rounded · · sensors · · sleeping · · +slingshot · · softBody · · sprites · · stack · · staticFriction · · +stress · · stress2 · · timescale · · views · · wreckingBall · · + +where · no change ● extrinsics changed ◆ intrinsics changed + +``` + +### Contributors ♥︎ + +Many thanks to the [contributors](https://github.com/liabru/matter-js/compare/0.14.2...0.15.0) of this release, [past contributors](https://github.com/liabru/matter-js/graphs/contributors) as well those involved in the [community](https://github.com/liabru/matter-js/issues) for your input and support. diff --git a/build/matter.js b/build/matter.js index b36c3f5..2ffab81 100644 --- a/build/matter.js +++ b/build/matter.js @@ -1,10 +1,8 @@ -/** -* matter-js 0.14.2 by @liabru 2018-06-11 -* http://brm.io/matter-js/ -* License MIT -*/ - -/** +/*! + * matter-js 0.15.0 by @liabru 2020-12-26 + * http://brm.io/matter-js/ + * License MIT + * * The MIT License (MIT) * * Copyright (c) Liam Brummitt and contributors. @@ -27,8 +25,2282 @@ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN * THE SOFTWARE. */ +(function webpackUniversalModuleDefinition(root, factory) { + if(typeof exports === 'object' && typeof module === 'object') + module.exports = factory((function webpackLoadOptionalExternalModule() { try { return require("poly-decomp"); } catch(e) {} }())); + else if(typeof define === 'function' && define.amd) + define("Matter", ["poly-decomp"], factory); + else if(typeof exports === 'object') + exports["Matter"] = factory((function webpackLoadOptionalExternalModule() { try { return require("poly-decomp"); } catch(e) {} }())); + else + root["Matter"] = factory(root["decomp"]); +})(this, function(__WEBPACK_EXTERNAL_MODULE__27__) { +return /******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; +/******/ +/******/ // The require function +/******/ function __webpack_require__(moduleId) { +/******/ +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) { +/******/ return installedModules[moduleId].exports; +/******/ } +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ i: moduleId, +/******/ l: false, +/******/ exports: {} +/******/ }; +/******/ +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); +/******/ +/******/ // Flag the module as loaded +/******/ module.l = true; +/******/ +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } +/******/ +/******/ +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; +/******/ +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; +/******/ +/******/ // define getter function for harmony exports +/******/ __webpack_require__.d = function(exports, name, getter) { +/******/ if(!__webpack_require__.o(exports, name)) { +/******/ Object.defineProperty(exports, name, { enumerable: true, get: getter }); +/******/ } +/******/ }; +/******/ +/******/ // define __esModule on exports +/******/ __webpack_require__.r = function(exports) { +/******/ if(typeof Symbol !== 'undefined' && Symbol.toStringTag) { +/******/ Object.defineProperty(exports, Symbol.toStringTag, { value: 'Module' }); +/******/ } +/******/ Object.defineProperty(exports, '__esModule', { value: true }); +/******/ }; +/******/ +/******/ // create a fake namespace object +/******/ // mode & 1: value is a module id, require it +/******/ // mode & 2: merge all properties of value into the ns +/******/ // mode & 4: return value when already ns object +/******/ // mode & 8|1: behave like require +/******/ __webpack_require__.t = function(value, mode) { +/******/ if(mode & 1) value = __webpack_require__(value); +/******/ if(mode & 8) return value; +/******/ if((mode & 4) && typeof value === 'object' && value && value.__esModule) return value; +/******/ var ns = Object.create(null); +/******/ __webpack_require__.r(ns); +/******/ Object.defineProperty(ns, 'default', { enumerable: true, value: value }); +/******/ if(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key)); +/******/ return ns; +/******/ }; +/******/ +/******/ // getDefaultExport function for compatibility with non-harmony modules +/******/ __webpack_require__.n = function(module) { +/******/ var getter = module && module.__esModule ? +/******/ function getDefault() { return module['default']; } : +/******/ function getModuleExports() { return module; }; +/******/ __webpack_require__.d(getter, 'a', getter); +/******/ return getter; +/******/ }; +/******/ +/******/ // Object.prototype.hasOwnProperty.call +/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); }; +/******/ +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; +/******/ +/******/ +/******/ // Load entry module and return exports +/******/ return __webpack_require__(__webpack_require__.s = 24); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ (function(module, exports) { + +/** +* The `Matter.Common` module contains utility functions that are common to all modules. +* +* @class Common +*/ + +var Common = {}; + +module.exports = Common; + +(function() { + + Common._nextId = 0; + Common._seed = 0; + Common._nowStartTime = +(new Date()); + + /** + * Extends the object in the first argument using the object in the second argument. + * @method extend + * @param {} obj + * @param {boolean} deep + * @return {} obj extended + */ + Common.extend = function(obj, deep) { + var argsStart, + args, + deepClone; + + if (typeof deep === 'boolean') { + argsStart = 2; + deepClone = deep; + } else { + argsStart = 1; + deepClone = true; + } + + for (var i = argsStart; i < arguments.length; i++) { + var source = arguments[i]; + + if (source) { + for (var prop in source) { + if (deepClone && source[prop] && source[prop].constructor === Object) { + if (!obj[prop] || obj[prop].constructor === Object) { + obj[prop] = obj[prop] || {}; + Common.extend(obj[prop], deepClone, source[prop]); + } else { + obj[prop] = source[prop]; + } + } else { + obj[prop] = source[prop]; + } + } + } + } + + return obj; + }; + + /** + * Creates a new clone of the object, if deep is true references will also be cloned. + * @method clone + * @param {} obj + * @param {bool} deep + * @return {} obj cloned + */ + Common.clone = function(obj, deep) { + return Common.extend({}, deep, obj); + }; + + /** + * Returns the list of keys for the given object. + * @method keys + * @param {} obj + * @return {string[]} keys + */ + Common.keys = function(obj) { + if (Object.keys) + return Object.keys(obj); + + // avoid hasOwnProperty for performance + var keys = []; + for (var key in obj) + keys.push(key); + return keys; + }; + + /** + * Returns the list of values for the given object. + * @method values + * @param {} obj + * @return {array} Array of the objects property values + */ + Common.values = function(obj) { + var values = []; + + if (Object.keys) { + var keys = Object.keys(obj); + for (var i = 0; i < keys.length; i++) { + values.push(obj[keys[i]]); + } + return values; + } + + // avoid hasOwnProperty for performance + for (var key in obj) + values.push(obj[key]); + return values; + }; + + /** + * Gets a value from `base` relative to the `path` string. + * @method get + * @param {} obj The base object + * @param {string} path The path relative to `base`, e.g. 'Foo.Bar.baz' + * @param {number} [begin] Path slice begin + * @param {number} [end] Path slice end + * @return {} The object at the given path + */ + Common.get = function(obj, path, begin, end) { + path = path.split('.').slice(begin, end); + + for (var i = 0; i < path.length; i += 1) { + obj = obj[path[i]]; + } + + return obj; + }; + + /** + * Sets a value on `base` relative to the given `path` string. + * @method set + * @param {} obj The base object + * @param {string} path The path relative to `base`, e.g. 'Foo.Bar.baz' + * @param {} val The value to set + * @param {number} [begin] Path slice begin + * @param {number} [end] Path slice end + * @return {} Pass through `val` for chaining + */ + Common.set = function(obj, path, val, begin, end) { + var parts = path.split('.').slice(begin, end); + Common.get(obj, path, 0, -1)[parts[parts.length - 1]] = val; + return val; + }; + + /** + * Shuffles the given array in-place. + * The function uses a seeded random generator. + * @method shuffle + * @param {array} array + * @return {array} array shuffled randomly + */ + Common.shuffle = function(array) { + for (var i = array.length - 1; i > 0; i--) { + var j = Math.floor(Common.random() * (i + 1)); + var temp = array[i]; + array[i] = array[j]; + array[j] = temp; + } + return array; + }; + + /** + * Randomly chooses a value from a list with equal probability. + * The function uses a seeded random generator. + * @method choose + * @param {array} choices + * @return {object} A random choice object from the array + */ + Common.choose = function(choices) { + return choices[Math.floor(Common.random() * choices.length)]; + }; + + /** + * Returns true if the object is a HTMLElement, otherwise false. + * @method isElement + * @param {object} obj + * @return {boolean} True if the object is a HTMLElement, otherwise false + */ + Common.isElement = function(obj) { + if (typeof HTMLElement !== 'undefined') { + return obj instanceof HTMLElement; + } + + return !!(obj && obj.nodeType && obj.nodeName); + }; + + /** + * Returns true if the object is an array. + * @method isArray + * @param {object} obj + * @return {boolean} True if the object is an array, otherwise false + */ + Common.isArray = function(obj) { + return Object.prototype.toString.call(obj) === '[object Array]'; + }; + + /** + * Returns true if the object is a function. + * @method isFunction + * @param {object} obj + * @return {boolean} True if the object is a function, otherwise false + */ + Common.isFunction = function(obj) { + return typeof obj === "function"; + }; + + /** + * Returns true if the object is a plain object. + * @method isPlainObject + * @param {object} obj + * @return {boolean} True if the object is a plain object, otherwise false + */ + Common.isPlainObject = function(obj) { + return typeof obj === 'object' && obj.constructor === Object; + }; + + /** + * Returns true if the object is a string. + * @method isString + * @param {object} obj + * @return {boolean} True if the object is a string, otherwise false + */ + Common.isString = function(obj) { + return toString.call(obj) === '[object String]'; + }; + + /** + * Returns the given value clamped between a minimum and maximum value. + * @method clamp + * @param {number} value + * @param {number} min + * @param {number} max + * @return {number} The value clamped between min and max inclusive + */ + Common.clamp = function(value, min, max) { + if (value < min) + return min; + if (value > max) + return max; + return value; + }; + + /** + * Returns the sign of the given value. + * @method sign + * @param {number} value + * @return {number} -1 if negative, +1 if 0 or positive + */ + Common.sign = function(value) { + return value < 0 ? -1 : 1; + }; + + /** + * Returns the current timestamp since the time origin (e.g. from page load). + * The result will be high-resolution including decimal places if available. + * @method now + * @return {number} the current timestamp + */ + Common.now = function() { + if (typeof window !== 'undefined' && window.performance) { + if (window.performance.now) { + return window.performance.now(); + } else if (window.performance.webkitNow) { + return window.performance.webkitNow(); + } + } + + return (new Date()) - Common._nowStartTime; + }; + + /** + * Returns a random value between a minimum and a maximum value inclusive. + * The function uses a seeded random generator. + * @method random + * @param {number} min + * @param {number} max + * @return {number} A random number between min and max inclusive + */ + Common.random = function(min, max) { + min = (typeof min !== "undefined") ? min : 0; + max = (typeof max !== "undefined") ? max : 1; + return min + _seededRandom() * (max - min); + }; + + var _seededRandom = function() { + // https://en.wikipedia.org/wiki/Linear_congruential_generator + Common._seed = (Common._seed * 9301 + 49297) % 233280; + return Common._seed / 233280; + }; + + /** + * Converts a CSS hex colour string into an integer. + * @method colorToNumber + * @param {string} colorString + * @return {number} An integer representing the CSS hex string + */ + Common.colorToNumber = function(colorString) { + colorString = colorString.replace('#',''); + + if (colorString.length == 3) { + colorString = colorString.charAt(0) + colorString.charAt(0) + + colorString.charAt(1) + colorString.charAt(1) + + colorString.charAt(2) + colorString.charAt(2); + } + + return parseInt(colorString, 16); + }; + + /** + * The console logging level to use, where each level includes all levels above and excludes the levels below. + * The default level is 'debug' which shows all console messages. + * + * Possible level values are: + * - 0 = None + * - 1 = Debug + * - 2 = Info + * - 3 = Warn + * - 4 = Error + * @property Common.logLevel + * @type {Number} + * @default 1 + */ + Common.logLevel = 1; + + /** + * Shows a `console.log` message only if the current `Common.logLevel` allows it. + * The message will be prefixed with 'matter-js' to make it easily identifiable. + * @method log + * @param ...objs {} The objects to log. + */ + Common.log = function() { + if (console && Common.logLevel > 0 && Common.logLevel <= 3) { + console.log.apply(console, ['matter-js:'].concat(Array.prototype.slice.call(arguments))); + } + }; + + /** + * Shows a `console.info` message only if the current `Common.logLevel` allows it. + * The message will be prefixed with 'matter-js' to make it easily identifiable. + * @method info + * @param ...objs {} The objects to log. + */ + Common.info = function() { + if (console && Common.logLevel > 0 && Common.logLevel <= 2) { + console.info.apply(console, ['matter-js:'].concat(Array.prototype.slice.call(arguments))); + } + }; + + /** + * Shows a `console.warn` message only if the current `Common.logLevel` allows it. + * The message will be prefixed with 'matter-js' to make it easily identifiable. + * @method warn + * @param ...objs {} The objects to log. + */ + Common.warn = function() { + if (console && Common.logLevel > 0 && Common.logLevel <= 3) { + console.warn.apply(console, ['matter-js:'].concat(Array.prototype.slice.call(arguments))); + } + }; + + /** + * Returns the next unique sequential ID. + * @method nextId + * @return {Number} Unique sequential ID + */ + Common.nextId = function() { + return Common._nextId++; + }; + + /** + * A cross browser compatible indexOf implementation. + * @method indexOf + * @param {array} haystack + * @param {object} needle + * @return {number} The position of needle in haystack, otherwise -1. + */ + Common.indexOf = function(haystack, needle) { + if (haystack.indexOf) + return haystack.indexOf(needle); + + for (var i = 0; i < haystack.length; i++) { + if (haystack[i] === needle) + return i; + } + + return -1; + }; + + /** + * A cross browser compatible array map implementation. + * @method map + * @param {array} list + * @param {function} func + * @return {array} Values from list transformed by func. + */ + Common.map = function(list, func) { + if (list.map) { + return list.map(func); + } + + var mapped = []; + + for (var i = 0; i < list.length; i += 1) { + mapped.push(func(list[i])); + } + + return mapped; + }; + + /** + * Takes a directed graph and returns the partially ordered set of vertices in topological order. + * Circular dependencies are allowed. + * @method topologicalSort + * @param {object} graph + * @return {array} Partially ordered set of vertices in topological order. + */ + Common.topologicalSort = function(graph) { + // https://github.com/mgechev/javascript-algorithms + // Copyright (c) Minko Gechev (MIT license) + // Modifications: tidy formatting and naming + var result = [], + visited = [], + temp = []; + + for (var node in graph) { + if (!visited[node] && !temp[node]) { + Common._topologicalSort(node, visited, temp, graph, result); + } + } + + return result; + }; + + Common._topologicalSort = function(node, visited, temp, graph, result) { + var neighbors = graph[node] || []; + temp[node] = true; + + for (var i = 0; i < neighbors.length; i += 1) { + var neighbor = neighbors[i]; + + if (temp[neighbor]) { + // skip circular dependencies + continue; + } + + if (!visited[neighbor]) { + Common._topologicalSort(neighbor, visited, temp, graph, result); + } + } + + temp[node] = false; + visited[node] = true; + + result.push(node); + }; + + /** + * Takes _n_ functions as arguments and returns a new function that calls them in order. + * The arguments applied when calling the new function will also be applied to every function passed. + * The value of `this` refers to the last value returned in the chain that was not `undefined`. + * Therefore if a passed function does not return a value, the previously returned value is maintained. + * After all passed functions have been called the new function returns the last returned value (if any). + * If any of the passed functions are a chain, then the chain will be flattened. + * @method chain + * @param ...funcs {function} The functions to chain. + * @return {function} A new function that calls the passed functions in order. + */ + Common.chain = function() { + var funcs = []; + + for (var i = 0; i < arguments.length; i += 1) { + var func = arguments[i]; + + if (func._chained) { + // flatten already chained functions + funcs.push.apply(funcs, func._chained); + } else { + funcs.push(func); + } + } + + var chain = function() { + // https://github.com/GoogleChrome/devtools-docs/issues/53#issuecomment-51941358 + var lastResult, + args = new Array(arguments.length); + + for (var i = 0, l = arguments.length; i < l; i++) { + args[i] = arguments[i]; + } + + for (i = 0; i < funcs.length; i += 1) { + var result = funcs[i].apply(lastResult, args); + + if (typeof result !== 'undefined') { + lastResult = result; + } + } + + return lastResult; + }; + + chain._chained = funcs; + + return chain; + }; + + /** + * Chains a function to excute before the original function on the given `path` relative to `base`. + * See also docs for `Common.chain`. + * @method chainPathBefore + * @param {} base The base object + * @param {string} path The path relative to `base` + * @param {function} func The function to chain before the original + * @return {function} The chained function that replaced the original + */ + Common.chainPathBefore = function(base, path, func) { + return Common.set(base, path, Common.chain( + func, + Common.get(base, path) + )); + }; + + /** + * Chains a function to excute after the original function on the given `path` relative to `base`. + * See also docs for `Common.chain`. + * @method chainPathAfter + * @param {} base The base object + * @param {string} path The path relative to `base` + * @param {function} func The function to chain after the original + * @return {function} The chained function that replaced the original + */ + Common.chainPathAfter = function(base, path, func) { + return Common.set(base, path, Common.chain( + Common.get(base, path), + func + )); + }; +})(); + + +/***/ }), +/* 1 */ +/***/ (function(module, exports) { + +/** +* The `Matter.Bounds` module contains methods for creating and manipulating axis-aligned bounding boxes (AABB). +* +* @class Bounds +*/ + +var Bounds = {}; + +module.exports = Bounds; + +(function() { + + /** + * Creates a new axis-aligned bounding box (AABB) for the given vertices. + * @method create + * @param {vertices} vertices + * @return {bounds} A new bounds object + */ + Bounds.create = function(vertices) { + var bounds = { + min: { x: 0, y: 0 }, + max: { x: 0, y: 0 } + }; + + if (vertices) + Bounds.update(bounds, vertices); + + return bounds; + }; + + /** + * Updates bounds using the given vertices and extends the bounds given a velocity. + * @method update + * @param {bounds} bounds + * @param {vertices} vertices + * @param {vector} velocity + */ + Bounds.update = function(bounds, vertices, velocity) { + bounds.min.x = Infinity; + bounds.max.x = -Infinity; + bounds.min.y = Infinity; + bounds.max.y = -Infinity; + + for (var i = 0; i < vertices.length; i++) { + var vertex = vertices[i]; + if (vertex.x > bounds.max.x) bounds.max.x = vertex.x; + if (vertex.x < bounds.min.x) bounds.min.x = vertex.x; + if (vertex.y > bounds.max.y) bounds.max.y = vertex.y; + if (vertex.y < bounds.min.y) bounds.min.y = vertex.y; + } + + if (velocity) { + if (velocity.x > 0) { + bounds.max.x += velocity.x; + } else { + bounds.min.x += velocity.x; + } + + if (velocity.y > 0) { + bounds.max.y += velocity.y; + } else { + bounds.min.y += velocity.y; + } + } + }; + + /** + * Returns true if the bounds contains the given point. + * @method contains + * @param {bounds} bounds + * @param {vector} point + * @return {boolean} True if the bounds contain the point, otherwise false + */ + Bounds.contains = function(bounds, point) { + return point.x >= bounds.min.x && point.x <= bounds.max.x + && point.y >= bounds.min.y && point.y <= bounds.max.y; + }; + + /** + * Returns true if the two bounds intersect. + * @method overlaps + * @param {bounds} boundsA + * @param {bounds} boundsB + * @return {boolean} True if the bounds overlap, otherwise false + */ + Bounds.overlaps = function(boundsA, boundsB) { + return (boundsA.min.x <= boundsB.max.x && boundsA.max.x >= boundsB.min.x + && boundsA.max.y >= boundsB.min.y && boundsA.min.y <= boundsB.max.y); + }; + + /** + * Translates the bounds by the given vector. + * @method translate + * @param {bounds} bounds + * @param {vector} vector + */ + Bounds.translate = function(bounds, vector) { + bounds.min.x += vector.x; + bounds.max.x += vector.x; + bounds.min.y += vector.y; + bounds.max.y += vector.y; + }; + + /** + * Shifts the bounds to the given position. + * @method shift + * @param {bounds} bounds + * @param {vector} position + */ + Bounds.shift = function(bounds, position) { + var deltaX = bounds.max.x - bounds.min.x, + deltaY = bounds.max.y - bounds.min.y; + + bounds.min.x = position.x; + bounds.max.x = position.x + deltaX; + bounds.min.y = position.y; + bounds.max.y = position.y + deltaY; + }; + +})(); + + +/***/ }), +/* 2 */ +/***/ (function(module, exports) { + +/** +* The `Matter.Vector` module contains methods for creating and manipulating vectors. +* Vectors are the basis of all the geometry related operations in the engine. +* A `Matter.Vector` object is of the form `{ x: 0, y: 0 }`. +* +* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). +* +* @class Vector +*/ + +// TODO: consider params for reusing vector objects + +var Vector = {}; + +module.exports = Vector; + +(function() { + + /** + * Creates a new vector. + * @method create + * @param {number} x + * @param {number} y + * @return {vector} A new vector + */ + Vector.create = function(x, y) { + return { x: x || 0, y: y || 0 }; + }; + + /** + * Returns a new vector with `x` and `y` copied from the given `vector`. + * @method clone + * @param {vector} vector + * @return {vector} A new cloned vector + */ + Vector.clone = function(vector) { + return { x: vector.x, y: vector.y }; + }; + + /** + * Returns the magnitude (length) of a vector. + * @method magnitude + * @param {vector} vector + * @return {number} The magnitude of the vector + */ + Vector.magnitude = function(vector) { + return Math.sqrt((vector.x * vector.x) + (vector.y * vector.y)); + }; + + /** + * Returns the magnitude (length) of a vector (therefore saving a `sqrt` operation). + * @method magnitudeSquared + * @param {vector} vector + * @return {number} The squared magnitude of the vector + */ + Vector.magnitudeSquared = function(vector) { + return (vector.x * vector.x) + (vector.y * vector.y); + }; + + /** + * Rotates the vector about (0, 0) by specified angle. + * @method rotate + * @param {vector} vector + * @param {number} angle + * @param {vector} [output] + * @return {vector} The vector rotated about (0, 0) + */ + Vector.rotate = function(vector, angle, output) { + var cos = Math.cos(angle), sin = Math.sin(angle); + if (!output) output = {}; + var x = vector.x * cos - vector.y * sin; + output.y = vector.x * sin + vector.y * cos; + output.x = x; + return output; + }; + + /** + * Rotates the vector about a specified point by specified angle. + * @method rotateAbout + * @param {vector} vector + * @param {number} angle + * @param {vector} point + * @param {vector} [output] + * @return {vector} A new vector rotated about the point + */ + Vector.rotateAbout = function(vector, angle, point, output) { + var cos = Math.cos(angle), sin = Math.sin(angle); + if (!output) output = {}; + var x = point.x + ((vector.x - point.x) * cos - (vector.y - point.y) * sin); + output.y = point.y + ((vector.x - point.x) * sin + (vector.y - point.y) * cos); + output.x = x; + return output; + }; + + /** + * Normalises a vector (such that its magnitude is `1`). + * @method normalise + * @param {vector} vector + * @return {vector} A new vector normalised + */ + Vector.normalise = function(vector) { + var magnitude = Vector.magnitude(vector); + if (magnitude === 0) + return { x: 0, y: 0 }; + return { x: vector.x / magnitude, y: vector.y / magnitude }; + }; + + /** + * Returns the dot-product of two vectors. + * @method dot + * @param {vector} vectorA + * @param {vector} vectorB + * @return {number} The dot product of the two vectors + */ + Vector.dot = function(vectorA, vectorB) { + return (vectorA.x * vectorB.x) + (vectorA.y * vectorB.y); + }; + + /** + * Returns the cross-product of two vectors. + * @method cross + * @param {vector} vectorA + * @param {vector} vectorB + * @return {number} The cross product of the two vectors + */ + Vector.cross = function(vectorA, vectorB) { + return (vectorA.x * vectorB.y) - (vectorA.y * vectorB.x); + }; + + /** + * Returns the cross-product of three vectors. + * @method cross3 + * @param {vector} vectorA + * @param {vector} vectorB + * @param {vector} vectorC + * @return {number} The cross product of the three vectors + */ + Vector.cross3 = function(vectorA, vectorB, vectorC) { + return (vectorB.x - vectorA.x) * (vectorC.y - vectorA.y) - (vectorB.y - vectorA.y) * (vectorC.x - vectorA.x); + }; + + /** + * Adds the two vectors. + * @method add + * @param {vector} vectorA + * @param {vector} vectorB + * @param {vector} [output] + * @return {vector} A new vector of vectorA and vectorB added + */ + Vector.add = function(vectorA, vectorB, output) { + if (!output) output = {}; + output.x = vectorA.x + vectorB.x; + output.y = vectorA.y + vectorB.y; + return output; + }; + + /** + * Subtracts the two vectors. + * @method sub + * @param {vector} vectorA + * @param {vector} vectorB + * @param {vector} [output] + * @return {vector} A new vector of vectorA and vectorB subtracted + */ + Vector.sub = function(vectorA, vectorB, output) { + if (!output) output = {}; + output.x = vectorA.x - vectorB.x; + output.y = vectorA.y - vectorB.y; + return output; + }; + + /** + * Multiplies a vector and a scalar. + * @method mult + * @param {vector} vector + * @param {number} scalar + * @return {vector} A new vector multiplied by scalar + */ + Vector.mult = function(vector, scalar) { + return { x: vector.x * scalar, y: vector.y * scalar }; + }; + + /** + * Divides a vector and a scalar. + * @method div + * @param {vector} vector + * @param {number} scalar + * @return {vector} A new vector divided by scalar + */ + Vector.div = function(vector, scalar) { + return { x: vector.x / scalar, y: vector.y / scalar }; + }; + + /** + * Returns the perpendicular vector. Set `negate` to true for the perpendicular in the opposite direction. + * @method perp + * @param {vector} vector + * @param {bool} [negate=false] + * @return {vector} The perpendicular vector + */ + Vector.perp = function(vector, negate) { + negate = negate === true ? -1 : 1; + return { x: negate * -vector.y, y: negate * vector.x }; + }; + + /** + * Negates both components of a vector such that it points in the opposite direction. + * @method neg + * @param {vector} vector + * @return {vector} The negated vector + */ + Vector.neg = function(vector) { + return { x: -vector.x, y: -vector.y }; + }; + + /** + * Returns the angle between the vector `vectorB - vectorA` and the x-axis in radians. + * @method angle + * @param {vector} vectorA + * @param {vector} vectorB + * @return {number} The angle in radians + */ + Vector.angle = function(vectorA, vectorB) { + return Math.atan2(vectorB.y - vectorA.y, vectorB.x - vectorA.x); + }; + + /** + * Temporary vector pool (not thread-safe). + * @property _temp + * @type {vector[]} + * @private + */ + Vector._temp = [ + Vector.create(), Vector.create(), + Vector.create(), Vector.create(), + Vector.create(), Vector.create() + ]; + +})(); + +/***/ }), +/* 3 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Vertices` module contains methods for creating and manipulating sets of vertices. +* A set of vertices is an array of `Matter.Vector` with additional indexing properties inserted by `Vertices.create`. +* A `Matter.Body` maintains a set of vertices to represent the shape of the object (its convex hull). +* +* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). +* +* @class Vertices +*/ + +var Vertices = {}; + +module.exports = Vertices; + +var Vector = __webpack_require__(2); +var Common = __webpack_require__(0); + +(function() { + + /** + * Creates a new set of `Matter.Body` compatible vertices. + * The `points` argument accepts an array of `Matter.Vector` points orientated around the origin `(0, 0)`, for example: + * + * [{ x: 0, y: 0 }, { x: 25, y: 50 }, { x: 50, y: 0 }] + * + * The `Vertices.create` method returns a new array of vertices, which are similar to Matter.Vector objects, + * but with some additional references required for efficient collision detection routines. + * + * Vertices must be specified in clockwise order. + * + * Note that the `body` argument is not optional, a `Matter.Body` reference must be provided. + * + * @method create + * @param {vector[]} points + * @param {body} body + */ + Vertices.create = function(points, body) { + var vertices = []; + + for (var i = 0; i < points.length; i++) { + var point = points[i], + vertex = { + x: point.x, + y: point.y, + index: i, + body: body, + isInternal: false + }; + + vertices.push(vertex); + } + + return vertices; + }; + + /** + * Parses a string containing ordered x y pairs separated by spaces (and optionally commas), + * into a `Matter.Vertices` object for the given `Matter.Body`. + * For parsing SVG paths, see `Svg.pathToVertices`. + * @method fromPath + * @param {string} path + * @param {body} body + * @return {vertices} vertices + */ + Vertices.fromPath = function(path, body) { + var pathPattern = /L?\s*([-\d.e]+)[\s,]*([-\d.e]+)*/ig, + points = []; + + path.replace(pathPattern, function(match, x, y) { + points.push({ x: parseFloat(x), y: parseFloat(y) }); + }); + + return Vertices.create(points, body); + }; + + /** + * Returns the centre (centroid) of the set of vertices. + * @method centre + * @param {vertices} vertices + * @return {vector} The centre point + */ + Vertices.centre = function(vertices) { + var area = Vertices.area(vertices, true), + centre = { x: 0, y: 0 }, + cross, + temp, + j; + + for (var i = 0; i < vertices.length; i++) { + j = (i + 1) % vertices.length; + cross = Vector.cross(vertices[i], vertices[j]); + temp = Vector.mult(Vector.add(vertices[i], vertices[j]), cross); + centre = Vector.add(centre, temp); + } + + return Vector.div(centre, 6 * area); + }; + + /** + * Returns the average (mean) of the set of vertices. + * @method mean + * @param {vertices} vertices + * @return {vector} The average point + */ + Vertices.mean = function(vertices) { + var average = { x: 0, y: 0 }; + + for (var i = 0; i < vertices.length; i++) { + average.x += vertices[i].x; + average.y += vertices[i].y; + } + + return Vector.div(average, vertices.length); + }; + + /** + * Returns the area of the set of vertices. + * @method area + * @param {vertices} vertices + * @param {bool} signed + * @return {number} The area + */ + Vertices.area = function(vertices, signed) { + var area = 0, + j = vertices.length - 1; + + for (var i = 0; i < vertices.length; i++) { + area += (vertices[j].x - vertices[i].x) * (vertices[j].y + vertices[i].y); + j = i; + } + + if (signed) + return area / 2; + + return Math.abs(area) / 2; + }; + + /** + * Returns the moment of inertia (second moment of area) of the set of vertices given the total mass. + * @method inertia + * @param {vertices} vertices + * @param {number} mass + * @return {number} The polygon's moment of inertia + */ + Vertices.inertia = function(vertices, mass) { + var numerator = 0, + denominator = 0, + v = vertices, + cross, + j; + + // find the polygon's moment of inertia, using second moment of area + // from equations at http://www.physicsforums.com/showthread.php?t=25293 + for (var n = 0; n < v.length; n++) { + j = (n + 1) % v.length; + cross = Math.abs(Vector.cross(v[j], v[n])); + numerator += cross * (Vector.dot(v[j], v[j]) + Vector.dot(v[j], v[n]) + Vector.dot(v[n], v[n])); + denominator += cross; + } + + return (mass / 6) * (numerator / denominator); + }; + + /** + * Translates the set of vertices in-place. + * @method translate + * @param {vertices} vertices + * @param {vector} vector + * @param {number} scalar + */ + Vertices.translate = function(vertices, vector, scalar) { + var i; + if (scalar) { + for (i = 0; i < vertices.length; i++) { + vertices[i].x += vector.x * scalar; + vertices[i].y += vector.y * scalar; + } + } else { + for (i = 0; i < vertices.length; i++) { + vertices[i].x += vector.x; + vertices[i].y += vector.y; + } + } + + return vertices; + }; + + /** + * Rotates the set of vertices in-place. + * @method rotate + * @param {vertices} vertices + * @param {number} angle + * @param {vector} point + */ + Vertices.rotate = function(vertices, angle, point) { + if (angle === 0) + return; + + var cos = Math.cos(angle), + sin = Math.sin(angle); + + for (var i = 0; i < vertices.length; i++) { + var vertice = vertices[i], + dx = vertice.x - point.x, + dy = vertice.y - point.y; + + vertice.x = point.x + (dx * cos - dy * sin); + vertice.y = point.y + (dx * sin + dy * cos); + } + + return vertices; + }; + + /** + * Returns `true` if the `point` is inside the set of `vertices`. + * @method contains + * @param {vertices} vertices + * @param {vector} point + * @return {boolean} True if the vertices contains point, otherwise false + */ + Vertices.contains = function(vertices, point) { + for (var i = 0; i < vertices.length; i++) { + var vertice = vertices[i], + nextVertice = vertices[(i + 1) % vertices.length]; + if ((point.x - vertice.x) * (nextVertice.y - vertice.y) + (point.y - vertice.y) * (vertice.x - nextVertice.x) > 0) { + return false; + } + } + + return true; + }; + + /** + * Scales the vertices from a point (default is centre) in-place. + * @method scale + * @param {vertices} vertices + * @param {number} scaleX + * @param {number} scaleY + * @param {vector} point + */ + Vertices.scale = function(vertices, scaleX, scaleY, point) { + if (scaleX === 1 && scaleY === 1) + return vertices; + + point = point || Vertices.centre(vertices); + + var vertex, + delta; + + for (var i = 0; i < vertices.length; i++) { + vertex = vertices[i]; + delta = Vector.sub(vertex, point); + vertices[i].x = point.x + delta.x * scaleX; + vertices[i].y = point.y + delta.y * scaleY; + } + + return vertices; + }; + + /** + * Chamfers a set of vertices by giving them rounded corners, returns a new set of vertices. + * The radius parameter is a single number or an array to specify the radius for each vertex. + * @method chamfer + * @param {vertices} vertices + * @param {number[]} radius + * @param {number} quality + * @param {number} qualityMin + * @param {number} qualityMax + */ + Vertices.chamfer = function(vertices, radius, quality, qualityMin, qualityMax) { + if (typeof radius === 'number') { + radius = [radius]; + } else { + radius = radius || [8]; + } + + // quality defaults to -1, which is auto + quality = (typeof quality !== 'undefined') ? quality : -1; + qualityMin = qualityMin || 2; + qualityMax = qualityMax || 14; + + var newVertices = []; + + for (var i = 0; i < vertices.length; i++) { + var prevVertex = vertices[i - 1 >= 0 ? i - 1 : vertices.length - 1], + vertex = vertices[i], + nextVertex = vertices[(i + 1) % vertices.length], + currentRadius = radius[i < radius.length ? i : radius.length - 1]; + + if (currentRadius === 0) { + newVertices.push(vertex); + continue; + } + + var prevNormal = Vector.normalise({ + x: vertex.y - prevVertex.y, + y: prevVertex.x - vertex.x + }); + + var nextNormal = Vector.normalise({ + x: nextVertex.y - vertex.y, + y: vertex.x - nextVertex.x + }); + + var diagonalRadius = Math.sqrt(2 * Math.pow(currentRadius, 2)), + radiusVector = Vector.mult(Common.clone(prevNormal), currentRadius), + midNormal = Vector.normalise(Vector.mult(Vector.add(prevNormal, nextNormal), 0.5)), + scaledVertex = Vector.sub(vertex, Vector.mult(midNormal, diagonalRadius)); + + var precision = quality; + + if (quality === -1) { + // automatically decide precision + precision = Math.pow(currentRadius, 0.32) * 1.75; + } + + precision = Common.clamp(precision, qualityMin, qualityMax); + + // use an even value for precision, more likely to reduce axes by using symmetry + if (precision % 2 === 1) + precision += 1; + + var alpha = Math.acos(Vector.dot(prevNormal, nextNormal)), + theta = alpha / precision; + + for (var j = 0; j < precision; j++) { + newVertices.push(Vector.add(Vector.rotate(radiusVector, theta * j), scaledVertex)); + } + } + + return newVertices; + }; + + /** + * Sorts the input vertices into clockwise order in place. + * @method clockwiseSort + * @param {vertices} vertices + * @return {vertices} vertices + */ + Vertices.clockwiseSort = function(vertices) { + var centre = Vertices.mean(vertices); + + vertices.sort(function(vertexA, vertexB) { + return Vector.angle(centre, vertexA) - Vector.angle(centre, vertexB); + }); + + return vertices; + }; + + /** + * Returns true if the vertices form a convex shape (vertices must be in clockwise order). + * @method isConvex + * @param {vertices} vertices + * @return {bool} `true` if the `vertices` are convex, `false` if not (or `null` if not computable). + */ + Vertices.isConvex = function(vertices) { + // http://paulbourke.net/geometry/polygonmesh/ + // Copyright (c) Paul Bourke (use permitted) + + var flag = 0, + n = vertices.length, + i, + j, + k, + z; + + if (n < 3) + return null; + + for (i = 0; i < n; i++) { + j = (i + 1) % n; + k = (i + 2) % n; + z = (vertices[j].x - vertices[i].x) * (vertices[k].y - vertices[j].y); + z -= (vertices[j].y - vertices[i].y) * (vertices[k].x - vertices[j].x); + + if (z < 0) { + flag |= 1; + } else if (z > 0) { + flag |= 2; + } + + if (flag === 3) { + return false; + } + } + + if (flag !== 0){ + return true; + } else { + return null; + } + }; + + /** + * Returns the convex hull of the input vertices as a new array of points. + * @method hull + * @param {vertices} vertices + * @return [vertex] vertices + */ + Vertices.hull = function(vertices) { + // http://geomalgorithms.com/a10-_hull-1.html + + var upper = [], + lower = [], + vertex, + i; + + // sort vertices on x-axis (y-axis for ties) + vertices = vertices.slice(0); + vertices.sort(function(vertexA, vertexB) { + var dx = vertexA.x - vertexB.x; + return dx !== 0 ? dx : vertexA.y - vertexB.y; + }); + + // build lower hull + for (i = 0; i < vertices.length; i += 1) { + vertex = vertices[i]; + + while (lower.length >= 2 + && Vector.cross3(lower[lower.length - 2], lower[lower.length - 1], vertex) <= 0) { + lower.pop(); + } + + lower.push(vertex); + } + + // build upper hull + for (i = vertices.length - 1; i >= 0; i -= 1) { + vertex = vertices[i]; + + while (upper.length >= 2 + && Vector.cross3(upper[upper.length - 2], upper[upper.length - 1], vertex) <= 0) { + upper.pop(); + } + + upper.push(vertex); + } + + // concatenation of the lower and upper hulls gives the convex hull + // omit last points because they are repeated at the beginning of the other list + upper.pop(); + lower.pop(); + + return upper.concat(lower); + }; + +})(); + + +/***/ }), +/* 4 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Events` module contains methods to fire and listen to events on other objects. +* +* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). +* +* @class Events +*/ + +var Events = {}; + +module.exports = Events; + +var Common = __webpack_require__(0); + +(function() { + + /** + * Subscribes a callback function to the given object's `eventName`. + * @method on + * @param {} object + * @param {string} eventNames + * @param {function} callback + */ + Events.on = function(object, eventNames, callback) { + var names = eventNames.split(' '), + name; + + for (var i = 0; i < names.length; i++) { + name = names[i]; + object.events = object.events || {}; + object.events[name] = object.events[name] || []; + object.events[name].push(callback); + } + + return callback; + }; + + /** + * Removes the given event callback. If no callback, clears all callbacks in `eventNames`. If no `eventNames`, clears all events. + * @method off + * @param {} object + * @param {string} eventNames + * @param {function} callback + */ + Events.off = function(object, eventNames, callback) { + if (!eventNames) { + object.events = {}; + return; + } + + // handle Events.off(object, callback) + if (typeof eventNames === 'function') { + callback = eventNames; + eventNames = Common.keys(object.events).join(' '); + } + + var names = eventNames.split(' '); + + for (var i = 0; i < names.length; i++) { + var callbacks = object.events[names[i]], + newCallbacks = []; + + if (callback && callbacks) { + for (var j = 0; j < callbacks.length; j++) { + if (callbacks[j] !== callback) + newCallbacks.push(callbacks[j]); + } + } + + object.events[names[i]] = newCallbacks; + } + }; + + /** + * Fires all the callbacks subscribed to the given object's `eventName`, in the order they subscribed, if any. + * @method trigger + * @param {} object + * @param {string} eventNames + * @param {} event + */ + Events.trigger = function(object, eventNames, event) { + var names, + name, + callbacks, + eventClone; + + var events = object.events; + + if (events && Common.keys(events).length > 0) { + if (!event) + event = {}; + + names = eventNames.split(' '); + + for (var i = 0; i < names.length; i++) { + name = names[i]; + callbacks = events[name]; + + if (callbacks) { + eventClone = Common.clone(event, false); + eventClone.name = name; + eventClone.source = object; + + for (var j = 0; j < callbacks.length; j++) { + callbacks[j].apply(object, [eventClone]); + } + } + } + } + }; + +})(); + + +/***/ }), +/* 5 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Composite` module contains methods for creating and manipulating composite bodies. +* A composite body is a collection of `Matter.Body`, `Matter.Constraint` and other `Matter.Composite`, therefore composites form a tree structure. +* It is important to use the functions in this module to modify composites, rather than directly modifying their properties. +* Note that the `Matter.World` object is also a type of `Matter.Composite` and as such all composite methods here can also operate on a `Matter.World`. +* +* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). +* +* @class Composite +*/ + +var Composite = {}; + +module.exports = Composite; + +var Events = __webpack_require__(4); +var Common = __webpack_require__(0); +var Bounds = __webpack_require__(1); +var Body = __webpack_require__(6); + +(function() { + + /** + * Creates a new composite. The options parameter is an object that specifies any properties you wish to override the defaults. + * See the properites section below for detailed information on what you can pass via the `options` object. + * @method create + * @param {} [options] + * @return {composite} A new composite + */ + Composite.create = function(options) { + return Common.extend({ + id: Common.nextId(), + type: 'composite', + parent: null, + isModified: false, + bodies: [], + constraints: [], + composites: [], + label: 'Composite', + plugin: {} + }, options); + }; + + /** + * Sets the composite's `isModified` flag. + * If `updateParents` is true, all parents will be set (default: false). + * If `updateChildren` is true, all children will be set (default: false). + * @method setModified + * @param {composite} composite + * @param {boolean} isModified + * @param {boolean} [updateParents=false] + * @param {boolean} [updateChildren=false] + */ + Composite.setModified = function(composite, isModified, updateParents, updateChildren) { + composite.isModified = isModified; + + if (updateParents && composite.parent) { + Composite.setModified(composite.parent, isModified, updateParents, updateChildren); + } + + if (updateChildren) { + for(var i = 0; i < composite.composites.length; i++) { + var childComposite = composite.composites[i]; + Composite.setModified(childComposite, isModified, updateParents, updateChildren); + } + } + }; + + /** + * Generic add function. Adds one or many body(s), constraint(s) or a composite(s) to the given composite. + * Triggers `beforeAdd` and `afterAdd` events on the `composite`. + * @method add + * @param {composite} composite + * @param {} object + * @return {composite} The original composite with the objects added + */ + Composite.add = function(composite, object) { + var objects = [].concat(object); + + Events.trigger(composite, 'beforeAdd', { object: object }); + + for (var i = 0; i < objects.length; i++) { + var obj = objects[i]; + + switch (obj.type) { + + case 'body': + // skip adding compound parts + if (obj.parent !== obj) { + Common.warn('Composite.add: skipped adding a compound body part (you must add its parent instead)'); + break; + } + + Composite.addBody(composite, obj); + break; + case 'constraint': + Composite.addConstraint(composite, obj); + break; + case 'composite': + Composite.addComposite(composite, obj); + break; + case 'mouseConstraint': + Composite.addConstraint(composite, obj.constraint); + break; + + } + } + + Events.trigger(composite, 'afterAdd', { object: object }); + + return composite; + }; + + /** + * Generic remove function. Removes one or many body(s), constraint(s) or a composite(s) to the given composite. + * Optionally searching its children recursively. + * Triggers `beforeRemove` and `afterRemove` events on the `composite`. + * @method remove + * @param {composite} composite + * @param {} object + * @param {boolean} [deep=false] + * @return {composite} The original composite with the objects removed + */ + Composite.remove = function(composite, object, deep) { + var objects = [].concat(object); + + Events.trigger(composite, 'beforeRemove', { object: object }); + + for (var i = 0; i < objects.length; i++) { + var obj = objects[i]; + + switch (obj.type) { + + case 'body': + Composite.removeBody(composite, obj, deep); + break; + case 'constraint': + Composite.removeConstraint(composite, obj, deep); + break; + case 'composite': + Composite.removeComposite(composite, obj, deep); + break; + case 'mouseConstraint': + Composite.removeConstraint(composite, obj.constraint); + break; + + } + } + + Events.trigger(composite, 'afterRemove', { object: object }); + + return composite; + }; + + /** + * Adds a composite to the given composite. + * @private + * @method addComposite + * @param {composite} compositeA + * @param {composite} compositeB + * @return {composite} The original compositeA with the objects from compositeB added + */ + Composite.addComposite = function(compositeA, compositeB) { + compositeA.composites.push(compositeB); + compositeB.parent = compositeA; + Composite.setModified(compositeA, true, true, false); + return compositeA; + }; + + /** + * Removes a composite from the given composite, and optionally searching its children recursively. + * @private + * @method removeComposite + * @param {composite} compositeA + * @param {composite} compositeB + * @param {boolean} [deep=false] + * @return {composite} The original compositeA with the composite removed + */ + Composite.removeComposite = function(compositeA, compositeB, deep) { + var position = Common.indexOf(compositeA.composites, compositeB); + if (position !== -1) { + Composite.removeCompositeAt(compositeA, position); + Composite.setModified(compositeA, true, true, false); + } + + if (deep) { + for (var i = 0; i < compositeA.composites.length; i++){ + Composite.removeComposite(compositeA.composites[i], compositeB, true); + } + } + + return compositeA; + }; + + /** + * Removes a composite from the given composite. + * @private + * @method removeCompositeAt + * @param {composite} composite + * @param {number} position + * @return {composite} The original composite with the composite removed + */ + Composite.removeCompositeAt = function(composite, position) { + composite.composites.splice(position, 1); + Composite.setModified(composite, true, true, false); + return composite; + }; + + /** + * Adds a body to the given composite. + * @private + * @method addBody + * @param {composite} composite + * @param {body} body + * @return {composite} The original composite with the body added + */ + Composite.addBody = function(composite, body) { + composite.bodies.push(body); + Composite.setModified(composite, true, true, false); + return composite; + }; + + /** + * Removes a body from the given composite, and optionally searching its children recursively. + * @private + * @method removeBody + * @param {composite} composite + * @param {body} body + * @param {boolean} [deep=false] + * @return {composite} The original composite with the body removed + */ + Composite.removeBody = function(composite, body, deep) { + var position = Common.indexOf(composite.bodies, body); + if (position !== -1) { + Composite.removeBodyAt(composite, position); + Composite.setModified(composite, true, true, false); + } + + if (deep) { + for (var i = 0; i < composite.composites.length; i++){ + Composite.removeBody(composite.composites[i], body, true); + } + } + + return composite; + }; + + /** + * Removes a body from the given composite. + * @private + * @method removeBodyAt + * @param {composite} composite + * @param {number} position + * @return {composite} The original composite with the body removed + */ + Composite.removeBodyAt = function(composite, position) { + composite.bodies.splice(position, 1); + Composite.setModified(composite, true, true, false); + return composite; + }; + + /** + * Adds a constraint to the given composite. + * @private + * @method addConstraint + * @param {composite} composite + * @param {constraint} constraint + * @return {composite} The original composite with the constraint added + */ + Composite.addConstraint = function(composite, constraint) { + composite.constraints.push(constraint); + Composite.setModified(composite, true, true, false); + return composite; + }; + + /** + * Removes a constraint from the given composite, and optionally searching its children recursively. + * @private + * @method removeConstraint + * @param {composite} composite + * @param {constraint} constraint + * @param {boolean} [deep=false] + * @return {composite} The original composite with the constraint removed + */ + Composite.removeConstraint = function(composite, constraint, deep) { + var position = Common.indexOf(composite.constraints, constraint); + if (position !== -1) { + Composite.removeConstraintAt(composite, position); + } + + if (deep) { + for (var i = 0; i < composite.composites.length; i++){ + Composite.removeConstraint(composite.composites[i], constraint, true); + } + } + + return composite; + }; + + /** + * Removes a body from the given composite. + * @private + * @method removeConstraintAt + * @param {composite} composite + * @param {number} position + * @return {composite} The original composite with the constraint removed + */ + Composite.removeConstraintAt = function(composite, position) { + composite.constraints.splice(position, 1); + Composite.setModified(composite, true, true, false); + return composite; + }; + + /** + * Removes all bodies, constraints and composites from the given composite. + * Optionally clearing its children recursively. + * @method clear + * @param {composite} composite + * @param {boolean} keepStatic + * @param {boolean} [deep=false] + */ + Composite.clear = function(composite, keepStatic, deep) { + if (deep) { + for (var i = 0; i < composite.composites.length; i++){ + Composite.clear(composite.composites[i], keepStatic, true); + } + } + + if (keepStatic) { + composite.bodies = composite.bodies.filter(function(body) { return body.isStatic; }); + } else { + composite.bodies.length = 0; + } + + composite.constraints.length = 0; + composite.composites.length = 0; + Composite.setModified(composite, true, true, false); + + return composite; + }; + + /** + * Returns all bodies in the given composite, including all bodies in its children, recursively. + * @method allBodies + * @param {composite} composite + * @return {body[]} All the bodies + */ + Composite.allBodies = function(composite) { + var bodies = [].concat(composite.bodies); + + for (var i = 0; i < composite.composites.length; i++) + bodies = bodies.concat(Composite.allBodies(composite.composites[i])); + + return bodies; + }; + + /** + * Returns all constraints in the given composite, including all constraints in its children, recursively. + * @method allConstraints + * @param {composite} composite + * @return {constraint[]} All the constraints + */ + Composite.allConstraints = function(composite) { + var constraints = [].concat(composite.constraints); + + for (var i = 0; i < composite.composites.length; i++) + constraints = constraints.concat(Composite.allConstraints(composite.composites[i])); + + return constraints; + }; + + /** + * Returns all composites in the given composite, including all composites in its children, recursively. + * @method allComposites + * @param {composite} composite + * @return {composite[]} All the composites + */ + Composite.allComposites = function(composite) { + var composites = [].concat(composite.composites); + + for (var i = 0; i < composite.composites.length; i++) + composites = composites.concat(Composite.allComposites(composite.composites[i])); + + return composites; + }; + + /** + * Searches the composite recursively for an object matching the type and id supplied, null if not found. + * @method get + * @param {composite} composite + * @param {number} id + * @param {string} type + * @return {object} The requested object, if found + */ + Composite.get = function(composite, id, type) { + var objects, + object; + + switch (type) { + case 'body': + objects = Composite.allBodies(composite); + break; + case 'constraint': + objects = Composite.allConstraints(composite); + break; + case 'composite': + objects = Composite.allComposites(composite).concat(composite); + break; + } + + if (!objects) + return null; + + object = objects.filter(function(object) { + return object.id.toString() === id.toString(); + }); + + return object.length === 0 ? null : object[0]; + }; + + /** + * Moves the given object(s) from compositeA to compositeB (equal to a remove followed by an add). + * @method move + * @param {compositeA} compositeA + * @param {object[]} objects + * @param {compositeB} compositeB + * @return {composite} Returns compositeA + */ + Composite.move = function(compositeA, objects, compositeB) { + Composite.remove(compositeA, objects); + Composite.add(compositeB, objects); + return compositeA; + }; + + /** + * Assigns new ids for all objects in the composite, recursively. + * @method rebase + * @param {composite} composite + * @return {composite} Returns composite + */ + Composite.rebase = function(composite) { + var objects = Composite.allBodies(composite) + .concat(Composite.allConstraints(composite)) + .concat(Composite.allComposites(composite)); + + for (var i = 0; i < objects.length; i++) { + objects[i].id = Common.nextId(); + } + + Composite.setModified(composite, true, true, false); + + return composite; + }; + + /** + * Translates all children in the composite by a given vector relative to their current positions, + * without imparting any velocity. + * @method translate + * @param {composite} composite + * @param {vector} translation + * @param {bool} [recursive=true] + */ + Composite.translate = function(composite, translation, recursive) { + var bodies = recursive ? Composite.allBodies(composite) : composite.bodies; + + for (var i = 0; i < bodies.length; i++) { + Body.translate(bodies[i], translation); + } + + Composite.setModified(composite, true, true, false); + + return composite; + }; + + /** + * Rotates all children in the composite by a given angle about the given point, without imparting any angular velocity. + * @method rotate + * @param {composite} composite + * @param {number} rotation + * @param {vector} point + * @param {bool} [recursive=true] + */ + Composite.rotate = function(composite, rotation, point, recursive) { + var cos = Math.cos(rotation), + sin = Math.sin(rotation), + bodies = recursive ? Composite.allBodies(composite) : composite.bodies; + + for (var i = 0; i < bodies.length; i++) { + var body = bodies[i], + dx = body.position.x - point.x, + dy = body.position.y - point.y; + + Body.setPosition(body, { + x: point.x + (dx * cos - dy * sin), + y: point.y + (dx * sin + dy * cos) + }); + + Body.rotate(body, rotation); + } + + Composite.setModified(composite, true, true, false); + + return composite; + }; + + /** + * Scales all children in the composite, including updating physical properties (mass, area, axes, inertia), from a world-space point. + * @method scale + * @param {composite} composite + * @param {number} scaleX + * @param {number} scaleY + * @param {vector} point + * @param {bool} [recursive=true] + */ + Composite.scale = function(composite, scaleX, scaleY, point, recursive) { + var bodies = recursive ? Composite.allBodies(composite) : composite.bodies; + + for (var i = 0; i < bodies.length; i++) { + var body = bodies[i], + dx = body.position.x - point.x, + dy = body.position.y - point.y; + + Body.setPosition(body, { + x: point.x + dx * scaleX, + y: point.y + dy * scaleY + }); + + Body.scale(body, scaleX, scaleY); + } + + Composite.setModified(composite, true, true, false); + + return composite; + }; + + /** + * Returns the union of the bounds of all of the composite's bodies. + * @method bounds + * @param {composite} composite The composite. + * @returns {bounds} The composite bounds. + */ + Composite.bounds = function(composite) { + var bodies = Composite.allBodies(composite), + vertices = []; + + for (var i = 0; i < bodies.length; i += 1) { + var body = bodies[i]; + vertices.push(body.bounds.min, body.bounds.max); + } + + return Bounds.create(vertices); + }; + + /* + * + * Events Documentation + * + */ + + /** + * Fired when a call to `Composite.add` is made, before objects have been added. + * + * @event beforeAdd + * @param {} event An event object + * @param {} event.object The object(s) to be added (may be a single body, constraint, composite or a mixed array of these) + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired when a call to `Composite.add` is made, after objects have been added. + * + * @event afterAdd + * @param {} event An event object + * @param {} event.object The object(s) that have been added (may be a single body, constraint, composite or a mixed array of these) + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired when a call to `Composite.remove` is made, before objects have been removed. + * + * @event beforeRemove + * @param {} event An event object + * @param {} event.object The object(s) to be removed (may be a single body, constraint, composite or a mixed array of these) + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired when a call to `Composite.remove` is made, after objects have been removed. + * + * @event afterRemove + * @param {} event An event object + * @param {} event.object The object(s) that have been removed (may be a single body, constraint, composite or a mixed array of these) + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /* + * + * Properties Documentation + * + */ + + /** + * An integer `Number` uniquely identifying number generated in `Composite.create` by `Common.nextId`. + * + * @property id + * @type number + */ + + /** + * A `String` denoting the type of object. + * + * @property type + * @type string + * @default "composite" + * @readOnly + */ + + /** + * An arbitrary `String` name to help the user identify and manage composites. + * + * @property label + * @type string + * @default "Composite" + */ + + /** + * A flag that specifies whether the composite has been modified during the current step. + * Most `Matter.Composite` methods will automatically set this flag to `true` to inform the engine of changes to be handled. + * If you need to change it manually, you should use the `Composite.setModified` method. + * + * @property isModified + * @type boolean + * @default false + */ + + /** + * The `Composite` that is the parent of this composite. It is automatically managed by the `Matter.Composite` methods. + * + * @property parent + * @type composite + * @default null + */ + + /** + * An array of `Body` that are _direct_ children of this composite. + * To add or remove bodies you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property. + * If you wish to recursively find all descendants, you should use the `Composite.allBodies` method. + * + * @property bodies + * @type body[] + * @default [] + */ + + /** + * An array of `Constraint` that are _direct_ children of this composite. + * To add or remove constraints you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property. + * If you wish to recursively find all descendants, you should use the `Composite.allConstraints` method. + * + * @property constraints + * @type constraint[] + * @default [] + */ + + /** + * An array of `Composite` that are _direct_ children of this composite. + * To add or remove composites you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property. + * If you wish to recursively find all descendants, you should use the `Composite.allComposites` method. + * + * @property composites + * @type composite[] + * @default [] + */ + + /** + * An object reserved for storing plugin-specific properties. + * + * @property plugin + * @type {} + */ + +})(); + + +/***/ }), +/* 6 */ +/***/ (function(module, exports, __webpack_require__) { -(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.Matter = f()}})(function(){var define,module,exports;return (function(){function r(e,n,t){function o(i,f){if(!n[i]){if(!e[i]){var c="function"==typeof require&&require;if(!f&&c)return c(i,!0);if(u)return u(i,!0);var a=new Error("Cannot find module '"+i+"'");throw a.code="MODULE_NOT_FOUND",a}var p=n[i]={exports:{}};e[i][0].call(p.exports,function(r){var n=e[i][1][r];return o(n||r)},p,p.exports,r,e,n,t)}return n[i].exports}for(var u="function"==typeof require&&require,i=0;i 0 && body.motion < Sleeping._motionSleepThreshold * timeFactor) { + body.sleepCounter += 1; - Body.setPosition(body, { - x: point.x + (dx * cos - dy * sin), - y: point.y + (dx * sin + dy * cos) - }); - - Body.rotate(body, rotation); - } - - Composite.setModified(composite, true, true, false); - - return composite; - }; - - /** - * Scales all children in the composite, including updating physical properties (mass, area, axes, inertia), from a world-space point. - * @method scale - * @param {composite} composite - * @param {number} scaleX - * @param {number} scaleY - * @param {vector} point - * @param {bool} [recursive=true] - */ - Composite.scale = function(composite, scaleX, scaleY, point, recursive) { - var bodies = recursive ? Composite.allBodies(composite) : composite.bodies; - - for (var i = 0; i < bodies.length; i++) { - var body = bodies[i], - dx = body.position.x - point.x, - dy = body.position.y - point.y; - - Body.setPosition(body, { - x: point.x + dx * scaleX, - y: point.y + dy * scaleY - }); - - Body.scale(body, scaleX, scaleY); - } - - Composite.setModified(composite, true, true, false); - - return composite; - }; - - /** - * Returns the union of the bounds of all of the composite's bodies. - * @method bounds - * @param {composite} composite The composite. - * @returns {bounds} The composite bounds. - */ - Composite.bounds = function(composite) { - var bodies = Composite.allBodies(composite), - vertices = []; - - for (var i = 0; i < bodies.length; i += 1) { - var body = bodies[i]; - vertices.push(body.bounds.min, body.bounds.max); - } - - return Bounds.create(vertices); - }; - - /* - * - * Events Documentation - * - */ - - /** - * Fired when a call to `Composite.add` is made, before objects have been added. - * - * @event beforeAdd - * @param {} event An event object - * @param {} event.object The object(s) to be added (may be a single body, constraint, composite or a mixed array of these) - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired when a call to `Composite.add` is made, after objects have been added. - * - * @event afterAdd - * @param {} event An event object - * @param {} event.object The object(s) that have been added (may be a single body, constraint, composite or a mixed array of these) - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired when a call to `Composite.remove` is made, before objects have been removed. - * - * @event beforeRemove - * @param {} event An event object - * @param {} event.object The object(s) to be removed (may be a single body, constraint, composite or a mixed array of these) - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired when a call to `Composite.remove` is made, after objects have been removed. - * - * @event afterRemove - * @param {} event An event object - * @param {} event.object The object(s) that have been removed (may be a single body, constraint, composite or a mixed array of these) - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /* - * - * Properties Documentation - * - */ - - /** - * An integer `Number` uniquely identifying number generated in `Composite.create` by `Common.nextId`. - * - * @property id - * @type number - */ - - /** - * A `String` denoting the type of object. - * - * @property type - * @type string - * @default "composite" - * @readOnly - */ - - /** - * An arbitrary `String` name to help the user identify and manage composites. - * - * @property label - * @type string - * @default "Composite" - */ - - /** - * A flag that specifies whether the composite has been modified during the current step. - * Most `Matter.Composite` methods will automatically set this flag to `true` to inform the engine of changes to be handled. - * If you need to change it manually, you should use the `Composite.setModified` method. - * - * @property isModified - * @type boolean - * @default false - */ - - /** - * The `Composite` that is the parent of this composite. It is automatically managed by the `Matter.Composite` methods. - * - * @property parent - * @type composite - * @default null - */ - - /** - * An array of `Body` that are _direct_ children of this composite. - * To add or remove bodies you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property. - * If you wish to recursively find all descendants, you should use the `Composite.allBodies` method. - * - * @property bodies - * @type body[] - * @default [] - */ - - /** - * An array of `Constraint` that are _direct_ children of this composite. - * To add or remove constraints you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property. - * If you wish to recursively find all descendants, you should use the `Composite.allConstraints` method. - * - * @property constraints - * @type constraint[] - * @default [] - */ - - /** - * An array of `Composite` that are _direct_ children of this composite. - * To add or remove composites you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property. - * If you wish to recursively find all descendants, you should use the `Composite.allComposites` method. - * - * @property composites - * @type composite[] - * @default [] - */ - - /** - * An object reserved for storing plugin-specific properties. - * - * @property plugin - * @type {} - */ - -})(); - -},{"../core/Common":14,"../core/Events":16,"../geometry/Bounds":26,"./Body":1}],3:[function(_dereq_,module,exports){ -/** -* The `Matter.World` module contains methods for creating and manipulating the world composite. -* A `Matter.World` is a `Matter.Composite` body, which is a collection of `Matter.Body`, `Matter.Constraint` and other `Matter.Composite`. -* A `Matter.World` has a few additional properties including `gravity` and `bounds`. -* It is important to use the functions in the `Matter.Composite` module to modify the world composite, rather than directly modifying its properties. -* There are also a few methods here that alias those in `Matter.Composite` for easier readability. -* -* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). -* -* @class World -* @extends Composite -*/ - -var World = {}; - -module.exports = World; - -var Composite = _dereq_('./Composite'); -var Constraint = _dereq_('../constraint/Constraint'); -var Common = _dereq_('../core/Common'); - -(function() { - - /** - * Creates a new world composite. The options parameter is an object that specifies any properties you wish to override the defaults. - * See the properties section below for detailed information on what you can pass via the `options` object. - * @method create - * @constructor - * @param {} options - * @return {world} A new world - */ - World.create = function(options) { - var composite = Composite.create(); - - var defaults = { - label: 'World', - gravity: { - x: 0, - y: 1, - scale: 0.001 - }, - bounds: { - min: { x: -Infinity, y: -Infinity }, - max: { x: Infinity, y: Infinity } - } - }; - - return Common.extend(composite, defaults, options); - }; - - /* - * - * Properties Documentation - * - */ - - /** - * The gravity to apply on the world. - * - * @property gravity - * @type object - */ - - /** - * The gravity x component. - * - * @property gravity.x - * @type object - * @default 0 - */ - - /** - * The gravity y component. - * - * @property gravity.y - * @type object - * @default 1 - */ - - /** - * The gravity scale factor. - * - * @property gravity.scale - * @type object - * @default 0.001 - */ - - /** - * A `Bounds` object that defines the world bounds for collision detection. - * - * @property bounds - * @type bounds - * @default { min: { x: -Infinity, y: -Infinity }, max: { x: Infinity, y: Infinity } } - */ - - // World is a Composite body - // see src/module/Outro.js for these aliases: - - /** - * An alias for Composite.add - * @method add - * @param {world} world - * @param {} object - * @return {composite} The original world with the objects added - */ - - /** - * An alias for Composite.remove - * @method remove - * @param {world} world - * @param {} object - * @param {boolean} [deep=false] - * @return {composite} The original world with the objects removed - */ - - /** - * An alias for Composite.clear - * @method clear - * @param {world} world - * @param {boolean} keepStatic - */ - - /** - * An alias for Composite.addComposite - * @method addComposite - * @param {world} world - * @param {composite} composite - * @return {world} The original world with the objects from composite added - */ - - /** - * An alias for Composite.addBody - * @method addBody - * @param {world} world - * @param {body} body - * @return {world} The original world with the body added - */ - - /** - * An alias for Composite.addConstraint - * @method addConstraint - * @param {world} world - * @param {constraint} constraint - * @return {world} The original world with the constraint added - */ - -})(); - -},{"../constraint/Constraint":12,"../core/Common":14,"./Composite":2}],4:[function(_dereq_,module,exports){ -/** -* The `Matter.Contact` module contains methods for creating and manipulating collision contacts. -* -* @class Contact -*/ - -var Contact = {}; - -module.exports = Contact; - -(function() { - - /** - * Creates a new contact. - * @method create - * @param {vertex} vertex - * @return {contact} A new contact - */ - Contact.create = function(vertex) { - return { - id: Contact.id(vertex), - vertex: vertex, - normalImpulse: 0, - tangentImpulse: 0 - }; - }; - - /** - * Generates a contact id. - * @method id - * @param {vertex} vertex - * @return {string} Unique contactID - */ - Contact.id = function(vertex) { - return vertex.body.id + '_' + vertex.index; - }; - -})(); - -},{}],5:[function(_dereq_,module,exports){ -/** -* The `Matter.Detector` module contains methods for detecting collisions given a set of pairs. -* -* @class Detector -*/ - -// TODO: speculative contacts - -var Detector = {}; - -module.exports = Detector; - -var SAT = _dereq_('./SAT'); -var Pair = _dereq_('./Pair'); -var Bounds = _dereq_('../geometry/Bounds'); - -(function() { - - /** - * Finds all collisions given a list of pairs. - * @method collisions - * @param {pair[]} broadphasePairs - * @param {engine} engine - * @return {array} collisions - */ - Detector.collisions = function(broadphasePairs, engine) { - var collisions = [], - pairsTable = engine.pairs.table; - - - for (var i = 0; i < broadphasePairs.length; i++) { - var bodyA = broadphasePairs[i][0], - bodyB = broadphasePairs[i][1]; - - if ((bodyA.isStatic || bodyA.isSleeping) && (bodyB.isStatic || bodyB.isSleeping)) - continue; - - if (!Detector.canCollide(bodyA.collisionFilter, bodyB.collisionFilter)) - continue; - - - // mid phase - if (Bounds.overlaps(bodyA.bounds, bodyB.bounds)) { - for (var j = bodyA.parts.length > 1 ? 1 : 0; j < bodyA.parts.length; j++) { - var partA = bodyA.parts[j]; - - for (var k = bodyB.parts.length > 1 ? 1 : 0; k < bodyB.parts.length; k++) { - var partB = bodyB.parts[k]; - - if ((partA === bodyA && partB === bodyB) || Bounds.overlaps(partA.bounds, partB.bounds)) { - // find a previous collision we could reuse - var pairId = Pair.id(partA, partB), - pair = pairsTable[pairId], - previousCollision; - - if (pair && pair.isActive) { - previousCollision = pair.collision; - } else { - previousCollision = null; - } - - // narrow phase - var collision = SAT.collides(partA, partB, previousCollision); - - - if (collision.collided) { - collisions.push(collision); - } - } - } - } - } - } - - return collisions; - }; - - /** - * Returns `true` if both supplied collision filters will allow a collision to occur. - * See `body.collisionFilter` for more information. - * @method canCollide - * @param {} filterA - * @param {} filterB - * @return {bool} `true` if collision can occur - */ - Detector.canCollide = function(filterA, filterB) { - if (filterA.group === filterB.group && filterA.group !== 0) - return filterA.group > 0; - - return (filterA.mask & filterB.category) !== 0 && (filterB.mask & filterA.category) !== 0; - }; - -})(); - -},{"../geometry/Bounds":26,"./Pair":7,"./SAT":11}],6:[function(_dereq_,module,exports){ -/** -* The `Matter.Grid` module contains methods for creating and manipulating collision broadphase grid structures. -* -* @class Grid -*/ - -var Grid = {}; - -module.exports = Grid; - -var Pair = _dereq_('./Pair'); -var Detector = _dereq_('./Detector'); -var Common = _dereq_('../core/Common'); - -(function() { - - /** - * Creates a new grid. - * @method create - * @param {} options - * @return {grid} A new grid - */ - Grid.create = function(options) { - var defaults = { - controller: Grid, - detector: Detector.collisions, - buckets: {}, - pairs: {}, - pairsList: [], - bucketWidth: 48, - bucketHeight: 48 - }; - - return Common.extend(defaults, options); - }; - - /** - * The width of a single grid bucket. - * - * @property bucketWidth - * @type number - * @default 48 - */ - - /** - * The height of a single grid bucket. - * - * @property bucketHeight - * @type number - * @default 48 - */ - - /** - * Updates the grid. - * @method update - * @param {grid} grid - * @param {body[]} bodies - * @param {engine} engine - * @param {boolean} forceUpdate - */ - Grid.update = function(grid, bodies, engine, forceUpdate) { - var i, col, row, - world = engine.world, - buckets = grid.buckets, - bucket, - bucketId, - gridChanged = false; - - - for (i = 0; i < bodies.length; i++) { - var body = bodies[i]; - - if (body.isSleeping && !forceUpdate) - continue; - - // don't update out of world bodies - if (body.bounds.max.x < world.bounds.min.x || body.bounds.min.x > world.bounds.max.x - || body.bounds.max.y < world.bounds.min.y || body.bounds.min.y > world.bounds.max.y) - continue; - - var newRegion = Grid._getRegion(grid, body); - - // if the body has changed grid region - if (!body.region || newRegion.id !== body.region.id || forceUpdate) { - - - if (!body.region || forceUpdate) - body.region = newRegion; - - var union = Grid._regionUnion(newRegion, body.region); - - // update grid buckets affected by region change - // iterate over the union of both regions - for (col = union.startCol; col <= union.endCol; col++) { - for (row = union.startRow; row <= union.endRow; row++) { - bucketId = Grid._getBucketId(col, row); - bucket = buckets[bucketId]; - - var isInsideNewRegion = (col >= newRegion.startCol && col <= newRegion.endCol - && row >= newRegion.startRow && row <= newRegion.endRow); - - var isInsideOldRegion = (col >= body.region.startCol && col <= body.region.endCol - && row >= body.region.startRow && row <= body.region.endRow); - - // remove from old region buckets - if (!isInsideNewRegion && isInsideOldRegion) { - if (isInsideOldRegion) { - if (bucket) - Grid._bucketRemoveBody(grid, bucket, body); - } - } - - // add to new region buckets - if (body.region === newRegion || (isInsideNewRegion && !isInsideOldRegion) || forceUpdate) { - if (!bucket) - bucket = Grid._createBucket(buckets, bucketId); - Grid._bucketAddBody(grid, bucket, body); - } - } - } - - // set the new region - body.region = newRegion; - - // flag changes so we can update pairs - gridChanged = true; - } - } - - // update pairs list only if pairs changed (i.e. a body changed region) - if (gridChanged) - grid.pairsList = Grid._createActivePairsList(grid); - }; - - /** - * Clears the grid. - * @method clear - * @param {grid} grid - */ - Grid.clear = function(grid) { - grid.buckets = {}; - grid.pairs = {}; - grid.pairsList = []; - }; - - /** - * Finds the union of two regions. - * @method _regionUnion - * @private - * @param {} regionA - * @param {} regionB - * @return {} region - */ - Grid._regionUnion = function(regionA, regionB) { - var startCol = Math.min(regionA.startCol, regionB.startCol), - endCol = Math.max(regionA.endCol, regionB.endCol), - startRow = Math.min(regionA.startRow, regionB.startRow), - endRow = Math.max(regionA.endRow, regionB.endRow); - - return Grid._createRegion(startCol, endCol, startRow, endRow); - }; - - /** - * Gets the region a given body falls in for a given grid. - * @method _getRegion - * @private - * @param {} grid - * @param {} body - * @return {} region - */ - Grid._getRegion = function(grid, body) { - var bounds = body.bounds, - startCol = Math.floor(bounds.min.x / grid.bucketWidth), - endCol = Math.floor(bounds.max.x / grid.bucketWidth), - startRow = Math.floor(bounds.min.y / grid.bucketHeight), - endRow = Math.floor(bounds.max.y / grid.bucketHeight); - - return Grid._createRegion(startCol, endCol, startRow, endRow); - }; - - /** - * Creates a region. - * @method _createRegion - * @private - * @param {} startCol - * @param {} endCol - * @param {} startRow - * @param {} endRow - * @return {} region - */ - Grid._createRegion = function(startCol, endCol, startRow, endRow) { - return { - id: startCol + ',' + endCol + ',' + startRow + ',' + endRow, - startCol: startCol, - endCol: endCol, - startRow: startRow, - endRow: endRow - }; - }; - - /** - * Gets the bucket id at the given position. - * @method _getBucketId - * @private - * @param {} column - * @param {} row - * @return {string} bucket id - */ - Grid._getBucketId = function(column, row) { - return 'C' + column + 'R' + row; - }; - - /** - * Creates a bucket. - * @method _createBucket - * @private - * @param {} buckets - * @param {} bucketId - * @return {} bucket - */ - Grid._createBucket = function(buckets, bucketId) { - var bucket = buckets[bucketId] = []; - return bucket; - }; - - /** - * Adds a body to a bucket. - * @method _bucketAddBody - * @private - * @param {} grid - * @param {} bucket - * @param {} body - */ - Grid._bucketAddBody = function(grid, bucket, body) { - // add new pairs - for (var i = 0; i < bucket.length; i++) { - var bodyB = bucket[i]; - - if (body.id === bodyB.id || (body.isStatic && bodyB.isStatic)) - continue; - - // keep track of the number of buckets the pair exists in - // important for Grid.update to work - var pairId = Pair.id(body, bodyB), - pair = grid.pairs[pairId]; - - if (pair) { - pair[2] += 1; - } else { - grid.pairs[pairId] = [body, bodyB, 1]; - } - } - - // add to bodies (after pairs, otherwise pairs with self) - bucket.push(body); - }; - - /** - * Removes a body from a bucket. - * @method _bucketRemoveBody - * @private - * @param {} grid - * @param {} bucket - * @param {} body - */ - Grid._bucketRemoveBody = function(grid, bucket, body) { - // remove from bucket - bucket.splice(Common.indexOf(bucket, body), 1); - - // update pair counts - for (var i = 0; i < bucket.length; i++) { - // keep track of the number of buckets the pair exists in - // important for _createActivePairsList to work - var bodyB = bucket[i], - pairId = Pair.id(body, bodyB), - pair = grid.pairs[pairId]; - - if (pair) - pair[2] -= 1; - } - }; - - /** - * Generates a list of the active pairs in the grid. - * @method _createActivePairsList - * @private - * @param {} grid - * @return [] pairs - */ - Grid._createActivePairsList = function(grid) { - var pairKeys, - pair, - pairs = []; - - // grid.pairs is used as a hashmap - pairKeys = Common.keys(grid.pairs); - - // iterate over grid.pairs - for (var k = 0; k < pairKeys.length; k++) { - pair = grid.pairs[pairKeys[k]]; - - // if pair exists in at least one bucket - // it is a pair that needs further collision testing so push it - if (pair[2] > 0) { - pairs.push(pair); - } else { - delete grid.pairs[pairKeys[k]]; - } - } - - return pairs; - }; - -})(); - -},{"../core/Common":14,"./Detector":5,"./Pair":7}],7:[function(_dereq_,module,exports){ -/** -* The `Matter.Pair` module contains methods for creating and manipulating collision pairs. -* -* @class Pair -*/ - -var Pair = {}; - -module.exports = Pair; - -var Contact = _dereq_('./Contact'); - -(function() { - - /** - * Creates a pair. - * @method create - * @param {collision} collision - * @param {number} timestamp - * @return {pair} A new pair - */ - Pair.create = function(collision, timestamp) { - var bodyA = collision.bodyA, - bodyB = collision.bodyB, - parentA = collision.parentA, - parentB = collision.parentB; - - var pair = { - id: Pair.id(bodyA, bodyB), - bodyA: bodyA, - bodyB: bodyB, - contacts: {}, - activeContacts: [], - separation: 0, - isActive: true, - isSensor: bodyA.isSensor || bodyB.isSensor, - timeCreated: timestamp, - timeUpdated: timestamp, - inverseMass: parentA.inverseMass + parentB.inverseMass, - friction: Math.min(parentA.friction, parentB.friction), - frictionStatic: Math.max(parentA.frictionStatic, parentB.frictionStatic), - restitution: Math.max(parentA.restitution, parentB.restitution), - slop: Math.max(parentA.slop, parentB.slop) - }; - - Pair.update(pair, collision, timestamp); - - return pair; - }; - - /** - * Updates a pair given a collision. - * @method update - * @param {pair} pair - * @param {collision} collision - * @param {number} timestamp - */ - Pair.update = function(pair, collision, timestamp) { - var contacts = pair.contacts, - supports = collision.supports, - activeContacts = pair.activeContacts, - parentA = collision.parentA, - parentB = collision.parentB; - - pair.collision = collision; - pair.inverseMass = parentA.inverseMass + parentB.inverseMass; - pair.friction = Math.min(parentA.friction, parentB.friction); - pair.frictionStatic = Math.max(parentA.frictionStatic, parentB.frictionStatic); - pair.restitution = Math.max(parentA.restitution, parentB.restitution); - pair.slop = Math.max(parentA.slop, parentB.slop); - activeContacts.length = 0; - - if (collision.collided) { - for (var i = 0; i < supports.length; i++) { - var support = supports[i], - contactId = Contact.id(support), - contact = contacts[contactId]; - - if (contact) { - activeContacts.push(contact); - } else { - activeContacts.push(contacts[contactId] = Contact.create(support)); - } - } - - pair.separation = collision.depth; - Pair.setActive(pair, true, timestamp); - } else { - if (pair.isActive === true) - Pair.setActive(pair, false, timestamp); - } - }; - - /** - * Set a pair as active or inactive. - * @method setActive - * @param {pair} pair - * @param {bool} isActive - * @param {number} timestamp - */ - Pair.setActive = function(pair, isActive, timestamp) { - if (isActive) { - pair.isActive = true; - pair.timeUpdated = timestamp; - } else { - pair.isActive = false; - pair.activeContacts.length = 0; - } - }; - - /** - * Get the id for the given pair. - * @method id - * @param {body} bodyA - * @param {body} bodyB - * @return {string} Unique pairId - */ - Pair.id = function(bodyA, bodyB) { - if (bodyA.id < bodyB.id) { - return 'A' + bodyA.id + 'B' + bodyB.id; - } else { - return 'A' + bodyB.id + 'B' + bodyA.id; - } - }; - -})(); - -},{"./Contact":4}],8:[function(_dereq_,module,exports){ -/** -* The `Matter.Pairs` module contains methods for creating and manipulating collision pair sets. -* -* @class Pairs -*/ - -var Pairs = {}; - -module.exports = Pairs; - -var Pair = _dereq_('./Pair'); -var Common = _dereq_('../core/Common'); - -(function() { - - Pairs._pairMaxIdleLife = 1000; - - /** - * Creates a new pairs structure. - * @method create - * @param {object} options - * @return {pairs} A new pairs structure - */ - Pairs.create = function(options) { - return Common.extend({ - table: {}, - list: [], - collisionStart: [], - collisionActive: [], - collisionEnd: [] - }, options); - }; - - /** - * Updates pairs given a list of collisions. - * @method update - * @param {object} pairs - * @param {collision[]} collisions - * @param {number} timestamp - */ - Pairs.update = function(pairs, collisions, timestamp) { - var pairsList = pairs.list, - pairsTable = pairs.table, - collisionStart = pairs.collisionStart, - collisionEnd = pairs.collisionEnd, - collisionActive = pairs.collisionActive, - activePairIds = [], - collision, - pairId, - pair, - i; - - // clear collision state arrays, but maintain old reference - collisionStart.length = 0; - collisionEnd.length = 0; - collisionActive.length = 0; - - for (i = 0; i < collisions.length; i++) { - collision = collisions[i]; - - if (collision.collided) { - pairId = Pair.id(collision.bodyA, collision.bodyB); - activePairIds.push(pairId); - - pair = pairsTable[pairId]; - - if (pair) { - // pair already exists (but may or may not be active) - if (pair.isActive) { - // pair exists and is active - collisionActive.push(pair); - } else { - // pair exists but was inactive, so a collision has just started again - collisionStart.push(pair); - } - - // update the pair - Pair.update(pair, collision, timestamp); - } else { - // pair did not exist, create a new pair - pair = Pair.create(collision, timestamp); - pairsTable[pairId] = pair; - - // push the new pair - collisionStart.push(pair); - pairsList.push(pair); - } - } - } - - // deactivate previously active pairs that are now inactive - for (i = 0; i < pairsList.length; i++) { - pair = pairsList[i]; - if (pair.isActive && Common.indexOf(activePairIds, pair.id) === -1) { - Pair.setActive(pair, false, timestamp); - collisionEnd.push(pair); + if (body.sleepCounter >= body.sleepThreshold) + Sleeping.set(body, true); + } else if (body.sleepCounter > 0) { + body.sleepCounter -= 1; } } }; - - /** - * Finds and removes pairs that have been inactive for a set amount of time. - * @method removeOld - * @param {object} pairs - * @param {number} timestamp - */ - Pairs.removeOld = function(pairs, timestamp) { - var pairsList = pairs.list, - pairsTable = pairs.table, - indexesToRemove = [], - pair, - collision, - pairIndex, - i; - - for (i = 0; i < pairsList.length; i++) { - pair = pairsList[i]; - collision = pair.collision; - - // never remove sleeping pairs - if (collision.bodyA.isSleeping || collision.bodyB.isSleeping) { - pair.timeUpdated = timestamp; - continue; - } - - // if pair is inactive for too long, mark it to be removed - if (timestamp - pair.timeUpdated > Pairs._pairMaxIdleLife) { - indexesToRemove.push(i); - } - } - - // remove marked pairs - for (i = 0; i < indexesToRemove.length; i++) { - pairIndex = indexesToRemove[i] - i; - pair = pairsList[pairIndex]; - delete pairsTable[pair.id]; - pairsList.splice(pairIndex, 1); - } - }; /** - * Clears the given pairs structure. - * @method clear - * @param {pairs} pairs - * @return {pairs} pairs - */ - Pairs.clear = function(pairs) { - pairs.table = {}; - pairs.list.length = 0; - pairs.collisionStart.length = 0; - pairs.collisionActive.length = 0; - pairs.collisionEnd.length = 0; - return pairs; - }; - -})(); - -},{"../core/Common":14,"./Pair":7}],9:[function(_dereq_,module,exports){ -/** -* The `Matter.Query` module contains methods for performing collision queries. -* -* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). -* -* @class Query -*/ - -var Query = {}; - -module.exports = Query; - -var Vector = _dereq_('../geometry/Vector'); -var SAT = _dereq_('./SAT'); -var Bounds = _dereq_('../geometry/Bounds'); -var Bodies = _dereq_('../factory/Bodies'); -var Vertices = _dereq_('../geometry/Vertices'); - -(function() { - - /** - * Returns a list of collisions between `body` and `bodies`. - * @method collides - * @param {body} body - * @param {body[]} bodies - * @return {object[]} Collisions - */ - Query.collides = function(body, bodies) { - var collisions = []; - - for (var i = 0; i < bodies.length; i++) { - var bodyA = bodies[i]; - - if (Bounds.overlaps(bodyA.bounds, body.bounds)) { - for (var j = bodyA.parts.length === 1 ? 0 : 1; j < bodyA.parts.length; j++) { - var part = bodyA.parts[j]; - - if (Bounds.overlaps(part.bounds, body.bounds)) { - var collision = SAT.collides(part, body); - - if (collision.collided) { - collisions.push(collision); - break; - } - } - } - } - } - - return collisions; - }; - - /** - * Casts a ray segment against a set of bodies and returns all collisions, ray width is optional. Intersection points are not provided. - * @method ray - * @param {body[]} bodies - * @param {vector} startPoint - * @param {vector} endPoint - * @param {number} [rayWidth] - * @return {object[]} Collisions - */ - Query.ray = function(bodies, startPoint, endPoint, rayWidth) { - rayWidth = rayWidth || 1e-100; - - var rayAngle = Vector.angle(startPoint, endPoint), - rayLength = Vector.magnitude(Vector.sub(startPoint, endPoint)), - rayX = (endPoint.x + startPoint.x) * 0.5, - rayY = (endPoint.y + startPoint.y) * 0.5, - ray = Bodies.rectangle(rayX, rayY, rayLength, rayWidth, { angle: rayAngle }), - collisions = Query.collides(ray, bodies); - - for (var i = 0; i < collisions.length; i += 1) { - var collision = collisions[i]; - collision.body = collision.bodyB = collision.bodyA; - } - - return collisions; - }; - - /** - * Returns all bodies whose bounds are inside (or outside if set) the given set of bounds, from the given set of bodies. - * @method region - * @param {body[]} bodies - * @param {bounds} bounds - * @param {bool} [outside=false] - * @return {body[]} The bodies matching the query - */ - Query.region = function(bodies, bounds, outside) { - var result = []; - - for (var i = 0; i < bodies.length; i++) { - var body = bodies[i], - overlaps = Bounds.overlaps(body.bounds, bounds); - if ((overlaps && !outside) || (!overlaps && outside)) - result.push(body); - } - - return result; - }; - - /** - * Returns all bodies whose vertices contain the given point, from the given set of bodies. - * @method point - * @param {body[]} bodies - * @param {vector} point - * @return {body[]} The bodies matching the query - */ - Query.point = function(bodies, point) { - var result = []; - - for (var i = 0; i < bodies.length; i++) { - var body = bodies[i]; - - if (Bounds.contains(body.bounds, point)) { - for (var j = body.parts.length === 1 ? 0 : 1; j < body.parts.length; j++) { - var part = body.parts[j]; - - if (Bounds.contains(part.bounds, point) - && Vertices.contains(part.vertices, point)) { - result.push(body); - break; - } - } - } - } - - return result; - }; - -})(); - -},{"../factory/Bodies":23,"../geometry/Bounds":26,"../geometry/Vector":28,"../geometry/Vertices":29,"./SAT":11}],10:[function(_dereq_,module,exports){ -/** -* The `Matter.Resolver` module contains methods for resolving collision pairs. -* -* @class Resolver -*/ - -var Resolver = {}; - -module.exports = Resolver; - -var Vertices = _dereq_('../geometry/Vertices'); -var Vector = _dereq_('../geometry/Vector'); -var Common = _dereq_('../core/Common'); -var Bounds = _dereq_('../geometry/Bounds'); - -(function() { - - Resolver._restingThresh = 4; - Resolver._restingThreshTangent = 6; - Resolver._positionDampen = 0.9; - Resolver._positionWarming = 0.8; - Resolver._frictionNormalMultiplier = 5; - - /** - * Prepare pairs for position solving. - * @method preSolvePosition - * @param {pair[]} pairs - */ - Resolver.preSolvePosition = function(pairs) { - var i, - pair, - activeCount; - - // find total contacts on each body - for (i = 0; i < pairs.length; i++) { - pair = pairs[i]; - - if (!pair.isActive) - continue; - - activeCount = pair.activeContacts.length; - pair.collision.parentA.totalContacts += activeCount; - pair.collision.parentB.totalContacts += activeCount; - } - }; - - /** - * Find a solution for pair positions. - * @method solvePosition + * Given a set of colliding pairs, wakes the sleeping bodies involved. + * @method afterCollisions * @param {pair[]} pairs * @param {number} timeScale */ - Resolver.solvePosition = function(pairs, timeScale) { - var i, - pair, - collision, - bodyA, - bodyB, - normal, - bodyBtoA, - contactShare, - positionImpulse, - contactCount = {}, - tempA = Vector._temp[0], - tempB = Vector._temp[1], - tempC = Vector._temp[2], - tempD = Vector._temp[3]; + Sleeping.afterCollisions = function(pairs, timeScale) { + var timeFactor = timeScale * timeScale * timeScale; - // find impulses required to resolve penetration - for (i = 0; i < pairs.length; i++) { - pair = pairs[i]; - - if (!pair.isActive || pair.isSensor) - continue; - - collision = pair.collision; - bodyA = collision.parentA; - bodyB = collision.parentB; - normal = collision.normal; - - // get current separation between body edges involved in collision - bodyBtoA = Vector.sub(Vector.add(bodyB.positionImpulse, bodyB.position, tempA), - Vector.add(bodyA.positionImpulse, - Vector.sub(bodyB.position, collision.penetration, tempB), tempC), tempD); - - pair.separation = Vector.dot(normal, bodyBtoA); - } - - for (i = 0; i < pairs.length; i++) { - pair = pairs[i]; - - if (!pair.isActive || pair.isSensor) - continue; - - collision = pair.collision; - bodyA = collision.parentA; - bodyB = collision.parentB; - normal = collision.normal; - positionImpulse = (pair.separation - pair.slop) * timeScale; - - if (bodyA.isStatic || bodyB.isStatic) - positionImpulse *= 2; - - if (!(bodyA.isStatic || bodyA.isSleeping)) { - contactShare = Resolver._positionDampen / bodyA.totalContacts; - bodyA.positionImpulse.x += normal.x * positionImpulse * contactShare; - bodyA.positionImpulse.y += normal.y * positionImpulse * contactShare; - } - - if (!(bodyB.isStatic || bodyB.isSleeping)) { - contactShare = Resolver._positionDampen / bodyB.totalContacts; - bodyB.positionImpulse.x -= normal.x * positionImpulse * contactShare; - bodyB.positionImpulse.y -= normal.y * positionImpulse * contactShare; - } - } - }; - - /** - * Apply position resolution. - * @method postSolvePosition - * @param {body[]} bodies - */ - Resolver.postSolvePosition = function(bodies) { - for (var i = 0; i < bodies.length; i++) { - var body = bodies[i]; - - // reset contact count - body.totalContacts = 0; - - if (body.positionImpulse.x !== 0 || body.positionImpulse.y !== 0) { - // update body geometry - for (var j = 0; j < body.parts.length; j++) { - var part = body.parts[j]; - Vertices.translate(part.vertices, body.positionImpulse); - Bounds.update(part.bounds, part.vertices, body.velocity); - part.position.x += body.positionImpulse.x; - part.position.y += body.positionImpulse.y; - } - - // move the body without changing velocity - body.positionPrev.x += body.positionImpulse.x; - body.positionPrev.y += body.positionImpulse.y; - - if (Vector.dot(body.positionImpulse, body.velocity) < 0) { - // reset cached impulse if the body has velocity along it - body.positionImpulse.x = 0; - body.positionImpulse.y = 0; - } else { - // warm the next iteration - body.positionImpulse.x *= Resolver._positionWarming; - body.positionImpulse.y *= Resolver._positionWarming; - } - } - } - }; - - /** - * Prepare pairs for velocity solving. - * @method preSolveVelocity - * @param {pair[]} pairs - */ - Resolver.preSolveVelocity = function(pairs) { - var i, - j, - pair, - contacts, - collision, - bodyA, - bodyB, - normal, - tangent, - contact, - contactVertex, - normalImpulse, - tangentImpulse, - offset, - impulse = Vector._temp[0], - tempA = Vector._temp[1]; - - for (i = 0; i < pairs.length; i++) { - pair = pairs[i]; - - if (!pair.isActive || pair.isSensor) - continue; - - contacts = pair.activeContacts; - collision = pair.collision; - bodyA = collision.parentA; - bodyB = collision.parentB; - normal = collision.normal; - tangent = collision.tangent; - - // resolve each contact - for (j = 0; j < contacts.length; j++) { - contact = contacts[j]; - contactVertex = contact.vertex; - normalImpulse = contact.normalImpulse; - tangentImpulse = contact.tangentImpulse; - - if (normalImpulse !== 0 || tangentImpulse !== 0) { - // total impulse from contact - impulse.x = (normal.x * normalImpulse) + (tangent.x * tangentImpulse); - impulse.y = (normal.y * normalImpulse) + (tangent.y * tangentImpulse); - - // apply impulse from contact - if (!(bodyA.isStatic || bodyA.isSleeping)) { - offset = Vector.sub(contactVertex, bodyA.position, tempA); - bodyA.positionPrev.x += impulse.x * bodyA.inverseMass; - bodyA.positionPrev.y += impulse.y * bodyA.inverseMass; - bodyA.anglePrev += Vector.cross(offset, impulse) * bodyA.inverseInertia; - } - - if (!(bodyB.isStatic || bodyB.isSleeping)) { - offset = Vector.sub(contactVertex, bodyB.position, tempA); - bodyB.positionPrev.x -= impulse.x * bodyB.inverseMass; - bodyB.positionPrev.y -= impulse.y * bodyB.inverseMass; - bodyB.anglePrev -= Vector.cross(offset, impulse) * bodyB.inverseInertia; - } - } - } - } - }; - - /** - * Find a solution for pair velocities. - * @method solveVelocity - * @param {pair[]} pairs - * @param {number} timeScale - */ - Resolver.solveVelocity = function(pairs, timeScale) { - var timeScaleSquared = timeScale * timeScale, - impulse = Vector._temp[0], - tempA = Vector._temp[1], - tempB = Vector._temp[2], - tempC = Vector._temp[3], - tempD = Vector._temp[4], - tempE = Vector._temp[5]; - + // wake up bodies involved in collisions for (var i = 0; i < pairs.length; i++) { var pair = pairs[i]; - if (!pair.isActive || pair.isSensor) + // don't wake inactive pairs + if (!pair.isActive) continue; - + var collision = pair.collision, - bodyA = collision.parentA, - bodyB = collision.parentB, - normal = collision.normal, - tangent = collision.tangent, - contacts = pair.activeContacts, - contactShare = 1 / contacts.length; + bodyA = collision.bodyA.parent, + bodyB = collision.bodyB.parent; + + // don't wake if at least one body is static + if ((bodyA.isSleeping && bodyB.isSleeping) || bodyA.isStatic || bodyB.isStatic) + continue; + + if (bodyA.isSleeping || bodyB.isSleeping) { + var sleepingBody = (bodyA.isSleeping && !bodyA.isStatic) ? bodyA : bodyB, + movingBody = sleepingBody === bodyA ? bodyB : bodyA; - // update body velocities - bodyA.velocity.x = bodyA.position.x - bodyA.positionPrev.x; - bodyA.velocity.y = bodyA.position.y - bodyA.positionPrev.y; - bodyB.velocity.x = bodyB.position.x - bodyB.positionPrev.x; - bodyB.velocity.y = bodyB.position.y - bodyB.positionPrev.y; - bodyA.angularVelocity = bodyA.angle - bodyA.anglePrev; - bodyB.angularVelocity = bodyB.angle - bodyB.anglePrev; - - // resolve each contact - for (var j = 0; j < contacts.length; j++) { - var contact = contacts[j], - contactVertex = contact.vertex, - offsetA = Vector.sub(contactVertex, bodyA.position, tempA), - offsetB = Vector.sub(contactVertex, bodyB.position, tempB), - velocityPointA = Vector.add(bodyA.velocity, Vector.mult(Vector.perp(offsetA), bodyA.angularVelocity), tempC), - velocityPointB = Vector.add(bodyB.velocity, Vector.mult(Vector.perp(offsetB), bodyB.angularVelocity), tempD), - relativeVelocity = Vector.sub(velocityPointA, velocityPointB, tempE), - normalVelocity = Vector.dot(normal, relativeVelocity); - - var tangentVelocity = Vector.dot(tangent, relativeVelocity), - tangentSpeed = Math.abs(tangentVelocity), - tangentVelocityDirection = Common.sign(tangentVelocity); - - // raw impulses - var normalImpulse = (1 + pair.restitution) * normalVelocity, - normalForce = Common.clamp(pair.separation + normalVelocity, 0, 1) * Resolver._frictionNormalMultiplier; - - // coulomb friction - var tangentImpulse = tangentVelocity, - maxFriction = Infinity; - - if (tangentSpeed > pair.friction * pair.frictionStatic * normalForce * timeScaleSquared) { - maxFriction = tangentSpeed; - tangentImpulse = Common.clamp( - pair.friction * tangentVelocityDirection * timeScaleSquared, - -maxFriction, maxFriction - ); + if (!sleepingBody.isStatic && movingBody.motion > Sleeping._motionWakeThreshold * timeFactor) { + Sleeping.set(sleepingBody, false); } + } + } + }; + + /** + * Set a body as sleeping or awake. + * @method set + * @param {body} body + * @param {boolean} isSleeping + */ + Sleeping.set = function(body, isSleeping) { + var wasSleeping = body.isSleeping; - // modify impulses accounting for mass, inertia and offset - var oAcN = Vector.cross(offsetA, normal), - oBcN = Vector.cross(offsetB, normal), - share = contactShare / (bodyA.inverseMass + bodyB.inverseMass + bodyA.inverseInertia * oAcN * oAcN + bodyB.inverseInertia * oBcN * oBcN); + if (isSleeping) { + body.isSleeping = true; + body.sleepCounter = body.sleepThreshold; - normalImpulse *= share; - tangentImpulse *= share; + body.positionImpulse.x = 0; + body.positionImpulse.y = 0; - // handle high velocity and resting collisions separately - if (normalVelocity < 0 && normalVelocity * normalVelocity > Resolver._restingThresh * timeScaleSquared) { - // high normal velocity so clear cached contact normal impulse - contact.normalImpulse = 0; - } else { - // solve resting collision constraints using Erin Catto's method (GDC08) - // impulse constraint tends to 0 - var contactNormalImpulse = contact.normalImpulse; - contact.normalImpulse = Math.min(contact.normalImpulse + normalImpulse, 0); - normalImpulse = contact.normalImpulse - contactNormalImpulse; - } + body.positionPrev.x = body.position.x; + body.positionPrev.y = body.position.y; - // handle high velocity and resting collisions separately - if (tangentVelocity * tangentVelocity > Resolver._restingThreshTangent * timeScaleSquared) { - // high tangent velocity so clear cached contact tangent impulse - contact.tangentImpulse = 0; - } else { - // solve resting collision constraints using Erin Catto's method (GDC08) - // tangent impulse tends to -tangentSpeed or +tangentSpeed - var contactTangentImpulse = contact.tangentImpulse; - contact.tangentImpulse = Common.clamp(contact.tangentImpulse + tangentImpulse, -maxFriction, maxFriction); - tangentImpulse = contact.tangentImpulse - contactTangentImpulse; - } + body.anglePrev = body.angle; + body.speed = 0; + body.angularSpeed = 0; + body.motion = 0; - // total impulse from contact - impulse.x = (normal.x * normalImpulse) + (tangent.x * tangentImpulse); - impulse.y = (normal.y * normalImpulse) + (tangent.y * tangentImpulse); - - // apply impulse from contact - if (!(bodyA.isStatic || bodyA.isSleeping)) { - bodyA.positionPrev.x += impulse.x * bodyA.inverseMass; - bodyA.positionPrev.y += impulse.y * bodyA.inverseMass; - bodyA.anglePrev += Vector.cross(offsetA, impulse) * bodyA.inverseInertia; - } + if (!wasSleeping) { + Events.trigger(body, 'sleepStart'); + } + } else { + body.isSleeping = false; + body.sleepCounter = 0; - if (!(bodyB.isStatic || bodyB.isSleeping)) { - bodyB.positionPrev.x -= impulse.x * bodyB.inverseMass; - bodyB.positionPrev.y -= impulse.y * bodyB.inverseMass; - bodyB.anglePrev -= Vector.cross(offsetB, impulse) * bodyB.inverseInertia; - } + if (wasSleeping) { + Events.trigger(body, 'sleepEnd'); } } }; })(); -},{"../core/Common":14,"../geometry/Bounds":26,"../geometry/Vector":28,"../geometry/Vertices":29}],11:[function(_dereq_,module,exports){ -/** -* The `Matter.SAT` module contains methods for detecting collisions using the Separating Axis Theorem. -* -* @class SAT -*/ -// TODO: true circles and curves +/***/ }), +/* 8 */ +/***/ (function(module, exports, __webpack_require__) { -var SAT = {}; - -module.exports = SAT; - -var Vertices = _dereq_('../geometry/Vertices'); -var Vector = _dereq_('../geometry/Vector'); - -(function() { - - /** - * Detect collision between two bodies using the Separating Axis Theorem. - * @method collides - * @param {body} bodyA - * @param {body} bodyB - * @param {collision} previousCollision - * @return {collision} collision - */ - SAT.collides = function(bodyA, bodyB, previousCollision) { - var overlapAB, - overlapBA, - minOverlap, - collision, - canReusePrevCol = false; - - if (previousCollision) { - // estimate total motion - var parentA = bodyA.parent, - parentB = bodyB.parent, - motion = parentA.speed * parentA.speed + parentA.angularSpeed * parentA.angularSpeed - + parentB.speed * parentB.speed + parentB.angularSpeed * parentB.angularSpeed; - - // we may be able to (partially) reuse collision result - // but only safe if collision was resting - canReusePrevCol = previousCollision && previousCollision.collided && motion < 0.2; - - // reuse collision object - collision = previousCollision; - } else { - collision = { collided: false, bodyA: bodyA, bodyB: bodyB }; - } - - if (previousCollision && canReusePrevCol) { - // if we can reuse the collision result - // we only need to test the previously found axis - var axisBodyA = collision.axisBody, - axisBodyB = axisBodyA === bodyA ? bodyB : bodyA, - axes = [axisBodyA.axes[previousCollision.axisNumber]]; - - minOverlap = SAT._overlapAxes(axisBodyA.vertices, axisBodyB.vertices, axes); - collision.reused = true; - - if (minOverlap.overlap <= 0) { - collision.collided = false; - return collision; - } - } else { - // if we can't reuse a result, perform a full SAT test - - overlapAB = SAT._overlapAxes(bodyA.vertices, bodyB.vertices, bodyA.axes); - - if (overlapAB.overlap <= 0) { - collision.collided = false; - return collision; - } - - overlapBA = SAT._overlapAxes(bodyB.vertices, bodyA.vertices, bodyB.axes); - - if (overlapBA.overlap <= 0) { - collision.collided = false; - return collision; - } - - if (overlapAB.overlap < overlapBA.overlap) { - minOverlap = overlapAB; - collision.axisBody = bodyA; - } else { - minOverlap = overlapBA; - collision.axisBody = bodyB; - } - - // important for reuse later - collision.axisNumber = minOverlap.axisNumber; - } - - collision.bodyA = bodyA.id < bodyB.id ? bodyA : bodyB; - collision.bodyB = bodyA.id < bodyB.id ? bodyB : bodyA; - collision.collided = true; - collision.depth = minOverlap.overlap; - collision.parentA = collision.bodyA.parent; - collision.parentB = collision.bodyB.parent; - - bodyA = collision.bodyA; - bodyB = collision.bodyB; - - // ensure normal is facing away from bodyA - if (Vector.dot(minOverlap.axis, Vector.sub(bodyB.position, bodyA.position)) < 0) { - collision.normal = { - x: minOverlap.axis.x, - y: minOverlap.axis.y - }; - } else { - collision.normal = { - x: -minOverlap.axis.x, - y: -minOverlap.axis.y - }; - } - - collision.tangent = Vector.perp(collision.normal); - - collision.penetration = collision.penetration || {}; - collision.penetration.x = collision.normal.x * collision.depth; - collision.penetration.y = collision.normal.y * collision.depth; - - // find support points, there is always either exactly one or two - var verticesB = SAT._findSupports(bodyA, bodyB, collision.normal), - supports = []; - - // find the supports from bodyB that are inside bodyA - if (Vertices.contains(bodyA.vertices, verticesB[0])) - supports.push(verticesB[0]); - - if (Vertices.contains(bodyA.vertices, verticesB[1])) - supports.push(verticesB[1]); - - // find the supports from bodyA that are inside bodyB - if (supports.length < 2) { - var verticesA = SAT._findSupports(bodyB, bodyA, Vector.neg(collision.normal)); - - if (Vertices.contains(bodyB.vertices, verticesA[0])) - supports.push(verticesA[0]); - - if (supports.length < 2 && Vertices.contains(bodyB.vertices, verticesA[1])) - supports.push(verticesA[1]); - } - - // account for the edge case of overlapping but no vertex containment - if (supports.length < 1) - supports = [verticesB[0]]; - - collision.supports = supports; - - return collision; - }; - - /** - * Find the overlap between two sets of vertices. - * @method _overlapAxes - * @private - * @param {} verticesA - * @param {} verticesB - * @param {} axes - * @return result - */ - SAT._overlapAxes = function(verticesA, verticesB, axes) { - var projectionA = Vector._temp[0], - projectionB = Vector._temp[1], - result = { overlap: Number.MAX_VALUE }, - overlap, - axis; - - for (var i = 0; i < axes.length; i++) { - axis = axes[i]; - - SAT._projectToAxis(projectionA, verticesA, axis); - SAT._projectToAxis(projectionB, verticesB, axis); - - overlap = Math.min(projectionA.max - projectionB.min, projectionB.max - projectionA.min); - - if (overlap <= 0) { - result.overlap = overlap; - return result; - } - - if (overlap < result.overlap) { - result.overlap = overlap; - result.axis = axis; - result.axisNumber = i; - } - } - - return result; - }; - - /** - * Projects vertices on an axis and returns an interval. - * @method _projectToAxis - * @private - * @param {} projection - * @param {} vertices - * @param {} axis - */ - SAT._projectToAxis = function(projection, vertices, axis) { - var min = Vector.dot(vertices[0], axis), - max = min; - - for (var i = 1; i < vertices.length; i += 1) { - var dot = Vector.dot(vertices[i], axis); - - if (dot > max) { - max = dot; - } else if (dot < min) { - min = dot; - } - } - - projection.min = min; - projection.max = max; - }; - - /** - * Finds supporting vertices given two bodies along a given direction using hill-climbing. - * @method _findSupports - * @private - * @param {} bodyA - * @param {} bodyB - * @param {} normal - * @return [vector] - */ - SAT._findSupports = function(bodyA, bodyB, normal) { - var nearestDistance = Number.MAX_VALUE, - vertexToBody = Vector._temp[0], - vertices = bodyB.vertices, - bodyAPosition = bodyA.position, - distance, - vertex, - vertexA, - vertexB; - - // find closest vertex on bodyB - for (var i = 0; i < vertices.length; i++) { - vertex = vertices[i]; - vertexToBody.x = vertex.x - bodyAPosition.x; - vertexToBody.y = vertex.y - bodyAPosition.y; - distance = -Vector.dot(normal, vertexToBody); - - if (distance < nearestDistance) { - nearestDistance = distance; - vertexA = vertex; - } - } - - // find next closest vertex using the two connected to it - var prevIndex = vertexA.index - 1 >= 0 ? vertexA.index - 1 : vertices.length - 1; - vertex = vertices[prevIndex]; - vertexToBody.x = vertex.x - bodyAPosition.x; - vertexToBody.y = vertex.y - bodyAPosition.y; - nearestDistance = -Vector.dot(normal, vertexToBody); - vertexB = vertex; - - var nextIndex = (vertexA.index + 1) % vertices.length; - vertex = vertices[nextIndex]; - vertexToBody.x = vertex.x - bodyAPosition.x; - vertexToBody.y = vertex.y - bodyAPosition.y; - distance = -Vector.dot(normal, vertexToBody); - if (distance < nearestDistance) { - vertexB = vertex; - } - - return [vertexA, vertexB]; - }; - -})(); - -},{"../geometry/Vector":28,"../geometry/Vertices":29}],12:[function(_dereq_,module,exports){ /** * The `Matter.Constraint` module contains methods for creating and manipulating constraints. * Constraints are used for specifying that a fixed distance must be maintained between two bodies (or a body and a fixed world-space position). @@ -3560,12 +3691,12 @@ var Constraint = {}; module.exports = Constraint; -var Vertices = _dereq_('../geometry/Vertices'); -var Vector = _dereq_('../geometry/Vector'); -var Sleeping = _dereq_('../core/Sleeping'); -var Bounds = _dereq_('../geometry/Bounds'); -var Axes = _dereq_('../geometry/Axes'); -var Common = _dereq_('../core/Common'); +var Vertices = __webpack_require__(3); +var Vector = __webpack_require__(2); +var Sleeping = __webpack_require__(7); +var Bounds = __webpack_require__(1); +var Axes = __webpack_require__(15); +var Common = __webpack_require__(0); (function() { @@ -3848,6 +3979,32 @@ var Common = _dereq_('../core/Common'); } }; + /** + * Returns the world-space position of `constraint.pointA`, accounting for `constraint.bodyA`. + * @method pointAWorld + * @param {constraint} constraint + * @returns {vector} the world-space position + */ + Constraint.pointAWorld = function(constraint) { + return { + x: (constraint.bodyA ? constraint.bodyA.position.x : 0) + constraint.pointA.x, + y: (constraint.bodyA ? constraint.bodyA.position.y : 0) + constraint.pointA.y + }; + }; + + /** + * Returns the world-space position of `constraint.pointB`, accounting for `constraint.bodyB`. + * @method pointBWorld + * @param {constraint} constraint + * @returns {vector} the world-space position + */ + Constraint.pointBWorld = function(constraint) { + return { + x: (constraint.bodyB ? constraint.bodyB.position.x : 0) + constraint.pointB.x, + y: (constraint.bodyB ? constraint.bodyB.position.y : 0) + constraint.pointB.y + }; + }; + /* * * Properties Documentation @@ -4000,4360 +4157,144 @@ var Common = _dereq_('../core/Common'); })(); -},{"../core/Common":14,"../core/Sleeping":22,"../geometry/Axes":25,"../geometry/Bounds":26,"../geometry/Vector":28,"../geometry/Vertices":29}],13:[function(_dereq_,module,exports){ + +/***/ }), +/* 9 */ +/***/ (function(module, exports, __webpack_require__) { + /** -* The `Matter.MouseConstraint` module contains methods for creating mouse constraints. -* Mouse constraints are used for allowing user interaction, providing the ability to move bodies via the mouse or touch. +* The `Matter.Pair` module contains methods for creating and manipulating collision pairs. * -* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). -* -* @class MouseConstraint +* @class Pair */ -var MouseConstraint = {}; +var Pair = {}; -module.exports = MouseConstraint; +module.exports = Pair; -var Vertices = _dereq_('../geometry/Vertices'); -var Sleeping = _dereq_('../core/Sleeping'); -var Mouse = _dereq_('../core/Mouse'); -var Events = _dereq_('../core/Events'); -var Detector = _dereq_('../collision/Detector'); -var Constraint = _dereq_('./Constraint'); -var Composite = _dereq_('../body/Composite'); -var Common = _dereq_('../core/Common'); -var Bounds = _dereq_('../geometry/Bounds'); +var Contact = __webpack_require__(18); (function() { - + /** - * Creates a new mouse constraint. - * All properties have default values, and many are pre-calculated automatically based on other properties. - * See the properties section below for detailed information on what you can pass via the `options` object. + * Creates a pair. * @method create - * @param {engine} engine - * @param {} options - * @return {MouseConstraint} A new MouseConstraint + * @param {collision} collision + * @param {number} timestamp + * @return {pair} A new pair */ - MouseConstraint.create = function(engine, options) { - var mouse = (engine ? engine.mouse : null) || (options ? options.mouse : null); + Pair.create = function(collision, timestamp) { + var bodyA = collision.bodyA, + bodyB = collision.bodyB, + parentA = collision.parentA, + parentB = collision.parentB; - if (!mouse) { - if (engine && engine.render && engine.render.canvas) { - mouse = Mouse.create(engine.render.canvas); - } else if (options && options.element) { - mouse = Mouse.create(options.element); - } else { - mouse = Mouse.create(); - Common.warn('MouseConstraint.create: options.mouse was undefined, options.element was undefined, may not function as expected'); - } - } - - var constraint = Constraint.create({ - label: 'Mouse Constraint', - pointA: mouse.position, - pointB: { x: 0, y: 0 }, - length: 0.01, - stiffness: 0.1, - angularStiffness: 1, - render: { - strokeStyle: '#90EE90', - lineWidth: 3 - } - }); - - var defaults = { - type: 'mouseConstraint', - mouse: mouse, - element: null, - body: null, - constraint: constraint, - collisionFilter: { - category: 0x0001, - mask: 0xFFFFFFFF, - group: 0 - } + var pair = { + id: Pair.id(bodyA, bodyB), + bodyA: bodyA, + bodyB: bodyB, + contacts: {}, + activeContacts: [], + separation: 0, + isActive: true, + confirmedActive: true, + isSensor: bodyA.isSensor || bodyB.isSensor, + timeCreated: timestamp, + timeUpdated: timestamp, + inverseMass: parentA.inverseMass + parentB.inverseMass, + friction: Math.min(parentA.friction, parentB.friction), + frictionStatic: Math.max(parentA.frictionStatic, parentB.frictionStatic), + restitution: Math.max(parentA.restitution, parentB.restitution), + slop: Math.max(parentA.slop, parentB.slop) }; - var mouseConstraint = Common.extend(defaults, options); + Pair.update(pair, collision, timestamp); - Events.on(engine, 'beforeUpdate', function() { - var allBodies = Composite.allBodies(engine.world); - MouseConstraint.update(mouseConstraint, allBodies); - MouseConstraint._triggerEvents(mouseConstraint); - }); - - return mouseConstraint; + return pair; }; /** - * Updates the given mouse constraint. - * @private + * Updates a pair given a collision. * @method update - * @param {MouseConstraint} mouseConstraint - * @param {body[]} bodies + * @param {pair} pair + * @param {collision} collision + * @param {number} timestamp */ - MouseConstraint.update = function(mouseConstraint, bodies) { - var mouse = mouseConstraint.mouse, - constraint = mouseConstraint.constraint, - body = mouseConstraint.body; - - if (mouse.button === 0) { - if (!constraint.bodyB) { - for (var i = 0; i < bodies.length; i++) { - body = bodies[i]; - if (Bounds.contains(body.bounds, mouse.position) - && Detector.canCollide(body.collisionFilter, mouseConstraint.collisionFilter)) { - for (var j = body.parts.length > 1 ? 1 : 0; j < body.parts.length; j++) { - var part = body.parts[j]; - if (Vertices.contains(part.vertices, mouse.position)) { - constraint.pointA = mouse.position; - constraint.bodyB = mouseConstraint.body = body; - constraint.pointB = { x: mouse.position.x - body.position.x, y: mouse.position.y - body.position.y }; - constraint.angleB = body.angle; - - Sleeping.set(body, false); - Events.trigger(mouseConstraint, 'startdrag', { mouse: mouse, body: body }); - - break; - } - } - } - } - } else { - Sleeping.set(constraint.bodyB, false); - constraint.pointA = mouse.position; - } - } else { - constraint.bodyB = mouseConstraint.body = null; - constraint.pointB = null; - - if (body) - Events.trigger(mouseConstraint, 'enddrag', { mouse: mouse, body: body }); - } - }; - - /** - * Triggers mouse constraint events. - * @method _triggerEvents - * @private - * @param {mouse} mouseConstraint - */ - MouseConstraint._triggerEvents = function(mouseConstraint) { - var mouse = mouseConstraint.mouse, - mouseEvents = mouse.sourceEvents; - - if (mouseEvents.mousemove) - Events.trigger(mouseConstraint, 'mousemove', { mouse: mouse }); - - if (mouseEvents.mousedown) - Events.trigger(mouseConstraint, 'mousedown', { mouse: mouse }); - - if (mouseEvents.mouseup) - Events.trigger(mouseConstraint, 'mouseup', { mouse: mouse }); - - // reset the mouse state ready for the next step - Mouse.clearSourceEvents(mouse); - }; - - /* - * - * Events Documentation - * - */ - - /** - * Fired when the mouse has moved (or a touch moves) during the last step - * - * @event mousemove - * @param {} event An event object - * @param {mouse} event.mouse The engine's mouse instance - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired when the mouse is down (or a touch has started) during the last step - * - * @event mousedown - * @param {} event An event object - * @param {mouse} event.mouse The engine's mouse instance - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired when the mouse is up (or a touch has ended) during the last step - * - * @event mouseup - * @param {} event An event object - * @param {mouse} event.mouse The engine's mouse instance - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired when the user starts dragging a body - * - * @event startdrag - * @param {} event An event object - * @param {mouse} event.mouse The engine's mouse instance - * @param {body} event.body The body being dragged - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired when the user ends dragging a body - * - * @event enddrag - * @param {} event An event object - * @param {mouse} event.mouse The engine's mouse instance - * @param {body} event.body The body that has stopped being dragged - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /* - * - * Properties Documentation - * - */ - - /** - * A `String` denoting the type of object. - * - * @property type - * @type string - * @default "constraint" - * @readOnly - */ - - /** - * The `Mouse` instance in use. If not supplied in `MouseConstraint.create`, one will be created. - * - * @property mouse - * @type mouse - * @default mouse - */ - - /** - * The `Body` that is currently being moved by the user, or `null` if no body. - * - * @property body - * @type body - * @default null - */ - - /** - * The `Constraint` object that is used to move the body during interaction. - * - * @property constraint - * @type constraint - */ - - /** - * An `Object` that specifies the collision filter properties. - * The collision filter allows the user to define which types of body this mouse constraint can interact with. - * See `body.collisionFilter` for more information. - * - * @property collisionFilter - * @type object - */ - -})(); - -},{"../body/Composite":2,"../collision/Detector":5,"../core/Common":14,"../core/Events":16,"../core/Mouse":19,"../core/Sleeping":22,"../geometry/Bounds":26,"../geometry/Vertices":29,"./Constraint":12}],14:[function(_dereq_,module,exports){ -(function (global){ -/** -* The `Matter.Common` module contains utility functions that are common to all modules. -* -* @class Common -*/ - -var Common = {}; - -module.exports = Common; - -(function() { - - Common._nextId = 0; - Common._seed = 0; - Common._nowStartTime = +(new Date()); - - /** - * Extends the object in the first argument using the object in the second argument. - * @method extend - * @param {} obj - * @param {boolean} deep - * @return {} obj extended - */ - Common.extend = function(obj, deep) { - var argsStart, - args, - deepClone; - - if (typeof deep === 'boolean') { - argsStart = 2; - deepClone = deep; - } else { - argsStart = 1; - deepClone = true; - } - - for (var i = argsStart; i < arguments.length; i++) { - var source = arguments[i]; - - if (source) { - for (var prop in source) { - if (deepClone && source[prop] && source[prop].constructor === Object) { - if (!obj[prop] || obj[prop].constructor === Object) { - obj[prop] = obj[prop] || {}; - Common.extend(obj[prop], deepClone, source[prop]); - } else { - obj[prop] = source[prop]; - } - } else { - obj[prop] = source[prop]; - } - } - } - } + Pair.update = function(pair, collision, timestamp) { + var contacts = pair.contacts, + supports = collision.supports, + activeContacts = pair.activeContacts, + parentA = collision.parentA, + parentB = collision.parentB; - return obj; - }; - - /** - * Creates a new clone of the object, if deep is true references will also be cloned. - * @method clone - * @param {} obj - * @param {bool} deep - * @return {} obj cloned - */ - Common.clone = function(obj, deep) { - return Common.extend({}, deep, obj); - }; - - /** - * Returns the list of keys for the given object. - * @method keys - * @param {} obj - * @return {string[]} keys - */ - Common.keys = function(obj) { - if (Object.keys) - return Object.keys(obj); - - // avoid hasOwnProperty for performance - var keys = []; - for (var key in obj) - keys.push(key); - return keys; - }; - - /** - * Returns the list of values for the given object. - * @method values - * @param {} obj - * @return {array} Array of the objects property values - */ - Common.values = function(obj) { - var values = []; + pair.collision = collision; + pair.inverseMass = parentA.inverseMass + parentB.inverseMass; + pair.friction = Math.min(parentA.friction, parentB.friction); + pair.frictionStatic = Math.max(parentA.frictionStatic, parentB.frictionStatic); + pair.restitution = Math.max(parentA.restitution, parentB.restitution); + pair.slop = Math.max(parentA.slop, parentB.slop); + activeContacts.length = 0; - if (Object.keys) { - var keys = Object.keys(obj); - for (var i = 0; i < keys.length; i++) { - values.push(obj[keys[i]]); - } - return values; - } - - // avoid hasOwnProperty for performance - for (var key in obj) - values.push(obj[key]); - return values; - }; - - /** - * Gets a value from `base` relative to the `path` string. - * @method get - * @param {} obj The base object - * @param {string} path The path relative to `base`, e.g. 'Foo.Bar.baz' - * @param {number} [begin] Path slice begin - * @param {number} [end] Path slice end - * @return {} The object at the given path - */ - Common.get = function(obj, path, begin, end) { - path = path.split('.').slice(begin, end); - - for (var i = 0; i < path.length; i += 1) { - obj = obj[path[i]]; - } - - return obj; - }; - - /** - * Sets a value on `base` relative to the given `path` string. - * @method set - * @param {} obj The base object - * @param {string} path The path relative to `base`, e.g. 'Foo.Bar.baz' - * @param {} val The value to set - * @param {number} [begin] Path slice begin - * @param {number} [end] Path slice end - * @return {} Pass through `val` for chaining - */ - Common.set = function(obj, path, val, begin, end) { - var parts = path.split('.').slice(begin, end); - Common.get(obj, path, 0, -1)[parts[parts.length - 1]] = val; - return val; - }; - - /** - * Shuffles the given array in-place. - * The function uses a seeded random generator. - * @method shuffle - * @param {array} array - * @return {array} array shuffled randomly - */ - Common.shuffle = function(array) { - for (var i = array.length - 1; i > 0; i--) { - var j = Math.floor(Common.random() * (i + 1)); - var temp = array[i]; - array[i] = array[j]; - array[j] = temp; - } - return array; - }; - - /** - * Randomly chooses a value from a list with equal probability. - * The function uses a seeded random generator. - * @method choose - * @param {array} choices - * @return {object} A random choice object from the array - */ - Common.choose = function(choices) { - return choices[Math.floor(Common.random() * choices.length)]; - }; - - /** - * Returns true if the object is a HTMLElement, otherwise false. - * @method isElement - * @param {object} obj - * @return {boolean} True if the object is a HTMLElement, otherwise false - */ - Common.isElement = function(obj) { - if (typeof HTMLElement !== 'undefined') { - return obj instanceof HTMLElement; - } - - return !!(obj && obj.nodeType && obj.nodeName); - }; - - /** - * Returns true if the object is an array. - * @method isArray - * @param {object} obj - * @return {boolean} True if the object is an array, otherwise false - */ - Common.isArray = function(obj) { - return Object.prototype.toString.call(obj) === '[object Array]'; - }; - - /** - * Returns true if the object is a function. - * @method isFunction - * @param {object} obj - * @return {boolean} True if the object is a function, otherwise false - */ - Common.isFunction = function(obj) { - return typeof obj === "function"; - }; - - /** - * Returns true if the object is a plain object. - * @method isPlainObject - * @param {object} obj - * @return {boolean} True if the object is a plain object, otherwise false - */ - Common.isPlainObject = function(obj) { - return typeof obj === 'object' && obj.constructor === Object; - }; - - /** - * Returns true if the object is a string. - * @method isString - * @param {object} obj - * @return {boolean} True if the object is a string, otherwise false - */ - Common.isString = function(obj) { - return toString.call(obj) === '[object String]'; - }; - - /** - * Returns the given value clamped between a minimum and maximum value. - * @method clamp - * @param {number} value - * @param {number} min - * @param {number} max - * @return {number} The value clamped between min and max inclusive - */ - Common.clamp = function(value, min, max) { - if (value < min) - return min; - if (value > max) - return max; - return value; - }; - - /** - * Returns the sign of the given value. - * @method sign - * @param {number} value - * @return {number} -1 if negative, +1 if 0 or positive - */ - Common.sign = function(value) { - return value < 0 ? -1 : 1; - }; - - /** - * Returns the current timestamp since the time origin (e.g. from page load). - * The result will be high-resolution including decimal places if available. - * @method now - * @return {number} the current timestamp - */ - Common.now = function() { - if (window.performance) { - if (window.performance.now) { - return window.performance.now(); - } else if (window.performance.webkitNow) { - return window.performance.webkitNow(); - } - } - - return (new Date()) - Common._nowStartTime; - }; - - /** - * Returns a random value between a minimum and a maximum value inclusive. - * The function uses a seeded random generator. - * @method random - * @param {number} min - * @param {number} max - * @return {number} A random number between min and max inclusive - */ - Common.random = function(min, max) { - min = (typeof min !== "undefined") ? min : 0; - max = (typeof max !== "undefined") ? max : 1; - return min + _seededRandom() * (max - min); - }; - - var _seededRandom = function() { - // https://en.wikipedia.org/wiki/Linear_congruential_generator - Common._seed = (Common._seed * 9301 + 49297) % 233280; - return Common._seed / 233280; - }; - - /** - * Converts a CSS hex colour string into an integer. - * @method colorToNumber - * @param {string} colorString - * @return {number} An integer representing the CSS hex string - */ - Common.colorToNumber = function(colorString) { - colorString = colorString.replace('#',''); - - if (colorString.length == 3) { - colorString = colorString.charAt(0) + colorString.charAt(0) - + colorString.charAt(1) + colorString.charAt(1) - + colorString.charAt(2) + colorString.charAt(2); - } - - return parseInt(colorString, 16); - }; - - /** - * The console logging level to use, where each level includes all levels above and excludes the levels below. - * The default level is 'debug' which shows all console messages. - * - * Possible level values are: - * - 0 = None - * - 1 = Debug - * - 2 = Info - * - 3 = Warn - * - 4 = Error - * @property Common.logLevel - * @type {Number} - * @default 1 - */ - Common.logLevel = 1; - - /** - * Shows a `console.log` message only if the current `Common.logLevel` allows it. - * The message will be prefixed with 'matter-js' to make it easily identifiable. - * @method log - * @param ...objs {} The objects to log. - */ - Common.log = function() { - if (console && Common.logLevel > 0 && Common.logLevel <= 3) { - console.log.apply(console, ['matter-js:'].concat(Array.prototype.slice.call(arguments))); - } - }; - - /** - * Shows a `console.info` message only if the current `Common.logLevel` allows it. - * The message will be prefixed with 'matter-js' to make it easily identifiable. - * @method info - * @param ...objs {} The objects to log. - */ - Common.info = function() { - if (console && Common.logLevel > 0 && Common.logLevel <= 2) { - console.info.apply(console, ['matter-js:'].concat(Array.prototype.slice.call(arguments))); - } - }; - - /** - * Shows a `console.warn` message only if the current `Common.logLevel` allows it. - * The message will be prefixed with 'matter-js' to make it easily identifiable. - * @method warn - * @param ...objs {} The objects to log. - */ - Common.warn = function() { - if (console && Common.logLevel > 0 && Common.logLevel <= 3) { - console.warn.apply(console, ['matter-js:'].concat(Array.prototype.slice.call(arguments))); - } - }; - - /** - * Returns the next unique sequential ID. - * @method nextId - * @return {Number} Unique sequential ID - */ - Common.nextId = function() { - return Common._nextId++; - }; - - /** - * A cross browser compatible indexOf implementation. - * @method indexOf - * @param {array} haystack - * @param {object} needle - * @return {number} The position of needle in haystack, otherwise -1. - */ - Common.indexOf = function(haystack, needle) { - if (haystack.indexOf) - return haystack.indexOf(needle); - - for (var i = 0; i < haystack.length; i++) { - if (haystack[i] === needle) - return i; - } - - return -1; - }; - - /** - * A cross browser compatible array map implementation. - * @method map - * @param {array} list - * @param {function} func - * @return {array} Values from list transformed by func. - */ - Common.map = function(list, func) { - if (list.map) { - return list.map(func); - } - - var mapped = []; - - for (var i = 0; i < list.length; i += 1) { - mapped.push(func(list[i])); - } - - return mapped; - }; - - /** - * Takes a directed graph and returns the partially ordered set of vertices in topological order. - * Circular dependencies are allowed. - * @method topologicalSort - * @param {object} graph - * @return {array} Partially ordered set of vertices in topological order. - */ - Common.topologicalSort = function(graph) { - // https://github.com/mgechev/javascript-algorithms - // Copyright (c) Minko Gechev (MIT license) - // Modifications: tidy formatting and naming - var result = [], - visited = [], - temp = []; - - for (var node in graph) { - if (!visited[node] && !temp[node]) { - Common._topologicalSort(node, visited, temp, graph, result); - } - } - - return result; - }; - - Common._topologicalSort = function(node, visited, temp, graph, result) { - var neighbors = graph[node] || []; - temp[node] = true; - - for (var i = 0; i < neighbors.length; i += 1) { - var neighbor = neighbors[i]; - - if (temp[neighbor]) { - // skip circular dependencies - continue; - } - - if (!visited[neighbor]) { - Common._topologicalSort(neighbor, visited, temp, graph, result); - } - } - - temp[node] = false; - visited[node] = true; - - result.push(node); - }; - - /** - * Takes _n_ functions as arguments and returns a new function that calls them in order. - * The arguments applied when calling the new function will also be applied to every function passed. - * The value of `this` refers to the last value returned in the chain that was not `undefined`. - * Therefore if a passed function does not return a value, the previously returned value is maintained. - * After all passed functions have been called the new function returns the last returned value (if any). - * If any of the passed functions are a chain, then the chain will be flattened. - * @method chain - * @param ...funcs {function} The functions to chain. - * @return {function} A new function that calls the passed functions in order. - */ - Common.chain = function() { - var funcs = []; - - for (var i = 0; i < arguments.length; i += 1) { - var func = arguments[i]; - - if (func._chained) { - // flatten already chained functions - funcs.push.apply(funcs, func._chained); - } else { - funcs.push(func); - } - } - - var chain = function() { - // https://github.com/GoogleChrome/devtools-docs/issues/53#issuecomment-51941358 - var lastResult, - args = new Array(arguments.length); - - for (var i = 0, l = arguments.length; i < l; i++) { - args[i] = arguments[i]; - } - - for (i = 0; i < funcs.length; i += 1) { - var result = funcs[i].apply(lastResult, args); - - if (typeof result !== 'undefined') { - lastResult = result; - } - } - - return lastResult; - }; - - chain._chained = funcs; - - return chain; - }; - - /** - * Chains a function to excute before the original function on the given `path` relative to `base`. - * See also docs for `Common.chain`. - * @method chainPathBefore - * @param {} base The base object - * @param {string} path The path relative to `base` - * @param {function} func The function to chain before the original - * @return {function} The chained function that replaced the original - */ - Common.chainPathBefore = function(base, path, func) { - return Common.set(base, path, Common.chain( - func, - Common.get(base, path) - )); - }; - - /** - * Chains a function to excute after the original function on the given `path` relative to `base`. - * See also docs for `Common.chain`. - * @method chainPathAfter - * @param {} base The base object - * @param {string} path The path relative to `base` - * @param {function} func The function to chain after the original - * @return {function} The chained function that replaced the original - */ - Common.chainPathAfter = function(base, path, func) { - return Common.set(base, path, Common.chain( - Common.get(base, path), - func - )); - }; - - /** - * Used to require external libraries outside of the bundle. - * It first looks for the `globalName` on the environment's global namespace. - * If the global is not found, it will fall back to using the standard `require` using the `moduleName`. - * @private - * @method _requireGlobal - * @param {string} globalName The global module name - * @param {string} moduleName The fallback CommonJS module name - * @return {} The loaded module - */ - Common._requireGlobal = function(globalName, moduleName) { - var obj = (typeof window !== 'undefined' ? window[globalName] : typeof global !== 'undefined' ? global[globalName] : null); - return obj || _dereq_(moduleName); - }; -})(); - -}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {}) -},{}],15:[function(_dereq_,module,exports){ -/** -* The `Matter.Engine` module contains methods for creating and manipulating engines. -* An engine is a controller that manages updating the simulation of the world. -* See `Matter.Runner` for an optional game loop utility. -* -* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). -* -* @class Engine -*/ - -var Engine = {}; - -module.exports = Engine; - -var World = _dereq_('../body/World'); -var Sleeping = _dereq_('./Sleeping'); -var Resolver = _dereq_('../collision/Resolver'); -var Render = _dereq_('../render/Render'); -var Pairs = _dereq_('../collision/Pairs'); -var Metrics = _dereq_('./Metrics'); -var Grid = _dereq_('../collision/Grid'); -var Events = _dereq_('./Events'); -var Composite = _dereq_('../body/Composite'); -var Constraint = _dereq_('../constraint/Constraint'); -var Common = _dereq_('./Common'); -var Body = _dereq_('../body/Body'); - -(function() { - - /** - * Creates a new engine. The options parameter is an object that specifies any properties you wish to override the defaults. - * All properties have default values, and many are pre-calculated automatically based on other properties. - * See the properties section below for detailed information on what you can pass via the `options` object. - * @method create - * @param {object} [options] - * @return {engine} engine - */ - Engine.create = function(element, options) { - // options may be passed as the first (and only) argument - options = Common.isElement(element) ? options : element; - element = Common.isElement(element) ? element : null; - options = options || {}; - - if (element || options.render) { - Common.warn('Engine.create: engine.render is deprecated (see docs)'); - } - - var defaults = { - positionIterations: 6, - velocityIterations: 4, - constraintIterations: 2, - enableSleeping: false, - events: [], - plugin: {}, - timing: { - timestamp: 0, - timeScale: 1 - }, - broadphase: { - controller: Grid - } - }; - - var engine = Common.extend(defaults, options); - - // @deprecated - if (element || engine.render) { - var renderDefaults = { - element: element, - controller: Render - }; - - engine.render = Common.extend(renderDefaults, engine.render); - } - - // @deprecated - if (engine.render && engine.render.controller) { - engine.render = engine.render.controller.create(engine.render); - } - - // @deprecated - if (engine.render) { - engine.render.engine = engine; - } - - engine.world = options.world || World.create(engine.world); - engine.pairs = Pairs.create(); - engine.broadphase = engine.broadphase.controller.create(engine.broadphase); - engine.metrics = engine.metrics || { extended: false }; - - - return engine; - }; - - /** - * Moves the simulation forward in time by `delta` ms. - * The `correction` argument is an optional `Number` that specifies the time correction factor to apply to the update. - * This can help improve the accuracy of the simulation in cases where `delta` is changing between updates. - * The value of `correction` is defined as `delta / lastDelta`, i.e. the percentage change of `delta` over the last step. - * Therefore the value is always `1` (no correction) when `delta` constant (or when no correction is desired, which is the default). - * See the paper on Time Corrected Verlet for more information. - * - * Triggers `beforeUpdate` and `afterUpdate` events. - * Triggers `collisionStart`, `collisionActive` and `collisionEnd` events. - * @method update - * @param {engine} engine - * @param {number} [delta=16.666] - * @param {number} [correction=1] - */ - Engine.update = function(engine, delta, correction) { - delta = delta || 1000 / 60; - correction = correction || 1; - - var world = engine.world, - timing = engine.timing, - broadphase = engine.broadphase, - broadphasePairs = [], - i; - - // increment timestamp - timing.timestamp += delta * timing.timeScale; - - // create an event object - var event = { - timestamp: timing.timestamp - }; - - Events.trigger(engine, 'beforeUpdate', event); - - // get lists of all bodies and constraints, no matter what composites they are in - var allBodies = Composite.allBodies(world), - allConstraints = Composite.allConstraints(world); - - - // if sleeping enabled, call the sleeping controller - if (engine.enableSleeping) - Sleeping.update(allBodies, timing.timeScale); - - // applies gravity to all bodies - Engine._bodiesApplyGravity(allBodies, world.gravity); - - // update all body position and rotation by integration - Engine._bodiesUpdate(allBodies, delta, timing.timeScale, correction, world.bounds); - - // update all constraints (first pass) - Constraint.preSolveAll(allBodies); - for (i = 0; i < engine.constraintIterations; i++) { - Constraint.solveAll(allConstraints, timing.timeScale); - } - Constraint.postSolveAll(allBodies); - - // broadphase pass: find potential collision pairs - if (broadphase.controller) { - // if world is dirty, we must flush the whole grid - if (world.isModified) - broadphase.controller.clear(broadphase); - - // update the grid buckets based on current bodies - broadphase.controller.update(broadphase, allBodies, engine, world.isModified); - broadphasePairs = broadphase.pairsList; - } else { - // if no broadphase set, we just pass all bodies - broadphasePairs = allBodies; - } - - // clear all composite modified flags - if (world.isModified) { - Composite.setModified(world, false, false, true); - } - - // narrowphase pass: find actual collisions, then create or update collision pairs - var collisions = broadphase.detector(broadphasePairs, engine); - - // update collision pairs - var pairs = engine.pairs, - timestamp = timing.timestamp; - Pairs.update(pairs, collisions, timestamp); - Pairs.removeOld(pairs, timestamp); - - // wake up bodies involved in collisions - if (engine.enableSleeping) - Sleeping.afterCollisions(pairs.list, timing.timeScale); - - // trigger collision events - if (pairs.collisionStart.length > 0) - Events.trigger(engine, 'collisionStart', { pairs: pairs.collisionStart }); - - // iteratively resolve position between collisions - Resolver.preSolvePosition(pairs.list); - for (i = 0; i < engine.positionIterations; i++) { - Resolver.solvePosition(pairs.list, timing.timeScale); - } - Resolver.postSolvePosition(allBodies); - - // update all constraints (second pass) - Constraint.preSolveAll(allBodies); - for (i = 0; i < engine.constraintIterations; i++) { - Constraint.solveAll(allConstraints, timing.timeScale); - } - Constraint.postSolveAll(allBodies); - - // iteratively resolve velocity between collisions - Resolver.preSolveVelocity(pairs.list); - for (i = 0; i < engine.velocityIterations; i++) { - Resolver.solveVelocity(pairs.list, timing.timeScale); - } - - // trigger collision events - if (pairs.collisionActive.length > 0) - Events.trigger(engine, 'collisionActive', { pairs: pairs.collisionActive }); - - if (pairs.collisionEnd.length > 0) - Events.trigger(engine, 'collisionEnd', { pairs: pairs.collisionEnd }); - - - // clear force buffers - Engine._bodiesClearForces(allBodies); - - Events.trigger(engine, 'afterUpdate', event); - - return engine; - }; - - /** - * Merges two engines by keeping the configuration of `engineA` but replacing the world with the one from `engineB`. - * @method merge - * @param {engine} engineA - * @param {engine} engineB - */ - Engine.merge = function(engineA, engineB) { - Common.extend(engineA, engineB); - - if (engineB.world) { - engineA.world = engineB.world; - - Engine.clear(engineA); - - var bodies = Composite.allBodies(engineA.world); - - for (var i = 0; i < bodies.length; i++) { - var body = bodies[i]; - Sleeping.set(body, false); - body.id = Common.nextId(); - } - } - }; - - /** - * Clears the engine including the world, pairs and broadphase. - * @method clear - * @param {engine} engine - */ - Engine.clear = function(engine) { - var world = engine.world; - - Pairs.clear(engine.pairs); - - var broadphase = engine.broadphase; - if (broadphase.controller) { - var bodies = Composite.allBodies(world); - broadphase.controller.clear(broadphase); - broadphase.controller.update(broadphase, bodies, engine, true); - } - }; - - /** - * Zeroes the `body.force` and `body.torque` force buffers. - * @method _bodiesClearForces - * @private - * @param {body[]} bodies - */ - Engine._bodiesClearForces = function(bodies) { - for (var i = 0; i < bodies.length; i++) { - var body = bodies[i]; - - // reset force buffers - body.force.x = 0; - body.force.y = 0; - body.torque = 0; - } - }; - - /** - * Applys a mass dependant force to all given bodies. - * @method _bodiesApplyGravity - * @private - * @param {body[]} bodies - * @param {vector} gravity - */ - Engine._bodiesApplyGravity = function(bodies, gravity) { - var gravityScale = typeof gravity.scale !== 'undefined' ? gravity.scale : 0.001; - - if ((gravity.x === 0 && gravity.y === 0) || gravityScale === 0) { - return; - } - - for (var i = 0; i < bodies.length; i++) { - var body = bodies[i]; - - if (body.isStatic || body.isSleeping) - continue; - - // apply gravity - body.force.y += body.mass * gravity.y * gravityScale; - body.force.x += body.mass * gravity.x * gravityScale; - } - }; - - /** - * Applys `Body.update` to all given `bodies`. - * @method _bodiesUpdate - * @private - * @param {body[]} bodies - * @param {number} deltaTime - * The amount of time elapsed between updates - * @param {number} timeScale - * @param {number} correction - * The Verlet correction factor (deltaTime / lastDeltaTime) - * @param {bounds} worldBounds - */ - Engine._bodiesUpdate = function(bodies, deltaTime, timeScale, correction, worldBounds) { - for (var i = 0; i < bodies.length; i++) { - var body = bodies[i]; - - if (body.isStatic || body.isSleeping) - continue; - - Body.update(body, deltaTime, timeScale, correction); - } - }; - - /** - * An alias for `Runner.run`, see `Matter.Runner` for more information. - * @method run - * @param {engine} engine - */ - - /** - * Fired just before an update - * - * @event beforeUpdate - * @param {} event An event object - * @param {number} event.timestamp The engine.timing.timestamp of the event - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired after engine update and all collision events - * - * @event afterUpdate - * @param {} event An event object - * @param {number} event.timestamp The engine.timing.timestamp of the event - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired after engine update, provides a list of all pairs that have started to collide in the current tick (if any) - * - * @event collisionStart - * @param {} event An event object - * @param {} event.pairs List of affected pairs - * @param {number} event.timestamp The engine.timing.timestamp of the event - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired after engine update, provides a list of all pairs that are colliding in the current tick (if any) - * - * @event collisionActive - * @param {} event An event object - * @param {} event.pairs List of affected pairs - * @param {number} event.timestamp The engine.timing.timestamp of the event - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired after engine update, provides a list of all pairs that have ended collision in the current tick (if any) - * - * @event collisionEnd - * @param {} event An event object - * @param {} event.pairs List of affected pairs - * @param {number} event.timestamp The engine.timing.timestamp of the event - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /* - * - * Properties Documentation - * - */ - - /** - * An integer `Number` that specifies the number of position iterations to perform each update. - * The higher the value, the higher quality the simulation will be at the expense of performance. - * - * @property positionIterations - * @type number - * @default 6 - */ - - /** - * An integer `Number` that specifies the number of velocity iterations to perform each update. - * The higher the value, the higher quality the simulation will be at the expense of performance. - * - * @property velocityIterations - * @type number - * @default 4 - */ - - /** - * An integer `Number` that specifies the number of constraint iterations to perform each update. - * The higher the value, the higher quality the simulation will be at the expense of performance. - * The default value of `2` is usually very adequate. - * - * @property constraintIterations - * @type number - * @default 2 - */ - - /** - * A flag that specifies whether the engine should allow sleeping via the `Matter.Sleeping` module. - * Sleeping can improve stability and performance, but often at the expense of accuracy. - * - * @property enableSleeping - * @type boolean - * @default false - */ - - /** - * An `Object` containing properties regarding the timing systems of the engine. - * - * @property timing - * @type object - */ - - /** - * A `Number` that specifies the global scaling factor of time for all bodies. - * A value of `0` freezes the simulation. - * A value of `0.1` gives a slow-motion effect. - * A value of `1.2` gives a speed-up effect. - * - * @property timing.timeScale - * @type number - * @default 1 - */ - - /** - * A `Number` that specifies the current simulation-time in milliseconds starting from `0`. - * It is incremented on every `Engine.update` by the given `delta` argument. - * - * @property timing.timestamp - * @type number - * @default 0 - */ - - /** - * An instance of a `Render` controller. The default value is a `Matter.Render` instance created by `Engine.create`. - * One may also develop a custom renderer module based on `Matter.Render` and pass an instance of it to `Engine.create` via `options.render`. - * - * A minimal custom renderer object must define at least three functions: `create`, `clear` and `world` (see `Matter.Render`). - * It is also possible to instead pass the _module_ reference via `options.render.controller` and `Engine.create` will instantiate one for you. - * - * @property render - * @type render - * @deprecated see Demo.js for an example of creating a renderer - * @default a Matter.Render instance - */ - - /** - * An instance of a broadphase controller. The default value is a `Matter.Grid` instance created by `Engine.create`. - * - * @property broadphase - * @type grid - * @default a Matter.Grid instance - */ - - /** - * A `World` composite object that will contain all simulated bodies and constraints. - * - * @property world - * @type world - * @default a Matter.World instance - */ - - /** - * An object reserved for storing plugin-specific properties. - * - * @property plugin - * @type {} - */ - -})(); - -},{"../body/Body":1,"../body/Composite":2,"../body/World":3,"../collision/Grid":6,"../collision/Pairs":8,"../collision/Resolver":10,"../constraint/Constraint":12,"../render/Render":31,"./Common":14,"./Events":16,"./Metrics":18,"./Sleeping":22}],16:[function(_dereq_,module,exports){ -/** -* The `Matter.Events` module contains methods to fire and listen to events on other objects. -* -* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). -* -* @class Events -*/ - -var Events = {}; - -module.exports = Events; - -var Common = _dereq_('./Common'); - -(function() { - - /** - * Subscribes a callback function to the given object's `eventName`. - * @method on - * @param {} object - * @param {string} eventNames - * @param {function} callback - */ - Events.on = function(object, eventNames, callback) { - var names = eventNames.split(' '), - name; - - for (var i = 0; i < names.length; i++) { - name = names[i]; - object.events = object.events || {}; - object.events[name] = object.events[name] || []; - object.events[name].push(callback); - } - - return callback; - }; - - /** - * Removes the given event callback. If no callback, clears all callbacks in `eventNames`. If no `eventNames`, clears all events. - * @method off - * @param {} object - * @param {string} eventNames - * @param {function} callback - */ - Events.off = function(object, eventNames, callback) { - if (!eventNames) { - object.events = {}; - return; - } - - // handle Events.off(object, callback) - if (typeof eventNames === 'function') { - callback = eventNames; - eventNames = Common.keys(object.events).join(' '); - } - - var names = eventNames.split(' '); - - for (var i = 0; i < names.length; i++) { - var callbacks = object.events[names[i]], - newCallbacks = []; - - if (callback && callbacks) { - for (var j = 0; j < callbacks.length; j++) { - if (callbacks[j] !== callback) - newCallbacks.push(callbacks[j]); - } - } - - object.events[names[i]] = newCallbacks; - } - }; - - /** - * Fires all the callbacks subscribed to the given object's `eventName`, in the order they subscribed, if any. - * @method trigger - * @param {} object - * @param {string} eventNames - * @param {} event - */ - Events.trigger = function(object, eventNames, event) { - var names, - name, - callbacks, - eventClone; - - if (object.events) { - if (!event) - event = {}; - - names = eventNames.split(' '); - - for (var i = 0; i < names.length; i++) { - name = names[i]; - callbacks = object.events[name]; - - if (callbacks) { - eventClone = Common.clone(event, false); - eventClone.name = name; - eventClone.source = object; - - for (var j = 0; j < callbacks.length; j++) { - callbacks[j].apply(object, [eventClone]); - } - } - } - } - }; - -})(); - -},{"./Common":14}],17:[function(_dereq_,module,exports){ -/** -* The `Matter` module is the top level namespace. It also includes a function for installing plugins on top of the library. -* -* @class Matter -*/ - -var Matter = {}; - -module.exports = Matter; - -var Plugin = _dereq_('./Plugin'); -var Common = _dereq_('./Common'); - -(function() { - - /** - * The library name. - * @property name - * @readOnly - * @type {String} - */ - Matter.name = 'matter-js'; - - /** - * The library version. - * @property version - * @readOnly - * @type {String} - */ - Matter.version = '0.14.2'; - - /** - * A list of plugin dependencies to be installed. These are normally set and installed through `Matter.use`. - * Alternatively you may set `Matter.uses` manually and install them by calling `Plugin.use(Matter)`. - * @property uses - * @type {Array} - */ - Matter.uses = []; - - /** - * The plugins that have been installed through `Matter.Plugin.install`. Read only. - * @property used - * @readOnly - * @type {Array} - */ - Matter.used = []; - - /** - * Installs the given plugins on the `Matter` namespace. - * This is a short-hand for `Plugin.use`, see it for more information. - * Call this function once at the start of your code, with all of the plugins you wish to install as arguments. - * Avoid calling this function multiple times unless you intend to manually control installation order. - * @method use - * @param ...plugin {Function} The plugin(s) to install on `base` (multi-argument). - */ - Matter.use = function() { - Plugin.use(Matter, Array.prototype.slice.call(arguments)); - }; - - /** - * Chains a function to excute before the original function on the given `path` relative to `Matter`. - * See also docs for `Common.chain`. - * @method before - * @param {string} path The path relative to `Matter` - * @param {function} func The function to chain before the original - * @return {function} The chained function that replaced the original - */ - Matter.before = function(path, func) { - path = path.replace(/^Matter./, ''); - return Common.chainPathBefore(Matter, path, func); - }; - - /** - * Chains a function to excute after the original function on the given `path` relative to `Matter`. - * See also docs for `Common.chain`. - * @method after - * @param {string} path The path relative to `Matter` - * @param {function} func The function to chain after the original - * @return {function} The chained function that replaced the original - */ - Matter.after = function(path, func) { - path = path.replace(/^Matter./, ''); - return Common.chainPathAfter(Matter, path, func); - }; - -})(); - -},{"./Common":14,"./Plugin":20}],18:[function(_dereq_,module,exports){ - -},{"../body/Composite":2,"./Common":14}],19:[function(_dereq_,module,exports){ -/** -* The `Matter.Mouse` module contains methods for creating and manipulating mouse inputs. -* -* @class Mouse -*/ - -var Mouse = {}; - -module.exports = Mouse; - -var Common = _dereq_('../core/Common'); - -(function() { - - /** - * Creates a mouse input. - * @method create - * @param {HTMLElement} element - * @return {mouse} A new mouse - */ - Mouse.create = function(element) { - var mouse = {}; - - if (!element) { - Common.log('Mouse.create: element was undefined, defaulting to document.body', 'warn'); - } - - mouse.element = element || document.body; - mouse.absolute = { x: 0, y: 0 }; - mouse.position = { x: 0, y: 0 }; - mouse.mousedownPosition = { x: 0, y: 0 }; - mouse.mouseupPosition = { x: 0, y: 0 }; - mouse.offset = { x: 0, y: 0 }; - mouse.scale = { x: 1, y: 1 }; - mouse.wheelDelta = 0; - mouse.button = -1; - mouse.pixelRatio = mouse.element.getAttribute('data-pixel-ratio') || 1; - - mouse.sourceEvents = { - mousemove: null, - mousedown: null, - mouseup: null, - mousewheel: null - }; - - mouse.mousemove = function(event) { - var position = Mouse._getRelativeMousePosition(event, mouse.element, mouse.pixelRatio), - touches = event.changedTouches; - - if (touches) { - mouse.button = 0; - event.preventDefault(); - } - - mouse.absolute.x = position.x; - mouse.absolute.y = position.y; - mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; - mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; - mouse.sourceEvents.mousemove = event; - }; - - mouse.mousedown = function(event) { - var position = Mouse._getRelativeMousePosition(event, mouse.element, mouse.pixelRatio), - touches = event.changedTouches; - - if (touches) { - mouse.button = 0; - event.preventDefault(); - } else { - mouse.button = event.button; - } - - mouse.absolute.x = position.x; - mouse.absolute.y = position.y; - mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; - mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; - mouse.mousedownPosition.x = mouse.position.x; - mouse.mousedownPosition.y = mouse.position.y; - mouse.sourceEvents.mousedown = event; - }; - - mouse.mouseup = function(event) { - var position = Mouse._getRelativeMousePosition(event, mouse.element, mouse.pixelRatio), - touches = event.changedTouches; - - if (touches) { - event.preventDefault(); - } - - mouse.button = -1; - mouse.absolute.x = position.x; - mouse.absolute.y = position.y; - mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; - mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; - mouse.mouseupPosition.x = mouse.position.x; - mouse.mouseupPosition.y = mouse.position.y; - mouse.sourceEvents.mouseup = event; - }; - - mouse.mousewheel = function(event) { - mouse.wheelDelta = Math.max(-1, Math.min(1, event.wheelDelta || -event.detail)); - event.preventDefault(); - }; - - Mouse.setElement(mouse, mouse.element); - - return mouse; - }; - - /** - * Sets the element the mouse is bound to (and relative to). - * @method setElement - * @param {mouse} mouse - * @param {HTMLElement} element - */ - Mouse.setElement = function(mouse, element) { - mouse.element = element; - - element.addEventListener('mousemove', mouse.mousemove); - element.addEventListener('mousedown', mouse.mousedown); - element.addEventListener('mouseup', mouse.mouseup); - - element.addEventListener('mousewheel', mouse.mousewheel); - element.addEventListener('DOMMouseScroll', mouse.mousewheel); - - element.addEventListener('touchmove', mouse.mousemove); - element.addEventListener('touchstart', mouse.mousedown); - element.addEventListener('touchend', mouse.mouseup); - }; - - /** - * Clears all captured source events. - * @method clearSourceEvents - * @param {mouse} mouse - */ - Mouse.clearSourceEvents = function(mouse) { - mouse.sourceEvents.mousemove = null; - mouse.sourceEvents.mousedown = null; - mouse.sourceEvents.mouseup = null; - mouse.sourceEvents.mousewheel = null; - mouse.wheelDelta = 0; - }; - - /** - * Sets the mouse position offset. - * @method setOffset - * @param {mouse} mouse - * @param {vector} offset - */ - Mouse.setOffset = function(mouse, offset) { - mouse.offset.x = offset.x; - mouse.offset.y = offset.y; - mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; - mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; - }; - - /** - * Sets the mouse position scale. - * @method setScale - * @param {mouse} mouse - * @param {vector} scale - */ - Mouse.setScale = function(mouse, scale) { - mouse.scale.x = scale.x; - mouse.scale.y = scale.y; - mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; - mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; - }; - - /** - * Gets the mouse position relative to an element given a screen pixel ratio. - * @method _getRelativeMousePosition - * @private - * @param {} event - * @param {} element - * @param {number} pixelRatio - * @return {} - */ - Mouse._getRelativeMousePosition = function(event, element, pixelRatio) { - var elementBounds = element.getBoundingClientRect(), - rootNode = (document.documentElement || document.body.parentNode || document.body), - scrollX = (window.pageXOffset !== undefined) ? window.pageXOffset : rootNode.scrollLeft, - scrollY = (window.pageYOffset !== undefined) ? window.pageYOffset : rootNode.scrollTop, - touches = event.changedTouches, - x, y; - - if (touches) { - x = touches[0].pageX - elementBounds.left - scrollX; - y = touches[0].pageY - elementBounds.top - scrollY; - } else { - x = event.pageX - elementBounds.left - scrollX; - y = event.pageY - elementBounds.top - scrollY; - } - - return { - x: x / (element.clientWidth / (element.width || element.clientWidth) * pixelRatio), - y: y / (element.clientHeight / (element.height || element.clientHeight) * pixelRatio) - }; - }; - -})(); - -},{"../core/Common":14}],20:[function(_dereq_,module,exports){ -/** -* The `Matter.Plugin` module contains functions for registering and installing plugins on modules. -* -* @class Plugin -*/ - -var Plugin = {}; - -module.exports = Plugin; - -var Common = _dereq_('./Common'); - -(function() { - - Plugin._registry = {}; - - /** - * Registers a plugin object so it can be resolved later by name. - * @method register - * @param plugin {} The plugin to register. - * @return {object} The plugin. - */ - Plugin.register = function(plugin) { - if (!Plugin.isPlugin(plugin)) { - Common.warn('Plugin.register:', Plugin.toString(plugin), 'does not implement all required fields.'); - } - - if (plugin.name in Plugin._registry) { - var registered = Plugin._registry[plugin.name], - pluginVersion = Plugin.versionParse(plugin.version).number, - registeredVersion = Plugin.versionParse(registered.version).number; - - if (pluginVersion > registeredVersion) { - Common.warn('Plugin.register:', Plugin.toString(registered), 'was upgraded to', Plugin.toString(plugin)); - Plugin._registry[plugin.name] = plugin; - } else if (pluginVersion < registeredVersion) { - Common.warn('Plugin.register:', Plugin.toString(registered), 'can not be downgraded to', Plugin.toString(plugin)); - } else if (plugin !== registered) { - Common.warn('Plugin.register:', Plugin.toString(plugin), 'is already registered to different plugin object'); - } - } else { - Plugin._registry[plugin.name] = plugin; - } - - return plugin; - }; - - /** - * Resolves a dependency to a plugin object from the registry if it exists. - * The `dependency` may contain a version, but only the name matters when resolving. - * @method resolve - * @param dependency {string} The dependency. - * @return {object} The plugin if resolved, otherwise `undefined`. - */ - Plugin.resolve = function(dependency) { - return Plugin._registry[Plugin.dependencyParse(dependency).name]; - }; - - /** - * Returns a pretty printed plugin name and version. - * @method toString - * @param plugin {} The plugin. - * @return {string} Pretty printed plugin name and version. - */ - Plugin.toString = function(plugin) { - return typeof plugin === 'string' ? plugin : (plugin.name || 'anonymous') + '@' + (plugin.version || plugin.range || '0.0.0'); - }; - - /** - * Returns `true` if the object meets the minimum standard to be considered a plugin. - * This means it must define the following properties: - * - `name` - * - `version` - * - `install` - * @method isPlugin - * @param obj {} The obj to test. - * @return {boolean} `true` if the object can be considered a plugin otherwise `false`. - */ - Plugin.isPlugin = function(obj) { - return obj && obj.name && obj.version && obj.install; - }; - - /** - * Returns `true` if a plugin with the given `name` been installed on `module`. - * @method isUsed - * @param module {} The module. - * @param name {string} The plugin name. - * @return {boolean} `true` if a plugin with the given `name` been installed on `module`, otherwise `false`. - */ - Plugin.isUsed = function(module, name) { - return module.used.indexOf(name) > -1; - }; - - /** - * Returns `true` if `plugin.for` is applicable to `module` by comparing against `module.name` and `module.version`. - * If `plugin.for` is not specified then it is assumed to be applicable. - * The value of `plugin.for` is a string of the format `'module-name'` or `'module-name@version'`. - * @method isFor - * @param plugin {} The plugin. - * @param module {} The module. - * @return {boolean} `true` if `plugin.for` is applicable to `module`, otherwise `false`. - */ - Plugin.isFor = function(plugin, module) { - var parsed = plugin.for && Plugin.dependencyParse(plugin.for); - return !plugin.for || (module.name === parsed.name && Plugin.versionSatisfies(module.version, parsed.range)); - }; - - /** - * Installs the plugins by calling `plugin.install` on each plugin specified in `plugins` if passed, otherwise `module.uses`. - * For installing plugins on `Matter` see the convenience function `Matter.use`. - * Plugins may be specified either by their name or a reference to the plugin object. - * Plugins themselves may specify further dependencies, but each plugin is installed only once. - * Order is important, a topological sort is performed to find the best resulting order of installation. - * This sorting attempts to satisfy every dependency's requested ordering, but may not be exact in all cases. - * This function logs the resulting status of each dependency in the console, along with any warnings. - * - A green tick ✅ indicates a dependency was resolved and installed. - * - An orange diamond 🔶 indicates a dependency was resolved but a warning was thrown for it or one if its dependencies. - * - A red cross ❌ indicates a dependency could not be resolved. - * Avoid calling this function multiple times on the same module unless you intend to manually control installation order. - * @method use - * @param module {} The module install plugins on. - * @param [plugins=module.uses] {} The plugins to install on module (optional, defaults to `module.uses`). - */ - Plugin.use = function(module, plugins) { - module.uses = (module.uses || []).concat(plugins || []); - - if (module.uses.length === 0) { - Common.warn('Plugin.use:', Plugin.toString(module), 'does not specify any dependencies to install.'); - return; - } - - var dependencies = Plugin.dependencies(module), - sortedDependencies = Common.topologicalSort(dependencies), - status = []; - - for (var i = 0; i < sortedDependencies.length; i += 1) { - if (sortedDependencies[i] === module.name) { - continue; - } - - var plugin = Plugin.resolve(sortedDependencies[i]); - - if (!plugin) { - status.push('❌ ' + sortedDependencies[i]); - continue; - } - - if (Plugin.isUsed(module, plugin.name)) { - continue; - } - - if (!Plugin.isFor(plugin, module)) { - Common.warn('Plugin.use:', Plugin.toString(plugin), 'is for', plugin.for, 'but installed on', Plugin.toString(module) + '.'); - plugin._warned = true; - } - - if (plugin.install) { - plugin.install(module); - } else { - Common.warn('Plugin.use:', Plugin.toString(plugin), 'does not specify an install function.'); - plugin._warned = true; - } - - if (plugin._warned) { - status.push('🔶 ' + Plugin.toString(plugin)); - delete plugin._warned; - } else { - status.push('✅ ' + Plugin.toString(plugin)); - } - - module.used.push(plugin.name); - } - - if (status.length > 0) { - Common.info(status.join(' ')); - } - }; - - /** - * Recursively finds all of a module's dependencies and returns a flat dependency graph. - * @method dependencies - * @param module {} The module. - * @return {object} A dependency graph. - */ - Plugin.dependencies = function(module, tracked) { - var parsedBase = Plugin.dependencyParse(module), - name = parsedBase.name; - - tracked = tracked || {}; - - if (name in tracked) { - return; - } - - module = Plugin.resolve(module) || module; - - tracked[name] = Common.map(module.uses || [], function(dependency) { - if (Plugin.isPlugin(dependency)) { - Plugin.register(dependency); - } - - var parsed = Plugin.dependencyParse(dependency), - resolved = Plugin.resolve(dependency); - - if (resolved && !Plugin.versionSatisfies(resolved.version, parsed.range)) { - Common.warn( - 'Plugin.dependencies:', Plugin.toString(resolved), 'does not satisfy', - Plugin.toString(parsed), 'used by', Plugin.toString(parsedBase) + '.' - ); - - resolved._warned = true; - module._warned = true; - } else if (!resolved) { - Common.warn( - 'Plugin.dependencies:', Plugin.toString(dependency), 'used by', - Plugin.toString(parsedBase), 'could not be resolved.' - ); - - module._warned = true; - } - - return parsed.name; - }); - - for (var i = 0; i < tracked[name].length; i += 1) { - Plugin.dependencies(tracked[name][i], tracked); - } - - return tracked; - }; - - /** - * Parses a dependency string into its components. - * The `dependency` is a string of the format `'module-name'` or `'module-name@version'`. - * See documentation for `Plugin.versionParse` for a description of the format. - * This function can also handle dependencies that are already resolved (e.g. a module object). - * @method dependencyParse - * @param dependency {string} The dependency of the format `'module-name'` or `'module-name@version'`. - * @return {object} The dependency parsed into its components. - */ - Plugin.dependencyParse = function(dependency) { - if (Common.isString(dependency)) { - var pattern = /^[\w-]+(@(\*|[\^~]?\d+\.\d+\.\d+(-[0-9A-Za-z-]+)?))?$/; - - if (!pattern.test(dependency)) { - Common.warn('Plugin.dependencyParse:', dependency, 'is not a valid dependency string.'); - } - - return { - name: dependency.split('@')[0], - range: dependency.split('@')[1] || '*' - }; - } - - return { - name: dependency.name, - range: dependency.range || dependency.version - }; - }; - - /** - * Parses a version string into its components. - * Versions are strictly of the format `x.y.z` (as in [semver](http://semver.org/)). - * Versions may optionally have a prerelease tag in the format `x.y.z-alpha`. - * Ranges are a strict subset of [npm ranges](https://docs.npmjs.com/misc/semver#advanced-range-syntax). - * Only the following range types are supported: - * - Tilde ranges e.g. `~1.2.3` - * - Caret ranges e.g. `^1.2.3` - * - Exact version e.g. `1.2.3` - * - Any version `*` - * @method versionParse - * @param range {string} The version string. - * @return {object} The version range parsed into its components. - */ - Plugin.versionParse = function(range) { - var pattern = /^\*|[\^~]?\d+\.\d+\.\d+(-[0-9A-Za-z-]+)?$/; - - if (!pattern.test(range)) { - Common.warn('Plugin.versionParse:', range, 'is not a valid version or range.'); - } - - var identifiers = range.split('-'); - range = identifiers[0]; - - var isRange = isNaN(Number(range[0])), - version = isRange ? range.substr(1) : range, - parts = Common.map(version.split('.'), function(part) { - return Number(part); - }); - - return { - isRange: isRange, - version: version, - range: range, - operator: isRange ? range[0] : '', - parts: parts, - prerelease: identifiers[1], - number: parts[0] * 1e8 + parts[1] * 1e4 + parts[2] - }; - }; - - /** - * Returns `true` if `version` satisfies the given `range`. - * See documentation for `Plugin.versionParse` for a description of the format. - * If a version or range is not specified, then any version (`*`) is assumed to satisfy. - * @method versionSatisfies - * @param version {string} The version string. - * @param range {string} The range string. - * @return {boolean} `true` if `version` satisfies `range`, otherwise `false`. - */ - Plugin.versionSatisfies = function(version, range) { - range = range || '*'; - - var rangeParsed = Plugin.versionParse(range), - rangeParts = rangeParsed.parts, - versionParsed = Plugin.versionParse(version), - versionParts = versionParsed.parts; - - if (rangeParsed.isRange) { - if (rangeParsed.operator === '*' || version === '*') { - return true; - } - - if (rangeParsed.operator === '~') { - return versionParts[0] === rangeParts[0] && versionParts[1] === rangeParts[1] && versionParts[2] >= rangeParts[2]; - } - - if (rangeParsed.operator === '^') { - if (rangeParts[0] > 0) { - return versionParts[0] === rangeParts[0] && versionParsed.number >= rangeParsed.number; - } - - if (rangeParts[1] > 0) { - return versionParts[1] === rangeParts[1] && versionParts[2] >= rangeParts[2]; - } - - return versionParts[2] === rangeParts[2]; - } - } - - return version === range || version === '*'; - }; - -})(); - -},{"./Common":14}],21:[function(_dereq_,module,exports){ -/** -* The `Matter.Runner` module is an optional utility which provides a game loop, -* that handles continuously updating a `Matter.Engine` for you within a browser. -* It is intended for development and debugging purposes, but may also be suitable for simple games. -* If you are using your own game loop instead, then you do not need the `Matter.Runner` module. -* Instead just call `Engine.update(engine, delta)` in your own loop. -* -* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). -* -* @class Runner -*/ - -var Runner = {}; - -module.exports = Runner; - -var Events = _dereq_('./Events'); -var Engine = _dereq_('./Engine'); -var Common = _dereq_('./Common'); - -(function() { - - var _requestAnimationFrame, - _cancelAnimationFrame; - - if (typeof window !== 'undefined') { - _requestAnimationFrame = window.requestAnimationFrame || window.webkitRequestAnimationFrame - || window.mozRequestAnimationFrame || window.msRequestAnimationFrame; - - _cancelAnimationFrame = window.cancelAnimationFrame || window.mozCancelAnimationFrame - || window.webkitCancelAnimationFrame || window.msCancelAnimationFrame; - } - - if (!_requestAnimationFrame) { - var _frameTimeout; - - _requestAnimationFrame = function(callback){ - _frameTimeout = setTimeout(function() { - callback(Common.now()); - }, 1000 / 60); - }; - - _cancelAnimationFrame = function() { - clearTimeout(_frameTimeout); - }; - } - - /** - * Creates a new Runner. The options parameter is an object that specifies any properties you wish to override the defaults. - * @method create - * @param {} options - */ - Runner.create = function(options) { - var defaults = { - fps: 60, - correction: 1, - deltaSampleSize: 60, - counterTimestamp: 0, - frameCounter: 0, - deltaHistory: [], - timePrev: null, - timeScalePrev: 1, - frameRequestId: null, - isFixed: false, - enabled: true - }; - - var runner = Common.extend(defaults, options); - - runner.delta = runner.delta || 1000 / runner.fps; - runner.deltaMin = runner.deltaMin || 1000 / runner.fps; - runner.deltaMax = runner.deltaMax || 1000 / (runner.fps * 0.5); - runner.fps = 1000 / runner.delta; - - return runner; - }; - - /** - * Continuously ticks a `Matter.Engine` by calling `Runner.tick` on the `requestAnimationFrame` event. - * @method run - * @param {engine} engine - */ - Runner.run = function(runner, engine) { - // create runner if engine is first argument - if (typeof runner.positionIterations !== 'undefined') { - engine = runner; - runner = Runner.create(); - } - - (function render(time){ - runner.frameRequestId = _requestAnimationFrame(render); - - if (time && runner.enabled) { - Runner.tick(runner, engine, time); - } - })(); - - return runner; - }; - - /** - * A game loop utility that updates the engine and renderer by one step (a 'tick'). - * Features delta smoothing, time correction and fixed or dynamic timing. - * Triggers `beforeTick`, `tick` and `afterTick` events on the engine. - * Consider just `Engine.update(engine, delta)` if you're using your own loop. - * @method tick - * @param {runner} runner - * @param {engine} engine - * @param {number} time - */ - Runner.tick = function(runner, engine, time) { - var timing = engine.timing, - correction = 1, - delta; - - // create an event object - var event = { - timestamp: timing.timestamp - }; - - Events.trigger(runner, 'beforeTick', event); - Events.trigger(engine, 'beforeTick', event); // @deprecated - - if (runner.isFixed) { - // fixed timestep - delta = runner.delta; - } else { - // dynamic timestep based on wall clock between calls - delta = (time - runner.timePrev) || runner.delta; - runner.timePrev = time; - - // optimistically filter delta over a few frames, to improve stability - runner.deltaHistory.push(delta); - runner.deltaHistory = runner.deltaHistory.slice(-runner.deltaSampleSize); - delta = Math.min.apply(null, runner.deltaHistory); - - // limit delta - delta = delta < runner.deltaMin ? runner.deltaMin : delta; - delta = delta > runner.deltaMax ? runner.deltaMax : delta; - - // correction for delta - correction = delta / runner.delta; - - // update engine timing object - runner.delta = delta; - } - - // time correction for time scaling - if (runner.timeScalePrev !== 0) - correction *= timing.timeScale / runner.timeScalePrev; - - if (timing.timeScale === 0) - correction = 0; - - runner.timeScalePrev = timing.timeScale; - runner.correction = correction; - - // fps counter - runner.frameCounter += 1; - if (time - runner.counterTimestamp >= 1000) { - runner.fps = runner.frameCounter * ((time - runner.counterTimestamp) / 1000); - runner.counterTimestamp = time; - runner.frameCounter = 0; - } - - Events.trigger(runner, 'tick', event); - Events.trigger(engine, 'tick', event); // @deprecated - - // if world has been modified, clear the render scene graph - if (engine.world.isModified - && engine.render - && engine.render.controller - && engine.render.controller.clear) { - engine.render.controller.clear(engine.render); // @deprecated - } - - // update - Events.trigger(runner, 'beforeUpdate', event); - Engine.update(engine, delta, correction); - Events.trigger(runner, 'afterUpdate', event); - - // render - // @deprecated - if (engine.render && engine.render.controller) { - Events.trigger(runner, 'beforeRender', event); - Events.trigger(engine, 'beforeRender', event); // @deprecated - - engine.render.controller.world(engine.render); - - Events.trigger(runner, 'afterRender', event); - Events.trigger(engine, 'afterRender', event); // @deprecated - } - - Events.trigger(runner, 'afterTick', event); - Events.trigger(engine, 'afterTick', event); // @deprecated - }; - - /** - * Ends execution of `Runner.run` on the given `runner`, by canceling the animation frame request event loop. - * If you wish to only temporarily pause the engine, see `engine.enabled` instead. - * @method stop - * @param {runner} runner - */ - Runner.stop = function(runner) { - _cancelAnimationFrame(runner.frameRequestId); - }; - - /** - * Alias for `Runner.run`. - * @method start - * @param {runner} runner - * @param {engine} engine - */ - Runner.start = function(runner, engine) { - Runner.run(runner, engine); - }; - - /* - * - * Events Documentation - * - */ - - /** - * Fired at the start of a tick, before any updates to the engine or timing - * - * @event beforeTick - * @param {} event An event object - * @param {number} event.timestamp The engine.timing.timestamp of the event - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired after engine timing updated, but just before update - * - * @event tick - * @param {} event An event object - * @param {number} event.timestamp The engine.timing.timestamp of the event - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired at the end of a tick, after engine update and after rendering - * - * @event afterTick - * @param {} event An event object - * @param {number} event.timestamp The engine.timing.timestamp of the event - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired before update - * - * @event beforeUpdate - * @param {} event An event object - * @param {number} event.timestamp The engine.timing.timestamp of the event - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired after update - * - * @event afterUpdate - * @param {} event An event object - * @param {number} event.timestamp The engine.timing.timestamp of the event - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - */ - - /** - * Fired before rendering - * - * @event beforeRender - * @param {} event An event object - * @param {number} event.timestamp The engine.timing.timestamp of the event - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - * @deprecated - */ - - /** - * Fired after rendering - * - * @event afterRender - * @param {} event An event object - * @param {number} event.timestamp The engine.timing.timestamp of the event - * @param {} event.source The source object of the event - * @param {} event.name The name of the event - * @deprecated - */ - - /* - * - * Properties Documentation - * - */ - - /** - * A flag that specifies whether the runner is running or not. - * - * @property enabled - * @type boolean - * @default true - */ - - /** - * A `Boolean` that specifies if the runner should use a fixed timestep (otherwise it is variable). - * If timing is fixed, then the apparent simulation speed will change depending on the frame rate (but behaviour will be deterministic). - * If the timing is variable, then the apparent simulation speed will be constant (approximately, but at the cost of determininism). - * - * @property isFixed - * @type boolean - * @default false - */ - - /** - * A `Number` that specifies the time step between updates in milliseconds. - * If `engine.timing.isFixed` is set to `true`, then `delta` is fixed. - * If it is `false`, then `delta` can dynamically change to maintain the correct apparent simulation speed. - * - * @property delta - * @type number - * @default 1000 / 60 - */ - -})(); - -},{"./Common":14,"./Engine":15,"./Events":16}],22:[function(_dereq_,module,exports){ -/** -* The `Matter.Sleeping` module contains methods to manage the sleeping state of bodies. -* -* @class Sleeping -*/ - -var Sleeping = {}; - -module.exports = Sleeping; - -var Events = _dereq_('./Events'); - -(function() { - - Sleeping._motionWakeThreshold = 0.18; - Sleeping._motionSleepThreshold = 0.08; - Sleeping._minBias = 0.9; - - /** - * Puts bodies to sleep or wakes them up depending on their motion. - * @method update - * @param {body[]} bodies - * @param {number} timeScale - */ - Sleeping.update = function(bodies, timeScale) { - var timeFactor = timeScale * timeScale * timeScale; - - // update bodies sleeping status - for (var i = 0; i < bodies.length; i++) { - var body = bodies[i], - motion = body.speed * body.speed + body.angularSpeed * body.angularSpeed; - - // wake up bodies if they have a force applied - if (body.force.x !== 0 || body.force.y !== 0) { - Sleeping.set(body, false); - continue; - } - - var minMotion = Math.min(body.motion, motion), - maxMotion = Math.max(body.motion, motion); - - // biased average motion estimation between frames - body.motion = Sleeping._minBias * minMotion + (1 - Sleeping._minBias) * maxMotion; - - if (body.sleepThreshold > 0 && body.motion < Sleeping._motionSleepThreshold * timeFactor) { - body.sleepCounter += 1; - - if (body.sleepCounter >= body.sleepThreshold) - Sleeping.set(body, true); - } else if (body.sleepCounter > 0) { - body.sleepCounter -= 1; - } - } - }; - - /** - * Given a set of colliding pairs, wakes the sleeping bodies involved. - * @method afterCollisions - * @param {pair[]} pairs - * @param {number} timeScale - */ - Sleeping.afterCollisions = function(pairs, timeScale) { - var timeFactor = timeScale * timeScale * timeScale; - - // wake up bodies involved in collisions - for (var i = 0; i < pairs.length; i++) { - var pair = pairs[i]; - - // don't wake inactive pairs - if (!pair.isActive) - continue; - - var collision = pair.collision, - bodyA = collision.bodyA.parent, - bodyB = collision.bodyB.parent; - - // don't wake if at least one body is static - if ((bodyA.isSleeping && bodyB.isSleeping) || bodyA.isStatic || bodyB.isStatic) - continue; - - if (bodyA.isSleeping || bodyB.isSleeping) { - var sleepingBody = (bodyA.isSleeping && !bodyA.isStatic) ? bodyA : bodyB, - movingBody = sleepingBody === bodyA ? bodyB : bodyA; - - if (!sleepingBody.isStatic && movingBody.motion > Sleeping._motionWakeThreshold * timeFactor) { - Sleeping.set(sleepingBody, false); - } - } - } - }; - - /** - * Set a body as sleeping or awake. - * @method set - * @param {body} body - * @param {boolean} isSleeping - */ - Sleeping.set = function(body, isSleeping) { - var wasSleeping = body.isSleeping; - - if (isSleeping) { - body.isSleeping = true; - body.sleepCounter = body.sleepThreshold; - - body.positionImpulse.x = 0; - body.positionImpulse.y = 0; - - body.positionPrev.x = body.position.x; - body.positionPrev.y = body.position.y; - - body.anglePrev = body.angle; - body.speed = 0; - body.angularSpeed = 0; - body.motion = 0; - - if (!wasSleeping) { - Events.trigger(body, 'sleepStart'); - } - } else { - body.isSleeping = false; - body.sleepCounter = 0; - - if (wasSleeping) { - Events.trigger(body, 'sleepEnd'); - } - } - }; - -})(); - -},{"./Events":16}],23:[function(_dereq_,module,exports){ -/** -* The `Matter.Bodies` module contains factory methods for creating rigid body models -* with commonly used body configurations (such as rectangles, circles and other polygons). -* -* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). -* -* @class Bodies -*/ - -// TODO: true circle bodies - -var Bodies = {}; - -module.exports = Bodies; - -var Vertices = _dereq_('../geometry/Vertices'); -var Common = _dereq_('../core/Common'); -var Body = _dereq_('../body/Body'); -var Bounds = _dereq_('../geometry/Bounds'); -var Vector = _dereq_('../geometry/Vector'); -var decomp; - -(function() { - - /** - * Creates a new rigid body model with a rectangle hull. - * The options parameter is an object that specifies any properties you wish to override the defaults. - * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. - * @method rectangle - * @param {number} x - * @param {number} y - * @param {number} width - * @param {number} height - * @param {object} [options] - * @return {body} A new rectangle body - */ - Bodies.rectangle = function(x, y, width, height, options) { - options = options || {}; - - var rectangle = { - label: 'Rectangle Body', - position: { x: x, y: y }, - vertices: Vertices.fromPath('L 0 0 L ' + width + ' 0 L ' + width + ' ' + height + ' L 0 ' + height) - }; - - if (options.chamfer) { - var chamfer = options.chamfer; - rectangle.vertices = Vertices.chamfer(rectangle.vertices, chamfer.radius, - chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); - delete options.chamfer; - } - - return Body.create(Common.extend({}, rectangle, options)); - }; - - /** - * Creates a new rigid body model with a trapezoid hull. - * The options parameter is an object that specifies any properties you wish to override the defaults. - * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. - * @method trapezoid - * @param {number} x - * @param {number} y - * @param {number} width - * @param {number} height - * @param {number} slope - * @param {object} [options] - * @return {body} A new trapezoid body - */ - Bodies.trapezoid = function(x, y, width, height, slope, options) { - options = options || {}; - - slope *= 0.5; - var roof = (1 - (slope * 2)) * width; - - var x1 = width * slope, - x2 = x1 + roof, - x3 = x2 + x1, - verticesPath; - - if (slope < 0.5) { - verticesPath = 'L 0 0 L ' + x1 + ' ' + (-height) + ' L ' + x2 + ' ' + (-height) + ' L ' + x3 + ' 0'; - } else { - verticesPath = 'L 0 0 L ' + x2 + ' ' + (-height) + ' L ' + x3 + ' 0'; - } - - var trapezoid = { - label: 'Trapezoid Body', - position: { x: x, y: y }, - vertices: Vertices.fromPath(verticesPath) - }; - - if (options.chamfer) { - var chamfer = options.chamfer; - trapezoid.vertices = Vertices.chamfer(trapezoid.vertices, chamfer.radius, - chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); - delete options.chamfer; - } - - return Body.create(Common.extend({}, trapezoid, options)); - }; - - /** - * Creates a new rigid body model with a circle hull. - * The options parameter is an object that specifies any properties you wish to override the defaults. - * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. - * @method circle - * @param {number} x - * @param {number} y - * @param {number} radius - * @param {object} [options] - * @param {number} [maxSides] - * @return {body} A new circle body - */ - Bodies.circle = function(x, y, radius, options, maxSides) { - options = options || {}; - - var circle = { - label: 'Circle Body', - circleRadius: radius - }; - - // approximate circles with polygons until true circles implemented in SAT - maxSides = maxSides || 25; - var sides = Math.ceil(Math.max(10, Math.min(maxSides, radius))); - - // optimisation: always use even number of sides (half the number of unique axes) - if (sides % 2 === 1) - sides += 1; - - return Bodies.polygon(x, y, sides, radius, Common.extend({}, circle, options)); - }; - - /** - * Creates a new rigid body model with a regular polygon hull with the given number of sides. - * The options parameter is an object that specifies any properties you wish to override the defaults. - * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. - * @method polygon - * @param {number} x - * @param {number} y - * @param {number} sides - * @param {number} radius - * @param {object} [options] - * @return {body} A new regular polygon body - */ - Bodies.polygon = function(x, y, sides, radius, options) { - options = options || {}; - - if (sides < 3) - return Bodies.circle(x, y, radius, options); - - var theta = 2 * Math.PI / sides, - path = '', - offset = theta * 0.5; - - for (var i = 0; i < sides; i += 1) { - var angle = offset + (i * theta), - xx = Math.cos(angle) * radius, - yy = Math.sin(angle) * radius; - - path += 'L ' + xx.toFixed(3) + ' ' + yy.toFixed(3) + ' '; - } - - var polygon = { - label: 'Polygon Body', - position: { x: x, y: y }, - vertices: Vertices.fromPath(path) - }; - - if (options.chamfer) { - var chamfer = options.chamfer; - polygon.vertices = Vertices.chamfer(polygon.vertices, chamfer.radius, - chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); - delete options.chamfer; - } - - return Body.create(Common.extend({}, polygon, options)); - }; - - /** - * Creates a body using the supplied vertices (or an array containing multiple sets of vertices). - * If the vertices are convex, they will pass through as supplied. - * Otherwise if the vertices are concave, they will be decomposed if [poly-decomp.js](https://github.com/schteppe/poly-decomp.js) is available. - * Note that this process is not guaranteed to support complex sets of vertices (e.g. those with holes may fail). - * By default the decomposition will discard collinear edges (to improve performance). - * It can also optionally discard any parts that have an area less than `minimumArea`. - * If the vertices can not be decomposed, the result will fall back to using the convex hull. - * The options parameter is an object that specifies any `Matter.Body` properties you wish to override the defaults. - * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. - * @method fromVertices - * @param {number} x - * @param {number} y - * @param [[vector]] vertexSets - * @param {object} [options] - * @param {bool} [flagInternal=false] - * @param {number} [removeCollinear=0.01] - * @param {number} [minimumArea=10] - * @return {body} - */ - Bodies.fromVertices = function(x, y, vertexSets, options, flagInternal, removeCollinear, minimumArea) { - if (!decomp) { - decomp = Common._requireGlobal('decomp', 'poly-decomp'); - } - - var body, - parts, - isConvex, - vertices, - i, - j, - k, - v, - z; - - options = options || {}; - parts = []; - - flagInternal = typeof flagInternal !== 'undefined' ? flagInternal : false; - removeCollinear = typeof removeCollinear !== 'undefined' ? removeCollinear : 0.01; - minimumArea = typeof minimumArea !== 'undefined' ? minimumArea : 10; - - if (!decomp) { - Common.warn('Bodies.fromVertices: poly-decomp.js required. Could not decompose vertices. Fallback to convex hull.'); - } - - // ensure vertexSets is an array of arrays - if (!Common.isArray(vertexSets[0])) { - vertexSets = [vertexSets]; - } - - for (v = 0; v < vertexSets.length; v += 1) { - vertices = vertexSets[v]; - isConvex = Vertices.isConvex(vertices); - - if (isConvex || !decomp) { - if (isConvex) { - vertices = Vertices.clockwiseSort(vertices); + if (collision.collided) { + for (var i = 0; i < supports.length; i++) { + var support = supports[i], + contactId = Contact.id(support), + contact = contacts[contactId]; + + if (contact) { + activeContacts.push(contact); } else { - // fallback to convex hull when decomposition is not possible - vertices = Vertices.hull(vertices); - } - - parts.push({ - position: { x: x, y: y }, - vertices: vertices - }); - } else { - // initialise a decomposition - var concave = vertices.map(function(vertex) { - return [vertex.x, vertex.y]; - }); - - // vertices are concave and simple, we can decompose into parts - decomp.makeCCW(concave); - if (removeCollinear !== false) - decomp.removeCollinearPoints(concave, removeCollinear); - - // use the quick decomposition algorithm (Bayazit) - var decomposed = decomp.quickDecomp(concave); - - // for each decomposed chunk - for (i = 0; i < decomposed.length; i++) { - var chunk = decomposed[i]; - - // convert vertices into the correct structure - var chunkVertices = chunk.map(function(vertices) { - return { - x: vertices[0], - y: vertices[1] - }; - }); - - // skip small chunks - if (minimumArea > 0 && Vertices.area(chunkVertices) < minimumArea) - continue; - - // create a compound part - parts.push({ - position: Vertices.centre(chunkVertices), - vertices: chunkVertices - }); + activeContacts.push(contacts[contactId] = Contact.create(support)); } } - } - // create body parts - for (i = 0; i < parts.length; i++) { - parts[i] = Body.create(Common.extend(parts[i], options)); - } - - // flag internal edges (coincident part edges) - if (flagInternal) { - var coincident_max_dist = 5; - - for (i = 0; i < parts.length; i++) { - var partA = parts[i]; - - for (j = i + 1; j < parts.length; j++) { - var partB = parts[j]; - - if (Bounds.overlaps(partA.bounds, partB.bounds)) { - var pav = partA.vertices, - pbv = partB.vertices; - - // iterate vertices of both parts - for (k = 0; k < partA.vertices.length; k++) { - for (z = 0; z < partB.vertices.length; z++) { - // find distances between the vertices - var da = Vector.magnitudeSquared(Vector.sub(pav[(k + 1) % pav.length], pbv[z])), - db = Vector.magnitudeSquared(Vector.sub(pav[k], pbv[(z + 1) % pbv.length])); - - // if both vertices are very close, consider the edge concident (internal) - if (da < coincident_max_dist && db < coincident_max_dist) { - pav[k].isInternal = true; - pbv[z].isInternal = true; - } - } - } - - } - } - } - } - - if (parts.length > 1) { - // create the parent body to be returned, that contains generated compound parts - body = Body.create(Common.extend({ parts: parts.slice(0) }, options)); - Body.setPosition(body, { x: x, y: y }); - - return body; + pair.separation = collision.depth; + Pair.setActive(pair, true, timestamp); } else { - return parts[0]; + if (pair.isActive === true) + Pair.setActive(pair, false, timestamp); } }; - -})(); - -},{"../body/Body":1,"../core/Common":14,"../geometry/Bounds":26,"../geometry/Vector":28,"../geometry/Vertices":29}],24:[function(_dereq_,module,exports){ -/** -* The `Matter.Composites` module contains factory methods for creating composite bodies -* with commonly used configurations (such as stacks and chains). -* -* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). -* -* @class Composites -*/ - -var Composites = {}; - -module.exports = Composites; - -var Composite = _dereq_('../body/Composite'); -var Constraint = _dereq_('../constraint/Constraint'); -var Common = _dereq_('../core/Common'); -var Body = _dereq_('../body/Body'); -var Bodies = _dereq_('./Bodies'); - -(function() { - - /** - * Create a new composite containing bodies created in the callback in a grid arrangement. - * This function uses the body's bounds to prevent overlaps. - * @method stack - * @param {number} xx - * @param {number} yy - * @param {number} columns - * @param {number} rows - * @param {number} columnGap - * @param {number} rowGap - * @param {function} callback - * @return {composite} A new composite containing objects created in the callback - */ - Composites.stack = function(xx, yy, columns, rows, columnGap, rowGap, callback) { - var stack = Composite.create({ label: 'Stack' }), - x = xx, - y = yy, - lastBody, - i = 0; - - for (var row = 0; row < rows; row++) { - var maxHeight = 0; - - for (var column = 0; column < columns; column++) { - var body = callback(x, y, column, row, lastBody, i); - - if (body) { - var bodyHeight = body.bounds.max.y - body.bounds.min.y, - bodyWidth = body.bounds.max.x - body.bounds.min.x; - - if (bodyHeight > maxHeight) - maxHeight = bodyHeight; - - Body.translate(body, { x: bodyWidth * 0.5, y: bodyHeight * 0.5 }); - - x = body.bounds.max.x + columnGap; - - Composite.addBody(stack, body); - - lastBody = body; - i += 1; - } else { - x += columnGap; - } - } - - y += maxHeight + rowGap; - x = xx; - } - - return stack; - }; /** - * Chains all bodies in the given composite together using constraints. - * @method chain - * @param {composite} composite - * @param {number} xOffsetA - * @param {number} yOffsetA - * @param {number} xOffsetB - * @param {number} yOffsetB - * @param {object} options - * @return {composite} A new composite containing objects chained together with constraints + * Set a pair as active or inactive. + * @method setActive + * @param {pair} pair + * @param {bool} isActive + * @param {number} timestamp */ - Composites.chain = function(composite, xOffsetA, yOffsetA, xOffsetB, yOffsetB, options) { - var bodies = composite.bodies; - - for (var i = 1; i < bodies.length; i++) { - var bodyA = bodies[i - 1], - bodyB = bodies[i], - bodyAHeight = bodyA.bounds.max.y - bodyA.bounds.min.y, - bodyAWidth = bodyA.bounds.max.x - bodyA.bounds.min.x, - bodyBHeight = bodyB.bounds.max.y - bodyB.bounds.min.y, - bodyBWidth = bodyB.bounds.max.x - bodyB.bounds.min.x; - - var defaults = { - bodyA: bodyA, - pointA: { x: bodyAWidth * xOffsetA, y: bodyAHeight * yOffsetA }, - bodyB: bodyB, - pointB: { x: bodyBWidth * xOffsetB, y: bodyBHeight * yOffsetB } - }; - - var constraint = Common.extend(defaults, options); - - Composite.addConstraint(composite, Constraint.create(constraint)); - } - - composite.label += ' Chain'; - - return composite; - }; - - /** - * Connects bodies in the composite with constraints in a grid pattern, with optional cross braces. - * @method mesh - * @param {composite} composite - * @param {number} columns - * @param {number} rows - * @param {boolean} crossBrace - * @param {object} options - * @return {composite} The composite containing objects meshed together with constraints - */ - Composites.mesh = function(composite, columns, rows, crossBrace, options) { - var bodies = composite.bodies, - row, - col, - bodyA, - bodyB, - bodyC; - - for (row = 0; row < rows; row++) { - for (col = 1; col < columns; col++) { - bodyA = bodies[(col - 1) + (row * columns)]; - bodyB = bodies[col + (row * columns)]; - Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyA, bodyB: bodyB }, options))); - } - - if (row > 0) { - for (col = 0; col < columns; col++) { - bodyA = bodies[col + ((row - 1) * columns)]; - bodyB = bodies[col + (row * columns)]; - Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyA, bodyB: bodyB }, options))); - - if (crossBrace && col > 0) { - bodyC = bodies[(col - 1) + ((row - 1) * columns)]; - Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyC, bodyB: bodyB }, options))); - } - - if (crossBrace && col < columns - 1) { - bodyC = bodies[(col + 1) + ((row - 1) * columns)]; - Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyC, bodyB: bodyB }, options))); - } - } - } - } - - composite.label += ' Mesh'; - - return composite; - }; - - /** - * Create a new composite containing bodies created in the callback in a pyramid arrangement. - * This function uses the body's bounds to prevent overlaps. - * @method pyramid - * @param {number} xx - * @param {number} yy - * @param {number} columns - * @param {number} rows - * @param {number} columnGap - * @param {number} rowGap - * @param {function} callback - * @return {composite} A new composite containing objects created in the callback - */ - Composites.pyramid = function(xx, yy, columns, rows, columnGap, rowGap, callback) { - return Composites.stack(xx, yy, columns, rows, columnGap, rowGap, function(x, y, column, row, lastBody, i) { - var actualRows = Math.min(rows, Math.ceil(columns / 2)), - lastBodyWidth = lastBody ? lastBody.bounds.max.x - lastBody.bounds.min.x : 0; - - if (row > actualRows) - return; - - // reverse row order - row = actualRows - row; - - var start = row, - end = columns - 1 - row; - - if (column < start || column > end) - return; - - // retroactively fix the first body's position, since width was unknown - if (i === 1) { - Body.translate(lastBody, { x: (column + (columns % 2 === 1 ? 1 : -1)) * lastBodyWidth, y: 0 }); - } - - var xOffset = lastBody ? column * lastBodyWidth : 0; - - return callback(xx + xOffset + column * columnGap, y, column, row, lastBody, i); - }); - }; - - /** - * Creates a composite with a Newton's Cradle setup of bodies and constraints. - * @method newtonsCradle - * @param {number} xx - * @param {number} yy - * @param {number} number - * @param {number} size - * @param {number} length - * @return {composite} A new composite newtonsCradle body - */ - Composites.newtonsCradle = function(xx, yy, number, size, length) { - var newtonsCradle = Composite.create({ label: 'Newtons Cradle' }); - - for (var i = 0; i < number; i++) { - var separation = 1.9, - circle = Bodies.circle(xx + i * (size * separation), yy + length, size, - { inertia: Infinity, restitution: 1, friction: 0, frictionAir: 0.0001, slop: 1 }), - constraint = Constraint.create({ pointA: { x: xx + i * (size * separation), y: yy }, bodyB: circle }); - - Composite.addBody(newtonsCradle, circle); - Composite.addConstraint(newtonsCradle, constraint); - } - - return newtonsCradle; - }; - - /** - * Creates a composite with simple car setup of bodies and constraints. - * @method car - * @param {number} xx - * @param {number} yy - * @param {number} width - * @param {number} height - * @param {number} wheelSize - * @return {composite} A new composite car body - */ - Composites.car = function(xx, yy, width, height, wheelSize) { - var group = Body.nextGroup(true), - wheelBase = 20, - wheelAOffset = -width * 0.5 + wheelBase, - wheelBOffset = width * 0.5 - wheelBase, - wheelYOffset = 0; - - var car = Composite.create({ label: 'Car' }), - body = Bodies.rectangle(xx, yy, width, height, { - collisionFilter: { - group: group - }, - chamfer: { - radius: height * 0.5 - }, - density: 0.0002 - }); - - var wheelA = Bodies.circle(xx + wheelAOffset, yy + wheelYOffset, wheelSize, { - collisionFilter: { - group: group - }, - friction: 0.8 - }); - - var wheelB = Bodies.circle(xx + wheelBOffset, yy + wheelYOffset, wheelSize, { - collisionFilter: { - group: group - }, - friction: 0.8 - }); - - var axelA = Constraint.create({ - bodyB: body, - pointB: { x: wheelAOffset, y: wheelYOffset }, - bodyA: wheelA, - stiffness: 1, - length: 0 - }); - - var axelB = Constraint.create({ - bodyB: body, - pointB: { x: wheelBOffset, y: wheelYOffset }, - bodyA: wheelB, - stiffness: 1, - length: 0 - }); - - Composite.addBody(car, body); - Composite.addBody(car, wheelA); - Composite.addBody(car, wheelB); - Composite.addConstraint(car, axelA); - Composite.addConstraint(car, axelB); - - return car; - }; - - /** - * Creates a simple soft body like object. - * @method softBody - * @param {number} xx - * @param {number} yy - * @param {number} columns - * @param {number} rows - * @param {number} columnGap - * @param {number} rowGap - * @param {boolean} crossBrace - * @param {number} particleRadius - * @param {} particleOptions - * @param {} constraintOptions - * @return {composite} A new composite softBody - */ - Composites.softBody = function(xx, yy, columns, rows, columnGap, rowGap, crossBrace, particleRadius, particleOptions, constraintOptions) { - particleOptions = Common.extend({ inertia: Infinity }, particleOptions); - constraintOptions = Common.extend({ stiffness: 0.2, render: { type: 'line', anchors: false } }, constraintOptions); - - var softBody = Composites.stack(xx, yy, columns, rows, columnGap, rowGap, function(x, y) { - return Bodies.circle(x, y, particleRadius, particleOptions); - }); - - Composites.mesh(softBody, columns, rows, crossBrace, constraintOptions); - - softBody.label = 'Soft Body'; - - return softBody; - }; - -})(); - -},{"../body/Body":1,"../body/Composite":2,"../constraint/Constraint":12,"../core/Common":14,"./Bodies":23}],25:[function(_dereq_,module,exports){ -/** -* The `Matter.Axes` module contains methods for creating and manipulating sets of axes. -* -* @class Axes -*/ - -var Axes = {}; - -module.exports = Axes; - -var Vector = _dereq_('../geometry/Vector'); -var Common = _dereq_('../core/Common'); - -(function() { - - /** - * Creates a new set of axes from the given vertices. - * @method fromVertices - * @param {vertices} vertices - * @return {axes} A new axes from the given vertices - */ - Axes.fromVertices = function(vertices) { - var axes = {}; - - // find the unique axes, using edge normal gradients - for (var i = 0; i < vertices.length; i++) { - var j = (i + 1) % vertices.length, - normal = Vector.normalise({ - x: vertices[j].y - vertices[i].y, - y: vertices[i].x - vertices[j].x - }), - gradient = (normal.y === 0) ? Infinity : (normal.x / normal.y); - - // limit precision - gradient = gradient.toFixed(3).toString(); - axes[gradient] = normal; - } - - return Common.values(axes); - }; - - /** - * Rotates a set of axes by the given angle. - * @method rotate - * @param {axes} axes - * @param {number} angle - */ - Axes.rotate = function(axes, angle) { - if (angle === 0) - return; - - var cos = Math.cos(angle), - sin = Math.sin(angle); - - for (var i = 0; i < axes.length; i++) { - var axis = axes[i], - xx; - xx = axis.x * cos - axis.y * sin; - axis.y = axis.x * sin + axis.y * cos; - axis.x = xx; - } - }; - -})(); - -},{"../core/Common":14,"../geometry/Vector":28}],26:[function(_dereq_,module,exports){ -/** -* The `Matter.Bounds` module contains methods for creating and manipulating axis-aligned bounding boxes (AABB). -* -* @class Bounds -*/ - -var Bounds = {}; - -module.exports = Bounds; - -(function() { - - /** - * Creates a new axis-aligned bounding box (AABB) for the given vertices. - * @method create - * @param {vertices} vertices - * @return {bounds} A new bounds object - */ - Bounds.create = function(vertices) { - var bounds = { - min: { x: 0, y: 0 }, - max: { x: 0, y: 0 } - }; - - if (vertices) - Bounds.update(bounds, vertices); - - return bounds; - }; - - /** - * Updates bounds using the given vertices and extends the bounds given a velocity. - * @method update - * @param {bounds} bounds - * @param {vertices} vertices - * @param {vector} velocity - */ - Bounds.update = function(bounds, vertices, velocity) { - bounds.min.x = Infinity; - bounds.max.x = -Infinity; - bounds.min.y = Infinity; - bounds.max.y = -Infinity; - - for (var i = 0; i < vertices.length; i++) { - var vertex = vertices[i]; - if (vertex.x > bounds.max.x) bounds.max.x = vertex.x; - if (vertex.x < bounds.min.x) bounds.min.x = vertex.x; - if (vertex.y > bounds.max.y) bounds.max.y = vertex.y; - if (vertex.y < bounds.min.y) bounds.min.y = vertex.y; - } - - if (velocity) { - if (velocity.x > 0) { - bounds.max.x += velocity.x; - } else { - bounds.min.x += velocity.x; - } - - if (velocity.y > 0) { - bounds.max.y += velocity.y; - } else { - bounds.min.y += velocity.y; - } - } - }; - - /** - * Returns true if the bounds contains the given point. - * @method contains - * @param {bounds} bounds - * @param {vector} point - * @return {boolean} True if the bounds contain the point, otherwise false - */ - Bounds.contains = function(bounds, point) { - return point.x >= bounds.min.x && point.x <= bounds.max.x - && point.y >= bounds.min.y && point.y <= bounds.max.y; - }; - - /** - * Returns true if the two bounds intersect. - * @method overlaps - * @param {bounds} boundsA - * @param {bounds} boundsB - * @return {boolean} True if the bounds overlap, otherwise false - */ - Bounds.overlaps = function(boundsA, boundsB) { - return (boundsA.min.x <= boundsB.max.x && boundsA.max.x >= boundsB.min.x - && boundsA.max.y >= boundsB.min.y && boundsA.min.y <= boundsB.max.y); - }; - - /** - * Translates the bounds by the given vector. - * @method translate - * @param {bounds} bounds - * @param {vector} vector - */ - Bounds.translate = function(bounds, vector) { - bounds.min.x += vector.x; - bounds.max.x += vector.x; - bounds.min.y += vector.y; - bounds.max.y += vector.y; - }; - - /** - * Shifts the bounds to the given position. - * @method shift - * @param {bounds} bounds - * @param {vector} position - */ - Bounds.shift = function(bounds, position) { - var deltaX = bounds.max.x - bounds.min.x, - deltaY = bounds.max.y - bounds.min.y; - - bounds.min.x = position.x; - bounds.max.x = position.x + deltaX; - bounds.min.y = position.y; - bounds.max.y = position.y + deltaY; - }; - -})(); - -},{}],27:[function(_dereq_,module,exports){ -/** -* The `Matter.Svg` module contains methods for converting SVG images into an array of vector points. -* -* To use this module you also need the SVGPathSeg polyfill: https://github.com/progers/pathseg -* -* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). -* -* @class Svg -*/ - -var Svg = {}; - -module.exports = Svg; - -var Bounds = _dereq_('../geometry/Bounds'); -var Common = _dereq_('../core/Common'); - -(function() { - - /** - * Converts an SVG path into an array of vector points. - * If the input path forms a concave shape, you must decompose the result into convex parts before use. - * See `Bodies.fromVertices` which provides support for this. - * Note that this function is not guaranteed to support complex paths (such as those with holes). - * You must load the `pathseg.js` polyfill on newer browsers. - * @method pathToVertices - * @param {SVGPathElement} path - * @param {Number} [sampleLength=15] - * @return {Vector[]} points - */ - Svg.pathToVertices = function(path, sampleLength) { - if (typeof window !== 'undefined' && !('SVGPathSeg' in window)) { - Common.warn('Svg.pathToVertices: SVGPathSeg not defined, a polyfill is required.'); - } - - // https://github.com/wout/svg.topoly.js/blob/master/svg.topoly.js - var i, il, total, point, segment, segments, - segmentsQueue, lastSegment, - lastPoint, segmentIndex, points = [], - lx, ly, length = 0, x = 0, y = 0; - - sampleLength = sampleLength || 15; - - var addPoint = function(px, py, pathSegType) { - // all odd-numbered path types are relative except PATHSEG_CLOSEPATH (1) - var isRelative = pathSegType % 2 === 1 && pathSegType > 1; - - // when the last point doesn't equal the current point add the current point - if (!lastPoint || px != lastPoint.x || py != lastPoint.y) { - if (lastPoint && isRelative) { - lx = lastPoint.x; - ly = lastPoint.y; - } else { - lx = 0; - ly = 0; - } - - var point = { - x: lx + px, - y: ly + py - }; - - // set last point - if (isRelative || !lastPoint) { - lastPoint = point; - } - - points.push(point); - - x = lx + px; - y = ly + py; - } - }; - - var addSegmentPoint = function(segment) { - var segType = segment.pathSegTypeAsLetter.toUpperCase(); - - // skip path ends - if (segType === 'Z') - return; - - // map segment to x and y - switch (segType) { - - case 'M': - case 'L': - case 'T': - case 'C': - case 'S': - case 'Q': - x = segment.x; - y = segment.y; - break; - case 'H': - x = segment.x; - break; - case 'V': - y = segment.y; - break; - } - - addPoint(x, y, segment.pathSegType); - }; - - // ensure path is absolute - Svg._svgPathToAbsolute(path); - - // get total length - total = path.getTotalLength(); - - // queue segments - segments = []; - for (i = 0; i < path.pathSegList.numberOfItems; i += 1) - segments.push(path.pathSegList.getItem(i)); - - segmentsQueue = segments.concat(); - - // sample through path - while (length < total) { - // get segment at position - segmentIndex = path.getPathSegAtLength(length); - segment = segments[segmentIndex]; - - // new segment - if (segment != lastSegment) { - while (segmentsQueue.length && segmentsQueue[0] != segment) - addSegmentPoint(segmentsQueue.shift()); - - lastSegment = segment; - } - - // add points in between when curving - // TODO: adaptive sampling - switch (segment.pathSegTypeAsLetter.toUpperCase()) { - - case 'C': - case 'T': - case 'S': - case 'Q': - case 'A': - point = path.getPointAtLength(length); - addPoint(point.x, point.y, 0); - break; - - } - - // increment by sample value - length += sampleLength; - } - - // add remaining segments not passed by sampling - for (i = 0, il = segmentsQueue.length; i < il; ++i) - addSegmentPoint(segmentsQueue[i]); - - return points; - }; - - Svg._svgPathToAbsolute = function(path) { - // http://phrogz.net/convert-svg-path-to-all-absolute-commands - // Copyright (c) Gavin Kistner - // http://phrogz.net/js/_ReuseLicense.txt - // Modifications: tidy formatting and naming - var x0, y0, x1, y1, x2, y2, segs = path.pathSegList, - x = 0, y = 0, len = segs.numberOfItems; - - for (var i = 0; i < len; ++i) { - var seg = segs.getItem(i), - segType = seg.pathSegTypeAsLetter; - - if (/[MLHVCSQTA]/.test(segType)) { - if ('x' in seg) x = seg.x; - if ('y' in seg) y = seg.y; - } else { - if ('x1' in seg) x1 = x + seg.x1; - if ('x2' in seg) x2 = x + seg.x2; - if ('y1' in seg) y1 = y + seg.y1; - if ('y2' in seg) y2 = y + seg.y2; - if ('x' in seg) x += seg.x; - if ('y' in seg) y += seg.y; - - switch (segType) { - - case 'm': - segs.replaceItem(path.createSVGPathSegMovetoAbs(x, y), i); - break; - case 'l': - segs.replaceItem(path.createSVGPathSegLinetoAbs(x, y), i); - break; - case 'h': - segs.replaceItem(path.createSVGPathSegLinetoHorizontalAbs(x), i); - break; - case 'v': - segs.replaceItem(path.createSVGPathSegLinetoVerticalAbs(y), i); - break; - case 'c': - segs.replaceItem(path.createSVGPathSegCurvetoCubicAbs(x, y, x1, y1, x2, y2), i); - break; - case 's': - segs.replaceItem(path.createSVGPathSegCurvetoCubicSmoothAbs(x, y, x2, y2), i); - break; - case 'q': - segs.replaceItem(path.createSVGPathSegCurvetoQuadraticAbs(x, y, x1, y1), i); - break; - case 't': - segs.replaceItem(path.createSVGPathSegCurvetoQuadraticSmoothAbs(x, y), i); - break; - case 'a': - segs.replaceItem(path.createSVGPathSegArcAbs(x, y, seg.r1, seg.r2, seg.angle, seg.largeArcFlag, seg.sweepFlag), i); - break; - case 'z': - case 'Z': - x = x0; - y = y0; - break; - - } - } - - if (segType == 'M' || segType == 'm') { - x0 = x; - y0 = y; - } - } - }; - -})(); -},{"../core/Common":14,"../geometry/Bounds":26}],28:[function(_dereq_,module,exports){ -/** -* The `Matter.Vector` module contains methods for creating and manipulating vectors. -* Vectors are the basis of all the geometry related operations in the engine. -* A `Matter.Vector` object is of the form `{ x: 0, y: 0 }`. -* -* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). -* -* @class Vector -*/ - -// TODO: consider params for reusing vector objects - -var Vector = {}; - -module.exports = Vector; - -(function() { - - /** - * Creates a new vector. - * @method create - * @param {number} x - * @param {number} y - * @return {vector} A new vector - */ - Vector.create = function(x, y) { - return { x: x || 0, y: y || 0 }; - }; - - /** - * Returns a new vector with `x` and `y` copied from the given `vector`. - * @method clone - * @param {vector} vector - * @return {vector} A new cloned vector - */ - Vector.clone = function(vector) { - return { x: vector.x, y: vector.y }; - }; - - /** - * Returns the magnitude (length) of a vector. - * @method magnitude - * @param {vector} vector - * @return {number} The magnitude of the vector - */ - Vector.magnitude = function(vector) { - return Math.sqrt((vector.x * vector.x) + (vector.y * vector.y)); - }; - - /** - * Returns the magnitude (length) of a vector (therefore saving a `sqrt` operation). - * @method magnitudeSquared - * @param {vector} vector - * @return {number} The squared magnitude of the vector - */ - Vector.magnitudeSquared = function(vector) { - return (vector.x * vector.x) + (vector.y * vector.y); - }; - - /** - * Rotates the vector about (0, 0) by specified angle. - * @method rotate - * @param {vector} vector - * @param {number} angle - * @param {vector} [output] - * @return {vector} The vector rotated about (0, 0) - */ - Vector.rotate = function(vector, angle, output) { - var cos = Math.cos(angle), sin = Math.sin(angle); - if (!output) output = {}; - var x = vector.x * cos - vector.y * sin; - output.y = vector.x * sin + vector.y * cos; - output.x = x; - return output; - }; - - /** - * Rotates the vector about a specified point by specified angle. - * @method rotateAbout - * @param {vector} vector - * @param {number} angle - * @param {vector} point - * @param {vector} [output] - * @return {vector} A new vector rotated about the point - */ - Vector.rotateAbout = function(vector, angle, point, output) { - var cos = Math.cos(angle), sin = Math.sin(angle); - if (!output) output = {}; - var x = point.x + ((vector.x - point.x) * cos - (vector.y - point.y) * sin); - output.y = point.y + ((vector.x - point.x) * sin + (vector.y - point.y) * cos); - output.x = x; - return output; - }; - - /** - * Normalises a vector (such that its magnitude is `1`). - * @method normalise - * @param {vector} vector - * @return {vector} A new vector normalised - */ - Vector.normalise = function(vector) { - var magnitude = Vector.magnitude(vector); - if (magnitude === 0) - return { x: 0, y: 0 }; - return { x: vector.x / magnitude, y: vector.y / magnitude }; - }; - - /** - * Returns the dot-product of two vectors. - * @method dot - * @param {vector} vectorA - * @param {vector} vectorB - * @return {number} The dot product of the two vectors - */ - Vector.dot = function(vectorA, vectorB) { - return (vectorA.x * vectorB.x) + (vectorA.y * vectorB.y); - }; - - /** - * Returns the cross-product of two vectors. - * @method cross - * @param {vector} vectorA - * @param {vector} vectorB - * @return {number} The cross product of the two vectors - */ - Vector.cross = function(vectorA, vectorB) { - return (vectorA.x * vectorB.y) - (vectorA.y * vectorB.x); - }; - - /** - * Returns the cross-product of three vectors. - * @method cross3 - * @param {vector} vectorA - * @param {vector} vectorB - * @param {vector} vectorC - * @return {number} The cross product of the three vectors - */ - Vector.cross3 = function(vectorA, vectorB, vectorC) { - return (vectorB.x - vectorA.x) * (vectorC.y - vectorA.y) - (vectorB.y - vectorA.y) * (vectorC.x - vectorA.x); - }; - - /** - * Adds the two vectors. - * @method add - * @param {vector} vectorA - * @param {vector} vectorB - * @param {vector} [output] - * @return {vector} A new vector of vectorA and vectorB added - */ - Vector.add = function(vectorA, vectorB, output) { - if (!output) output = {}; - output.x = vectorA.x + vectorB.x; - output.y = vectorA.y + vectorB.y; - return output; - }; - - /** - * Subtracts the two vectors. - * @method sub - * @param {vector} vectorA - * @param {vector} vectorB - * @param {vector} [output] - * @return {vector} A new vector of vectorA and vectorB subtracted - */ - Vector.sub = function(vectorA, vectorB, output) { - if (!output) output = {}; - output.x = vectorA.x - vectorB.x; - output.y = vectorA.y - vectorB.y; - return output; - }; - - /** - * Multiplies a vector and a scalar. - * @method mult - * @param {vector} vector - * @param {number} scalar - * @return {vector} A new vector multiplied by scalar - */ - Vector.mult = function(vector, scalar) { - return { x: vector.x * scalar, y: vector.y * scalar }; - }; - - /** - * Divides a vector and a scalar. - * @method div - * @param {vector} vector - * @param {number} scalar - * @return {vector} A new vector divided by scalar - */ - Vector.div = function(vector, scalar) { - return { x: vector.x / scalar, y: vector.y / scalar }; - }; - - /** - * Returns the perpendicular vector. Set `negate` to true for the perpendicular in the opposite direction. - * @method perp - * @param {vector} vector - * @param {bool} [negate=false] - * @return {vector} The perpendicular vector - */ - Vector.perp = function(vector, negate) { - negate = negate === true ? -1 : 1; - return { x: negate * -vector.y, y: negate * vector.x }; - }; - - /** - * Negates both components of a vector such that it points in the opposite direction. - * @method neg - * @param {vector} vector - * @return {vector} The negated vector - */ - Vector.neg = function(vector) { - return { x: -vector.x, y: -vector.y }; - }; - - /** - * Returns the angle between the vector `vectorB - vectorA` and the x-axis in radians. - * @method angle - * @param {vector} vectorA - * @param {vector} vectorB - * @return {number} The angle in radians - */ - Vector.angle = function(vectorA, vectorB) { - return Math.atan2(vectorB.y - vectorA.y, vectorB.x - vectorA.x); - }; - - /** - * Temporary vector pool (not thread-safe). - * @property _temp - * @type {vector[]} - * @private - */ - Vector._temp = [ - Vector.create(), Vector.create(), - Vector.create(), Vector.create(), - Vector.create(), Vector.create() - ]; - -})(); -},{}],29:[function(_dereq_,module,exports){ -/** -* The `Matter.Vertices` module contains methods for creating and manipulating sets of vertices. -* A set of vertices is an array of `Matter.Vector` with additional indexing properties inserted by `Vertices.create`. -* A `Matter.Body` maintains a set of vertices to represent the shape of the object (its convex hull). -* -* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). -* -* @class Vertices -*/ - -var Vertices = {}; - -module.exports = Vertices; - -var Vector = _dereq_('../geometry/Vector'); -var Common = _dereq_('../core/Common'); - -(function() { - - /** - * Creates a new set of `Matter.Body` compatible vertices. - * The `points` argument accepts an array of `Matter.Vector` points orientated around the origin `(0, 0)`, for example: - * - * [{ x: 0, y: 0 }, { x: 25, y: 50 }, { x: 50, y: 0 }] - * - * The `Vertices.create` method returns a new array of vertices, which are similar to Matter.Vector objects, - * but with some additional references required for efficient collision detection routines. - * - * Vertices must be specified in clockwise order. - * - * Note that the `body` argument is not optional, a `Matter.Body` reference must be provided. - * - * @method create - * @param {vector[]} points - * @param {body} body - */ - Vertices.create = function(points, body) { - var vertices = []; - - for (var i = 0; i < points.length; i++) { - var point = points[i], - vertex = { - x: point.x, - y: point.y, - index: i, - body: body, - isInternal: false - }; - - vertices.push(vertex); - } - - return vertices; - }; - - /** - * Parses a string containing ordered x y pairs separated by spaces (and optionally commas), - * into a `Matter.Vertices` object for the given `Matter.Body`. - * For parsing SVG paths, see `Svg.pathToVertices`. - * @method fromPath - * @param {string} path - * @param {body} body - * @return {vertices} vertices - */ - Vertices.fromPath = function(path, body) { - var pathPattern = /L?\s*([\-\d\.e]+)[\s,]*([\-\d\.e]+)*/ig, - points = []; - - path.replace(pathPattern, function(match, x, y) { - points.push({ x: parseFloat(x), y: parseFloat(y) }); - }); - - return Vertices.create(points, body); - }; - - /** - * Returns the centre (centroid) of the set of vertices. - * @method centre - * @param {vertices} vertices - * @return {vector} The centre point - */ - Vertices.centre = function(vertices) { - var area = Vertices.area(vertices, true), - centre = { x: 0, y: 0 }, - cross, - temp, - j; - - for (var i = 0; i < vertices.length; i++) { - j = (i + 1) % vertices.length; - cross = Vector.cross(vertices[i], vertices[j]); - temp = Vector.mult(Vector.add(vertices[i], vertices[j]), cross); - centre = Vector.add(centre, temp); - } - - return Vector.div(centre, 6 * area); - }; - - /** - * Returns the average (mean) of the set of vertices. - * @method mean - * @param {vertices} vertices - * @return {vector} The average point - */ - Vertices.mean = function(vertices) { - var average = { x: 0, y: 0 }; - - for (var i = 0; i < vertices.length; i++) { - average.x += vertices[i].x; - average.y += vertices[i].y; - } - - return Vector.div(average, vertices.length); - }; - - /** - * Returns the area of the set of vertices. - * @method area - * @param {vertices} vertices - * @param {bool} signed - * @return {number} The area - */ - Vertices.area = function(vertices, signed) { - var area = 0, - j = vertices.length - 1; - - for (var i = 0; i < vertices.length; i++) { - area += (vertices[j].x - vertices[i].x) * (vertices[j].y + vertices[i].y); - j = i; - } - - if (signed) - return area / 2; - - return Math.abs(area) / 2; - }; - - /** - * Returns the moment of inertia (second moment of area) of the set of vertices given the total mass. - * @method inertia - * @param {vertices} vertices - * @param {number} mass - * @return {number} The polygon's moment of inertia - */ - Vertices.inertia = function(vertices, mass) { - var numerator = 0, - denominator = 0, - v = vertices, - cross, - j; - - // find the polygon's moment of inertia, using second moment of area - // from equations at http://www.physicsforums.com/showthread.php?t=25293 - for (var n = 0; n < v.length; n++) { - j = (n + 1) % v.length; - cross = Math.abs(Vector.cross(v[j], v[n])); - numerator += cross * (Vector.dot(v[j], v[j]) + Vector.dot(v[j], v[n]) + Vector.dot(v[n], v[n])); - denominator += cross; - } - - return (mass / 6) * (numerator / denominator); - }; - - /** - * Translates the set of vertices in-place. - * @method translate - * @param {vertices} vertices - * @param {vector} vector - * @param {number} scalar - */ - Vertices.translate = function(vertices, vector, scalar) { - var i; - if (scalar) { - for (i = 0; i < vertices.length; i++) { - vertices[i].x += vector.x * scalar; - vertices[i].y += vector.y * scalar; - } + Pair.setActive = function(pair, isActive, timestamp) { + if (isActive) { + pair.isActive = true; + pair.timeUpdated = timestamp; } else { - for (i = 0; i < vertices.length; i++) { - vertices[i].x += vector.x; - vertices[i].y += vector.y; - } + pair.isActive = false; + pair.activeContacts.length = 0; } - - return vertices; }; /** - * Rotates the set of vertices in-place. - * @method rotate - * @param {vertices} vertices - * @param {number} angle - * @param {vector} point + * Get the id for the given pair. + * @method id + * @param {body} bodyA + * @param {body} bodyB + * @return {string} Unique pairId */ - Vertices.rotate = function(vertices, angle, point) { - if (angle === 0) - return; - - var cos = Math.cos(angle), - sin = Math.sin(angle); - - for (var i = 0; i < vertices.length; i++) { - var vertice = vertices[i], - dx = vertice.x - point.x, - dy = vertice.y - point.y; - - vertice.x = point.x + (dx * cos - dy * sin); - vertice.y = point.y + (dx * sin + dy * cos); - } - - return vertices; - }; - - /** - * Returns `true` if the `point` is inside the set of `vertices`. - * @method contains - * @param {vertices} vertices - * @param {vector} point - * @return {boolean} True if the vertices contains point, otherwise false - */ - Vertices.contains = function(vertices, point) { - for (var i = 0; i < vertices.length; i++) { - var vertice = vertices[i], - nextVertice = vertices[(i + 1) % vertices.length]; - if ((point.x - vertice.x) * (nextVertice.y - vertice.y) + (point.y - vertice.y) * (vertice.x - nextVertice.x) > 0) { - return false; - } - } - - return true; - }; - - /** - * Scales the vertices from a point (default is centre) in-place. - * @method scale - * @param {vertices} vertices - * @param {number} scaleX - * @param {number} scaleY - * @param {vector} point - */ - Vertices.scale = function(vertices, scaleX, scaleY, point) { - if (scaleX === 1 && scaleY === 1) - return vertices; - - point = point || Vertices.centre(vertices); - - var vertex, - delta; - - for (var i = 0; i < vertices.length; i++) { - vertex = vertices[i]; - delta = Vector.sub(vertex, point); - vertices[i].x = point.x + delta.x * scaleX; - vertices[i].y = point.y + delta.y * scaleY; - } - - return vertices; - }; - - /** - * Chamfers a set of vertices by giving them rounded corners, returns a new set of vertices. - * The radius parameter is a single number or an array to specify the radius for each vertex. - * @method chamfer - * @param {vertices} vertices - * @param {number[]} radius - * @param {number} quality - * @param {number} qualityMin - * @param {number} qualityMax - */ - Vertices.chamfer = function(vertices, radius, quality, qualityMin, qualityMax) { - if (typeof radius === 'number') { - radius = [radius]; + Pair.id = function(bodyA, bodyB) { + if (bodyA.id < bodyB.id) { + return 'A' + bodyA.id + 'B' + bodyB.id; } else { - radius = radius || [8]; + return 'A' + bodyB.id + 'B' + bodyA.id; } - - // quality defaults to -1, which is auto - quality = (typeof quality !== 'undefined') ? quality : -1; - qualityMin = qualityMin || 2; - qualityMax = qualityMax || 14; - - var newVertices = []; - - for (var i = 0; i < vertices.length; i++) { - var prevVertex = vertices[i - 1 >= 0 ? i - 1 : vertices.length - 1], - vertex = vertices[i], - nextVertex = vertices[(i + 1) % vertices.length], - currentRadius = radius[i < radius.length ? i : radius.length - 1]; - - if (currentRadius === 0) { - newVertices.push(vertex); - continue; - } - - var prevNormal = Vector.normalise({ - x: vertex.y - prevVertex.y, - y: prevVertex.x - vertex.x - }); - - var nextNormal = Vector.normalise({ - x: nextVertex.y - vertex.y, - y: vertex.x - nextVertex.x - }); - - var diagonalRadius = Math.sqrt(2 * Math.pow(currentRadius, 2)), - radiusVector = Vector.mult(Common.clone(prevNormal), currentRadius), - midNormal = Vector.normalise(Vector.mult(Vector.add(prevNormal, nextNormal), 0.5)), - scaledVertex = Vector.sub(vertex, Vector.mult(midNormal, diagonalRadius)); - - var precision = quality; - - if (quality === -1) { - // automatically decide precision - precision = Math.pow(currentRadius, 0.32) * 1.75; - } - - precision = Common.clamp(precision, qualityMin, qualityMax); - - // use an even value for precision, more likely to reduce axes by using symmetry - if (precision % 2 === 1) - precision += 1; - - var alpha = Math.acos(Vector.dot(prevNormal, nextNormal)), - theta = alpha / precision; - - for (var j = 0; j < precision; j++) { - newVertices.push(Vector.add(Vector.rotate(radiusVector, theta * j), scaledVertex)); - } - } - - return newVertices; - }; - - /** - * Sorts the input vertices into clockwise order in place. - * @method clockwiseSort - * @param {vertices} vertices - * @return {vertices} vertices - */ - Vertices.clockwiseSort = function(vertices) { - var centre = Vertices.mean(vertices); - - vertices.sort(function(vertexA, vertexB) { - return Vector.angle(centre, vertexA) - Vector.angle(centre, vertexB); - }); - - return vertices; - }; - - /** - * Returns true if the vertices form a convex shape (vertices must be in clockwise order). - * @method isConvex - * @param {vertices} vertices - * @return {bool} `true` if the `vertices` are convex, `false` if not (or `null` if not computable). - */ - Vertices.isConvex = function(vertices) { - // http://paulbourke.net/geometry/polygonmesh/ - // Copyright (c) Paul Bourke (use permitted) - - var flag = 0, - n = vertices.length, - i, - j, - k, - z; - - if (n < 3) - return null; - - for (i = 0; i < n; i++) { - j = (i + 1) % n; - k = (i + 2) % n; - z = (vertices[j].x - vertices[i].x) * (vertices[k].y - vertices[j].y); - z -= (vertices[j].y - vertices[i].y) * (vertices[k].x - vertices[j].x); - - if (z < 0) { - flag |= 1; - } else if (z > 0) { - flag |= 2; - } - - if (flag === 3) { - return false; - } - } - - if (flag !== 0){ - return true; - } else { - return null; - } - }; - - /** - * Returns the convex hull of the input vertices as a new array of points. - * @method hull - * @param {vertices} vertices - * @return [vertex] vertices - */ - Vertices.hull = function(vertices) { - // http://geomalgorithms.com/a10-_hull-1.html - - var upper = [], - lower = [], - vertex, - i; - - // sort vertices on x-axis (y-axis for ties) - vertices = vertices.slice(0); - vertices.sort(function(vertexA, vertexB) { - var dx = vertexA.x - vertexB.x; - return dx !== 0 ? dx : vertexA.y - vertexB.y; - }); - - // build lower hull - for (i = 0; i < vertices.length; i += 1) { - vertex = vertices[i]; - - while (lower.length >= 2 - && Vector.cross3(lower[lower.length - 2], lower[lower.length - 1], vertex) <= 0) { - lower.pop(); - } - - lower.push(vertex); - } - - // build upper hull - for (i = vertices.length - 1; i >= 0; i -= 1) { - vertex = vertices[i]; - - while (upper.length >= 2 - && Vector.cross3(upper[upper.length - 2], upper[upper.length - 1], vertex) <= 0) { - upper.pop(); - } - - upper.push(vertex); - } - - // concatenation of the lower and upper hulls gives the convex hull - // omit last points because they are repeated at the beginning of the other list - upper.pop(); - lower.pop(); - - return upper.concat(lower); }; })(); -},{"../core/Common":14,"../geometry/Vector":28}],30:[function(_dereq_,module,exports){ -var Matter = module.exports = _dereq_('../core/Matter'); -Matter.Body = _dereq_('../body/Body'); -Matter.Composite = _dereq_('../body/Composite'); -Matter.World = _dereq_('../body/World'); +/***/ }), +/* 10 */ +/***/ (function(module, exports, __webpack_require__) { -Matter.Contact = _dereq_('../collision/Contact'); -Matter.Detector = _dereq_('../collision/Detector'); -Matter.Grid = _dereq_('../collision/Grid'); -Matter.Pairs = _dereq_('../collision/Pairs'); -Matter.Pair = _dereq_('../collision/Pair'); -Matter.Query = _dereq_('../collision/Query'); -Matter.Resolver = _dereq_('../collision/Resolver'); -Matter.SAT = _dereq_('../collision/SAT'); - -Matter.Constraint = _dereq_('../constraint/Constraint'); -Matter.MouseConstraint = _dereq_('../constraint/MouseConstraint'); - -Matter.Common = _dereq_('../core/Common'); -Matter.Engine = _dereq_('../core/Engine'); -Matter.Events = _dereq_('../core/Events'); -Matter.Mouse = _dereq_('../core/Mouse'); -Matter.Runner = _dereq_('../core/Runner'); -Matter.Sleeping = _dereq_('../core/Sleeping'); -Matter.Plugin = _dereq_('../core/Plugin'); - - -Matter.Bodies = _dereq_('../factory/Bodies'); -Matter.Composites = _dereq_('../factory/Composites'); - -Matter.Axes = _dereq_('../geometry/Axes'); -Matter.Bounds = _dereq_('../geometry/Bounds'); -Matter.Svg = _dereq_('../geometry/Svg'); -Matter.Vector = _dereq_('../geometry/Vector'); -Matter.Vertices = _dereq_('../geometry/Vertices'); - -Matter.Render = _dereq_('../render/Render'); -Matter.RenderPixi = _dereq_('../render/RenderPixi'); - -// aliases - -Matter.World.add = Matter.Composite.add; -Matter.World.remove = Matter.Composite.remove; -Matter.World.addComposite = Matter.Composite.addComposite; -Matter.World.addBody = Matter.Composite.addBody; -Matter.World.addConstraint = Matter.Composite.addConstraint; -Matter.World.clear = Matter.Composite.clear; -Matter.Engine.run = Matter.Runner.run; - -},{"../body/Body":1,"../body/Composite":2,"../body/World":3,"../collision/Contact":4,"../collision/Detector":5,"../collision/Grid":6,"../collision/Pair":7,"../collision/Pairs":8,"../collision/Query":9,"../collision/Resolver":10,"../collision/SAT":11,"../constraint/Constraint":12,"../constraint/MouseConstraint":13,"../core/Common":14,"../core/Engine":15,"../core/Events":16,"../core/Matter":17,"../core/Metrics":18,"../core/Mouse":19,"../core/Plugin":20,"../core/Runner":21,"../core/Sleeping":22,"../factory/Bodies":23,"../factory/Composites":24,"../geometry/Axes":25,"../geometry/Bounds":26,"../geometry/Svg":27,"../geometry/Vector":28,"../geometry/Vertices":29,"../render/Render":31,"../render/RenderPixi":32}],31:[function(_dereq_,module,exports){ /** * The `Matter.Render` module is a simple HTML5 canvas based renderer for visualising instances of `Matter.Engine`. * It is intended for development and debugging purposes, but may also be suitable for simple games. @@ -8366,13 +4307,13 @@ var Render = {}; module.exports = Render; -var Common = _dereq_('../core/Common'); -var Composite = _dereq_('../body/Composite'); -var Bounds = _dereq_('../geometry/Bounds'); -var Events = _dereq_('../core/Events'); -var Grid = _dereq_('../collision/Grid'); -var Vector = _dereq_('../geometry/Vector'); -var Mouse = _dereq_('../core/Mouse'); +var Common = __webpack_require__(0); +var Composite = __webpack_require__(5); +var Bounds = __webpack_require__(1); +var Events = __webpack_require__(4); +var Grid = __webpack_require__(11); +var Vector = __webpack_require__(2); +var Mouse = __webpack_require__(14); (function() { @@ -8408,8 +4349,8 @@ var Mouse = _dereq_('../core/Mouse'); width: 800, height: 600, pixelRatio: 1, - background: '#18181d', - wireframeBackground: '#0f0f13', + background: '#14151f', + wireframeBackground: '#14151f', hasBounds: !!options.bounds, enabled: true, wireframes: true, @@ -8511,7 +4452,6 @@ var Mouse = _dereq_('../core/Mouse'); canvas.height = options.height * pixelRatio; canvas.style.width = options.width + 'px'; canvas.style.height = options.height + 'px'; - render.context.scale(pixelRatio, pixelRatio); }; /** @@ -8623,7 +4563,11 @@ var Mouse = _dereq_('../core/Mouse'); boundsScaleX = boundsWidth / render.options.width, boundsScaleY = boundsHeight / render.options.height; - render.context.scale(1 / boundsScaleX, 1 / boundsScaleY); + render.context.setTransform( + render.options.pixelRatio / boundsScaleX, 0, 0, + render.options.pixelRatio / boundsScaleY, 0, 0 + ); + render.context.translate(-render.bounds.min.x, -render.bounds.min.y); }; @@ -8704,8 +4648,8 @@ var Mouse = _dereq_('../core/Mouse'); // update mouse if (render.mouse) { Mouse.setScale(render.mouse, { - x: (render.bounds.max.x - render.bounds.min.x) / render.canvas.width, - y: (render.bounds.max.y - render.bounds.min.y) / render.canvas.height + x: (render.bounds.max.x - render.bounds.min.x) / render.options.width, + y: (render.bounds.max.y - render.bounds.min.y) / render.options.height }); Mouse.setOffset(render.mouse, render.bounds.min); @@ -8713,6 +4657,10 @@ var Mouse = _dereq_('../core/Mouse'); } else { constraints = allConstraints; bodies = allBodies; + + if (render.options.pixelRatio !== 1) { + render.context.setTransform(render.options.pixelRatio, 0, 0, render.options.pixelRatio, 0, 0); + } } if (!options.wireframes || (engine.enableSleeping && options.showSleeping)) { @@ -8792,6 +4740,27 @@ var Mouse = _dereq_('../core/Mouse'); text += "fps: " + Math.round(metrics.timing.fps) + space; } + // @if DEBUG + if (metrics.extended) { + if (metrics.timing) { + text += "delta: " + metrics.timing.delta.toFixed(3) + space; + text += "correction: " + metrics.timing.correction.toFixed(3) + space; + } + + text += "bodies: " + bodies.length + space; + + if (engine.broadphase.controller === Grid) + text += "buckets: " + metrics.buckets + space; + + text += "\n"; + + text += "collisions: " + metrics.collisions + space; + text += "pairs: " + engine.pairs.list.length + space; + text += "broad: " + metrics.broadEff + space; + text += "mid: " + metrics.midEff + space; + text += "narrow: " + metrics.narrowEff + space; + } + // @endif render.debugString = text; render.debugTimestamp = engine.timing.timestamp; @@ -9255,7 +5224,7 @@ var Mouse = _dereq_('../core/Mouse'); // render a single axis indicator c.moveTo(part.position.x, part.position.y); c.lineTo((part.vertices[0].x + part.vertices[part.vertices.length-1].x) / 2, - (part.vertices[0].y + part.vertices[part.vertices.length-1].y) / 2); + (part.vertices[0].y + part.vertices[part.vertices.length-1].y) / 2); } } } @@ -9555,9 +5524,9 @@ var Mouse = _dereq_('../core/Mouse'); var region = bucketId.split(/C|R/); c.rect(0.5 + parseInt(region[1], 10) * grid.bucketWidth, - 0.5 + parseInt(region[2], 10) * grid.bucketHeight, - grid.bucketWidth, - grid.bucketHeight); + 0.5 + parseInt(region[2], 10) * grid.bucketHeight, + grid.bucketWidth, + grid.bucketHeight); } c.lineWidth = 1; @@ -9604,7 +5573,7 @@ var Mouse = _dereq_('../core/Mouse'); bounds = item.bounds; context.beginPath(); context.rect(Math.floor(bounds.min.x - 3), Math.floor(bounds.min.y - 3), - Math.floor(bounds.max.x - bounds.min.x + 6), Math.floor(bounds.max.y - bounds.min.y + 6)); + Math.floor(bounds.max.x - bounds.min.x + 6), Math.floor(bounds.max.y - bounds.min.y + 6)); context.closePath(); context.stroke(); @@ -9638,7 +5607,7 @@ var Mouse = _dereq_('../core/Mouse'); bounds = inspector.selectBounds; context.beginPath(); context.rect(Math.floor(bounds.min.x), Math.floor(bounds.min.y), - Math.floor(bounds.max.x - bounds.min.x), Math.floor(bounds.max.y - bounds.min.y)); + Math.floor(bounds.max.x - bounds.min.x), Math.floor(bounds.max.y - bounds.min.y)); context.closePath(); context.stroke(); context.fill(); @@ -9840,7 +5809,4482 @@ var Mouse = _dereq_('../core/Mouse'); })(); -},{"../body/Composite":2,"../collision/Grid":6,"../core/Common":14,"../core/Events":16,"../core/Mouse":19,"../geometry/Bounds":26,"../geometry/Vector":28}],32:[function(_dereq_,module,exports){ + +/***/ }), +/* 11 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Grid` module contains methods for creating and manipulating collision broadphase grid structures. +* +* @class Grid +*/ + +var Grid = {}; + +module.exports = Grid; + +var Pair = __webpack_require__(9); +var Detector = __webpack_require__(12); +var Common = __webpack_require__(0); + +(function() { + + /** + * Creates a new grid. + * @method create + * @param {} options + * @return {grid} A new grid + */ + Grid.create = function(options) { + var defaults = { + controller: Grid, + detector: Detector.collisions, + buckets: {}, + pairs: {}, + pairsList: [], + bucketWidth: 48, + bucketHeight: 48 + }; + + return Common.extend(defaults, options); + }; + + /** + * The width of a single grid bucket. + * + * @property bucketWidth + * @type number + * @default 48 + */ + + /** + * The height of a single grid bucket. + * + * @property bucketHeight + * @type number + * @default 48 + */ + + /** + * Updates the grid. + * @method update + * @param {grid} grid + * @param {body[]} bodies + * @param {engine} engine + * @param {boolean} forceUpdate + */ + Grid.update = function(grid, bodies, engine, forceUpdate) { + var i, col, row, + world = engine.world, + buckets = grid.buckets, + bucket, + bucketId, + gridChanged = false; + + // @if DEBUG + var metrics = engine.metrics; + metrics.broadphaseTests = 0; + // @endif + + for (i = 0; i < bodies.length; i++) { + var body = bodies[i]; + + if (body.isSleeping && !forceUpdate) + continue; + + // don't update out of world bodies + if (body.bounds.max.x < world.bounds.min.x || body.bounds.min.x > world.bounds.max.x + || body.bounds.max.y < world.bounds.min.y || body.bounds.min.y > world.bounds.max.y) + continue; + + var newRegion = Grid._getRegion(grid, body); + + // if the body has changed grid region + if (!body.region || newRegion.id !== body.region.id || forceUpdate) { + + // @if DEBUG + metrics.broadphaseTests += 1; + // @endif + + if (!body.region || forceUpdate) + body.region = newRegion; + + var union = Grid._regionUnion(newRegion, body.region); + + // update grid buckets affected by region change + // iterate over the union of both regions + for (col = union.startCol; col <= union.endCol; col++) { + for (row = union.startRow; row <= union.endRow; row++) { + bucketId = Grid._getBucketId(col, row); + bucket = buckets[bucketId]; + + var isInsideNewRegion = (col >= newRegion.startCol && col <= newRegion.endCol + && row >= newRegion.startRow && row <= newRegion.endRow); + + var isInsideOldRegion = (col >= body.region.startCol && col <= body.region.endCol + && row >= body.region.startRow && row <= body.region.endRow); + + // remove from old region buckets + if (!isInsideNewRegion && isInsideOldRegion) { + if (isInsideOldRegion) { + if (bucket) + Grid._bucketRemoveBody(grid, bucket, body); + } + } + + // add to new region buckets + if (body.region === newRegion || (isInsideNewRegion && !isInsideOldRegion) || forceUpdate) { + if (!bucket) + bucket = Grid._createBucket(buckets, bucketId); + Grid._bucketAddBody(grid, bucket, body); + } + } + } + + // set the new region + body.region = newRegion; + + // flag changes so we can update pairs + gridChanged = true; + } + } + + // update pairs list only if pairs changed (i.e. a body changed region) + if (gridChanged) + grid.pairsList = Grid._createActivePairsList(grid); + }; + + /** + * Clears the grid. + * @method clear + * @param {grid} grid + */ + Grid.clear = function(grid) { + grid.buckets = {}; + grid.pairs = {}; + grid.pairsList = []; + }; + + /** + * Finds the union of two regions. + * @method _regionUnion + * @private + * @param {} regionA + * @param {} regionB + * @return {} region + */ + Grid._regionUnion = function(regionA, regionB) { + var startCol = Math.min(regionA.startCol, regionB.startCol), + endCol = Math.max(regionA.endCol, regionB.endCol), + startRow = Math.min(regionA.startRow, regionB.startRow), + endRow = Math.max(regionA.endRow, regionB.endRow); + + return Grid._createRegion(startCol, endCol, startRow, endRow); + }; + + /** + * Gets the region a given body falls in for a given grid. + * @method _getRegion + * @private + * @param {} grid + * @param {} body + * @return {} region + */ + Grid._getRegion = function(grid, body) { + var bounds = body.bounds, + startCol = Math.floor(bounds.min.x / grid.bucketWidth), + endCol = Math.floor(bounds.max.x / grid.bucketWidth), + startRow = Math.floor(bounds.min.y / grid.bucketHeight), + endRow = Math.floor(bounds.max.y / grid.bucketHeight); + + return Grid._createRegion(startCol, endCol, startRow, endRow); + }; + + /** + * Creates a region. + * @method _createRegion + * @private + * @param {} startCol + * @param {} endCol + * @param {} startRow + * @param {} endRow + * @return {} region + */ + Grid._createRegion = function(startCol, endCol, startRow, endRow) { + return { + id: startCol + ',' + endCol + ',' + startRow + ',' + endRow, + startCol: startCol, + endCol: endCol, + startRow: startRow, + endRow: endRow + }; + }; + + /** + * Gets the bucket id at the given position. + * @method _getBucketId + * @private + * @param {} column + * @param {} row + * @return {string} bucket id + */ + Grid._getBucketId = function(column, row) { + return 'C' + column + 'R' + row; + }; + + /** + * Creates a bucket. + * @method _createBucket + * @private + * @param {} buckets + * @param {} bucketId + * @return {} bucket + */ + Grid._createBucket = function(buckets, bucketId) { + var bucket = buckets[bucketId] = []; + return bucket; + }; + + /** + * Adds a body to a bucket. + * @method _bucketAddBody + * @private + * @param {} grid + * @param {} bucket + * @param {} body + */ + Grid._bucketAddBody = function(grid, bucket, body) { + // add new pairs + for (var i = 0; i < bucket.length; i++) { + var bodyB = bucket[i]; + + if (body.id === bodyB.id || (body.isStatic && bodyB.isStatic)) + continue; + + // keep track of the number of buckets the pair exists in + // important for Grid.update to work + var pairId = Pair.id(body, bodyB), + pair = grid.pairs[pairId]; + + if (pair) { + pair[2] += 1; + } else { + grid.pairs[pairId] = [body, bodyB, 1]; + } + } + + // add to bodies (after pairs, otherwise pairs with self) + bucket.push(body); + }; + + /** + * Removes a body from a bucket. + * @method _bucketRemoveBody + * @private + * @param {} grid + * @param {} bucket + * @param {} body + */ + Grid._bucketRemoveBody = function(grid, bucket, body) { + // remove from bucket + bucket.splice(Common.indexOf(bucket, body), 1); + + // update pair counts + for (var i = 0; i < bucket.length; i++) { + // keep track of the number of buckets the pair exists in + // important for _createActivePairsList to work + var bodyB = bucket[i], + pairId = Pair.id(body, bodyB), + pair = grid.pairs[pairId]; + + if (pair) + pair[2] -= 1; + } + }; + + /** + * Generates a list of the active pairs in the grid. + * @method _createActivePairsList + * @private + * @param {} grid + * @return [] pairs + */ + Grid._createActivePairsList = function(grid) { + var pairKeys, + pair, + pairs = []; + + // grid.pairs is used as a hashmap + pairKeys = Common.keys(grid.pairs); + + // iterate over grid.pairs + for (var k = 0; k < pairKeys.length; k++) { + pair = grid.pairs[pairKeys[k]]; + + // if pair exists in at least one bucket + // it is a pair that needs further collision testing so push it + if (pair[2] > 0) { + pairs.push(pair); + } else { + delete grid.pairs[pairKeys[k]]; + } + } + + return pairs; + }; + +})(); + + +/***/ }), +/* 12 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Detector` module contains methods for detecting collisions given a set of pairs. +* +* @class Detector +*/ + +// TODO: speculative contacts + +var Detector = {}; + +module.exports = Detector; + +var SAT = __webpack_require__(13); +var Pair = __webpack_require__(9); +var Bounds = __webpack_require__(1); + +(function() { + + /** + * Finds all collisions given a list of pairs. + * @method collisions + * @param {pair[]} broadphasePairs + * @param {engine} engine + * @return {array} collisions + */ + Detector.collisions = function(broadphasePairs, engine) { + var collisions = [], + pairsTable = engine.pairs.table; + + // @if DEBUG + var metrics = engine.metrics; + // @endif + + for (var i = 0; i < broadphasePairs.length; i++) { + var bodyA = broadphasePairs[i][0], + bodyB = broadphasePairs[i][1]; + + if ((bodyA.isStatic || bodyA.isSleeping) && (bodyB.isStatic || bodyB.isSleeping)) + continue; + + if (!Detector.canCollide(bodyA.collisionFilter, bodyB.collisionFilter)) + continue; + + // @if DEBUG + metrics.midphaseTests += 1; + // @endif + + // mid phase + if (Bounds.overlaps(bodyA.bounds, bodyB.bounds)) { + for (var j = bodyA.parts.length > 1 ? 1 : 0; j < bodyA.parts.length; j++) { + var partA = bodyA.parts[j]; + + for (var k = bodyB.parts.length > 1 ? 1 : 0; k < bodyB.parts.length; k++) { + var partB = bodyB.parts[k]; + + if ((partA === bodyA && partB === bodyB) || Bounds.overlaps(partA.bounds, partB.bounds)) { + // find a previous collision we could reuse + var pairId = Pair.id(partA, partB), + pair = pairsTable[pairId], + previousCollision; + + if (pair && pair.isActive) { + previousCollision = pair.collision; + } else { + previousCollision = null; + } + + // narrow phase + var collision = SAT.collides(partA, partB, previousCollision); + + // @if DEBUG + metrics.narrowphaseTests += 1; + if (collision.reused) + metrics.narrowReuseCount += 1; + // @endif + + if (collision.collided) { + collisions.push(collision); + // @if DEBUG + metrics.narrowDetections += 1; + // @endif + } + } + } + } + } + } + + return collisions; + }; + + /** + * Returns `true` if both supplied collision filters will allow a collision to occur. + * See `body.collisionFilter` for more information. + * @method canCollide + * @param {} filterA + * @param {} filterB + * @return {bool} `true` if collision can occur + */ + Detector.canCollide = function(filterA, filterB) { + if (filterA.group === filterB.group && filterA.group !== 0) + return filterA.group > 0; + + return (filterA.mask & filterB.category) !== 0 && (filterB.mask & filterA.category) !== 0; + }; + +})(); + + +/***/ }), +/* 13 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.SAT` module contains methods for detecting collisions using the Separating Axis Theorem. +* +* @class SAT +*/ + +// TODO: true circles and curves + +var SAT = {}; + +module.exports = SAT; + +var Vertices = __webpack_require__(3); +var Vector = __webpack_require__(2); + +(function() { + + /** + * Detect collision between two bodies using the Separating Axis Theorem. + * @method collides + * @param {body} bodyA + * @param {body} bodyB + * @param {collision} previousCollision + * @return {collision} collision + */ + SAT.collides = function(bodyA, bodyB, previousCollision) { + var overlapAB, + overlapBA, + minOverlap, + collision, + canReusePrevCol = false; + + if (previousCollision) { + // estimate total motion + var parentA = bodyA.parent, + parentB = bodyB.parent, + motion = parentA.speed * parentA.speed + parentA.angularSpeed * parentA.angularSpeed + + parentB.speed * parentB.speed + parentB.angularSpeed * parentB.angularSpeed; + + // we may be able to (partially) reuse collision result + // but only safe if collision was resting + canReusePrevCol = previousCollision && previousCollision.collided && motion < 0.2; + + // reuse collision object + collision = previousCollision; + } else { + collision = { collided: false, bodyA: bodyA, bodyB: bodyB }; + } + + if (previousCollision && canReusePrevCol) { + // if we can reuse the collision result + // we only need to test the previously found axis + var axisBodyA = collision.axisBody, + axisBodyB = axisBodyA === bodyA ? bodyB : bodyA, + axes = [axisBodyA.axes[previousCollision.axisNumber]]; + + minOverlap = SAT._overlapAxes(axisBodyA.vertices, axisBodyB.vertices, axes); + collision.reused = true; + + if (minOverlap.overlap <= 0) { + collision.collided = false; + return collision; + } + } else { + // if we can't reuse a result, perform a full SAT test + + overlapAB = SAT._overlapAxes(bodyA.vertices, bodyB.vertices, bodyA.axes); + + if (overlapAB.overlap <= 0) { + collision.collided = false; + return collision; + } + + overlapBA = SAT._overlapAxes(bodyB.vertices, bodyA.vertices, bodyB.axes); + + if (overlapBA.overlap <= 0) { + collision.collided = false; + return collision; + } + + if (overlapAB.overlap < overlapBA.overlap) { + minOverlap = overlapAB; + collision.axisBody = bodyA; + } else { + minOverlap = overlapBA; + collision.axisBody = bodyB; + } + + // important for reuse later + collision.axisNumber = minOverlap.axisNumber; + } + + collision.bodyA = bodyA.id < bodyB.id ? bodyA : bodyB; + collision.bodyB = bodyA.id < bodyB.id ? bodyB : bodyA; + collision.collided = true; + collision.depth = minOverlap.overlap; + collision.parentA = collision.bodyA.parent; + collision.parentB = collision.bodyB.parent; + + bodyA = collision.bodyA; + bodyB = collision.bodyB; + + // ensure normal is facing away from bodyA + if (Vector.dot(minOverlap.axis, Vector.sub(bodyB.position, bodyA.position)) < 0) { + collision.normal = { + x: minOverlap.axis.x, + y: minOverlap.axis.y + }; + } else { + collision.normal = { + x: -minOverlap.axis.x, + y: -minOverlap.axis.y + }; + } + + collision.tangent = Vector.perp(collision.normal); + + collision.penetration = collision.penetration || {}; + collision.penetration.x = collision.normal.x * collision.depth; + collision.penetration.y = collision.normal.y * collision.depth; + + // find support points, there is always either exactly one or two + var verticesB = SAT._findSupports(bodyA, bodyB, collision.normal), + supports = []; + + // find the supports from bodyB that are inside bodyA + if (Vertices.contains(bodyA.vertices, verticesB[0])) + supports.push(verticesB[0]); + + if (Vertices.contains(bodyA.vertices, verticesB[1])) + supports.push(verticesB[1]); + + // find the supports from bodyA that are inside bodyB + if (supports.length < 2) { + var verticesA = SAT._findSupports(bodyB, bodyA, Vector.neg(collision.normal)); + + if (Vertices.contains(bodyB.vertices, verticesA[0])) + supports.push(verticesA[0]); + + if (supports.length < 2 && Vertices.contains(bodyB.vertices, verticesA[1])) + supports.push(verticesA[1]); + } + + // account for the edge case of overlapping but no vertex containment + if (supports.length < 1) + supports = [verticesB[0]]; + + collision.supports = supports; + + return collision; + }; + + /** + * Find the overlap between two sets of vertices. + * @method _overlapAxes + * @private + * @param {} verticesA + * @param {} verticesB + * @param {} axes + * @return result + */ + SAT._overlapAxes = function(verticesA, verticesB, axes) { + var projectionA = Vector._temp[0], + projectionB = Vector._temp[1], + result = { overlap: Number.MAX_VALUE }, + overlap, + axis; + + for (var i = 0; i < axes.length; i++) { + axis = axes[i]; + + SAT._projectToAxis(projectionA, verticesA, axis); + SAT._projectToAxis(projectionB, verticesB, axis); + + overlap = Math.min(projectionA.max - projectionB.min, projectionB.max - projectionA.min); + + if (overlap <= 0) { + result.overlap = overlap; + return result; + } + + if (overlap < result.overlap) { + result.overlap = overlap; + result.axis = axis; + result.axisNumber = i; + } + } + + return result; + }; + + /** + * Projects vertices on an axis and returns an interval. + * @method _projectToAxis + * @private + * @param {} projection + * @param {} vertices + * @param {} axis + */ + SAT._projectToAxis = function(projection, vertices, axis) { + var min = Vector.dot(vertices[0], axis), + max = min; + + for (var i = 1; i < vertices.length; i += 1) { + var dot = Vector.dot(vertices[i], axis); + + if (dot > max) { + max = dot; + } else if (dot < min) { + min = dot; + } + } + + projection.min = min; + projection.max = max; + }; + + /** + * Finds supporting vertices given two bodies along a given direction using hill-climbing. + * @method _findSupports + * @private + * @param {} bodyA + * @param {} bodyB + * @param {} normal + * @return [vector] + */ + SAT._findSupports = function(bodyA, bodyB, normal) { + var nearestDistance = Number.MAX_VALUE, + vertexToBody = Vector._temp[0], + vertices = bodyB.vertices, + bodyAPosition = bodyA.position, + distance, + vertex, + vertexA, + vertexB; + + // find closest vertex on bodyB + for (var i = 0; i < vertices.length; i++) { + vertex = vertices[i]; + vertexToBody.x = vertex.x - bodyAPosition.x; + vertexToBody.y = vertex.y - bodyAPosition.y; + distance = -Vector.dot(normal, vertexToBody); + + if (distance < nearestDistance) { + nearestDistance = distance; + vertexA = vertex; + } + } + + // find next closest vertex using the two connected to it + var prevIndex = vertexA.index - 1 >= 0 ? vertexA.index - 1 : vertices.length - 1; + vertex = vertices[prevIndex]; + vertexToBody.x = vertex.x - bodyAPosition.x; + vertexToBody.y = vertex.y - bodyAPosition.y; + nearestDistance = -Vector.dot(normal, vertexToBody); + vertexB = vertex; + + var nextIndex = (vertexA.index + 1) % vertices.length; + vertex = vertices[nextIndex]; + vertexToBody.x = vertex.x - bodyAPosition.x; + vertexToBody.y = vertex.y - bodyAPosition.y; + distance = -Vector.dot(normal, vertexToBody); + if (distance < nearestDistance) { + vertexB = vertex; + } + + return [vertexA, vertexB]; + }; + +})(); + + +/***/ }), +/* 14 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Mouse` module contains methods for creating and manipulating mouse inputs. +* +* @class Mouse +*/ + +var Mouse = {}; + +module.exports = Mouse; + +var Common = __webpack_require__(0); + +(function() { + + /** + * Creates a mouse input. + * @method create + * @param {HTMLElement} element + * @return {mouse} A new mouse + */ + Mouse.create = function(element) { + var mouse = {}; + + if (!element) { + Common.log('Mouse.create: element was undefined, defaulting to document.body', 'warn'); + } + + mouse.element = element || document.body; + mouse.absolute = { x: 0, y: 0 }; + mouse.position = { x: 0, y: 0 }; + mouse.mousedownPosition = { x: 0, y: 0 }; + mouse.mouseupPosition = { x: 0, y: 0 }; + mouse.offset = { x: 0, y: 0 }; + mouse.scale = { x: 1, y: 1 }; + mouse.wheelDelta = 0; + mouse.button = -1; + mouse.pixelRatio = parseInt(mouse.element.getAttribute('data-pixel-ratio'), 10) || 1; + + mouse.sourceEvents = { + mousemove: null, + mousedown: null, + mouseup: null, + mousewheel: null + }; + + mouse.mousemove = function(event) { + var position = Mouse._getRelativeMousePosition(event, mouse.element, mouse.pixelRatio), + touches = event.changedTouches; + + if (touches) { + mouse.button = 0; + event.preventDefault(); + } + + mouse.absolute.x = position.x; + mouse.absolute.y = position.y; + mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; + mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; + mouse.sourceEvents.mousemove = event; + }; + + mouse.mousedown = function(event) { + var position = Mouse._getRelativeMousePosition(event, mouse.element, mouse.pixelRatio), + touches = event.changedTouches; + + if (touches) { + mouse.button = 0; + event.preventDefault(); + } else { + mouse.button = event.button; + } + + mouse.absolute.x = position.x; + mouse.absolute.y = position.y; + mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; + mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; + mouse.mousedownPosition.x = mouse.position.x; + mouse.mousedownPosition.y = mouse.position.y; + mouse.sourceEvents.mousedown = event; + }; + + mouse.mouseup = function(event) { + var position = Mouse._getRelativeMousePosition(event, mouse.element, mouse.pixelRatio), + touches = event.changedTouches; + + if (touches) { + event.preventDefault(); + } + + mouse.button = -1; + mouse.absolute.x = position.x; + mouse.absolute.y = position.y; + mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; + mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; + mouse.mouseupPosition.x = mouse.position.x; + mouse.mouseupPosition.y = mouse.position.y; + mouse.sourceEvents.mouseup = event; + }; + + mouse.mousewheel = function(event) { + mouse.wheelDelta = Math.max(-1, Math.min(1, event.wheelDelta || -event.detail)); + event.preventDefault(); + }; + + Mouse.setElement(mouse, mouse.element); + + return mouse; + }; + + /** + * Sets the element the mouse is bound to (and relative to). + * @method setElement + * @param {mouse} mouse + * @param {HTMLElement} element + */ + Mouse.setElement = function(mouse, element) { + mouse.element = element; + + element.addEventListener('mousemove', mouse.mousemove); + element.addEventListener('mousedown', mouse.mousedown); + element.addEventListener('mouseup', mouse.mouseup); + + element.addEventListener('mousewheel', mouse.mousewheel); + element.addEventListener('DOMMouseScroll', mouse.mousewheel); + + element.addEventListener('touchmove', mouse.mousemove); + element.addEventListener('touchstart', mouse.mousedown); + element.addEventListener('touchend', mouse.mouseup); + }; + + /** + * Clears all captured source events. + * @method clearSourceEvents + * @param {mouse} mouse + */ + Mouse.clearSourceEvents = function(mouse) { + mouse.sourceEvents.mousemove = null; + mouse.sourceEvents.mousedown = null; + mouse.sourceEvents.mouseup = null; + mouse.sourceEvents.mousewheel = null; + mouse.wheelDelta = 0; + }; + + /** + * Sets the mouse position offset. + * @method setOffset + * @param {mouse} mouse + * @param {vector} offset + */ + Mouse.setOffset = function(mouse, offset) { + mouse.offset.x = offset.x; + mouse.offset.y = offset.y; + mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; + mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; + }; + + /** + * Sets the mouse position scale. + * @method setScale + * @param {mouse} mouse + * @param {vector} scale + */ + Mouse.setScale = function(mouse, scale) { + mouse.scale.x = scale.x; + mouse.scale.y = scale.y; + mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; + mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; + }; + + /** + * Gets the mouse position relative to an element given a screen pixel ratio. + * @method _getRelativeMousePosition + * @private + * @param {} event + * @param {} element + * @param {number} pixelRatio + * @return {} + */ + Mouse._getRelativeMousePosition = function(event, element, pixelRatio) { + var elementBounds = element.getBoundingClientRect(), + rootNode = (document.documentElement || document.body.parentNode || document.body), + scrollX = (window.pageXOffset !== undefined) ? window.pageXOffset : rootNode.scrollLeft, + scrollY = (window.pageYOffset !== undefined) ? window.pageYOffset : rootNode.scrollTop, + touches = event.changedTouches, + x, y; + + if (touches) { + x = touches[0].pageX - elementBounds.left - scrollX; + y = touches[0].pageY - elementBounds.top - scrollY; + } else { + x = event.pageX - elementBounds.left - scrollX; + y = event.pageY - elementBounds.top - scrollY; + } + + return { + x: x / (element.clientWidth / (element.width || element.clientWidth) * pixelRatio), + y: y / (element.clientHeight / (element.height || element.clientHeight) * pixelRatio) + }; + }; + +})(); + + +/***/ }), +/* 15 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Axes` module contains methods for creating and manipulating sets of axes. +* +* @class Axes +*/ + +var Axes = {}; + +module.exports = Axes; + +var Vector = __webpack_require__(2); +var Common = __webpack_require__(0); + +(function() { + + /** + * Creates a new set of axes from the given vertices. + * @method fromVertices + * @param {vertices} vertices + * @return {axes} A new axes from the given vertices + */ + Axes.fromVertices = function(vertices) { + var axes = {}; + + // find the unique axes, using edge normal gradients + for (var i = 0; i < vertices.length; i++) { + var j = (i + 1) % vertices.length, + normal = Vector.normalise({ + x: vertices[j].y - vertices[i].y, + y: vertices[i].x - vertices[j].x + }), + gradient = (normal.y === 0) ? Infinity : (normal.x / normal.y); + + // limit precision + gradient = gradient.toFixed(3).toString(); + axes[gradient] = normal; + } + + return Common.values(axes); + }; + + /** + * Rotates a set of axes by the given angle. + * @method rotate + * @param {axes} axes + * @param {number} angle + */ + Axes.rotate = function(axes, angle) { + if (angle === 0) + return; + + var cos = Math.cos(angle), + sin = Math.sin(angle); + + for (var i = 0; i < axes.length; i++) { + var axis = axes[i], + xx; + xx = axis.x * cos - axis.y * sin; + axis.y = axis.x * sin + axis.y * cos; + axis.x = xx; + } + }; + +})(); + + +/***/ }), +/* 16 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Bodies` module contains factory methods for creating rigid body models +* with commonly used body configurations (such as rectangles, circles and other polygons). +* +* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). +* +* @class Bodies +*/ + +// TODO: true circle bodies + +var Bodies = {}; + +module.exports = Bodies; + +var Vertices = __webpack_require__(3); +var Common = __webpack_require__(0); +var Body = __webpack_require__(6); +var Bounds = __webpack_require__(1); +var Vector = __webpack_require__(2); + +(function() { + + /** + * Creates a new rigid body model with a rectangle hull. + * The options parameter is an object that specifies any properties you wish to override the defaults. + * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. + * @method rectangle + * @param {number} x + * @param {number} y + * @param {number} width + * @param {number} height + * @param {object} [options] + * @return {body} A new rectangle body + */ + Bodies.rectangle = function(x, y, width, height, options) { + options = options || {}; + + var rectangle = { + label: 'Rectangle Body', + position: { x: x, y: y }, + vertices: Vertices.fromPath('L 0 0 L ' + width + ' 0 L ' + width + ' ' + height + ' L 0 ' + height) + }; + + if (options.chamfer) { + var chamfer = options.chamfer; + rectangle.vertices = Vertices.chamfer(rectangle.vertices, chamfer.radius, + chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); + delete options.chamfer; + } + + return Body.create(Common.extend({}, rectangle, options)); + }; + + /** + * Creates a new rigid body model with a trapezoid hull. + * The options parameter is an object that specifies any properties you wish to override the defaults. + * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. + * @method trapezoid + * @param {number} x + * @param {number} y + * @param {number} width + * @param {number} height + * @param {number} slope + * @param {object} [options] + * @return {body} A new trapezoid body + */ + Bodies.trapezoid = function(x, y, width, height, slope, options) { + options = options || {}; + + slope *= 0.5; + var roof = (1 - (slope * 2)) * width; + + var x1 = width * slope, + x2 = x1 + roof, + x3 = x2 + x1, + verticesPath; + + if (slope < 0.5) { + verticesPath = 'L 0 0 L ' + x1 + ' ' + (-height) + ' L ' + x2 + ' ' + (-height) + ' L ' + x3 + ' 0'; + } else { + verticesPath = 'L 0 0 L ' + x2 + ' ' + (-height) + ' L ' + x3 + ' 0'; + } + + var trapezoid = { + label: 'Trapezoid Body', + position: { x: x, y: y }, + vertices: Vertices.fromPath(verticesPath) + }; + + if (options.chamfer) { + var chamfer = options.chamfer; + trapezoid.vertices = Vertices.chamfer(trapezoid.vertices, chamfer.radius, + chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); + delete options.chamfer; + } + + return Body.create(Common.extend({}, trapezoid, options)); + }; + + /** + * Creates a new rigid body model with a circle hull. + * The options parameter is an object that specifies any properties you wish to override the defaults. + * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. + * @method circle + * @param {number} x + * @param {number} y + * @param {number} radius + * @param {object} [options] + * @param {number} [maxSides] + * @return {body} A new circle body + */ + Bodies.circle = function(x, y, radius, options, maxSides) { + options = options || {}; + + var circle = { + label: 'Circle Body', + circleRadius: radius + }; + + // approximate circles with polygons until true circles implemented in SAT + maxSides = maxSides || 25; + var sides = Math.ceil(Math.max(10, Math.min(maxSides, radius))); + + // optimisation: always use even number of sides (half the number of unique axes) + if (sides % 2 === 1) + sides += 1; + + return Bodies.polygon(x, y, sides, radius, Common.extend({}, circle, options)); + }; + + /** + * Creates a new rigid body model with a regular polygon hull with the given number of sides. + * The options parameter is an object that specifies any properties you wish to override the defaults. + * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. + * @method polygon + * @param {number} x + * @param {number} y + * @param {number} sides + * @param {number} radius + * @param {object} [options] + * @return {body} A new regular polygon body + */ + Bodies.polygon = function(x, y, sides, radius, options) { + options = options || {}; + + if (sides < 3) + return Bodies.circle(x, y, radius, options); + + var theta = 2 * Math.PI / sides, + path = '', + offset = theta * 0.5; + + for (var i = 0; i < sides; i += 1) { + var angle = offset + (i * theta), + xx = Math.cos(angle) * radius, + yy = Math.sin(angle) * radius; + + path += 'L ' + xx.toFixed(3) + ' ' + yy.toFixed(3) + ' '; + } + + var polygon = { + label: 'Polygon Body', + position: { x: x, y: y }, + vertices: Vertices.fromPath(path) + }; + + if (options.chamfer) { + var chamfer = options.chamfer; + polygon.vertices = Vertices.chamfer(polygon.vertices, chamfer.radius, + chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); + delete options.chamfer; + } + + return Body.create(Common.extend({}, polygon, options)); + }; + + /** + * Creates a body using the supplied vertices (or an array containing multiple sets of vertices). + * If the vertices are convex, they will pass through as supplied. + * Otherwise if the vertices are concave, they will be decomposed if [poly-decomp.js](https://github.com/schteppe/poly-decomp.js) is available. + * Note that this process is not guaranteed to support complex sets of vertices (e.g. those with holes may fail). + * By default the decomposition will discard collinear edges (to improve performance). + * It can also optionally discard any parts that have an area less than `minimumArea`. + * If the vertices can not be decomposed, the result will fall back to using the convex hull. + * The options parameter is an object that specifies any `Matter.Body` properties you wish to override the defaults. + * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. + * @method fromVertices + * @param {number} x + * @param {number} y + * @param [[vector]] vertexSets + * @param {object} [options] + * @param {bool} [flagInternal=false] + * @param {number} [removeCollinear=0.01] + * @param {number} [minimumArea=10] + * @return {body} + */ + Bodies.fromVertices = function(x, y, vertexSets, options, flagInternal, removeCollinear, minimumArea) { + var globals = typeof global !== 'undefined' ? global : window, + decomp, + body, + parts, + isConvex, + vertices, + i, + j, + k, + v, + z; + + try { + decomp = globals.decomp || __webpack_require__(27); + } catch (e) { + // decomp is undefined + } + + options = options || {}; + parts = []; + + flagInternal = typeof flagInternal !== 'undefined' ? flagInternal : false; + removeCollinear = typeof removeCollinear !== 'undefined' ? removeCollinear : 0.01; + minimumArea = typeof minimumArea !== 'undefined' ? minimumArea : 10; + + if (!decomp) { + Common.warn('Bodies.fromVertices: poly-decomp.js required. Could not decompose vertices. Fallback to convex hull.'); + } + + // ensure vertexSets is an array of arrays + if (!Common.isArray(vertexSets[0])) { + vertexSets = [vertexSets]; + } + + for (v = 0; v < vertexSets.length; v += 1) { + vertices = vertexSets[v]; + isConvex = Vertices.isConvex(vertices); + + if (isConvex || !decomp) { + if (isConvex) { + vertices = Vertices.clockwiseSort(vertices); + } else { + // fallback to convex hull when decomposition is not possible + vertices = Vertices.hull(vertices); + } + + parts.push({ + position: { x: x, y: y }, + vertices: vertices + }); + } else { + // initialise a decomposition + var concave = vertices.map(function(vertex) { + return [vertex.x, vertex.y]; + }); + + // vertices are concave and simple, we can decompose into parts + decomp.makeCCW(concave); + if (removeCollinear !== false) + decomp.removeCollinearPoints(concave, removeCollinear); + + // use the quick decomposition algorithm (Bayazit) + var decomposed = decomp.quickDecomp(concave); + + // for each decomposed chunk + for (i = 0; i < decomposed.length; i++) { + var chunk = decomposed[i]; + + // convert vertices into the correct structure + var chunkVertices = chunk.map(function(vertices) { + return { + x: vertices[0], + y: vertices[1] + }; + }); + + // skip small chunks + if (minimumArea > 0 && Vertices.area(chunkVertices) < minimumArea) + continue; + + // create a compound part + parts.push({ + position: Vertices.centre(chunkVertices), + vertices: chunkVertices + }); + } + } + } + + // create body parts + for (i = 0; i < parts.length; i++) { + parts[i] = Body.create(Common.extend(parts[i], options)); + } + + // flag internal edges (coincident part edges) + if (flagInternal) { + var coincident_max_dist = 5; + + for (i = 0; i < parts.length; i++) { + var partA = parts[i]; + + for (j = i + 1; j < parts.length; j++) { + var partB = parts[j]; + + if (Bounds.overlaps(partA.bounds, partB.bounds)) { + var pav = partA.vertices, + pbv = partB.vertices; + + // iterate vertices of both parts + for (k = 0; k < partA.vertices.length; k++) { + for (z = 0; z < partB.vertices.length; z++) { + // find distances between the vertices + var da = Vector.magnitudeSquared(Vector.sub(pav[(k + 1) % pav.length], pbv[z])), + db = Vector.magnitudeSquared(Vector.sub(pav[k], pbv[(z + 1) % pbv.length])); + + // if both vertices are very close, consider the edge concident (internal) + if (da < coincident_max_dist && db < coincident_max_dist) { + pav[k].isInternal = true; + pbv[z].isInternal = true; + } + } + } + + } + } + } + } + + if (parts.length > 1) { + // create the parent body to be returned, that contains generated compound parts + body = Body.create(Common.extend({ parts: parts.slice(0) }, options)); + Body.setPosition(body, { x: x, y: y }); + + return body; + } else { + return parts[0]; + } + }; + +})(); + + +/***/ }), +/* 17 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Plugin` module contains functions for registering and installing plugins on modules. +* +* @class Plugin +*/ + +var Plugin = {}; + +module.exports = Plugin; + +var Common = __webpack_require__(0); + +(function() { + + Plugin._registry = {}; + + /** + * Registers a plugin object so it can be resolved later by name. + * @method register + * @param plugin {} The plugin to register. + * @return {object} The plugin. + */ + Plugin.register = function(plugin) { + if (!Plugin.isPlugin(plugin)) { + Common.warn('Plugin.register:', Plugin.toString(plugin), 'does not implement all required fields.'); + } + + if (plugin.name in Plugin._registry) { + var registered = Plugin._registry[plugin.name], + pluginVersion = Plugin.versionParse(plugin.version).number, + registeredVersion = Plugin.versionParse(registered.version).number; + + if (pluginVersion > registeredVersion) { + Common.warn('Plugin.register:', Plugin.toString(registered), 'was upgraded to', Plugin.toString(plugin)); + Plugin._registry[plugin.name] = plugin; + } else if (pluginVersion < registeredVersion) { + Common.warn('Plugin.register:', Plugin.toString(registered), 'can not be downgraded to', Plugin.toString(plugin)); + } else if (plugin !== registered) { + Common.warn('Plugin.register:', Plugin.toString(plugin), 'is already registered to different plugin object'); + } + } else { + Plugin._registry[plugin.name] = plugin; + } + + return plugin; + }; + + /** + * Resolves a dependency to a plugin object from the registry if it exists. + * The `dependency` may contain a version, but only the name matters when resolving. + * @method resolve + * @param dependency {string} The dependency. + * @return {object} The plugin if resolved, otherwise `undefined`. + */ + Plugin.resolve = function(dependency) { + return Plugin._registry[Plugin.dependencyParse(dependency).name]; + }; + + /** + * Returns a pretty printed plugin name and version. + * @method toString + * @param plugin {} The plugin. + * @return {string} Pretty printed plugin name and version. + */ + Plugin.toString = function(plugin) { + return typeof plugin === 'string' ? plugin : (plugin.name || 'anonymous') + '@' + (plugin.version || plugin.range || '0.0.0'); + }; + + /** + * Returns `true` if the object meets the minimum standard to be considered a plugin. + * This means it must define the following properties: + * - `name` + * - `version` + * - `install` + * @method isPlugin + * @param obj {} The obj to test. + * @return {boolean} `true` if the object can be considered a plugin otherwise `false`. + */ + Plugin.isPlugin = function(obj) { + return obj && obj.name && obj.version && obj.install; + }; + + /** + * Returns `true` if a plugin with the given `name` been installed on `module`. + * @method isUsed + * @param module {} The module. + * @param name {string} The plugin name. + * @return {boolean} `true` if a plugin with the given `name` been installed on `module`, otherwise `false`. + */ + Plugin.isUsed = function(module, name) { + return module.used.indexOf(name) > -1; + }; + + /** + * Returns `true` if `plugin.for` is applicable to `module` by comparing against `module.name` and `module.version`. + * If `plugin.for` is not specified then it is assumed to be applicable. + * The value of `plugin.for` is a string of the format `'module-name'` or `'module-name@version'`. + * @method isFor + * @param plugin {} The plugin. + * @param module {} The module. + * @return {boolean} `true` if `plugin.for` is applicable to `module`, otherwise `false`. + */ + Plugin.isFor = function(plugin, module) { + var parsed = plugin.for && Plugin.dependencyParse(plugin.for); + return !plugin.for || (module.name === parsed.name && Plugin.versionSatisfies(module.version, parsed.range)); + }; + + /** + * Installs the plugins by calling `plugin.install` on each plugin specified in `plugins` if passed, otherwise `module.uses`. + * For installing plugins on `Matter` see the convenience function `Matter.use`. + * Plugins may be specified either by their name or a reference to the plugin object. + * Plugins themselves may specify further dependencies, but each plugin is installed only once. + * Order is important, a topological sort is performed to find the best resulting order of installation. + * This sorting attempts to satisfy every dependency's requested ordering, but may not be exact in all cases. + * This function logs the resulting status of each dependency in the console, along with any warnings. + * - A green tick ✅ indicates a dependency was resolved and installed. + * - An orange diamond 🔶 indicates a dependency was resolved but a warning was thrown for it or one if its dependencies. + * - A red cross ❌ indicates a dependency could not be resolved. + * Avoid calling this function multiple times on the same module unless you intend to manually control installation order. + * @method use + * @param module {} The module install plugins on. + * @param [plugins=module.uses] {} The plugins to install on module (optional, defaults to `module.uses`). + */ + Plugin.use = function(module, plugins) { + module.uses = (module.uses || []).concat(plugins || []); + + if (module.uses.length === 0) { + Common.warn('Plugin.use:', Plugin.toString(module), 'does not specify any dependencies to install.'); + return; + } + + var dependencies = Plugin.dependencies(module), + sortedDependencies = Common.topologicalSort(dependencies), + status = []; + + for (var i = 0; i < sortedDependencies.length; i += 1) { + if (sortedDependencies[i] === module.name) { + continue; + } + + var plugin = Plugin.resolve(sortedDependencies[i]); + + if (!plugin) { + status.push('❌ ' + sortedDependencies[i]); + continue; + } + + if (Plugin.isUsed(module, plugin.name)) { + continue; + } + + if (!Plugin.isFor(plugin, module)) { + Common.warn('Plugin.use:', Plugin.toString(plugin), 'is for', plugin.for, 'but installed on', Plugin.toString(module) + '.'); + plugin._warned = true; + } + + if (plugin.install) { + plugin.install(module); + } else { + Common.warn('Plugin.use:', Plugin.toString(plugin), 'does not specify an install function.'); + plugin._warned = true; + } + + if (plugin._warned) { + status.push('🔶 ' + Plugin.toString(plugin)); + delete plugin._warned; + } else { + status.push('✅ ' + Plugin.toString(plugin)); + } + + module.used.push(plugin.name); + } + + if (status.length > 0) { + Common.info(status.join(' ')); + } + }; + + /** + * Recursively finds all of a module's dependencies and returns a flat dependency graph. + * @method dependencies + * @param module {} The module. + * @return {object} A dependency graph. + */ + Plugin.dependencies = function(module, tracked) { + var parsedBase = Plugin.dependencyParse(module), + name = parsedBase.name; + + tracked = tracked || {}; + + if (name in tracked) { + return; + } + + module = Plugin.resolve(module) || module; + + tracked[name] = Common.map(module.uses || [], function(dependency) { + if (Plugin.isPlugin(dependency)) { + Plugin.register(dependency); + } + + var parsed = Plugin.dependencyParse(dependency), + resolved = Plugin.resolve(dependency); + + if (resolved && !Plugin.versionSatisfies(resolved.version, parsed.range)) { + Common.warn( + 'Plugin.dependencies:', Plugin.toString(resolved), 'does not satisfy', + Plugin.toString(parsed), 'used by', Plugin.toString(parsedBase) + '.' + ); + + resolved._warned = true; + module._warned = true; + } else if (!resolved) { + Common.warn( + 'Plugin.dependencies:', Plugin.toString(dependency), 'used by', + Plugin.toString(parsedBase), 'could not be resolved.' + ); + + module._warned = true; + } + + return parsed.name; + }); + + for (var i = 0; i < tracked[name].length; i += 1) { + Plugin.dependencies(tracked[name][i], tracked); + } + + return tracked; + }; + + /** + * Parses a dependency string into its components. + * The `dependency` is a string of the format `'module-name'` or `'module-name@version'`. + * See documentation for `Plugin.versionParse` for a description of the format. + * This function can also handle dependencies that are already resolved (e.g. a module object). + * @method dependencyParse + * @param dependency {string} The dependency of the format `'module-name'` or `'module-name@version'`. + * @return {object} The dependency parsed into its components. + */ + Plugin.dependencyParse = function(dependency) { + if (Common.isString(dependency)) { + var pattern = /^[\w-]+(@(\*|[\^~]?\d+\.\d+\.\d+(-[0-9A-Za-z-]+)?))?$/; + + if (!pattern.test(dependency)) { + Common.warn('Plugin.dependencyParse:', dependency, 'is not a valid dependency string.'); + } + + return { + name: dependency.split('@')[0], + range: dependency.split('@')[1] || '*' + }; + } + + return { + name: dependency.name, + range: dependency.range || dependency.version + }; + }; + + /** + * Parses a version string into its components. + * Versions are strictly of the format `x.y.z` (as in [semver](http://semver.org/)). + * Versions may optionally have a prerelease tag in the format `x.y.z-alpha`. + * Ranges are a strict subset of [npm ranges](https://docs.npmjs.com/misc/semver#advanced-range-syntax). + * Only the following range types are supported: + * - Tilde ranges e.g. `~1.2.3` + * - Caret ranges e.g. `^1.2.3` + * - Exact version e.g. `1.2.3` + * - Any version `*` + * @method versionParse + * @param range {string} The version string. + * @return {object} The version range parsed into its components. + */ + Plugin.versionParse = function(range) { + var pattern = /^\*|[\^~]?\d+\.\d+\.\d+(-[0-9A-Za-z-]+)?$/; + + if (!pattern.test(range)) { + Common.warn('Plugin.versionParse:', range, 'is not a valid version or range.'); + } + + var identifiers = range.split('-'); + range = identifiers[0]; + + var isRange = isNaN(Number(range[0])), + version = isRange ? range.substr(1) : range, + parts = Common.map(version.split('.'), function(part) { + return Number(part); + }); + + return { + isRange: isRange, + version: version, + range: range, + operator: isRange ? range[0] : '', + parts: parts, + prerelease: identifiers[1], + number: parts[0] * 1e8 + parts[1] * 1e4 + parts[2] + }; + }; + + /** + * Returns `true` if `version` satisfies the given `range`. + * See documentation for `Plugin.versionParse` for a description of the format. + * If a version or range is not specified, then any version (`*`) is assumed to satisfy. + * @method versionSatisfies + * @param version {string} The version string. + * @param range {string} The range string. + * @return {boolean} `true` if `version` satisfies `range`, otherwise `false`. + */ + Plugin.versionSatisfies = function(version, range) { + range = range || '*'; + + var rangeParsed = Plugin.versionParse(range), + rangeParts = rangeParsed.parts, + versionParsed = Plugin.versionParse(version), + versionParts = versionParsed.parts; + + if (rangeParsed.isRange) { + if (rangeParsed.operator === '*' || version === '*') { + return true; + } + + if (rangeParsed.operator === '~') { + return versionParts[0] === rangeParts[0] && versionParts[1] === rangeParts[1] && versionParts[2] >= rangeParts[2]; + } + + if (rangeParsed.operator === '^') { + if (rangeParts[0] > 0) { + return versionParts[0] === rangeParts[0] && versionParsed.number >= rangeParsed.number; + } + + if (rangeParts[1] > 0) { + return versionParts[1] === rangeParts[1] && versionParts[2] >= rangeParts[2]; + } + + return versionParts[2] === rangeParts[2]; + } + } + + return version === range || version === '*'; + }; + +})(); + + +/***/ }), +/* 18 */ +/***/ (function(module, exports) { + +/** +* The `Matter.Contact` module contains methods for creating and manipulating collision contacts. +* +* @class Contact +*/ + +var Contact = {}; + +module.exports = Contact; + +(function() { + + /** + * Creates a new contact. + * @method create + * @param {vertex} vertex + * @return {contact} A new contact + */ + Contact.create = function(vertex) { + return { + id: Contact.id(vertex), + vertex: vertex, + normalImpulse: 0, + tangentImpulse: 0 + }; + }; + + /** + * Generates a contact id. + * @method id + * @param {vertex} vertex + * @return {string} Unique contactID + */ + Contact.id = function(vertex) { + return vertex.body.id + '_' + vertex.index; + }; + +})(); + + +/***/ }), +/* 19 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.World` module contains methods for creating and manipulating the world composite. +* A `Matter.World` is a `Matter.Composite` body, which is a collection of `Matter.Body`, `Matter.Constraint` and other `Matter.Composite`. +* A `Matter.World` has a few additional properties including `gravity` and `bounds`. +* It is important to use the functions in the `Matter.Composite` module to modify the world composite, rather than directly modifying its properties. +* There are also a few methods here that alias those in `Matter.Composite` for easier readability. +* +* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). +* +* @class World +* @extends Composite +*/ + +var World = {}; + +module.exports = World; + +var Composite = __webpack_require__(5); +var Constraint = __webpack_require__(8); +var Common = __webpack_require__(0); + +(function() { + + /** + * Creates a new world composite. The options parameter is an object that specifies any properties you wish to override the defaults. + * See the properties section below for detailed information on what you can pass via the `options` object. + * @method create + * @constructor + * @param {} options + * @return {world} A new world + */ + World.create = function(options) { + var composite = Composite.create(); + + var defaults = { + label: 'World', + gravity: { + x: 0, + y: 1, + scale: 0.001 + }, + bounds: { + min: { x: -Infinity, y: -Infinity }, + max: { x: Infinity, y: Infinity } + } + }; + + return Common.extend(composite, defaults, options); + }; + + /* + * + * Properties Documentation + * + */ + + /** + * The gravity to apply on the world. + * + * @property gravity + * @type object + */ + + /** + * The gravity x component. + * + * @property gravity.x + * @type object + * @default 0 + */ + + /** + * The gravity y component. + * + * @property gravity.y + * @type object + * @default 1 + */ + + /** + * The gravity scale factor. + * + * @property gravity.scale + * @type object + * @default 0.001 + */ + + /** + * A `Bounds` object that defines the world bounds for collision detection. + * + * @property bounds + * @type bounds + * @default { min: { x: -Infinity, y: -Infinity }, max: { x: Infinity, y: Infinity } } + */ + + // World is a Composite body + // see src/module/Outro.js for these aliases: + + /** + * An alias for Composite.add + * @method add + * @param {world} world + * @param {} object + * @return {composite} The original world with the objects added + */ + + /** + * An alias for Composite.remove + * @method remove + * @param {world} world + * @param {} object + * @param {boolean} [deep=false] + * @return {composite} The original world with the objects removed + */ + + /** + * An alias for Composite.clear + * @method clear + * @param {world} world + * @param {boolean} keepStatic + */ + + /** + * An alias for Composite.addComposite + * @method addComposite + * @param {world} world + * @param {composite} composite + * @return {world} The original world with the objects from composite added + */ + + /** + * An alias for Composite.addBody + * @method addBody + * @param {world} world + * @param {body} body + * @return {world} The original world with the body added + */ + + /** + * An alias for Composite.addConstraint + * @method addConstraint + * @param {world} world + * @param {constraint} constraint + * @return {world} The original world with the constraint added + */ + +})(); + + +/***/ }), +/* 20 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Pairs` module contains methods for creating and manipulating collision pair sets. +* +* @class Pairs +*/ + +var Pairs = {}; + +module.exports = Pairs; + +var Pair = __webpack_require__(9); +var Common = __webpack_require__(0); + +(function() { + + Pairs._pairMaxIdleLife = 1000; + + /** + * Creates a new pairs structure. + * @method create + * @param {object} options + * @return {pairs} A new pairs structure + */ + Pairs.create = function(options) { + return Common.extend({ + table: {}, + list: [], + collisionStart: [], + collisionActive: [], + collisionEnd: [] + }, options); + }; + + /** + * Updates pairs given a list of collisions. + * @method update + * @param {object} pairs + * @param {collision[]} collisions + * @param {number} timestamp + */ + Pairs.update = function(pairs, collisions, timestamp) { + var pairsList = pairs.list, + pairsTable = pairs.table, + collisionStart = pairs.collisionStart, + collisionEnd = pairs.collisionEnd, + collisionActive = pairs.collisionActive, + collision, + pairId, + pair, + i; + + // clear collision state arrays, but maintain old reference + collisionStart.length = 0; + collisionEnd.length = 0; + collisionActive.length = 0; + + for (i = 0; i < pairsList.length; i++) { + pairsList[i].confirmedActive = false; + } + + for (i = 0; i < collisions.length; i++) { + collision = collisions[i]; + + if (collision.collided) { + pairId = Pair.id(collision.bodyA, collision.bodyB); + + pair = pairsTable[pairId]; + + if (pair) { + // pair already exists (but may or may not be active) + if (pair.isActive) { + // pair exists and is active + collisionActive.push(pair); + } else { + // pair exists but was inactive, so a collision has just started again + collisionStart.push(pair); + } + + // update the pair + Pair.update(pair, collision, timestamp); + pair.confirmedActive = true; + } else { + // pair did not exist, create a new pair + pair = Pair.create(collision, timestamp); + pairsTable[pairId] = pair; + + // push the new pair + collisionStart.push(pair); + pairsList.push(pair); + } + } + } + + // deactivate previously active pairs that are now inactive + for (i = 0; i < pairsList.length; i++) { + pair = pairsList[i]; + if (pair.isActive && !pair.confirmedActive) { + Pair.setActive(pair, false, timestamp); + collisionEnd.push(pair); + } + } + }; + + /** + * Finds and removes pairs that have been inactive for a set amount of time. + * @method removeOld + * @param {object} pairs + * @param {number} timestamp + */ + Pairs.removeOld = function(pairs, timestamp) { + var pairsList = pairs.list, + pairsTable = pairs.table, + indexesToRemove = [], + pair, + collision, + pairIndex, + i; + + for (i = 0; i < pairsList.length; i++) { + pair = pairsList[i]; + collision = pair.collision; + + // never remove sleeping pairs + if (collision.bodyA.isSleeping || collision.bodyB.isSleeping) { + pair.timeUpdated = timestamp; + continue; + } + + // if pair is inactive for too long, mark it to be removed + if (timestamp - pair.timeUpdated > Pairs._pairMaxIdleLife) { + indexesToRemove.push(i); + } + } + + // remove marked pairs + for (i = 0; i < indexesToRemove.length; i++) { + pairIndex = indexesToRemove[i] - i; + pair = pairsList[pairIndex]; + delete pairsTable[pair.id]; + pairsList.splice(pairIndex, 1); + } + }; + + /** + * Clears the given pairs structure. + * @method clear + * @param {pairs} pairs + * @return {pairs} pairs + */ + Pairs.clear = function(pairs) { + pairs.table = {}; + pairs.list.length = 0; + pairs.collisionStart.length = 0; + pairs.collisionActive.length = 0; + pairs.collisionEnd.length = 0; + return pairs; + }; + +})(); + + +/***/ }), +/* 21 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Resolver` module contains methods for resolving collision pairs. +* +* @class Resolver +*/ + +var Resolver = {}; + +module.exports = Resolver; + +var Vertices = __webpack_require__(3); +var Vector = __webpack_require__(2); +var Common = __webpack_require__(0); +var Bounds = __webpack_require__(1); + +(function() { + + Resolver._restingThresh = 4; + Resolver._restingThreshTangent = 6; + Resolver._positionDampen = 0.9; + Resolver._positionWarming = 0.8; + Resolver._frictionNormalMultiplier = 5; + + /** + * Prepare pairs for position solving. + * @method preSolvePosition + * @param {pair[]} pairs + */ + Resolver.preSolvePosition = function(pairs) { + var i, + pair, + activeCount; + + // find total contacts on each body + for (i = 0; i < pairs.length; i++) { + pair = pairs[i]; + + if (!pair.isActive) + continue; + + activeCount = pair.activeContacts.length; + pair.collision.parentA.totalContacts += activeCount; + pair.collision.parentB.totalContacts += activeCount; + } + }; + + /** + * Find a solution for pair positions. + * @method solvePosition + * @param {pair[]} pairs + * @param {number} timeScale + */ + Resolver.solvePosition = function(pairs, timeScale) { + var i, + pair, + collision, + bodyA, + bodyB, + normal, + bodyBtoA, + contactShare, + positionImpulse, + contactCount = {}, + tempA = Vector._temp[0], + tempB = Vector._temp[1], + tempC = Vector._temp[2], + tempD = Vector._temp[3]; + + // find impulses required to resolve penetration + for (i = 0; i < pairs.length; i++) { + pair = pairs[i]; + + if (!pair.isActive || pair.isSensor) + continue; + + collision = pair.collision; + bodyA = collision.parentA; + bodyB = collision.parentB; + normal = collision.normal; + + // get current separation between body edges involved in collision + bodyBtoA = Vector.sub(Vector.add(bodyB.positionImpulse, bodyB.position, tempA), + Vector.add(bodyA.positionImpulse, + Vector.sub(bodyB.position, collision.penetration, tempB), tempC), tempD); + + pair.separation = Vector.dot(normal, bodyBtoA); + } + + for (i = 0; i < pairs.length; i++) { + pair = pairs[i]; + + if (!pair.isActive || pair.isSensor) + continue; + + collision = pair.collision; + bodyA = collision.parentA; + bodyB = collision.parentB; + normal = collision.normal; + positionImpulse = (pair.separation - pair.slop) * timeScale; + + if (bodyA.isStatic || bodyB.isStatic) + positionImpulse *= 2; + + if (!(bodyA.isStatic || bodyA.isSleeping)) { + contactShare = Resolver._positionDampen / bodyA.totalContacts; + bodyA.positionImpulse.x += normal.x * positionImpulse * contactShare; + bodyA.positionImpulse.y += normal.y * positionImpulse * contactShare; + } + + if (!(bodyB.isStatic || bodyB.isSleeping)) { + contactShare = Resolver._positionDampen / bodyB.totalContacts; + bodyB.positionImpulse.x -= normal.x * positionImpulse * contactShare; + bodyB.positionImpulse.y -= normal.y * positionImpulse * contactShare; + } + } + }; + + /** + * Apply position resolution. + * @method postSolvePosition + * @param {body[]} bodies + */ + Resolver.postSolvePosition = function(bodies) { + for (var i = 0; i < bodies.length; i++) { + var body = bodies[i]; + + // reset contact count + body.totalContacts = 0; + + if (body.positionImpulse.x !== 0 || body.positionImpulse.y !== 0) { + // update body geometry + for (var j = 0; j < body.parts.length; j++) { + var part = body.parts[j]; + Vertices.translate(part.vertices, body.positionImpulse); + Bounds.update(part.bounds, part.vertices, body.velocity); + part.position.x += body.positionImpulse.x; + part.position.y += body.positionImpulse.y; + } + + // move the body without changing velocity + body.positionPrev.x += body.positionImpulse.x; + body.positionPrev.y += body.positionImpulse.y; + + if (Vector.dot(body.positionImpulse, body.velocity) < 0) { + // reset cached impulse if the body has velocity along it + body.positionImpulse.x = 0; + body.positionImpulse.y = 0; + } else { + // warm the next iteration + body.positionImpulse.x *= Resolver._positionWarming; + body.positionImpulse.y *= Resolver._positionWarming; + } + } + } + }; + + /** + * Prepare pairs for velocity solving. + * @method preSolveVelocity + * @param {pair[]} pairs + */ + Resolver.preSolveVelocity = function(pairs) { + var i, + j, + pair, + contacts, + collision, + bodyA, + bodyB, + normal, + tangent, + contact, + contactVertex, + normalImpulse, + tangentImpulse, + offset, + impulse = Vector._temp[0], + tempA = Vector._temp[1]; + + for (i = 0; i < pairs.length; i++) { + pair = pairs[i]; + + if (!pair.isActive || pair.isSensor) + continue; + + contacts = pair.activeContacts; + collision = pair.collision; + bodyA = collision.parentA; + bodyB = collision.parentB; + normal = collision.normal; + tangent = collision.tangent; + + // resolve each contact + for (j = 0; j < contacts.length; j++) { + contact = contacts[j]; + contactVertex = contact.vertex; + normalImpulse = contact.normalImpulse; + tangentImpulse = contact.tangentImpulse; + + if (normalImpulse !== 0 || tangentImpulse !== 0) { + // total impulse from contact + impulse.x = (normal.x * normalImpulse) + (tangent.x * tangentImpulse); + impulse.y = (normal.y * normalImpulse) + (tangent.y * tangentImpulse); + + // apply impulse from contact + if (!(bodyA.isStatic || bodyA.isSleeping)) { + offset = Vector.sub(contactVertex, bodyA.position, tempA); + bodyA.positionPrev.x += impulse.x * bodyA.inverseMass; + bodyA.positionPrev.y += impulse.y * bodyA.inverseMass; + bodyA.anglePrev += Vector.cross(offset, impulse) * bodyA.inverseInertia; + } + + if (!(bodyB.isStatic || bodyB.isSleeping)) { + offset = Vector.sub(contactVertex, bodyB.position, tempA); + bodyB.positionPrev.x -= impulse.x * bodyB.inverseMass; + bodyB.positionPrev.y -= impulse.y * bodyB.inverseMass; + bodyB.anglePrev -= Vector.cross(offset, impulse) * bodyB.inverseInertia; + } + } + } + } + }; + + /** + * Find a solution for pair velocities. + * @method solveVelocity + * @param {pair[]} pairs + * @param {number} timeScale + */ + Resolver.solveVelocity = function(pairs, timeScale) { + var timeScaleSquared = timeScale * timeScale, + impulse = Vector._temp[0], + tempA = Vector._temp[1], + tempB = Vector._temp[2], + tempC = Vector._temp[3], + tempD = Vector._temp[4], + tempE = Vector._temp[5]; + + for (var i = 0; i < pairs.length; i++) { + var pair = pairs[i]; + + if (!pair.isActive || pair.isSensor) + continue; + + var collision = pair.collision, + bodyA = collision.parentA, + bodyB = collision.parentB, + normal = collision.normal, + tangent = collision.tangent, + contacts = pair.activeContacts, + contactShare = 1 / contacts.length; + + // update body velocities + bodyA.velocity.x = bodyA.position.x - bodyA.positionPrev.x; + bodyA.velocity.y = bodyA.position.y - bodyA.positionPrev.y; + bodyB.velocity.x = bodyB.position.x - bodyB.positionPrev.x; + bodyB.velocity.y = bodyB.position.y - bodyB.positionPrev.y; + bodyA.angularVelocity = bodyA.angle - bodyA.anglePrev; + bodyB.angularVelocity = bodyB.angle - bodyB.anglePrev; + + // resolve each contact + for (var j = 0; j < contacts.length; j++) { + var contact = contacts[j], + contactVertex = contact.vertex, + offsetA = Vector.sub(contactVertex, bodyA.position, tempA), + offsetB = Vector.sub(contactVertex, bodyB.position, tempB), + velocityPointA = Vector.add(bodyA.velocity, Vector.mult(Vector.perp(offsetA), bodyA.angularVelocity), tempC), + velocityPointB = Vector.add(bodyB.velocity, Vector.mult(Vector.perp(offsetB), bodyB.angularVelocity), tempD), + relativeVelocity = Vector.sub(velocityPointA, velocityPointB, tempE), + normalVelocity = Vector.dot(normal, relativeVelocity); + + var tangentVelocity = Vector.dot(tangent, relativeVelocity), + tangentSpeed = Math.abs(tangentVelocity), + tangentVelocityDirection = Common.sign(tangentVelocity); + + // raw impulses + var normalImpulse = (1 + pair.restitution) * normalVelocity, + normalForce = Common.clamp(pair.separation + normalVelocity, 0, 1) * Resolver._frictionNormalMultiplier; + + // coulomb friction + var tangentImpulse = tangentVelocity, + maxFriction = Infinity; + + if (tangentSpeed > pair.friction * pair.frictionStatic * normalForce * timeScaleSquared) { + maxFriction = tangentSpeed; + tangentImpulse = Common.clamp( + pair.friction * tangentVelocityDirection * timeScaleSquared, + -maxFriction, maxFriction + ); + } + + // modify impulses accounting for mass, inertia and offset + var oAcN = Vector.cross(offsetA, normal), + oBcN = Vector.cross(offsetB, normal), + share = contactShare / (bodyA.inverseMass + bodyB.inverseMass + bodyA.inverseInertia * oAcN * oAcN + bodyB.inverseInertia * oBcN * oBcN); + + normalImpulse *= share; + tangentImpulse *= share; + + // handle high velocity and resting collisions separately + if (normalVelocity < 0 && normalVelocity * normalVelocity > Resolver._restingThresh * timeScaleSquared) { + // high normal velocity so clear cached contact normal impulse + contact.normalImpulse = 0; + } else { + // solve resting collision constraints using Erin Catto's method (GDC08) + // impulse constraint tends to 0 + var contactNormalImpulse = contact.normalImpulse; + contact.normalImpulse = Math.min(contact.normalImpulse + normalImpulse, 0); + normalImpulse = contact.normalImpulse - contactNormalImpulse; + } + + // handle high velocity and resting collisions separately + if (tangentVelocity * tangentVelocity > Resolver._restingThreshTangent * timeScaleSquared) { + // high tangent velocity so clear cached contact tangent impulse + contact.tangentImpulse = 0; + } else { + // solve resting collision constraints using Erin Catto's method (GDC08) + // tangent impulse tends to -tangentSpeed or +tangentSpeed + var contactTangentImpulse = contact.tangentImpulse; + contact.tangentImpulse = Common.clamp(contact.tangentImpulse + tangentImpulse, -maxFriction, maxFriction); + tangentImpulse = contact.tangentImpulse - contactTangentImpulse; + } + + // total impulse from contact + impulse.x = (normal.x * normalImpulse) + (tangent.x * tangentImpulse); + impulse.y = (normal.y * normalImpulse) + (tangent.y * tangentImpulse); + + // apply impulse from contact + if (!(bodyA.isStatic || bodyA.isSleeping)) { + bodyA.positionPrev.x += impulse.x * bodyA.inverseMass; + bodyA.positionPrev.y += impulse.y * bodyA.inverseMass; + bodyA.anglePrev += Vector.cross(offsetA, impulse) * bodyA.inverseInertia; + } + + if (!(bodyB.isStatic || bodyB.isSleeping)) { + bodyB.positionPrev.x -= impulse.x * bodyB.inverseMass; + bodyB.positionPrev.y -= impulse.y * bodyB.inverseMass; + bodyB.anglePrev -= Vector.cross(offsetB, impulse) * bodyB.inverseInertia; + } + } + } + }; + +})(); + + +/***/ }), +/* 22 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Engine` module contains methods for creating and manipulating engines. +* An engine is a controller that manages updating the simulation of the world. +* See `Matter.Runner` for an optional game loop utility. +* +* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). +* +* @class Engine +*/ + +var Engine = {}; + +module.exports = Engine; + +var World = __webpack_require__(19); +var Sleeping = __webpack_require__(7); +var Resolver = __webpack_require__(21); +var Render = __webpack_require__(10); +var Pairs = __webpack_require__(20); +var Metrics = __webpack_require__(23); +var Grid = __webpack_require__(11); +var Events = __webpack_require__(4); +var Composite = __webpack_require__(5); +var Constraint = __webpack_require__(8); +var Common = __webpack_require__(0); +var Body = __webpack_require__(6); + +(function() { + + /** + * Creates a new engine. The options parameter is an object that specifies any properties you wish to override the defaults. + * All properties have default values, and many are pre-calculated automatically based on other properties. + * See the properties section below for detailed information on what you can pass via the `options` object. + * @method create + * @param {object} [options] + * @return {engine} engine + */ + Engine.create = function(element, options) { + // options may be passed as the first (and only) argument + options = Common.isElement(element) ? options : element; + element = Common.isElement(element) ? element : null; + options = options || {}; + + if (element || options.render) { + Common.warn('Engine.create: engine.render is deprecated (see docs)'); + } + + var defaults = { + positionIterations: 6, + velocityIterations: 4, + constraintIterations: 2, + enableSleeping: false, + events: [], + plugin: {}, + timing: { + timestamp: 0, + timeScale: 1 + }, + broadphase: { + controller: Grid + } + }; + + var engine = Common.extend(defaults, options); + + // @deprecated + if (element || engine.render) { + var renderDefaults = { + element: element, + controller: Render + }; + + engine.render = Common.extend(renderDefaults, engine.render); + } + + // @deprecated + if (engine.render && engine.render.controller) { + engine.render = engine.render.controller.create(engine.render); + } + + // @deprecated + if (engine.render) { + engine.render.engine = engine; + } + + engine.world = options.world || World.create(engine.world); + engine.pairs = Pairs.create(); + engine.broadphase = engine.broadphase.controller.create(engine.broadphase); + engine.metrics = engine.metrics || { extended: false }; + + // @if DEBUG + engine.metrics = Metrics.create(engine.metrics); + // @endif + + return engine; + }; + + /** + * Moves the simulation forward in time by `delta` ms. + * The `correction` argument is an optional `Number` that specifies the time correction factor to apply to the update. + * This can help improve the accuracy of the simulation in cases where `delta` is changing between updates. + * The value of `correction` is defined as `delta / lastDelta`, i.e. the percentage change of `delta` over the last step. + * Therefore the value is always `1` (no correction) when `delta` constant (or when no correction is desired, which is the default). + * See the paper on Time Corrected Verlet for more information. + * + * Triggers `beforeUpdate` and `afterUpdate` events. + * Triggers `collisionStart`, `collisionActive` and `collisionEnd` events. + * @method update + * @param {engine} engine + * @param {number} [delta=16.666] + * @param {number} [correction=1] + */ + Engine.update = function(engine, delta, correction) { + delta = delta || 1000 / 60; + correction = correction || 1; + + var world = engine.world, + timing = engine.timing, + broadphase = engine.broadphase, + broadphasePairs = [], + i; + + // increment timestamp + timing.timestamp += delta * timing.timeScale; + + // create an event object + var event = { + timestamp: timing.timestamp + }; + + Events.trigger(engine, 'beforeUpdate', event); + + // get lists of all bodies and constraints, no matter what composites they are in + var allBodies = Composite.allBodies(world), + allConstraints = Composite.allConstraints(world); + + // @if DEBUG + // reset metrics logging + Metrics.reset(engine.metrics); + // @endif + + // if sleeping enabled, call the sleeping controller + if (engine.enableSleeping) + Sleeping.update(allBodies, timing.timeScale); + + // applies gravity to all bodies + Engine._bodiesApplyGravity(allBodies, world.gravity); + + // update all body position and rotation by integration + Engine._bodiesUpdate(allBodies, delta, timing.timeScale, correction, world.bounds); + + // update all constraints (first pass) + Constraint.preSolveAll(allBodies); + for (i = 0; i < engine.constraintIterations; i++) { + Constraint.solveAll(allConstraints, timing.timeScale); + } + Constraint.postSolveAll(allBodies); + + // broadphase pass: find potential collision pairs + if (broadphase.controller) { + // if world is dirty, we must flush the whole grid + if (world.isModified) + broadphase.controller.clear(broadphase); + + // update the grid buckets based on current bodies + broadphase.controller.update(broadphase, allBodies, engine, world.isModified); + broadphasePairs = broadphase.pairsList; + } else { + // if no broadphase set, we just pass all bodies + broadphasePairs = allBodies; + } + + // clear all composite modified flags + if (world.isModified) { + Composite.setModified(world, false, false, true); + } + + // narrowphase pass: find actual collisions, then create or update collision pairs + var collisions = broadphase.detector(broadphasePairs, engine); + + // update collision pairs + var pairs = engine.pairs, + timestamp = timing.timestamp; + Pairs.update(pairs, collisions, timestamp); + Pairs.removeOld(pairs, timestamp); + + // wake up bodies involved in collisions + if (engine.enableSleeping) + Sleeping.afterCollisions(pairs.list, timing.timeScale); + + // trigger collision events + if (pairs.collisionStart.length > 0) + Events.trigger(engine, 'collisionStart', { pairs: pairs.collisionStart }); + + // iteratively resolve position between collisions + Resolver.preSolvePosition(pairs.list); + for (i = 0; i < engine.positionIterations; i++) { + Resolver.solvePosition(pairs.list, timing.timeScale); + } + Resolver.postSolvePosition(allBodies); + + // update all constraints (second pass) + Constraint.preSolveAll(allBodies); + for (i = 0; i < engine.constraintIterations; i++) { + Constraint.solveAll(allConstraints, timing.timeScale); + } + Constraint.postSolveAll(allBodies); + + // iteratively resolve velocity between collisions + Resolver.preSolveVelocity(pairs.list); + for (i = 0; i < engine.velocityIterations; i++) { + Resolver.solveVelocity(pairs.list, timing.timeScale); + } + + // trigger collision events + if (pairs.collisionActive.length > 0) + Events.trigger(engine, 'collisionActive', { pairs: pairs.collisionActive }); + + if (pairs.collisionEnd.length > 0) + Events.trigger(engine, 'collisionEnd', { pairs: pairs.collisionEnd }); + + // @if DEBUG + // update metrics log + Metrics.update(engine.metrics, engine); + // @endif + + // clear force buffers + Engine._bodiesClearForces(allBodies); + + Events.trigger(engine, 'afterUpdate', event); + + return engine; + }; + + /** + * Merges two engines by keeping the configuration of `engineA` but replacing the world with the one from `engineB`. + * @method merge + * @param {engine} engineA + * @param {engine} engineB + */ + Engine.merge = function(engineA, engineB) { + Common.extend(engineA, engineB); + + if (engineB.world) { + engineA.world = engineB.world; + + Engine.clear(engineA); + + var bodies = Composite.allBodies(engineA.world); + + for (var i = 0; i < bodies.length; i++) { + var body = bodies[i]; + Sleeping.set(body, false); + body.id = Common.nextId(); + } + } + }; + + /** + * Clears the engine including the world, pairs and broadphase. + * @method clear + * @param {engine} engine + */ + Engine.clear = function(engine) { + var world = engine.world; + + Pairs.clear(engine.pairs); + + var broadphase = engine.broadphase; + if (broadphase.controller) { + var bodies = Composite.allBodies(world); + broadphase.controller.clear(broadphase); + broadphase.controller.update(broadphase, bodies, engine, true); + } + }; + + /** + * Zeroes the `body.force` and `body.torque` force buffers. + * @method _bodiesClearForces + * @private + * @param {body[]} bodies + */ + Engine._bodiesClearForces = function(bodies) { + for (var i = 0; i < bodies.length; i++) { + var body = bodies[i]; + + // reset force buffers + body.force.x = 0; + body.force.y = 0; + body.torque = 0; + } + }; + + /** + * Applys a mass dependant force to all given bodies. + * @method _bodiesApplyGravity + * @private + * @param {body[]} bodies + * @param {vector} gravity + */ + Engine._bodiesApplyGravity = function(bodies, gravity) { + var gravityScale = typeof gravity.scale !== 'undefined' ? gravity.scale : 0.001; + + if ((gravity.x === 0 && gravity.y === 0) || gravityScale === 0) { + return; + } + + for (var i = 0; i < bodies.length; i++) { + var body = bodies[i]; + + if (body.isStatic || body.isSleeping) + continue; + + // apply gravity + body.force.y += body.mass * gravity.y * gravityScale; + body.force.x += body.mass * gravity.x * gravityScale; + } + }; + + /** + * Applys `Body.update` to all given `bodies`. + * @method _bodiesUpdate + * @private + * @param {body[]} bodies + * @param {number} deltaTime + * The amount of time elapsed between updates + * @param {number} timeScale + * @param {number} correction + * The Verlet correction factor (deltaTime / lastDeltaTime) + * @param {bounds} worldBounds + */ + Engine._bodiesUpdate = function(bodies, deltaTime, timeScale, correction, worldBounds) { + for (var i = 0; i < bodies.length; i++) { + var body = bodies[i]; + + if (body.isStatic || body.isSleeping) + continue; + + Body.update(body, deltaTime, timeScale, correction); + } + }; + + /** + * An alias for `Runner.run`, see `Matter.Runner` for more information. + * @method run + * @param {engine} engine + */ + + /** + * Fired just before an update + * + * @event beforeUpdate + * @param {} event An event object + * @param {number} event.timestamp The engine.timing.timestamp of the event + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired after engine update and all collision events + * + * @event afterUpdate + * @param {} event An event object + * @param {number} event.timestamp The engine.timing.timestamp of the event + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired after engine update, provides a list of all pairs that have started to collide in the current tick (if any) + * + * @event collisionStart + * @param {} event An event object + * @param {} event.pairs List of affected pairs + * @param {number} event.timestamp The engine.timing.timestamp of the event + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired after engine update, provides a list of all pairs that are colliding in the current tick (if any) + * + * @event collisionActive + * @param {} event An event object + * @param {} event.pairs List of affected pairs + * @param {number} event.timestamp The engine.timing.timestamp of the event + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired after engine update, provides a list of all pairs that have ended collision in the current tick (if any) + * + * @event collisionEnd + * @param {} event An event object + * @param {} event.pairs List of affected pairs + * @param {number} event.timestamp The engine.timing.timestamp of the event + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /* + * + * Properties Documentation + * + */ + + /** + * An integer `Number` that specifies the number of position iterations to perform each update. + * The higher the value, the higher quality the simulation will be at the expense of performance. + * + * @property positionIterations + * @type number + * @default 6 + */ + + /** + * An integer `Number` that specifies the number of velocity iterations to perform each update. + * The higher the value, the higher quality the simulation will be at the expense of performance. + * + * @property velocityIterations + * @type number + * @default 4 + */ + + /** + * An integer `Number` that specifies the number of constraint iterations to perform each update. + * The higher the value, the higher quality the simulation will be at the expense of performance. + * The default value of `2` is usually very adequate. + * + * @property constraintIterations + * @type number + * @default 2 + */ + + /** + * A flag that specifies whether the engine should allow sleeping via the `Matter.Sleeping` module. + * Sleeping can improve stability and performance, but often at the expense of accuracy. + * + * @property enableSleeping + * @type boolean + * @default false + */ + + /** + * An `Object` containing properties regarding the timing systems of the engine. + * + * @property timing + * @type object + */ + + /** + * A `Number` that specifies the global scaling factor of time for all bodies. + * A value of `0` freezes the simulation. + * A value of `0.1` gives a slow-motion effect. + * A value of `1.2` gives a speed-up effect. + * + * @property timing.timeScale + * @type number + * @default 1 + */ + + /** + * A `Number` that specifies the current simulation-time in milliseconds starting from `0`. + * It is incremented on every `Engine.update` by the given `delta` argument. + * + * @property timing.timestamp + * @type number + * @default 0 + */ + + /** + * An instance of a `Render` controller. The default value is a `Matter.Render` instance created by `Engine.create`. + * One may also develop a custom renderer module based on `Matter.Render` and pass an instance of it to `Engine.create` via `options.render`. + * + * A minimal custom renderer object must define at least three functions: `create`, `clear` and `world` (see `Matter.Render`). + * It is also possible to instead pass the _module_ reference via `options.render.controller` and `Engine.create` will instantiate one for you. + * + * @property render + * @type render + * @deprecated see Demo.js for an example of creating a renderer + * @default a Matter.Render instance + */ + + /** + * An instance of a broadphase controller. The default value is a `Matter.Grid` instance created by `Engine.create`. + * + * @property broadphase + * @type grid + * @default a Matter.Grid instance + */ + + /** + * A `World` composite object that will contain all simulated bodies and constraints. + * + * @property world + * @type world + * @default a Matter.World instance + */ + + /** + * An object reserved for storing plugin-specific properties. + * + * @property plugin + * @type {} + */ + +})(); + + +/***/ }), +/* 23 */ +/***/ (function(module, exports, __webpack_require__) { + +// @if DEBUG +/** +* _Internal Class_, not generally used outside of the engine's internals. +* +*/ + +var Metrics = {}; + +module.exports = Metrics; + +var Composite = __webpack_require__(5); +var Common = __webpack_require__(0); + +(function() { + + /** + * Creates a new metrics. + * @method create + * @private + * @return {metrics} A new metrics + */ + Metrics.create = function(options) { + var defaults = { + extended: false, + narrowDetections: 0, + narrowphaseTests: 0, + narrowReuse: 0, + narrowReuseCount: 0, + midphaseTests: 0, + broadphaseTests: 0, + narrowEff: 0.0001, + midEff: 0.0001, + broadEff: 0.0001, + collisions: 0, + buckets: 0, + bodies: 0, + pairs: 0 + }; + + return Common.extend(defaults, false, options); + }; + + /** + * Resets metrics. + * @method reset + * @private + * @param {metrics} metrics + */ + Metrics.reset = function(metrics) { + if (metrics.extended) { + metrics.narrowDetections = 0; + metrics.narrowphaseTests = 0; + metrics.narrowReuse = 0; + metrics.narrowReuseCount = 0; + metrics.midphaseTests = 0; + metrics.broadphaseTests = 0; + metrics.narrowEff = 0; + metrics.midEff = 0; + metrics.broadEff = 0; + metrics.collisions = 0; + metrics.buckets = 0; + metrics.pairs = 0; + metrics.bodies = 0; + } + }; + + /** + * Updates metrics. + * @method update + * @private + * @param {metrics} metrics + * @param {engine} engine + */ + Metrics.update = function(metrics, engine) { + if (metrics.extended) { + var world = engine.world, + bodies = Composite.allBodies(world); + + metrics.collisions = metrics.narrowDetections; + metrics.pairs = engine.pairs.list.length; + metrics.bodies = bodies.length; + metrics.midEff = (metrics.narrowDetections / (metrics.midphaseTests || 1)).toFixed(2); + metrics.narrowEff = (metrics.narrowDetections / (metrics.narrowphaseTests || 1)).toFixed(2); + metrics.broadEff = (1 - (metrics.broadphaseTests / (bodies.length || 1))).toFixed(2); + metrics.narrowReuse = (metrics.narrowReuseCount / (metrics.narrowphaseTests || 1)).toFixed(2); + //var broadphase = engine.broadphase[engine.broadphase.current]; + //if (broadphase.instance) + // metrics.buckets = Common.keys(broadphase.instance.buckets).length; + } + }; + +})(); +// @endif + + +/***/ }), +/* 24 */ +/***/ (function(module, exports, __webpack_require__) { + +var Matter = module.exports = __webpack_require__(25); + +Matter.Body = __webpack_require__(6); +Matter.Composite = __webpack_require__(5); +Matter.World = __webpack_require__(19); + +Matter.Contact = __webpack_require__(18); +Matter.Detector = __webpack_require__(12); +Matter.Grid = __webpack_require__(11); +Matter.Pairs = __webpack_require__(20); +Matter.Pair = __webpack_require__(9); +Matter.Query = __webpack_require__(26); +Matter.Resolver = __webpack_require__(21); +Matter.SAT = __webpack_require__(13); + +Matter.Constraint = __webpack_require__(8); +Matter.MouseConstraint = __webpack_require__(28); + +Matter.Common = __webpack_require__(0); +Matter.Engine = __webpack_require__(22); +Matter.Events = __webpack_require__(4); +Matter.Mouse = __webpack_require__(14); +Matter.Runner = __webpack_require__(29); +Matter.Sleeping = __webpack_require__(7); +Matter.Plugin = __webpack_require__(17); + +// @if DEBUG +Matter.Metrics = __webpack_require__(23); +// @endif + +Matter.Bodies = __webpack_require__(16); +Matter.Composites = __webpack_require__(30); + +Matter.Axes = __webpack_require__(15); +Matter.Bounds = __webpack_require__(1); +Matter.Svg = __webpack_require__(31); +Matter.Vector = __webpack_require__(2); +Matter.Vertices = __webpack_require__(3); + +Matter.Render = __webpack_require__(10); +Matter.RenderPixi = __webpack_require__(32); + +// aliases + +Matter.World.add = Matter.Composite.add; +Matter.World.remove = Matter.Composite.remove; +Matter.World.addComposite = Matter.Composite.addComposite; +Matter.World.addBody = Matter.Composite.addBody; +Matter.World.addConstraint = Matter.Composite.addConstraint; +Matter.World.clear = Matter.Composite.clear; +Matter.Engine.run = Matter.Runner.run; + + +/***/ }), +/* 25 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter` module is the top level namespace. It also includes a function for installing plugins on top of the library. +* +* @class Matter +*/ + +var Matter = {}; + +module.exports = Matter; + +var Plugin = __webpack_require__(17); +var Common = __webpack_require__(0); + +(function() { + + /** + * The library name. + * @property name + * @readOnly + * @type {String} + */ + Matter.name = 'matter-js'; + + /** + * The library version. + * @property version + * @readOnly + * @type {String} + */ + Matter.version = true ? "0.15.0" : undefined; + + /** + * A list of plugin dependencies to be installed. These are normally set and installed through `Matter.use`. + * Alternatively you may set `Matter.uses` manually and install them by calling `Plugin.use(Matter)`. + * @property uses + * @type {Array} + */ + Matter.uses = []; + + /** + * The plugins that have been installed through `Matter.Plugin.install`. Read only. + * @property used + * @readOnly + * @type {Array} + */ + Matter.used = []; + + /** + * Installs the given plugins on the `Matter` namespace. + * This is a short-hand for `Plugin.use`, see it for more information. + * Call this function once at the start of your code, with all of the plugins you wish to install as arguments. + * Avoid calling this function multiple times unless you intend to manually control installation order. + * @method use + * @param ...plugin {Function} The plugin(s) to install on `base` (multi-argument). + */ + Matter.use = function() { + Plugin.use(Matter, Array.prototype.slice.call(arguments)); + }; + + /** + * Chains a function to excute before the original function on the given `path` relative to `Matter`. + * See also docs for `Common.chain`. + * @method before + * @param {string} path The path relative to `Matter` + * @param {function} func The function to chain before the original + * @return {function} The chained function that replaced the original + */ + Matter.before = function(path, func) { + path = path.replace(/^Matter./, ''); + return Common.chainPathBefore(Matter, path, func); + }; + + /** + * Chains a function to excute after the original function on the given `path` relative to `Matter`. + * See also docs for `Common.chain`. + * @method after + * @param {string} path The path relative to `Matter` + * @param {function} func The function to chain after the original + * @return {function} The chained function that replaced the original + */ + Matter.after = function(path, func) { + path = path.replace(/^Matter./, ''); + return Common.chainPathAfter(Matter, path, func); + }; + +})(); + + +/***/ }), +/* 26 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Query` module contains methods for performing collision queries. +* +* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). +* +* @class Query +*/ + +var Query = {}; + +module.exports = Query; + +var Vector = __webpack_require__(2); +var SAT = __webpack_require__(13); +var Bounds = __webpack_require__(1); +var Bodies = __webpack_require__(16); +var Vertices = __webpack_require__(3); + +(function() { + + /** + * Returns a list of collisions between `body` and `bodies`. + * @method collides + * @param {body} body + * @param {body[]} bodies + * @return {object[]} Collisions + */ + Query.collides = function(body, bodies) { + var collisions = []; + + for (var i = 0; i < bodies.length; i++) { + var bodyA = bodies[i]; + + if (Bounds.overlaps(bodyA.bounds, body.bounds)) { + for (var j = bodyA.parts.length === 1 ? 0 : 1; j < bodyA.parts.length; j++) { + var part = bodyA.parts[j]; + + if (Bounds.overlaps(part.bounds, body.bounds)) { + var collision = SAT.collides(part, body); + + if (collision.collided) { + collisions.push(collision); + break; + } + } + } + } + } + + return collisions; + }; + + /** + * Casts a ray segment against a set of bodies and returns all collisions, ray width is optional. Intersection points are not provided. + * @method ray + * @param {body[]} bodies + * @param {vector} startPoint + * @param {vector} endPoint + * @param {number} [rayWidth] + * @return {object[]} Collisions + */ + Query.ray = function(bodies, startPoint, endPoint, rayWidth) { + rayWidth = rayWidth || 1e-100; + + var rayAngle = Vector.angle(startPoint, endPoint), + rayLength = Vector.magnitude(Vector.sub(startPoint, endPoint)), + rayX = (endPoint.x + startPoint.x) * 0.5, + rayY = (endPoint.y + startPoint.y) * 0.5, + ray = Bodies.rectangle(rayX, rayY, rayLength, rayWidth, { angle: rayAngle }), + collisions = Query.collides(ray, bodies); + + for (var i = 0; i < collisions.length; i += 1) { + var collision = collisions[i]; + collision.body = collision.bodyB = collision.bodyA; + } + + return collisions; + }; + + /** + * Returns all bodies whose bounds are inside (or outside if set) the given set of bounds, from the given set of bodies. + * @method region + * @param {body[]} bodies + * @param {bounds} bounds + * @param {bool} [outside=false] + * @return {body[]} The bodies matching the query + */ + Query.region = function(bodies, bounds, outside) { + var result = []; + + for (var i = 0; i < bodies.length; i++) { + var body = bodies[i], + overlaps = Bounds.overlaps(body.bounds, bounds); + if ((overlaps && !outside) || (!overlaps && outside)) + result.push(body); + } + + return result; + }; + + /** + * Returns all bodies whose vertices contain the given point, from the given set of bodies. + * @method point + * @param {body[]} bodies + * @param {vector} point + * @return {body[]} The bodies matching the query + */ + Query.point = function(bodies, point) { + var result = []; + + for (var i = 0; i < bodies.length; i++) { + var body = bodies[i]; + + if (Bounds.contains(body.bounds, point)) { + for (var j = body.parts.length === 1 ? 0 : 1; j < body.parts.length; j++) { + var part = body.parts[j]; + + if (Bounds.contains(part.bounds, point) + && Vertices.contains(part.vertices, point)) { + result.push(body); + break; + } + } + } + } + + return result; + }; + +})(); + + +/***/ }), +/* 27 */ +/***/ (function(module, exports) { + +if(typeof __WEBPACK_EXTERNAL_MODULE__27__ === 'undefined') {var e = new Error("Cannot find module 'undefined'"); e.code = 'MODULE_NOT_FOUND'; throw e;} +module.exports = __WEBPACK_EXTERNAL_MODULE__27__; + +/***/ }), +/* 28 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.MouseConstraint` module contains methods for creating mouse constraints. +* Mouse constraints are used for allowing user interaction, providing the ability to move bodies via the mouse or touch. +* +* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). +* +* @class MouseConstraint +*/ + +var MouseConstraint = {}; + +module.exports = MouseConstraint; + +var Vertices = __webpack_require__(3); +var Sleeping = __webpack_require__(7); +var Mouse = __webpack_require__(14); +var Events = __webpack_require__(4); +var Detector = __webpack_require__(12); +var Constraint = __webpack_require__(8); +var Composite = __webpack_require__(5); +var Common = __webpack_require__(0); +var Bounds = __webpack_require__(1); + +(function() { + + /** + * Creates a new mouse constraint. + * All properties have default values, and many are pre-calculated automatically based on other properties. + * See the properties section below for detailed information on what you can pass via the `options` object. + * @method create + * @param {engine} engine + * @param {} options + * @return {MouseConstraint} A new MouseConstraint + */ + MouseConstraint.create = function(engine, options) { + var mouse = (engine ? engine.mouse : null) || (options ? options.mouse : null); + + if (!mouse) { + if (engine && engine.render && engine.render.canvas) { + mouse = Mouse.create(engine.render.canvas); + } else if (options && options.element) { + mouse = Mouse.create(options.element); + } else { + mouse = Mouse.create(); + Common.warn('MouseConstraint.create: options.mouse was undefined, options.element was undefined, may not function as expected'); + } + } + + var constraint = Constraint.create({ + label: 'Mouse Constraint', + pointA: mouse.position, + pointB: { x: 0, y: 0 }, + length: 0.01, + stiffness: 0.1, + angularStiffness: 1, + render: { + strokeStyle: '#90EE90', + lineWidth: 3 + } + }); + + var defaults = { + type: 'mouseConstraint', + mouse: mouse, + element: null, + body: null, + constraint: constraint, + collisionFilter: { + category: 0x0001, + mask: 0xFFFFFFFF, + group: 0 + } + }; + + var mouseConstraint = Common.extend(defaults, options); + + Events.on(engine, 'beforeUpdate', function() { + var allBodies = Composite.allBodies(engine.world); + MouseConstraint.update(mouseConstraint, allBodies); + MouseConstraint._triggerEvents(mouseConstraint); + }); + + return mouseConstraint; + }; + + /** + * Updates the given mouse constraint. + * @private + * @method update + * @param {MouseConstraint} mouseConstraint + * @param {body[]} bodies + */ + MouseConstraint.update = function(mouseConstraint, bodies) { + var mouse = mouseConstraint.mouse, + constraint = mouseConstraint.constraint, + body = mouseConstraint.body; + + if (mouse.button === 0) { + if (!constraint.bodyB) { + for (var i = 0; i < bodies.length; i++) { + body = bodies[i]; + if (Bounds.contains(body.bounds, mouse.position) + && Detector.canCollide(body.collisionFilter, mouseConstraint.collisionFilter)) { + for (var j = body.parts.length > 1 ? 1 : 0; j < body.parts.length; j++) { + var part = body.parts[j]; + if (Vertices.contains(part.vertices, mouse.position)) { + constraint.pointA = mouse.position; + constraint.bodyB = mouseConstraint.body = body; + constraint.pointB = { x: mouse.position.x - body.position.x, y: mouse.position.y - body.position.y }; + constraint.angleB = body.angle; + + Sleeping.set(body, false); + Events.trigger(mouseConstraint, 'startdrag', { mouse: mouse, body: body }); + + break; + } + } + } + } + } else { + Sleeping.set(constraint.bodyB, false); + constraint.pointA = mouse.position; + } + } else { + constraint.bodyB = mouseConstraint.body = null; + constraint.pointB = null; + + if (body) + Events.trigger(mouseConstraint, 'enddrag', { mouse: mouse, body: body }); + } + }; + + /** + * Triggers mouse constraint events. + * @method _triggerEvents + * @private + * @param {mouse} mouseConstraint + */ + MouseConstraint._triggerEvents = function(mouseConstraint) { + var mouse = mouseConstraint.mouse, + mouseEvents = mouse.sourceEvents; + + if (mouseEvents.mousemove) + Events.trigger(mouseConstraint, 'mousemove', { mouse: mouse }); + + if (mouseEvents.mousedown) + Events.trigger(mouseConstraint, 'mousedown', { mouse: mouse }); + + if (mouseEvents.mouseup) + Events.trigger(mouseConstraint, 'mouseup', { mouse: mouse }); + + // reset the mouse state ready for the next step + Mouse.clearSourceEvents(mouse); + }; + + /* + * + * Events Documentation + * + */ + + /** + * Fired when the mouse has moved (or a touch moves) during the last step + * + * @event mousemove + * @param {} event An event object + * @param {mouse} event.mouse The engine's mouse instance + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired when the mouse is down (or a touch has started) during the last step + * + * @event mousedown + * @param {} event An event object + * @param {mouse} event.mouse The engine's mouse instance + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired when the mouse is up (or a touch has ended) during the last step + * + * @event mouseup + * @param {} event An event object + * @param {mouse} event.mouse The engine's mouse instance + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired when the user starts dragging a body + * + * @event startdrag + * @param {} event An event object + * @param {mouse} event.mouse The engine's mouse instance + * @param {body} event.body The body being dragged + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired when the user ends dragging a body + * + * @event enddrag + * @param {} event An event object + * @param {mouse} event.mouse The engine's mouse instance + * @param {body} event.body The body that has stopped being dragged + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /* + * + * Properties Documentation + * + */ + + /** + * A `String` denoting the type of object. + * + * @property type + * @type string + * @default "constraint" + * @readOnly + */ + + /** + * The `Mouse` instance in use. If not supplied in `MouseConstraint.create`, one will be created. + * + * @property mouse + * @type mouse + * @default mouse + */ + + /** + * The `Body` that is currently being moved by the user, or `null` if no body. + * + * @property body + * @type body + * @default null + */ + + /** + * The `Constraint` object that is used to move the body during interaction. + * + * @property constraint + * @type constraint + */ + + /** + * An `Object` that specifies the collision filter properties. + * The collision filter allows the user to define which types of body this mouse constraint can interact with. + * See `body.collisionFilter` for more information. + * + * @property collisionFilter + * @type object + */ + +})(); + + +/***/ }), +/* 29 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Runner` module is an optional utility which provides a game loop, +* that handles continuously updating a `Matter.Engine` for you within a browser. +* It is intended for development and debugging purposes, but may also be suitable for simple games. +* If you are using your own game loop instead, then you do not need the `Matter.Runner` module. +* Instead just call `Engine.update(engine, delta)` in your own loop. +* +* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). +* +* @class Runner +*/ + +var Runner = {}; + +module.exports = Runner; + +var Events = __webpack_require__(4); +var Engine = __webpack_require__(22); +var Common = __webpack_require__(0); + +(function() { + + var _requestAnimationFrame, + _cancelAnimationFrame; + + if (typeof window !== 'undefined') { + _requestAnimationFrame = window.requestAnimationFrame || window.webkitRequestAnimationFrame + || window.mozRequestAnimationFrame || window.msRequestAnimationFrame; + + _cancelAnimationFrame = window.cancelAnimationFrame || window.mozCancelAnimationFrame + || window.webkitCancelAnimationFrame || window.msCancelAnimationFrame; + } + + if (!_requestAnimationFrame) { + var _frameTimeout; + + _requestAnimationFrame = function(callback){ + _frameTimeout = setTimeout(function() { + callback(Common.now()); + }, 1000 / 60); + }; + + _cancelAnimationFrame = function() { + clearTimeout(_frameTimeout); + }; + } + + /** + * Creates a new Runner. The options parameter is an object that specifies any properties you wish to override the defaults. + * @method create + * @param {} options + */ + Runner.create = function(options) { + var defaults = { + fps: 60, + correction: 1, + deltaSampleSize: 60, + counterTimestamp: 0, + frameCounter: 0, + deltaHistory: [], + timePrev: null, + timeScalePrev: 1, + frameRequestId: null, + isFixed: false, + enabled: true + }; + + var runner = Common.extend(defaults, options); + + runner.delta = runner.delta || 1000 / runner.fps; + runner.deltaMin = runner.deltaMin || 1000 / runner.fps; + runner.deltaMax = runner.deltaMax || 1000 / (runner.fps * 0.5); + runner.fps = 1000 / runner.delta; + + return runner; + }; + + /** + * Continuously ticks a `Matter.Engine` by calling `Runner.tick` on the `requestAnimationFrame` event. + * @method run + * @param {engine} engine + */ + Runner.run = function(runner, engine) { + // create runner if engine is first argument + if (typeof runner.positionIterations !== 'undefined') { + engine = runner; + runner = Runner.create(); + } + + (function render(time){ + runner.frameRequestId = _requestAnimationFrame(render); + + if (time && runner.enabled) { + Runner.tick(runner, engine, time); + } + })(); + + return runner; + }; + + /** + * A game loop utility that updates the engine and renderer by one step (a 'tick'). + * Features delta smoothing, time correction and fixed or dynamic timing. + * Triggers `beforeTick`, `tick` and `afterTick` events on the engine. + * Consider just `Engine.update(engine, delta)` if you're using your own loop. + * @method tick + * @param {runner} runner + * @param {engine} engine + * @param {number} time + */ + Runner.tick = function(runner, engine, time) { + var timing = engine.timing, + correction = 1, + delta; + + // create an event object + var event = { + timestamp: timing.timestamp + }; + + Events.trigger(runner, 'beforeTick', event); + Events.trigger(engine, 'beforeTick', event); // @deprecated + + if (runner.isFixed) { + // fixed timestep + delta = runner.delta; + } else { + // dynamic timestep based on wall clock between calls + delta = (time - runner.timePrev) || runner.delta; + runner.timePrev = time; + + // optimistically filter delta over a few frames, to improve stability + runner.deltaHistory.push(delta); + runner.deltaHistory = runner.deltaHistory.slice(-runner.deltaSampleSize); + delta = Math.min.apply(null, runner.deltaHistory); + + // limit delta + delta = delta < runner.deltaMin ? runner.deltaMin : delta; + delta = delta > runner.deltaMax ? runner.deltaMax : delta; + + // correction for delta + correction = delta / runner.delta; + + // update engine timing object + runner.delta = delta; + } + + // time correction for time scaling + if (runner.timeScalePrev !== 0) + correction *= timing.timeScale / runner.timeScalePrev; + + if (timing.timeScale === 0) + correction = 0; + + runner.timeScalePrev = timing.timeScale; + runner.correction = correction; + + // fps counter + runner.frameCounter += 1; + if (time - runner.counterTimestamp >= 1000) { + runner.fps = runner.frameCounter * ((time - runner.counterTimestamp) / 1000); + runner.counterTimestamp = time; + runner.frameCounter = 0; + } + + Events.trigger(runner, 'tick', event); + Events.trigger(engine, 'tick', event); // @deprecated + + // if world has been modified, clear the render scene graph + if (engine.world.isModified + && engine.render + && engine.render.controller + && engine.render.controller.clear) { + engine.render.controller.clear(engine.render); // @deprecated + } + + // update + Events.trigger(runner, 'beforeUpdate', event); + Engine.update(engine, delta, correction); + Events.trigger(runner, 'afterUpdate', event); + + // render + // @deprecated + if (engine.render && engine.render.controller) { + Events.trigger(runner, 'beforeRender', event); + Events.trigger(engine, 'beforeRender', event); // @deprecated + + engine.render.controller.world(engine.render); + + Events.trigger(runner, 'afterRender', event); + Events.trigger(engine, 'afterRender', event); // @deprecated + } + + Events.trigger(runner, 'afterTick', event); + Events.trigger(engine, 'afterTick', event); // @deprecated + }; + + /** + * Ends execution of `Runner.run` on the given `runner`, by canceling the animation frame request event loop. + * If you wish to only temporarily pause the engine, see `engine.enabled` instead. + * @method stop + * @param {runner} runner + */ + Runner.stop = function(runner) { + _cancelAnimationFrame(runner.frameRequestId); + }; + + /** + * Alias for `Runner.run`. + * @method start + * @param {runner} runner + * @param {engine} engine + */ + Runner.start = function(runner, engine) { + Runner.run(runner, engine); + }; + + /* + * + * Events Documentation + * + */ + + /** + * Fired at the start of a tick, before any updates to the engine or timing + * + * @event beforeTick + * @param {} event An event object + * @param {number} event.timestamp The engine.timing.timestamp of the event + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired after engine timing updated, but just before update + * + * @event tick + * @param {} event An event object + * @param {number} event.timestamp The engine.timing.timestamp of the event + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired at the end of a tick, after engine update and after rendering + * + * @event afterTick + * @param {} event An event object + * @param {number} event.timestamp The engine.timing.timestamp of the event + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired before update + * + * @event beforeUpdate + * @param {} event An event object + * @param {number} event.timestamp The engine.timing.timestamp of the event + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired after update + * + * @event afterUpdate + * @param {} event An event object + * @param {number} event.timestamp The engine.timing.timestamp of the event + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + */ + + /** + * Fired before rendering + * + * @event beforeRender + * @param {} event An event object + * @param {number} event.timestamp The engine.timing.timestamp of the event + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + * @deprecated + */ + + /** + * Fired after rendering + * + * @event afterRender + * @param {} event An event object + * @param {number} event.timestamp The engine.timing.timestamp of the event + * @param {} event.source The source object of the event + * @param {} event.name The name of the event + * @deprecated + */ + + /* + * + * Properties Documentation + * + */ + + /** + * A flag that specifies whether the runner is running or not. + * + * @property enabled + * @type boolean + * @default true + */ + + /** + * A `Boolean` that specifies if the runner should use a fixed timestep (otherwise it is variable). + * If timing is fixed, then the apparent simulation speed will change depending on the frame rate (but behaviour will be deterministic). + * If the timing is variable, then the apparent simulation speed will be constant (approximately, but at the cost of determininism). + * + * @property isFixed + * @type boolean + * @default false + */ + + /** + * A `Number` that specifies the time step between updates in milliseconds. + * If `engine.timing.isFixed` is set to `true`, then `delta` is fixed. + * If it is `false`, then `delta` can dynamically change to maintain the correct apparent simulation speed. + * + * @property delta + * @type number + * @default 1000 / 60 + */ + +})(); + + +/***/ }), +/* 30 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Composites` module contains factory methods for creating composite bodies +* with commonly used configurations (such as stacks and chains). +* +* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). +* +* @class Composites +*/ + +var Composites = {}; + +module.exports = Composites; + +var Composite = __webpack_require__(5); +var Constraint = __webpack_require__(8); +var Common = __webpack_require__(0); +var Body = __webpack_require__(6); +var Bodies = __webpack_require__(16); + +(function() { + + /** + * Create a new composite containing bodies created in the callback in a grid arrangement. + * This function uses the body's bounds to prevent overlaps. + * @method stack + * @param {number} xx + * @param {number} yy + * @param {number} columns + * @param {number} rows + * @param {number} columnGap + * @param {number} rowGap + * @param {function} callback + * @return {composite} A new composite containing objects created in the callback + */ + Composites.stack = function(xx, yy, columns, rows, columnGap, rowGap, callback) { + var stack = Composite.create({ label: 'Stack' }), + x = xx, + y = yy, + lastBody, + i = 0; + + for (var row = 0; row < rows; row++) { + var maxHeight = 0; + + for (var column = 0; column < columns; column++) { + var body = callback(x, y, column, row, lastBody, i); + + if (body) { + var bodyHeight = body.bounds.max.y - body.bounds.min.y, + bodyWidth = body.bounds.max.x - body.bounds.min.x; + + if (bodyHeight > maxHeight) + maxHeight = bodyHeight; + + Body.translate(body, { x: bodyWidth * 0.5, y: bodyHeight * 0.5 }); + + x = body.bounds.max.x + columnGap; + + Composite.addBody(stack, body); + + lastBody = body; + i += 1; + } else { + x += columnGap; + } + } + + y += maxHeight + rowGap; + x = xx; + } + + return stack; + }; + + /** + * Chains all bodies in the given composite together using constraints. + * @method chain + * @param {composite} composite + * @param {number} xOffsetA + * @param {number} yOffsetA + * @param {number} xOffsetB + * @param {number} yOffsetB + * @param {object} options + * @return {composite} A new composite containing objects chained together with constraints + */ + Composites.chain = function(composite, xOffsetA, yOffsetA, xOffsetB, yOffsetB, options) { + var bodies = composite.bodies; + + for (var i = 1; i < bodies.length; i++) { + var bodyA = bodies[i - 1], + bodyB = bodies[i], + bodyAHeight = bodyA.bounds.max.y - bodyA.bounds.min.y, + bodyAWidth = bodyA.bounds.max.x - bodyA.bounds.min.x, + bodyBHeight = bodyB.bounds.max.y - bodyB.bounds.min.y, + bodyBWidth = bodyB.bounds.max.x - bodyB.bounds.min.x; + + var defaults = { + bodyA: bodyA, + pointA: { x: bodyAWidth * xOffsetA, y: bodyAHeight * yOffsetA }, + bodyB: bodyB, + pointB: { x: bodyBWidth * xOffsetB, y: bodyBHeight * yOffsetB } + }; + + var constraint = Common.extend(defaults, options); + + Composite.addConstraint(composite, Constraint.create(constraint)); + } + + composite.label += ' Chain'; + + return composite; + }; + + /** + * Connects bodies in the composite with constraints in a grid pattern, with optional cross braces. + * @method mesh + * @param {composite} composite + * @param {number} columns + * @param {number} rows + * @param {boolean} crossBrace + * @param {object} options + * @return {composite} The composite containing objects meshed together with constraints + */ + Composites.mesh = function(composite, columns, rows, crossBrace, options) { + var bodies = composite.bodies, + row, + col, + bodyA, + bodyB, + bodyC; + + for (row = 0; row < rows; row++) { + for (col = 1; col < columns; col++) { + bodyA = bodies[(col - 1) + (row * columns)]; + bodyB = bodies[col + (row * columns)]; + Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyA, bodyB: bodyB }, options))); + } + + if (row > 0) { + for (col = 0; col < columns; col++) { + bodyA = bodies[col + ((row - 1) * columns)]; + bodyB = bodies[col + (row * columns)]; + Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyA, bodyB: bodyB }, options))); + + if (crossBrace && col > 0) { + bodyC = bodies[(col - 1) + ((row - 1) * columns)]; + Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyC, bodyB: bodyB }, options))); + } + + if (crossBrace && col < columns - 1) { + bodyC = bodies[(col + 1) + ((row - 1) * columns)]; + Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyC, bodyB: bodyB }, options))); + } + } + } + } + + composite.label += ' Mesh'; + + return composite; + }; + + /** + * Create a new composite containing bodies created in the callback in a pyramid arrangement. + * This function uses the body's bounds to prevent overlaps. + * @method pyramid + * @param {number} xx + * @param {number} yy + * @param {number} columns + * @param {number} rows + * @param {number} columnGap + * @param {number} rowGap + * @param {function} callback + * @return {composite} A new composite containing objects created in the callback + */ + Composites.pyramid = function(xx, yy, columns, rows, columnGap, rowGap, callback) { + return Composites.stack(xx, yy, columns, rows, columnGap, rowGap, function(x, y, column, row, lastBody, i) { + var actualRows = Math.min(rows, Math.ceil(columns / 2)), + lastBodyWidth = lastBody ? lastBody.bounds.max.x - lastBody.bounds.min.x : 0; + + if (row > actualRows) + return; + + // reverse row order + row = actualRows - row; + + var start = row, + end = columns - 1 - row; + + if (column < start || column > end) + return; + + // retroactively fix the first body's position, since width was unknown + if (i === 1) { + Body.translate(lastBody, { x: (column + (columns % 2 === 1 ? 1 : -1)) * lastBodyWidth, y: 0 }); + } + + var xOffset = lastBody ? column * lastBodyWidth : 0; + + return callback(xx + xOffset + column * columnGap, y, column, row, lastBody, i); + }); + }; + + /** + * Creates a composite with a Newton's Cradle setup of bodies and constraints. + * @method newtonsCradle + * @param {number} xx + * @param {number} yy + * @param {number} number + * @param {number} size + * @param {number} length + * @return {composite} A new composite newtonsCradle body + */ + Composites.newtonsCradle = function(xx, yy, number, size, length) { + var newtonsCradle = Composite.create({ label: 'Newtons Cradle' }); + + for (var i = 0; i < number; i++) { + var separation = 1.9, + circle = Bodies.circle(xx + i * (size * separation), yy + length, size, + { inertia: Infinity, restitution: 1, friction: 0, frictionAir: 0.0001, slop: 1 }), + constraint = Constraint.create({ pointA: { x: xx + i * (size * separation), y: yy }, bodyB: circle }); + + Composite.addBody(newtonsCradle, circle); + Composite.addConstraint(newtonsCradle, constraint); + } + + return newtonsCradle; + }; + + /** + * Creates a composite with simple car setup of bodies and constraints. + * @method car + * @param {number} xx + * @param {number} yy + * @param {number} width + * @param {number} height + * @param {number} wheelSize + * @return {composite} A new composite car body + */ + Composites.car = function(xx, yy, width, height, wheelSize) { + var group = Body.nextGroup(true), + wheelBase = 20, + wheelAOffset = -width * 0.5 + wheelBase, + wheelBOffset = width * 0.5 - wheelBase, + wheelYOffset = 0; + + var car = Composite.create({ label: 'Car' }), + body = Bodies.rectangle(xx, yy, width, height, { + collisionFilter: { + group: group + }, + chamfer: { + radius: height * 0.5 + }, + density: 0.0002 + }); + + var wheelA = Bodies.circle(xx + wheelAOffset, yy + wheelYOffset, wheelSize, { + collisionFilter: { + group: group + }, + friction: 0.8 + }); + + var wheelB = Bodies.circle(xx + wheelBOffset, yy + wheelYOffset, wheelSize, { + collisionFilter: { + group: group + }, + friction: 0.8 + }); + + var axelA = Constraint.create({ + bodyB: body, + pointB: { x: wheelAOffset, y: wheelYOffset }, + bodyA: wheelA, + stiffness: 1, + length: 0 + }); + + var axelB = Constraint.create({ + bodyB: body, + pointB: { x: wheelBOffset, y: wheelYOffset }, + bodyA: wheelB, + stiffness: 1, + length: 0 + }); + + Composite.addBody(car, body); + Composite.addBody(car, wheelA); + Composite.addBody(car, wheelB); + Composite.addConstraint(car, axelA); + Composite.addConstraint(car, axelB); + + return car; + }; + + /** + * Creates a simple soft body like object. + * @method softBody + * @param {number} xx + * @param {number} yy + * @param {number} columns + * @param {number} rows + * @param {number} columnGap + * @param {number} rowGap + * @param {boolean} crossBrace + * @param {number} particleRadius + * @param {} particleOptions + * @param {} constraintOptions + * @return {composite} A new composite softBody + */ + Composites.softBody = function(xx, yy, columns, rows, columnGap, rowGap, crossBrace, particleRadius, particleOptions, constraintOptions) { + particleOptions = Common.extend({ inertia: Infinity }, particleOptions); + constraintOptions = Common.extend({ stiffness: 0.2, render: { type: 'line', anchors: false } }, constraintOptions); + + var softBody = Composites.stack(xx, yy, columns, rows, columnGap, rowGap, function(x, y) { + return Bodies.circle(x, y, particleRadius, particleOptions); + }); + + Composites.mesh(softBody, columns, rows, crossBrace, constraintOptions); + + softBody.label = 'Soft Body'; + + return softBody; + }; + +})(); + + +/***/ }), +/* 31 */ +/***/ (function(module, exports, __webpack_require__) { + +/** +* The `Matter.Svg` module contains methods for converting SVG images into an array of vector points. +* +* To use this module you also need the SVGPathSeg polyfill: https://github.com/progers/pathseg +* +* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). +* +* @class Svg +*/ + +var Svg = {}; + +module.exports = Svg; + +var Bounds = __webpack_require__(1); +var Common = __webpack_require__(0); + +(function() { + + /** + * Converts an SVG path into an array of vector points. + * If the input path forms a concave shape, you must decompose the result into convex parts before use. + * See `Bodies.fromVertices` which provides support for this. + * Note that this function is not guaranteed to support complex paths (such as those with holes). + * You must load the `pathseg.js` polyfill on newer browsers. + * @method pathToVertices + * @param {SVGPathElement} path + * @param {Number} [sampleLength=15] + * @return {Vector[]} points + */ + Svg.pathToVertices = function(path, sampleLength) { + if (typeof window !== 'undefined' && !('SVGPathSeg' in window)) { + Common.warn('Svg.pathToVertices: SVGPathSeg not defined, a polyfill is required.'); + } + + // https://github.com/wout/svg.topoly.js/blob/master/svg.topoly.js + var i, il, total, point, segment, segments, + segmentsQueue, lastSegment, + lastPoint, segmentIndex, points = [], + lx, ly, length = 0, x = 0, y = 0; + + sampleLength = sampleLength || 15; + + var addPoint = function(px, py, pathSegType) { + // all odd-numbered path types are relative except PATHSEG_CLOSEPATH (1) + var isRelative = pathSegType % 2 === 1 && pathSegType > 1; + + // when the last point doesn't equal the current point add the current point + if (!lastPoint || px != lastPoint.x || py != lastPoint.y) { + if (lastPoint && isRelative) { + lx = lastPoint.x; + ly = lastPoint.y; + } else { + lx = 0; + ly = 0; + } + + var point = { + x: lx + px, + y: ly + py + }; + + // set last point + if (isRelative || !lastPoint) { + lastPoint = point; + } + + points.push(point); + + x = lx + px; + y = ly + py; + } + }; + + var addSegmentPoint = function(segment) { + var segType = segment.pathSegTypeAsLetter.toUpperCase(); + + // skip path ends + if (segType === 'Z') + return; + + // map segment to x and y + switch (segType) { + + case 'M': + case 'L': + case 'T': + case 'C': + case 'S': + case 'Q': + x = segment.x; + y = segment.y; + break; + case 'H': + x = segment.x; + break; + case 'V': + y = segment.y; + break; + } + + addPoint(x, y, segment.pathSegType); + }; + + // ensure path is absolute + Svg._svgPathToAbsolute(path); + + // get total length + total = path.getTotalLength(); + + // queue segments + segments = []; + for (i = 0; i < path.pathSegList.numberOfItems; i += 1) + segments.push(path.pathSegList.getItem(i)); + + segmentsQueue = segments.concat(); + + // sample through path + while (length < total) { + // get segment at position + segmentIndex = path.getPathSegAtLength(length); + segment = segments[segmentIndex]; + + // new segment + if (segment != lastSegment) { + while (segmentsQueue.length && segmentsQueue[0] != segment) + addSegmentPoint(segmentsQueue.shift()); + + lastSegment = segment; + } + + // add points in between when curving + // TODO: adaptive sampling + switch (segment.pathSegTypeAsLetter.toUpperCase()) { + + case 'C': + case 'T': + case 'S': + case 'Q': + case 'A': + point = path.getPointAtLength(length); + addPoint(point.x, point.y, 0); + break; + + } + + // increment by sample value + length += sampleLength; + } + + // add remaining segments not passed by sampling + for (i = 0, il = segmentsQueue.length; i < il; ++i) + addSegmentPoint(segmentsQueue[i]); + + return points; + }; + + Svg._svgPathToAbsolute = function(path) { + // http://phrogz.net/convert-svg-path-to-all-absolute-commands + // Copyright (c) Gavin Kistner + // http://phrogz.net/js/_ReuseLicense.txt + // Modifications: tidy formatting and naming + var x0, y0, x1, y1, x2, y2, segs = path.pathSegList, + x = 0, y = 0, len = segs.numberOfItems; + + for (var i = 0; i < len; ++i) { + var seg = segs.getItem(i), + segType = seg.pathSegTypeAsLetter; + + if (/[MLHVCSQTA]/.test(segType)) { + if ('x' in seg) x = seg.x; + if ('y' in seg) y = seg.y; + } else { + if ('x1' in seg) x1 = x + seg.x1; + if ('x2' in seg) x2 = x + seg.x2; + if ('y1' in seg) y1 = y + seg.y1; + if ('y2' in seg) y2 = y + seg.y2; + if ('x' in seg) x += seg.x; + if ('y' in seg) y += seg.y; + + switch (segType) { + + case 'm': + segs.replaceItem(path.createSVGPathSegMovetoAbs(x, y), i); + break; + case 'l': + segs.replaceItem(path.createSVGPathSegLinetoAbs(x, y), i); + break; + case 'h': + segs.replaceItem(path.createSVGPathSegLinetoHorizontalAbs(x), i); + break; + case 'v': + segs.replaceItem(path.createSVGPathSegLinetoVerticalAbs(y), i); + break; + case 'c': + segs.replaceItem(path.createSVGPathSegCurvetoCubicAbs(x, y, x1, y1, x2, y2), i); + break; + case 's': + segs.replaceItem(path.createSVGPathSegCurvetoCubicSmoothAbs(x, y, x2, y2), i); + break; + case 'q': + segs.replaceItem(path.createSVGPathSegCurvetoQuadraticAbs(x, y, x1, y1), i); + break; + case 't': + segs.replaceItem(path.createSVGPathSegCurvetoQuadraticSmoothAbs(x, y), i); + break; + case 'a': + segs.replaceItem(path.createSVGPathSegArcAbs(x, y, seg.r1, seg.r2, seg.angle, seg.largeArcFlag, seg.sweepFlag), i); + break; + case 'z': + case 'Z': + x = x0; + y = y0; + break; + + } + } + + if (segType == 'M' || segType == 'm') { + x0 = x; + y0 = y; + } + } + }; + +})(); + +/***/ }), +/* 32 */ +/***/ (function(module, exports, __webpack_require__) { + /** * The `Matter.RenderPixi` module is an example renderer using pixi.js. * See also `Matter.Render` for a canvas based renderer. @@ -9854,11 +10298,11 @@ var RenderPixi = {}; module.exports = RenderPixi; -var Bounds = _dereq_('../geometry/Bounds'); -var Composite = _dereq_('../body/Composite'); -var Common = _dereq_('../core/Common'); -var Events = _dereq_('../core/Events'); -var Vector = _dereq_('../geometry/Vector'); +var Bounds = __webpack_require__(1); +var Composite = __webpack_require__(5); +var Common = __webpack_require__(0); +var Events = __webpack_require__(4); +var Vector = __webpack_require__(2); (function() { @@ -10328,7 +10772,7 @@ var Vector = _dereq_('../geometry/Vector'); primitive.moveTo(part.position.x - body.position.x, part.position.y - body.position.y); primitive.lineTo(((part.vertices[0].x + part.vertices[part.vertices.length-1].x) / 2 - body.position.x), - ((part.vertices[0].y + part.vertices[part.vertices.length-1].y) / 2 - body.position.y)); + ((part.vertices[0].y + part.vertices[part.vertices.length-1].y) / 2 - body.position.y)); primitive.endFill(); } @@ -10357,5 +10801,7 @@ var Vector = _dereq_('../geometry/Vector'); })(); -},{"../body/Composite":2,"../core/Common":14,"../core/Events":16,"../geometry/Bounds":26,"../geometry/Vector":28}]},{},[30])(30) -}); + +/***/ }) +/******/ ]); +}); \ No newline at end of file diff --git a/build/matter.min.js b/build/matter.min.js index 8255c59..81784de 100644 --- a/build/matter.min.js +++ b/build/matter.min.js @@ -1,96 +1,6 @@ -/** -* matter-js 0.14.2 by @liabru 2018-06-11 -* http://brm.io/matter-js/ -* License MIT -*/ -!function(e){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=e();else if("function"==typeof define&&define.amd)define([],e);else{var t;t="undefined"!=typeof window?window:"undefined"!=typeof global?global:"undefined"!=typeof self?self:this,t.Matter=e()}}(function(){return function(){function e(t,n,o){function i(s,a){if(!n[s]){if(!t[s]){var l="function"==typeof require&&require;if(!a&&l)return l(s,!0);if(r)return r(s,!0);var c=new Error("Cannot find module '"+s+"'");throw c.code="MODULE_NOT_FOUND",c}var d=n[s]={exports:{}};t[s][0].call(d.exports,function(e){return i(t[s][1][e]||e)},d,d.exports,e,t,n,o)}return n[s].exports}for(var r="function"==typeof require&&require,s=0;s0&&r.rotateAbout(s.position,n,e.position,s.position)}},o.setVelocity=function(e,t){e.positionPrev.x=e.position.x-t.x,e.positionPrev.y=e.position.y-t.y, -e.velocity.x=t.x,e.velocity.y=t.y,e.speed=r.magnitude(e.velocity)},o.setAngularVelocity=function(e,t){e.anglePrev=e.angle-t,e.angularVelocity=t,e.angularSpeed=Math.abs(e.angularVelocity)},o.translate=function(e,t){o.setPosition(e,r.add(e.position,t))},o.rotate=function(e,t,n){if(n){var i=Math.cos(t),r=Math.sin(t),s=e.position.x-n.x,a=e.position.y-n.y;o.setPosition(e,{x:n.x+(s*i-a*r),y:n.y+(s*r+a*i)}),o.setAngle(e,e.angle+t)}else o.setAngle(e,e.angle+t)},o.scale=function(e,t,n,r){var s=0,a=0;r=r||e.position;for(var d=0;d0&&(s+=u.area,a+=u.inertia),u.position.x=r.x+(u.position.x-r.x)*t,u.position.y=r.y+(u.position.y-r.y)*n,l.update(u.bounds,u.vertices,e.velocity) -}e.parts.length>1&&(e.area=s,e.isStatic||(o.setMass(e,e.density*s),o.setInertia(e,a))),e.circleRadius&&(t===n?e.circleRadius*=t:e.circleRadius=null)},o.update=function(e,t,n,o){var s=Math.pow(t*n*e.timeScale,2),a=1-e.frictionAir*n*e.timeScale,d=e.position.x-e.positionPrev.x,u=e.position.y-e.positionPrev.y;e.velocity.x=d*a*o+e.force.x/e.mass*s,e.velocity.y=u*a*o+e.force.y/e.mass*s,e.positionPrev.x=e.position.x,e.positionPrev.y=e.position.y,e.position.x+=e.velocity.x,e.position.y+=e.velocity.y,e.angularVelocity=(e.angle-e.anglePrev)*a*o+e.torque/e.inertia*s,e.anglePrev=e.angle,e.angle+=e.angularVelocity,e.speed=r.magnitude(e.velocity),e.angularSpeed=Math.abs(e.angularVelocity);for(var p=0;p0&&(f.position.x+=e.velocity.x,f.position.y+=e.velocity.y),0!==e.angularVelocity&&(i.rotate(f.vertices,e.angularVelocity,e.position),c.rotate(f.axes,e.angularVelocity), -p>0&&r.rotateAbout(f.position,e.angularVelocity,e.position,f.position)),l.update(f.bounds,f.vertices,e.velocity)}},o.applyForce=function(e,t,n){e.force.x+=n.x,e.force.y+=n.y;var o={x:t.x-e.position.x,y:t.y-e.position.y};e.torque+=o.x*n.y-o.y*n.x},o._totalProperties=function(e){for(var t={mass:0,area:0,inertia:0,centre:{x:0,y:0}},n=1===e.parts.length?0:1;n1?1:0;u1?1:0;f0:0!=(e.mask&t.category)&&0!=(t.mask&e.category)}}()},{"../geometry/Bounds":26,"./Pair":7,"./SAT":11}],6:[function(e,t,n){var o={};t.exports=o;var i=e("./Pair"),r=e("./Detector"),s=e("../core/Common");!function(){o.create=function(e){var t={controller:o,detector:r.collisions,buckets:{},pairs:{},pairsList:[],bucketWidth:48,bucketHeight:48};return s.extend(t,e)},o.update=function(e,t,n,i){ -var r,s,a,l,c,d=n.world,u=e.buckets,p=!1;for(r=0;rd.bounds.max.x||f.bounds.max.yd.bounds.max.y)){var m=o._getRegion(e,f);if(!f.region||m.id!==f.region.id||i){f.region&&!i||(f.region=m);var v=o._regionUnion(m,f.region);for(s=v.startCol;s<=v.endCol;s++)for(a=v.startRow;a<=v.endRow;a++){c=o._getBucketId(s,a),l=u[c];var y=s>=m.startCol&&s<=m.endCol&&a>=m.startRow&&a<=m.endRow,g=s>=f.region.startCol&&s<=f.region.endCol&&a>=f.region.startRow&&a<=f.region.endRow;!y&&g&&g&&l&&o._bucketRemoveBody(e,l,f),(f.region===m||y&&!g||i)&&(l||(l=o._createBucket(u,c)),o._bucketAddBody(e,l,f))}f.region=m,p=!0}}}p&&(e.pairsList=o._createActivePairsList(e))},o.clear=function(e){e.buckets={},e.pairs={},e.pairsList=[]},o._regionUnion=function(e,t){var n=Math.min(e.startCol,t.startCol),i=Math.max(e.endCol,t.endCol),r=Math.min(e.startRow,t.startRow),s=Math.max(e.endRow,t.endRow) -;return o._createRegion(n,i,r,s)},o._getRegion=function(e,t){var n=t.bounds,i=Math.floor(n.min.x/e.bucketWidth),r=Math.floor(n.max.x/e.bucketWidth),s=Math.floor(n.min.y/e.bucketHeight),a=Math.floor(n.max.y/e.bucketHeight);return o._createRegion(i,r,s,a)},o._createRegion=function(e,t,n,o){return{id:e+","+t+","+n+","+o,startCol:e,endCol:t,startRow:n,endRow:o}},o._getBucketId=function(e,t){return"C"+e+"R"+t},o._createBucket=function(e,t){return e[t]=[]},o._bucketAddBody=function(e,t,n){for(var o=0;o0?o.push(n):delete e.pairs[t[i]];return o}}()},{"../core/Common":14,"./Detector":5,"./Pair":7}], -7:[function(e,t,n){var o={};t.exports=o;var i=e("./Contact");!function(){o.create=function(e,t){var n=e.bodyA,i=e.bodyB,r=e.parentA,s=e.parentB,a={id:o.id(n,i),bodyA:n,bodyB:i,contacts:{},activeContacts:[],separation:0,isActive:!0,isSensor:n.isSensor||i.isSensor,timeCreated:t,timeUpdated:t,inverseMass:r.inverseMass+s.inverseMass,friction:Math.min(r.friction,s.friction),frictionStatic:Math.max(r.frictionStatic,s.frictionStatic),restitution:Math.max(r.restitution,s.restitution),slop:Math.max(r.slop,s.slop)};return o.update(a,e,t),a},o.update=function(e,t,n){var r=e.contacts,s=t.supports,a=e.activeContacts,l=t.parentA,c=t.parentB;if(e.collision=t,e.inverseMass=l.inverseMass+c.inverseMass,e.friction=Math.min(l.friction,c.friction),e.frictionStatic=Math.max(l.frictionStatic,c.frictionStatic),e.restitution=Math.max(l.restitution,c.restitution),e.slop=Math.max(l.slop,c.slop),a.length=0,t.collided){for(var d=0;do._pairMaxIdleLife&&c.push(s);for(s=0;sf.friction*f.frictionStatic*E*n&&(F=T,L=s.clamp(f.friction*R*n,-F,F));var O=r.cross(A,g),q=r.cross(P,g),W=b/(v.inverseMass+y.inverseMass+v.inverseInertia*O*O+y.inverseInertia*q*q);if(V*=W,L*=W,I<0&&I*I>o._restingThresh*n)S.normalImpulse=0;else{var D=S.normalImpulse;S.normalImpulse=Math.min(S.normalImpulse+V,0),V=S.normalImpulse-D}if(_*_>o._restingThreshTangent*n)S.tangentImpulse=0;else{var N=S.tangentImpulse;S.tangentImpulse=s.clamp(S.tangentImpulse+L,-F,F),L=S.tangentImpulse-N}i.x=g.x*V+x.x*L,i.y=g.y*V+x.y*L,v.isStatic||v.isSleeping||(v.positionPrev.x+=i.x*v.inverseMass,v.positionPrev.y+=i.y*v.inverseMass, -v.anglePrev+=r.cross(A,i)*v.inverseInertia),y.isStatic||y.isSleeping||(y.positionPrev.x-=i.x*y.inverseMass,y.positionPrev.y-=i.y*y.inverseMass,y.anglePrev-=r.cross(P,i)*y.inverseInertia)}}}}}()},{"../core/Common":14,"../geometry/Bounds":26,"../geometry/Vector":28,"../geometry/Vertices":29}],11:[function(e,t,n){var o={};t.exports=o;var i=e("../geometry/Vertices"),r=e("../geometry/Vector");!function(){o.collides=function(e,t,n){var s,a,l,c,d=!1;if(n){var u=e.parent,p=t.parent,f=u.speed*u.speed+u.angularSpeed*u.angularSpeed+p.speed*p.speed+p.angularSpeed*p.angularSpeed;d=n&&n.collided&&f<.2,c=n}else c={collided:!1,bodyA:e,bodyB:t};if(n&&d){var m=c.axisBody,v=m===e?t:e,y=[m.axes[n.axisNumber]];if(l=o._overlapAxes(m.vertices,v.vertices,y),c.reused=!0,l.overlap<=0)return c.collided=!1,c}else{if(s=o._overlapAxes(e.vertices,t.vertices,e.axes),s.overlap<=0)return c.collided=!1,c;if(a=o._overlapAxes(t.vertices,e.vertices,t.axes),a.overlap<=0)return c.collided=!1,c;s.overlapi?i=a:a=0?s.index-1:d.length-1],c.x=i.x-u.x,c.y=i.y-u.y,l=-r.dot(n,c),a=i,i=d[(s.index+1)%d.length],c.x=i.x-u.x,c.y=i.y-u.y,o=-r.dot(n,c),o0?1:.7),t.damping=t.damping||0,t.angularStiffness=t.angularStiffness||0,t.angleA=t.bodyA?t.bodyA.angle:t.angleA,t.angleB=t.bodyB?t.bodyB.angle:t.angleB,t.plugin={};var s={visible:!0,lineWidth:2,strokeStyle:"#ffffff",type:"line",anchors:!0};return 0===t.length&&t.stiffness>.1?(s.type="pin",s.anchors=!1):t.stiffness<.9&&(s.type="spring"),t.render=c.extend(s,t.render),t},o.preSolveAll=function(e){for(var t=0;t0&&(u.position.x+=c.x,u.position.y+=c.y),0!==c.angle&&(i.rotate(u.vertices,c.angle,n.position),l.rotate(u.axes,c.angle), -d>0&&r.rotateAbout(u.position,c.angle,n.position,u.position)),a.update(u.bounds,u.vertices,n.velocity)}c.angle*=o._warming,c.x*=o._warming,c.y*=o._warming}}}}()},{"../core/Common":14,"../core/Sleeping":22,"../geometry/Axes":25,"../geometry/Bounds":26,"../geometry/Vector":28,"../geometry/Vertices":29}],13:[function(e,t,n){var o={};t.exports=o;var i=e("../geometry/Vertices"),r=e("../core/Sleeping"),s=e("../core/Mouse"),a=e("../core/Events"),l=e("../collision/Detector"),c=e("./Constraint"),d=e("../body/Composite"),u=e("../core/Common"),p=e("../geometry/Bounds");!function(){o.create=function(e,t){var n=(e?e.mouse:null)||(t?t.mouse:null);n||(e&&e.render&&e.render.canvas?n=s.create(e.render.canvas):t&&t.element?n=s.create(t.element):(n=s.create(),u.warn("MouseConstraint.create: options.mouse was undefined, options.element was undefined, may not function as expected")));var i=c.create({label:"Mouse Constraint",pointA:n.position,pointB:{x:0,y:0},length:.01,stiffness:.1,angularStiffness:1, -render:{strokeStyle:"#90EE90",lineWidth:3}}),r={type:"mouseConstraint",mouse:n,element:null,body:null,constraint:i,collisionFilter:{category:1,mask:4294967295,group:0}},l=u.extend(r,t);return a.on(e,"beforeUpdate",function(){var t=d.allBodies(e.world);o.update(l,t),o._triggerEvents(l)}),l},o.update=function(e,t){var n=e.mouse,o=e.constraint,s=e.body;if(0===n.button){if(o.bodyB)r.set(o.bodyB,!1),o.pointA=n.position;else for(var c=0;c1?1:0;d0;t--){var n=Math.floor(o.random()*(t+1)),i=e[t];e[t]=e[n],e[n]=i}return e},o.choose=function(e){return e[Math.floor(o.random()*e.length)]},o.isElement=function(e){return"undefined"!=typeof HTMLElement?e instanceof HTMLElement:!!(e&&e.nodeType&&e.nodeName)},o.isArray=function(e){return"[object Array]"===Object.prototype.toString.call(e)},o.isFunction=function(e){return"function"==typeof e},o.isPlainObject=function(e){return"object"==typeof e&&e.constructor===Object},o.isString=function(e){return"[object String]"===toString.call(e)},o.clamp=function(e,t,n){return en?n:e},o.sign=function(e){return e<0?-1:1},o.now=function(){ -if(window.performance){if(window.performance.now)return window.performance.now();if(window.performance.webkitNow)return window.performance.webkitNow()}return new Date-o._nowStartTime},o.random=function(e,n){return e=void 0!==e?e:0,n=void 0!==n?n:1,e+t()*(n-e)};var t=function(){return o._seed=(9301*o._seed+49297)%233280,o._seed/233280};o.colorToNumber=function(e){return e=e.replace("#",""),3==e.length&&(e=e.charAt(0)+e.charAt(0)+e.charAt(1)+e.charAt(1)+e.charAt(2)+e.charAt(2)),parseInt(e,16)},o.logLevel=1,o.log=function(){console&&o.logLevel>0&&o.logLevel<=3&&console.log.apply(console,["matter-js:"].concat(Array.prototype.slice.call(arguments)))},o.info=function(){console&&o.logLevel>0&&o.logLevel<=2&&console.info.apply(console,["matter-js:"].concat(Array.prototype.slice.call(arguments)))},o.warn=function(){console&&o.logLevel>0&&o.logLevel<=3&&console.warn.apply(console,["matter-js:"].concat(Array.prototype.slice.call(arguments)))},o.nextId=function(){return o._nextId++}, -o.indexOf=function(e,t){if(e.indexOf)return e.indexOf(t);for(var n=0;n0&&d.trigger(e,"collisionStart",{pairs:h.collisionStart}),s.preSolvePosition(h.list),i=0;i0&&d.trigger(e,"collisionActive",{pairs:h.collisionActive}),h.collisionEnd.length>0&&d.trigger(e,"collisionEnd",{pairs:h.collisionEnd}),o._bodiesClearForces(y),d.trigger(e,"afterUpdate",v),e},o.merge=function(e,t){if(f.extend(e,t),t.world){e.world=t.world,o.clear(e);for(var n=u.allBodies(e.world),i=0;ir?(i.warn("Plugin.register:",o.toString(t),"was upgraded to",o.toString(e)),o._registry[e.name]=e):n-1},o.isFor=function(e,t){var n=e.for&&o.dependencyParse(e.for) -;return!e.for||t.name===n.name&&o.versionSatisfies(t.version,n.range)},o.use=function(e,t){if(e.uses=(e.uses||[]).concat(t||[]),0===e.uses.length)return void i.warn("Plugin.use:",o.toString(e),"does not specify any dependencies to install.");for(var n=o.dependencies(e),r=i.topologicalSort(n),s=[],a=0;a0&&i.info(s.join(" "))},o.dependencies=function(e,t){var n=o.dependencyParse(e),r=n.name;if(t=t||{},!(r in t)){e=o.resolve(e)||e,t[r]=i.map(e.uses||[],function(t){o.isPlugin(t)&&o.register(t);var r=o.dependencyParse(t),s=o.resolve(t) -;return s&&!o.versionSatisfies(s.version,r.range)?(i.warn("Plugin.dependencies:",o.toString(s),"does not satisfy",o.toString(r),"used by",o.toString(n)+"."),s._warned=!0,e._warned=!0):s||(i.warn("Plugin.dependencies:",o.toString(t),"used by",o.toString(n),"could not be resolved."),e._warned=!0),r.name});for(var s=0;s=i[2];if("^"===n.operator)return i[0]>0?s[0]===i[0]&&r.number>=n.number:i[1]>0?s[1]===i[1]&&s[2]>=i[2]:s[2]===i[2]}return e===t||"*"===e}}()},{"./Common":14}],21:[function(e,t,n){var o={};t.exports=o;var i=e("./Events"),r=e("./Engine"),s=e("./Common");!function(){var e,t;if("undefined"!=typeof window&&(e=window.requestAnimationFrame||window.webkitRequestAnimationFrame||window.mozRequestAnimationFrame||window.msRequestAnimationFrame,t=window.cancelAnimationFrame||window.mozCancelAnimationFrame||window.webkitCancelAnimationFrame||window.msCancelAnimationFrame),!e){var n;e=function(e){n=setTimeout(function(){e(s.now())},1e3/60)},t=function(){clearTimeout(n)}}o.create=function(e){var t={fps:60,correction:1,deltaSampleSize:60, -counterTimestamp:0,frameCounter:0,deltaHistory:[],timePrev:null,timeScalePrev:1,frameRequestId:null,isFixed:!1,enabled:!0},n=s.extend(t,e);return n.delta=n.delta||1e3/n.fps,n.deltaMin=n.deltaMin||1e3/n.fps,n.deltaMax=n.deltaMax||1e3/(.5*n.fps),n.fps=1e3/n.delta,n},o.run=function(t,n){return void 0!==t.positionIterations&&(n=t,t=o.create()),function i(r){t.frameRequestId=e(i),r&&t.enabled&&o.tick(t,n,r)}(),t},o.tick=function(e,t,n){var o,s=t.timing,a=1,l={timestamp:s.timestamp};i.trigger(e,"beforeTick",l),i.trigger(t,"beforeTick",l),e.isFixed?o=e.delta:(o=n-e.timePrev||e.delta,e.timePrev=n,e.deltaHistory.push(o),e.deltaHistory=e.deltaHistory.slice(-e.deltaSampleSize),o=Math.min.apply(null,e.deltaHistory),o=oe.deltaMax?e.deltaMax:o,a=o/e.delta,e.delta=o),0!==e.timeScalePrev&&(a*=s.timeScale/e.timeScalePrev),0===s.timeScale&&(a=0),e.timeScalePrev=s.timeScale,e.correction=a,e.frameCounter+=1, -n-e.counterTimestamp>=1e3&&(e.fps=e.frameCounter*((n-e.counterTimestamp)/1e3),e.counterTimestamp=n,e.frameCounter=0),i.trigger(e,"tick",l),i.trigger(t,"tick",l),t.world.isModified&&t.render&&t.render.controller&&t.render.controller.clear&&t.render.controller.clear(t.render),i.trigger(e,"beforeUpdate",l),r.update(t,o,a),i.trigger(e,"afterUpdate",l),t.render&&t.render.controller&&(i.trigger(e,"beforeRender",l),i.trigger(t,"beforeRender",l),t.render.controller.world(t.render),i.trigger(e,"afterRender",l),i.trigger(t,"afterRender",l)),i.trigger(e,"afterTick",l),i.trigger(t,"afterTick",l)},o.stop=function(e){t(e.frameRequestId)},o.start=function(e,t){o.run(e,t)}}()},{"./Common":14,"./Engine":15,"./Events":16}],22:[function(e,t,n){var o={};t.exports=o;var i=e("./Events");!function(){o._motionWakeThreshold=.18,o._motionSleepThreshold=.08,o._minBias=.9,o.update=function(e,t){for(var n=t*t*t,i=0;i0&&r.motion=r.sleepThreshold&&o.set(r,!0)):r.sleepCounter>0&&(r.sleepCounter-=1)}else o.set(r,!1)}},o.afterCollisions=function(e,t){for(var n=t*t*t,i=0;io._motionWakeThreshold*n&&o.set(c,!1)}}}},o.set=function(e,t){var n=e.isSleeping;t?(e.isSleeping=!0,e.sleepCounter=e.sleepThreshold,e.positionImpulse.x=0,e.positionImpulse.y=0,e.positionPrev.x=e.position.x,e.positionPrev.y=e.position.y,e.anglePrev=e.angle,e.speed=0,e.angularSpeed=0,e.motion=0,n||i.trigger(e,"sleepStart")):(e.isSleeping=!1,e.sleepCounter=0,n&&i.trigger(e,"sleepEnd"))}}()},{ -"./Events":16}],23:[function(e,t,n){var o={};t.exports=o;var i,r=e("../geometry/Vertices"),s=e("../core/Common"),a=e("../body/Body"),l=e("../geometry/Bounds"),c=e("../geometry/Vector");!function(){o.rectangle=function(e,t,n,o,i){i=i||{};var l={label:"Rectangle Body",position:{x:e,y:t},vertices:r.fromPath("L 0 0 L "+n+" 0 L "+n+" "+o+" L 0 "+o)};if(i.chamfer){var c=i.chamfer;l.vertices=r.chamfer(l.vertices,c.radius,c.quality,c.qualityMin,c.qualityMax),delete i.chamfer}return a.create(s.extend({},l,i))},o.trapezoid=function(e,t,n,o,i,l){l=l||{},i*=.5;var c,d=(1-2*i)*n,u=n*i,p=u+d,f=p+u;c=i<.5?"L 0 0 L "+u+" "+-o+" L "+p+" "+-o+" L "+f+" 0":"L 0 0 L "+p+" "+-o+" L "+f+" 0";var m={label:"Trapezoid Body",position:{x:e,y:t},vertices:r.fromPath(c)};if(l.chamfer){var v=l.chamfer;m.vertices=r.chamfer(m.vertices,v.radius,v.quality,v.qualityMin,v.qualityMax),delete l.chamfer}return a.create(s.extend({},m,l))},o.circle=function(e,t,n,i,r){i=i||{};var a={label:"Circle Body",circleRadius:n};r=r||25 -;var l=Math.ceil(Math.max(10,Math.min(r,n)));return l%2==1&&(l+=1),o.polygon(e,t,l,n,s.extend({},a,i))},o.polygon=function(e,t,n,i,l){if(l=l||{},n<3)return o.circle(e,t,i,l);for(var c=2*Math.PI/n,d="",u=.5*c,p=0;p0&&r.area(P)1?(f=a.create(s.extend({parts:m.slice(0)},o)),a.setPosition(f,{x:e,y:t}),f):m[0]}}()},{"../body/Body":1,"../core/Common":14,"../geometry/Bounds":26,"../geometry/Vector":28,"../geometry/Vertices":29}],24:[function(e,t,n){var o={};t.exports=o -;var i=e("../body/Composite"),r=e("../constraint/Constraint"),s=e("../core/Common"),a=e("../body/Body"),l=e("./Bodies");!function(){o.stack=function(e,t,n,o,r,s,l){for(var c,d=i.create({label:"Stack"}),u=e,p=t,f=0,m=0;mv&&(v=x),a.translate(g,{x:.5*h,y:.5*x}),u=g.bounds.max.x+r,i.addBody(d,g),c=g,f+=1}else u+=r}p+=v+s,u=e}return d},o.chain=function(e,t,n,o,a,l){for(var c=e.bodies,d=1;d0)for(c=0;c0&&(p=f[c-1+(l-1)*t],i.addConstraint(e,r.create(s.extend({bodyA:p,bodyB:u},a)))),o&&cp)){c=p-c;var m=c,v=n-1-c;if(!(sv)){1===u&&a.translate(d,{x:(s+(n%2==1?1:-1))*f,y:0});return l(e+(d?s*f:0)+s*r,o,s,c,d,u)}}})},o.newtonsCradle=function(e,t,n,o,s){for(var a=i.create({label:"Newtons Cradle"}),c=0;ce.max.x&&(e.max.x=i.x),i.xe.max.y&&(e.max.y=i.y),i.y0?e.max.x+=n.x:e.min.x+=n.x,n.y>0?e.max.y+=n.y:e.min.y+=n.y)},o.contains=function(e,t){return t.x>=e.min.x&&t.x<=e.max.x&&t.y>=e.min.y&&t.y<=e.max.y},o.overlaps=function(e,t){return e.min.x<=t.max.x&&e.max.x>=t.min.x&&e.max.y>=t.min.y&&e.min.y<=t.max.y},o.translate=function(e,t){e.min.x+=t.x, -e.max.x+=t.x,e.min.y+=t.y,e.max.y+=t.y},o.shift=function(e,t){var n=e.max.x-e.min.x,o=e.max.y-e.min.y;e.min.x=t.x,e.max.x=t.x+n,e.min.y=t.y,e.max.y=t.y+o}}()},{}],27:[function(e,t,n){var o={};t.exports=o;var i=(e("../geometry/Bounds"),e("../core/Common"));!function(){o.pathToVertices=function(e,t){"undefined"==typeof window||"SVGPathSeg"in window||i.warn("Svg.pathToVertices: SVGPathSeg not defined, a polyfill is required.");var n,r,s,a,l,c,d,u,p,f,m,v,y=[],g=0,x=0,h=0;t=t||15;var b=function(e,t,n){var o=n%2==1&&n>1;if(!p||e!=p.x||t!=p.y){p&&o?(m=p.x,v=p.y):(m=0,v=0);var i={x:m+e,y:v+t};!o&&p||(p=i),y.push(i),x=m+e,h=v+t}},w=function(e){var t=e.pathSegTypeAsLetter.toUpperCase();if("Z"!==t){switch(t){case"M":case"L":case"T":case"C":case"S":case"Q":x=e.x,h=e.y;break;case"H":x=e.x;break;case"V":h=e.y}b(x,h,e.pathSegType)}};for(o._svgPathToAbsolute(e),s=e.getTotalLength(),c=[],n=0;n0)return!1}return!0},o.scale=function(e,t,n,r){if(1===t&&1===n)return e;r=r||o.centre(e);for(var s,a,l=0;l=0?l-1:e.length-1],d=e[l],u=e[(l+1)%e.length],p=t[l0&&(r|=2),3===r)return!1;return 0!==r||null},o.hull=function(e){var t,n,o=[],r=[];for(e=e.slice(0),e.sort(function(e,t){var n=e.x-t.x;return 0!==n?n:e.y-t.y}),n=0;n=2&&i.cross3(r[r.length-2],r[r.length-1],t)<=0;)r.pop();r.push(t)}for(n=e.length-1;n>=0;n-=1){for(t=e[n];o.length>=2&&i.cross3(o[o.length-2],o[o.length-1],t)<=0;)o.pop();o.push(t)}return o.pop(),r.pop(),o.concat(r)}}()},{"../core/Common":14,"../geometry/Vector":28}],30:[function(e,t,n){var o=t.exports=e("../core/Matter");o.Body=e("../body/Body"),o.Composite=e("../body/Composite"), -o.World=e("../body/World"),o.Contact=e("../collision/Contact"),o.Detector=e("../collision/Detector"),o.Grid=e("../collision/Grid"),o.Pairs=e("../collision/Pairs"),o.Pair=e("../collision/Pair"),o.Query=e("../collision/Query"),o.Resolver=e("../collision/Resolver"),o.SAT=e("../collision/SAT"),o.Constraint=e("../constraint/Constraint"),o.MouseConstraint=e("../constraint/MouseConstraint"),o.Common=e("../core/Common"),o.Engine=e("../core/Engine"),o.Events=e("../core/Events"),o.Mouse=e("../core/Mouse"),o.Runner=e("../core/Runner"),o.Sleeping=e("../core/Sleeping"),o.Plugin=e("../core/Plugin"),o.Bodies=e("../factory/Bodies"),o.Composites=e("../factory/Composites"),o.Axes=e("../geometry/Axes"),o.Bounds=e("../geometry/Bounds"),o.Svg=e("../geometry/Svg"),o.Vector=e("../geometry/Vector"),o.Vertices=e("../geometry/Vertices"),o.Render=e("../render/Render"),o.RenderPixi=e("../render/RenderPixi"),o.World.add=o.Composite.add,o.World.remove=o.Composite.remove, -o.World.addComposite=o.Composite.addComposite,o.World.addBody=o.Composite.addBody,o.World.addConstraint=o.Composite.addConstraint,o.World.clear=o.Composite.clear,o.Engine.run=o.Runner.run},{"../body/Body":1,"../body/Composite":2,"../body/World":3,"../collision/Contact":4,"../collision/Detector":5,"../collision/Grid":6,"../collision/Pair":7,"../collision/Pairs":8,"../collision/Query":9,"../collision/Resolver":10,"../collision/SAT":11,"../constraint/Constraint":12,"../constraint/MouseConstraint":13,"../core/Common":14,"../core/Engine":15,"../core/Events":16,"../core/Matter":17,"../core/Metrics":18,"../core/Mouse":19,"../core/Plugin":20,"../core/Runner":21,"../core/Sleeping":22,"../factory/Bodies":23,"../factory/Composites":24,"../geometry/Axes":25,"../geometry/Bounds":26,"../geometry/Svg":27,"../geometry/Vector":28,"../geometry/Vertices":29,"../render/Render":31,"../render/RenderPixi":32}],31:[function(e,t,n){var o={};t.exports=o -;var i=e("../core/Common"),r=e("../body/Composite"),s=e("../geometry/Bounds"),a=e("../core/Events"),l=e("../collision/Grid"),c=e("../geometry/Vector"),d=e("../core/Mouse");!function(){var e,t;"undefined"!=typeof window&&(e=window.requestAnimationFrame||window.webkitRequestAnimationFrame||window.mozRequestAnimationFrame||window.msRequestAnimationFrame||function(e){window.setTimeout(function(){e(i.now())},1e3/60)},t=window.cancelAnimationFrame||window.mozCancelAnimationFrame||window.webkitCancelAnimationFrame||window.msCancelAnimationFrame),o.create=function(e){var t={controller:o,engine:null,element:null,canvas:null,mouse:null,frameRequestId:null,options:{width:800,height:600,pixelRatio:1,background:"#18181d",wireframeBackground:"#0f0f13",hasBounds:!!e.bounds,enabled:!0,wireframes:!0,showSleeping:!0,showDebug:!1,showBroadphase:!1,showBounds:!1,showVelocity:!1,showCollisions:!1,showSeparations:!1,showAxes:!1,showPositions:!1,showAngleIndicator:!1,showIds:!1,showShadows:!1, -showVertexNumbers:!1,showConvexHulls:!1,showInternalEdges:!1,showMousePosition:!1}},r=i.extend(t,e);return r.canvas&&(r.canvas.width=r.options.width||r.canvas.width,r.canvas.height=r.options.height||r.canvas.height),r.mouse=e.mouse,r.engine=e.engine,r.canvas=r.canvas||n(r.options.width,r.options.height),r.context=r.canvas.getContext("2d"),r.textures={},r.bounds=r.bounds||{min:{x:0,y:0},max:{x:r.canvas.width,y:r.canvas.height}},1!==r.options.pixelRatio&&o.setPixelRatio(r,r.options.pixelRatio),i.isElement(r.element)?r.element.appendChild(r.canvas):r.canvas.parentNode||i.log("Render.create: options.element was undefined, render.canvas was created but not appended","warn"),r},o.run=function(t){!function n(i){t.frameRequestId=e(n),o.world(t)}()},o.stop=function(e){t(e.frameRequestId)},o.setPixelRatio=function(e,t){var n=e.options,o=e.canvas;"auto"===t&&(t=u(o)),n.pixelRatio=t,o.setAttribute("data-pixel-ratio",t),o.width=n.width*t,o.height=n.height*t,o.style.width=n.width+"px", -o.style.height=n.height+"px",e.context.scale(t,t)},o.lookAt=function(e,t,n,o){o=void 0===o||o,t=i.isArray(t)?t:[t],n=n||{x:0,y:0};for(var r={min:{x:1/0,y:1/0},max:{x:-1/0,y:-1/0}},s=0;sr.max.x&&(r.max.x=c.x),l.yr.max.y&&(r.max.y=c.y))}var u=r.max.x-r.min.x+2*n.x,p=r.max.y-r.min.y+2*n.y,f=e.canvas.height,m=e.canvas.width,v=m/f,y=u/p,g=1,x=1;y>v?x=y/v:g=v/y,e.options.hasBounds=!0,e.bounds.min.x=r.min.x,e.bounds.max.x=r.min.x+u*g,e.bounds.min.y=r.min.y,e.bounds.max.y=r.min.y+p*x,o&&(e.bounds.min.x+=.5*u-u*g*.5,e.bounds.max.x+=.5*u-u*g*.5,e.bounds.min.y+=.5*p-p*x*.5,e.bounds.max.y+=.5*p-p*x*.5),e.bounds.min.x-=n.x,e.bounds.max.x-=n.x,e.bounds.min.y-=n.y,e.bounds.max.y-=n.y,e.mouse&&(d.setScale(e.mouse,{x:(e.bounds.max.x-e.bounds.min.x)/e.canvas.width,y:(e.bounds.max.y-e.bounds.min.y)/e.canvas.height}), -d.setOffset(e.mouse,e.bounds.min))},o.startViewTransform=function(e){var t=e.bounds.max.x-e.bounds.min.x,n=e.bounds.max.y-e.bounds.min.y,o=t/e.options.width,i=n/e.options.height;e.context.scale(1/o,1/i),e.context.translate(-e.bounds.min.x,-e.bounds.min.y)},o.endViewTransform=function(e){e.context.setTransform(e.options.pixelRatio,0,0,e.options.pixelRatio,0,0)},o.world=function(e){var t,n=e.engine,i=n.world,u=e.canvas,p=e.context,m=e.options,v=r.allBodies(i),y=r.allConstraints(i),g=m.wireframes?m.wireframeBackground:m.background,x=[],h=[],b={timestamp:n.timing.timestamp};if(a.trigger(e,"beforeRender",b),e.currentBackground!==g&&f(e,g),p.globalCompositeOperation="source-in",p.fillStyle="transparent",p.fillRect(0,0,u.width,u.height),p.globalCompositeOperation="source-over",m.hasBounds){for(t=0;t=500){var l="";s.timing&&(l+="fps: "+Math.round(s.timing.fps)+" "),e.debugString=l,e.debugTimestamp=o.timing.timestamp}if(e.debugString){n.font="12px Arial",a.wireframes?n.fillStyle="rgba(255,255,255,0.5)":n.fillStyle="rgba(0,0,0,0.5)";for(var c=e.debugString.split("\n"),d=0;d1?1:0;s1?1:0;a1?1:0;r1?1:0;a1?1:0;r1?1:0;r1?1:0;i0)){var u=o.activeContacts[0].vertex.x,p=o.activeContacts[0].vertex.y;2===o.activeContacts.length&&(u=(o.activeContacts[0].vertex.x+o.activeContacts[1].vertex.x)/2,p=(o.activeContacts[0].vertex.y+o.activeContacts[1].vertex.y)/2),i.bodyB===i.supports[0].body||!0===i.bodyA.isStatic?a.moveTo(u-8*i.normal.x,p-8*i.normal.y):a.moveTo(u+8*i.normal.x,p+8*i.normal.y),a.lineTo(u,p)} -l.wireframes?a.strokeStyle="rgba(255,165,0,0.7)":a.strokeStyle="orange",a.lineWidth=1,a.stroke()},o.separations=function(e,t,n){var o,i,r,s,a,l=n,c=e.options;for(l.beginPath(),a=0;a1?1:0;p0;t--){var i=Math.floor(n.random()*(t+1)),o=e[t];e[t]=e[i],e[i]=o}return e},n.choose=function(e){return e[Math.floor(n.random()*e.length)]},n.isElement=function(e){return"undefined"!=typeof HTMLElement?e instanceof HTMLElement:!!(e&&e.nodeType&&e.nodeName)},n.isArray=function(e){return"[object Array]"===Object.prototype.toString.call(e)},n.isFunction=function(e){return"function"==typeof e},n.isPlainObject=function(e){return"object"==typeof e&&e.constructor===Object},n.isString=function(e){return"[object String]"===toString.call(e)},n.clamp=function(e,t,n){return en?n:e},n.sign=function(e){return e<0?-1:1},n.now=function(){if("undefined"!=typeof window&&window.performance){if(window.performance.now)return window.performance.now();if(window.performance.webkitNow)return window.performance.webkitNow()}return new Date-n._nowStartTime},n.random=function(t,n){return n=void 0!==n?n:1,(t=void 0!==t?t:0)+e()*(n-t)};var e=function(){return n._seed=(9301*n._seed+49297)%233280,n._seed/233280};n.colorToNumber=function(e){return 3==(e=e.replace("#","")).length&&(e=e.charAt(0)+e.charAt(0)+e.charAt(1)+e.charAt(1)+e.charAt(2)+e.charAt(2)),parseInt(e,16)},n.logLevel=1,n.log=function(){console&&n.logLevel>0&&n.logLevel<=3&&console.log.apply(console,["matter-js:"].concat(Array.prototype.slice.call(arguments)))},n.info=function(){console&&n.logLevel>0&&n.logLevel<=2&&console.info.apply(console,["matter-js:"].concat(Array.prototype.slice.call(arguments)))},n.warn=function(){console&&n.logLevel>0&&n.logLevel<=3&&console.warn.apply(console,["matter-js:"].concat(Array.prototype.slice.call(arguments)))},n.nextId=function(){return n._nextId++},n.indexOf=function(e,t){if(e.indexOf)return e.indexOf(t);for(var n=0;ne.max.x&&(e.max.x=o.x),o.xe.max.y&&(e.max.y=o.y),o.y0?e.max.x+=n.x:e.min.x+=n.x,n.y>0?e.max.y+=n.y:e.min.y+=n.y)},n.contains=function(e,t){return t.x>=e.min.x&&t.x<=e.max.x&&t.y>=e.min.y&&t.y<=e.max.y},n.overlaps=function(e,t){return e.min.x<=t.max.x&&e.max.x>=t.min.x&&e.max.y>=t.min.y&&e.min.y<=t.max.y},n.translate=function(e,t){e.min.x+=t.x,e.max.x+=t.x,e.min.y+=t.y,e.max.y+=t.y},n.shift=function(e,t){var n=e.max.x-e.min.x,i=e.max.y-e.min.y;e.min.x=t.x,e.max.x=t.x+n,e.min.y=t.y,e.max.y=t.y+i}},function(e,t){var n={};e.exports=n,n.create=function(e,t){return{x:e||0,y:t||0}},n.clone=function(e){return{x:e.x,y:e.y}},n.magnitude=function(e){return Math.sqrt(e.x*e.x+e.y*e.y)},n.magnitudeSquared=function(e){return e.x*e.x+e.y*e.y},n.rotate=function(e,t,n){var i=Math.cos(t),o=Math.sin(t);n||(n={});var r=e.x*i-e.y*o;return n.y=e.x*o+e.y*i,n.x=r,n},n.rotateAbout=function(e,t,n,i){var o=Math.cos(t),r=Math.sin(t);i||(i={});var s=n.x+((e.x-n.x)*o-(e.y-n.y)*r);return i.y=n.y+((e.x-n.x)*r+(e.y-n.y)*o),i.x=s,i},n.normalise=function(e){var t=n.magnitude(e);return 0===t?{x:0,y:0}:{x:e.x/t,y:e.y/t}},n.dot=function(e,t){return e.x*t.x+e.y*t.y},n.cross=function(e,t){return e.x*t.y-e.y*t.x},n.cross3=function(e,t,n){return(t.x-e.x)*(n.y-e.y)-(t.y-e.y)*(n.x-e.x)},n.add=function(e,t,n){return n||(n={}),n.x=e.x+t.x,n.y=e.y+t.y,n},n.sub=function(e,t,n){return n||(n={}),n.x=e.x-t.x,n.y=e.y-t.y,n},n.mult=function(e,t){return{x:e.x*t,y:e.y*t}},n.div=function(e,t){return{x:e.x/t,y:e.y/t}},n.perp=function(e,t){return{x:(t=!0===t?-1:1)*-e.y,y:t*e.x}},n.neg=function(e){return{x:-e.x,y:-e.y}},n.angle=function(e,t){return Math.atan2(t.y-e.y,t.x-e.x)},n._temp=[n.create(),n.create(),n.create(),n.create(),n.create(),n.create()]},function(e,t,n){var i={};e.exports=i;var o=n(2),r=n(0);i.create=function(e,t){for(var n=[],i=0;i0)return!1}return!0},i.scale=function(e,t,n,r){if(1===t&&1===n)return e;var s,a;r=r||i.centre(e);for(var l=0;l=0?l-1:e.length-1],d=e[l],u=e[(l+1)%e.length],p=t[l0&&(r|=2),3===r)return!1;return 0!==r||null},i.hull=function(e){var t,n,i=[],r=[];for((e=e.slice(0)).sort((function(e,t){var n=e.x-t.x;return 0!==n?n:e.y-t.y})),n=0;n=2&&o.cross3(r[r.length-2],r[r.length-1],t)<=0;)r.pop();r.push(t)}for(n=e.length-1;n>=0;n-=1){for(t=e[n];i.length>=2&&o.cross3(i[i.length-2],i[i.length-1],t)<=0;)i.pop();i.push(t)}return i.pop(),r.pop(),i.concat(r)}},function(e,t,n){var i={};e.exports=i;var o=n(0);i.on=function(e,t,n){for(var i,o=t.split(" "),r=0;r0){n||(n={}),i=t.split(" ");for(var c=0;c0&&r.rotateAbout(s.position,n,e.position,s.position)}},i.setVelocity=function(e,t){e.positionPrev.x=e.position.x-t.x,e.positionPrev.y=e.position.y-t.y,e.velocity.x=t.x,e.velocity.y=t.y,e.speed=r.magnitude(e.velocity)},i.setAngularVelocity=function(e,t){e.anglePrev=e.angle-t,e.angularVelocity=t,e.angularSpeed=Math.abs(e.angularVelocity)},i.translate=function(e,t){i.setPosition(e,r.add(e.position,t))},i.rotate=function(e,t,n){if(n){var o=Math.cos(t),r=Math.sin(t),s=e.position.x-n.x,a=e.position.y-n.y;i.setPosition(e,{x:n.x+(s*o-a*r),y:n.y+(s*r+a*o)}),i.setAngle(e,e.angle+t)}else i.setAngle(e,e.angle+t)},i.scale=function(e,t,n,r){var s=0,a=0;r=r||e.position;for(var d=0;d0&&(s+=u.area,a+=u.inertia),u.position.x=r.x+(u.position.x-r.x)*t,u.position.y=r.y+(u.position.y-r.y)*n,l.update(u.bounds,u.vertices,e.velocity)}e.parts.length>1&&(e.area=s,e.isStatic||(i.setMass(e,e.density*s),i.setInertia(e,a))),e.circleRadius&&(t===n?e.circleRadius*=t:e.circleRadius=null)},i.update=function(e,t,n,i){var s=Math.pow(t*n*e.timeScale,2),a=1-e.frictionAir*n*e.timeScale,d=e.position.x-e.positionPrev.x,u=e.position.y-e.positionPrev.y;e.velocity.x=d*a*i+e.force.x/e.mass*s,e.velocity.y=u*a*i+e.force.y/e.mass*s,e.positionPrev.x=e.position.x,e.positionPrev.y=e.position.y,e.position.x+=e.velocity.x,e.position.y+=e.velocity.y,e.angularVelocity=(e.angle-e.anglePrev)*a*i+e.torque/e.inertia*s,e.anglePrev=e.angle,e.angle+=e.angularVelocity,e.speed=r.magnitude(e.velocity),e.angularSpeed=Math.abs(e.angularVelocity);for(var p=0;p0&&(f.position.x+=e.velocity.x,f.position.y+=e.velocity.y),0!==e.angularVelocity&&(o.rotate(f.vertices,e.angularVelocity,e.position),c.rotate(f.axes,e.angularVelocity),p>0&&r.rotateAbout(f.position,e.angularVelocity,e.position,f.position)),l.update(f.bounds,f.vertices,e.velocity)}},i.applyForce=function(e,t,n){e.force.x+=n.x,e.force.y+=n.y;var i=t.x-e.position.x,o=t.y-e.position.y;e.torque+=i*n.y-o*n.x},i._totalProperties=function(e){for(var t={mass:0,area:0,inertia:0,centre:{x:0,y:0}},n=1===e.parts.length?0:1;n0&&r.motion=r.sleepThreshold&&i.set(r,!0)):r.sleepCounter>0&&(r.sleepCounter-=1)}else i.set(r,!1)}},i.afterCollisions=function(e,t){for(var n=t*t*t,o=0;oi._motionWakeThreshold*n&&i.set(c,!1)}}}},i.set=function(e,t){var n=e.isSleeping;t?(e.isSleeping=!0,e.sleepCounter=e.sleepThreshold,e.positionImpulse.x=0,e.positionImpulse.y=0,e.positionPrev.x=e.position.x,e.positionPrev.y=e.position.y,e.anglePrev=e.angle,e.speed=0,e.angularSpeed=0,e.motion=0,n||o.trigger(e,"sleepStart")):(e.isSleeping=!1,e.sleepCounter=0,n&&o.trigger(e,"sleepEnd"))}},function(e,t,n){var i={};e.exports=i;var o=n(3),r=n(2),s=n(7),a=n(1),l=n(15),c=n(0);i._warming=.4,i._torqueDampen=1,i._minLength=1e-6,i.create=function(e){var t=e;t.bodyA&&!t.pointA&&(t.pointA={x:0,y:0}),t.bodyB&&!t.pointB&&(t.pointB={x:0,y:0});var n=t.bodyA?r.add(t.bodyA.position,t.pointA):t.pointA,i=t.bodyB?r.add(t.bodyB.position,t.pointB):t.pointB,o=r.magnitude(r.sub(n,i));t.length=void 0!==t.length?t.length:o,t.id=t.id||c.nextId(),t.label=t.label||"Constraint",t.type="constraint",t.stiffness=t.stiffness||(t.length>0?1:.7),t.damping=t.damping||0,t.angularStiffness=t.angularStiffness||0,t.angleA=t.bodyA?t.bodyA.angle:t.angleA,t.angleB=t.bodyB?t.bodyB.angle:t.angleB,t.plugin={};var s={visible:!0,lineWidth:2,strokeStyle:"#ffffff",type:"line",anchors:!0};return 0===t.length&&t.stiffness>.1?(s.type="pin",s.anchors=!1):t.stiffness<.9&&(s.type="spring"),t.render=c.extend(s,t.render),t},i.preSolveAll=function(e){for(var t=0;t0&&(u.position.x+=c.x,u.position.y+=c.y),0!==c.angle&&(o.rotate(u.vertices,c.angle,n.position),l.rotate(u.axes,c.angle),d>0&&r.rotateAbout(u.position,c.angle,n.position,u.position)),a.update(u.bounds,u.vertices,n.velocity)}c.angle*=i._warming,c.x*=i._warming,c.y*=i._warming}}},i.pointAWorld=function(e){return{x:(e.bodyA?e.bodyA.position.x:0)+e.pointA.x,y:(e.bodyA?e.bodyA.position.y:0)+e.pointA.y}},i.pointBWorld=function(e){return{x:(e.bodyB?e.bodyB.position.x:0)+e.pointB.x,y:(e.bodyB?e.bodyB.position.y:0)+e.pointB.y}}},function(e,t,n){var i={};e.exports=i;var o=n(18);i.create=function(e,t){var n=e.bodyA,o=e.bodyB,r=e.parentA,s=e.parentB,a={id:i.id(n,o),bodyA:n,bodyB:o,contacts:{},activeContacts:[],separation:0,isActive:!0,confirmedActive:!0,isSensor:n.isSensor||o.isSensor,timeCreated:t,timeUpdated:t,inverseMass:r.inverseMass+s.inverseMass,friction:Math.min(r.friction,s.friction),frictionStatic:Math.max(r.frictionStatic,s.frictionStatic),restitution:Math.max(r.restitution,s.restitution),slop:Math.max(r.slop,s.slop)};return i.update(a,e,t),a},i.update=function(e,t,n){var r=e.contacts,s=t.supports,a=e.activeContacts,l=t.parentA,c=t.parentB;if(e.collision=t,e.inverseMass=l.inverseMass+c.inverseMass,e.friction=Math.min(l.friction,c.friction),e.frictionStatic=Math.max(l.frictionStatic,c.frictionStatic),e.restitution=Math.max(l.restitution,c.restitution),e.slop=Math.max(l.slop,c.slop),a.length=0,t.collided){for(var d=0;dr.max.x&&(r.max.x=c.x),l.yr.max.y&&(r.max.y=c.y))}var u=r.max.x-r.min.x+2*n.x,p=r.max.y-r.min.y+2*n.y,f=e.canvas.height,v=e.canvas.width/f,m=u/p,y=1,g=1;m>v?g=m/v:y=v/m,e.options.hasBounds=!0,e.bounds.min.x=r.min.x,e.bounds.max.x=r.min.x+u*y,e.bounds.min.y=r.min.y,e.bounds.max.y=r.min.y+p*g,i&&(e.bounds.min.x+=.5*u-u*y*.5,e.bounds.max.x+=.5*u-u*y*.5,e.bounds.min.y+=.5*p-p*g*.5,e.bounds.max.y+=.5*p-p*g*.5),e.bounds.min.x-=n.x,e.bounds.max.x-=n.x,e.bounds.min.y-=n.y,e.bounds.max.y-=n.y,e.mouse&&(d.setScale(e.mouse,{x:(e.bounds.max.x-e.bounds.min.x)/e.canvas.width,y:(e.bounds.max.y-e.bounds.min.y)/e.canvas.height}),d.setOffset(e.mouse,e.bounds.min))},i.startViewTransform=function(e){var t=e.bounds.max.x-e.bounds.min.x,n=e.bounds.max.y-e.bounds.min.y,i=t/e.options.width,o=n/e.options.height;e.context.setTransform(e.options.pixelRatio/i,0,0,e.options.pixelRatio/o,0,0),e.context.translate(-e.bounds.min.x,-e.bounds.min.y)},i.endViewTransform=function(e){e.context.setTransform(e.options.pixelRatio,0,0,e.options.pixelRatio,0,0)},i.world=function(e){var t,n=e.engine,o=n.world,u=e.canvas,p=e.context,v=e.options,m=r.allBodies(o),y=r.allConstraints(o),g=v.wireframes?v.wireframeBackground:v.background,x=[],h=[],b={timestamp:n.timing.timestamp};if(a.trigger(e,"beforeRender",b),e.currentBackground!==g&&f(e,g),p.globalCompositeOperation="source-in",p.fillStyle="transparent",p.fillRect(0,0,u.width,u.height),p.globalCompositeOperation="source-over",v.hasBounds){for(t=0;t=500){var d="";s.timing&&(d+="fps: "+Math.round(s.timing.fps)+" "),s.extended&&(s.timing&&(d+="delta: "+s.timing.delta.toFixed(3)+" ",d+="correction: "+s.timing.correction.toFixed(3)+" "),d+="bodies: "+c.length+" ",i.broadphase.controller===l&&(d+="buckets: "+s.buckets+" "),d+="\n",d+="collisions: "+s.collisions+" ",d+="pairs: "+i.pairs.list.length+" ",d+="broad: "+s.broadEff+" ",d+="mid: "+s.midEff+" ",d+="narrow: "+s.narrowEff+" "),e.debugString=d,e.debugTimestamp=i.timing.timestamp}if(e.debugString){n.font="12px Arial",a.wireframes?n.fillStyle="rgba(255,255,255,0.5)":n.fillStyle="rgba(0,0,0,0.5)";for(var u=e.debugString.split("\n"),p=0;p1?1:0;s1?1:0;a1?1:0;r1?1:0;a1?1:0;r1?1:0;r1?1:0;o0)){var d=i.activeContacts[0].vertex.x,u=i.activeContacts[0].vertex.y;2===i.activeContacts.length&&(d=(i.activeContacts[0].vertex.x+i.activeContacts[1].vertex.x)/2,u=(i.activeContacts[0].vertex.y+i.activeContacts[1].vertex.y)/2),o.bodyB===o.supports[0].body||!0===o.bodyA.isStatic?a.moveTo(d-8*o.normal.x,u-8*o.normal.y):a.moveTo(d+8*o.normal.x,u+8*o.normal.y),a.lineTo(d,u)}l.wireframes?a.strokeStyle="rgba(255,165,0,0.7)":a.strokeStyle="orange",a.lineWidth=1,a.stroke()},i.separations=function(e,t,n){var i,o,r,s,a,l=n,c=e.options;for(l.beginPath(),a=0;ad.bounds.max.x||v.bounds.max.yd.bounds.max.y)){var m=i._getRegion(e,v);if(!v.region||m.id!==v.region.id||o){f.broadphaseTests+=1,v.region&&!o||(v.region=m);var y=i._regionUnion(m,v.region);for(s=y.startCol;s<=y.endCol;s++)for(a=y.startRow;a<=y.endRow;a++){l=u[c=i._getBucketId(s,a)];var g=s>=m.startCol&&s<=m.endCol&&a>=m.startRow&&a<=m.endRow,x=s>=v.region.startCol&&s<=v.region.endCol&&a>=v.region.startRow&&a<=v.region.endRow;!g&&x&&x&&l&&i._bucketRemoveBody(e,l,v),(v.region===m||g&&!x||o)&&(l||(l=i._createBucket(u,c)),i._bucketAddBody(e,l,v))}v.region=m,p=!0}}}p&&(e.pairsList=i._createActivePairsList(e))},i.clear=function(e){e.buckets={},e.pairs={},e.pairsList=[]},i._regionUnion=function(e,t){var n=Math.min(e.startCol,t.startCol),o=Math.max(e.endCol,t.endCol),r=Math.min(e.startRow,t.startRow),s=Math.max(e.endRow,t.endRow);return i._createRegion(n,o,r,s)},i._getRegion=function(e,t){var n=t.bounds,o=Math.floor(n.min.x/e.bucketWidth),r=Math.floor(n.max.x/e.bucketWidth),s=Math.floor(n.min.y/e.bucketHeight),a=Math.floor(n.max.y/e.bucketHeight);return i._createRegion(o,r,s,a)},i._createRegion=function(e,t,n,i){return{id:e+","+t+","+n+","+i,startCol:e,endCol:t,startRow:n,endRow:i}},i._getBucketId=function(e,t){return"C"+e+"R"+t},i._createBucket=function(e,t){return e[t]=[]},i._bucketAddBody=function(e,t,n){for(var i=0;i0?i.push(n):delete e.pairs[t[o]];return i}},function(e,t,n){var i={};e.exports=i;var o=n(13),r=n(9),s=n(1);i.collisions=function(e,t){for(var n=[],a=t.pairs.table,l=t.metrics,c=0;c1?1:0;p1?1:0;v0:0!=(e.mask&t.category)&&0!=(t.mask&e.category)}},function(e,t,n){var i={};e.exports=i;var o=n(3),r=n(2);i.collides=function(e,t,n){var s,a,l,c,d=!1;if(n){var u=e.parent,p=t.parent,f=u.speed*u.speed+u.angularSpeed*u.angularSpeed+p.speed*p.speed+p.angularSpeed*p.angularSpeed;d=n&&n.collided&&f<.2,c=n}else c={collided:!1,bodyA:e,bodyB:t};if(n&&d){var v=c.axisBody,m=v===e?t:e,y=[v.axes[n.axisNumber]];if(l=i._overlapAxes(v.vertices,m.vertices,y),c.reused=!0,l.overlap<=0)return c.collided=!1,c}else{if((s=i._overlapAxes(e.vertices,t.vertices,e.axes)).overlap<=0)return c.collided=!1,c;if((a=i._overlapAxes(t.vertices,e.vertices,t.axes)).overlap<=0)return c.collided=!1,c;s.overlapo?o=a:a=0?s.index-1:d.length-1],c.x=o.x-u.x,c.y=o.y-u.y,l=-r.dot(n,c),a=o,o=d[(s.index+1)%d.length],c.x=o.x-u.x,c.y=o.y-u.y,(i=-r.dot(n,c))0&&o.area(M)1?(v=s.create(r.extend({parts:m.slice(0)},c)),s.setPosition(v,{x:e,y:t}),v):m[0]}},function(e,t,n){var i={};e.exports=i;var o=n(0);i._registry={},i.register=function(e){if(i.isPlugin(e)||o.warn("Plugin.register:",i.toString(e),"does not implement all required fields."),e.name in i._registry){var t=i._registry[e.name],n=i.versionParse(e.version).number,r=i.versionParse(t.version).number;n>r?(o.warn("Plugin.register:",i.toString(t),"was upgraded to",i.toString(e)),i._registry[e.name]=e):n-1},i.isFor=function(e,t){var n=e.for&&i.dependencyParse(e.for);return!e.for||t.name===n.name&&i.versionSatisfies(t.version,n.range)},i.use=function(e,t){if(e.uses=(e.uses||[]).concat(t||[]),0!==e.uses.length){for(var n=i.dependencies(e),r=o.topologicalSort(n),s=[],a=0;a0&&o.info(s.join(" "))}else o.warn("Plugin.use:",i.toString(e),"does not specify any dependencies to install.")},i.dependencies=function(e,t){var n=i.dependencyParse(e),r=n.name;if(!(r in(t=t||{}))){e=i.resolve(e)||e,t[r]=o.map(e.uses||[],(function(t){i.isPlugin(t)&&i.register(t);var r=i.dependencyParse(t),s=i.resolve(t);return s&&!i.versionSatisfies(s.version,r.range)?(o.warn("Plugin.dependencies:",i.toString(s),"does not satisfy",i.toString(r),"used by",i.toString(n)+"."),s._warned=!0,e._warned=!0):s||(o.warn("Plugin.dependencies:",i.toString(t),"used by",i.toString(n),"could not be resolved."),e._warned=!0),r.name}));for(var s=0;s=o[2];if("^"===n.operator)return o[0]>0?s[0]===o[0]&&r.number>=n.number:o[1]>0?s[1]===o[1]&&s[2]>=o[2]:s[2]===o[2]}return e===t||"*"===e}},function(e,t){var n={};e.exports=n,n.create=function(e){return{id:n.id(e),vertex:e,normalImpulse:0,tangentImpulse:0}},n.id=function(e){return e.body.id+"_"+e.index}},function(e,t,n){var i={};e.exports=i;var o=n(5),r=(n(8),n(0));i.create=function(e){var t=o.create(),n={label:"World",gravity:{x:0,y:1,scale:.001},bounds:{min:{x:-1/0,y:-1/0},max:{x:1/0,y:1/0}}};return r.extend(t,n,e)}},function(e,t,n){var i={};e.exports=i;var o=n(9),r=n(0);i._pairMaxIdleLife=1e3,i.create=function(e){return r.extend({table:{},list:[],collisionStart:[],collisionActive:[],collisionEnd:[]},e)},i.update=function(e,t,n){var i,r,s,a,l=e.list,c=e.table,d=e.collisionStart,u=e.collisionEnd,p=e.collisionActive;for(d.length=0,u.length=0,p.length=0,a=0;ai._pairMaxIdleLife&&c.push(s);for(s=0;sf.friction*f.frictionStatic*O*n&&(F=T,E=s.clamp(f.friction*R*n,-F,F));var V=r.cross(P,g),W=r.cross(C,g),q=b/(m.inverseMass+y.inverseMass+m.inverseInertia*V*V+y.inverseInertia*W*W);if(L*=q,E*=q,I<0&&I*I>i._restingThresh*n)S.normalImpulse=0;else{var j=S.normalImpulse;S.normalImpulse=Math.min(S.normalImpulse+L,0),L=S.normalImpulse-j}if(_*_>i._restingThreshTangent*n)S.tangentImpulse=0;else{var D=S.tangentImpulse;S.tangentImpulse=s.clamp(S.tangentImpulse+E,-F,F),E=S.tangentImpulse-D}o.x=g.x*L+x.x*E,o.y=g.y*L+x.y*E,m.isStatic||m.isSleeping||(m.positionPrev.x+=o.x*m.inverseMass,m.positionPrev.y+=o.y*m.inverseMass,m.anglePrev+=r.cross(P,o)*m.inverseInertia),y.isStatic||y.isSleeping||(y.positionPrev.x-=o.x*y.inverseMass,y.positionPrev.y-=o.y*y.inverseMass,y.anglePrev-=r.cross(C,o)*y.inverseInertia)}}}}},function(e,t,n){var i={};e.exports=i;var o=n(19),r=n(7),s=n(21),a=n(10),l=n(20),c=n(23),d=n(11),u=n(4),p=n(5),f=n(8),v=n(0),m=n(6);i.create=function(e,t){t=(t=v.isElement(e)?t:e)||{},((e=v.isElement(e)?e:null)||t.render)&&v.warn("Engine.create: engine.render is deprecated (see docs)");var n={positionIterations:6,velocityIterations:4,constraintIterations:2,enableSleeping:!1,events:[],plugin:{},timing:{timestamp:0,timeScale:1},broadphase:{controller:d}},i=v.extend(n,t);if(e||i.render){var r={element:e,controller:a};i.render=v.extend(r,i.render)}return i.render&&i.render.controller&&(i.render=i.render.controller.create(i.render)),i.render&&(i.render.engine=i),i.world=t.world||o.create(i.world),i.pairs=l.create(),i.broadphase=i.broadphase.controller.create(i.broadphase),i.metrics=i.metrics||{extended:!1},i.metrics=c.create(i.metrics),i},i.update=function(e,t,n){t=t||1e3/60,n=n||1;var o,a=e.world,d=e.timing,v=e.broadphase,m=[];d.timestamp+=t*d.timeScale;var y={timestamp:d.timestamp};u.trigger(e,"beforeUpdate",y);var g=p.allBodies(a),x=p.allConstraints(a);for(c.reset(e.metrics),e.enableSleeping&&r.update(g,d.timeScale),i._bodiesApplyGravity(g,a.gravity),i._bodiesUpdate(g,t,d.timeScale,n,a.bounds),f.preSolveAll(g),o=0;o0&&u.trigger(e,"collisionStart",{pairs:b.collisionStart}),s.preSolvePosition(b.list),o=0;o0&&u.trigger(e,"collisionActive",{pairs:b.collisionActive}),b.collisionEnd.length>0&&u.trigger(e,"collisionEnd",{pairs:b.collisionEnd}),c.update(e.metrics,e),i._bodiesClearForces(g),u.trigger(e,"afterUpdate",y),e},i.merge=function(e,t){if(v.extend(e,t),t.world){e.world=t.world,i.clear(e);for(var n=p.allBodies(e.world),o=0;o1?1:0;de.deltaMax?e.deltaMax:i)/e.delta,e.delta=i),0!==e.timeScalePrev&&(a*=s.timeScale/e.timeScalePrev),0===s.timeScale&&(a=0),e.timeScalePrev=s.timeScale,e.correction=a,e.frameCounter+=1,n-e.counterTimestamp>=1e3&&(e.fps=e.frameCounter*((n-e.counterTimestamp)/1e3),e.counterTimestamp=n,e.frameCounter=0),o.trigger(e,"tick",l),o.trigger(t,"tick",l),t.world.isModified&&t.render&&t.render.controller&&t.render.controller.clear&&t.render.controller.clear(t.render),o.trigger(e,"beforeUpdate",l),r.update(t,i,a),o.trigger(e,"afterUpdate",l),t.render&&t.render.controller&&(o.trigger(e,"beforeRender",l),o.trigger(t,"beforeRender",l),t.render.controller.world(t.render),o.trigger(e,"afterRender",l),o.trigger(t,"afterRender",l)),o.trigger(e,"afterTick",l),o.trigger(t,"afterTick",l)},i.stop=function(e){t(e.frameRequestId)},i.start=function(e,t){i.run(e,t)}}()},function(e,t,n){var i={};e.exports=i;var o=n(5),r=n(8),s=n(0),a=n(6),l=n(16);i.stack=function(e,t,n,i,r,s,l){for(var c,d=o.create({label:"Stack"}),u=e,p=t,f=0,v=0;vm&&(m=x),a.translate(g,{x:.5*h,y:.5*x}),u=g.bounds.max.x+r,o.addBody(d,g),c=g,f+=1}else u+=r}p+=m+s,u=e}return d},i.chain=function(e,t,n,i,a,l){for(var c=e.bodies,d=1;d0)for(c=0;c0&&(p=f[c-1+(l-1)*t],o.addConstraint(e,r.create(s.extend({bodyA:p,bodyB:u},a)))),i&&cp||s<(c=p-c)||s>n-1-c))return 1===u&&a.translate(d,{x:(s+(n%2==1?1:-1))*f,y:0}),l(e+(d?s*f:0)+s*r,i,s,c,d,u)}))},i.newtonsCradle=function(e,t,n,i,s){for(var a=o.create({label:"Newtons Cradle"}),c=0;c1;if(!p||e!=p.x||t!=p.y){p&&i?(f=p.x,v=p.y):(f=0,v=0);var o={x:f+e,y:v+t};!i&&p||(p=o),m.push(o),g=f+e,x=v+t}},b=function(e){var t=e.pathSegTypeAsLetter.toUpperCase();if("Z"!==t){switch(t){case"M":case"L":case"T":case"C":case"S":case"Q":g=e.x,x=e.y;break;case"H":g=e.x;break;case"V":x=e.y}h(g,x,e.pathSegType)}};for(i._svgPathToAbsolute(e),s=e.getTotalLength(),c=[],n=0;n1?1:0;p 5) { category = blueCategory; - color = blueColor; + color = colorB; } else if (row > 2) { category = greenCategory; - color = greenColor; + color = colorC; } return Bodies.circle(x, y, 20, { @@ -1325,7 +1324,7 @@ Example.collisionFiltering = function() { mask: defaultCategory | greenCategory }, render: { - fillStyle: greenColor + fillStyle: colorC } }) ); @@ -1337,7 +1336,7 @@ Example.collisionFiltering = function() { mask: defaultCategory | redCategory }, render: { - fillStyle: redColor + fillStyle: colorA } }) ); @@ -1349,7 +1348,7 @@ Example.collisionFiltering = function() { mask: defaultCategory | blueCategory }, render: { - fillStyle: blueColor + fillStyle: colorB } }) ); @@ -1782,7 +1781,7 @@ Example.concave = function() { horseShoe = Vertices.fromPath('35 7 19 17 14 38 14 58 25 79 45 85 65 84 65 66 46 67 34 59 30 44 33 29 45 23 66 23 66 7 53 7'); var stack = Composites.stack(50, 50, 6, 4, 10, 10, function(x, y) { - var color = Common.choose(['#556270', '#4ECDC4', '#C7F464', '#FF6B6B', '#C44D58']); + var color = Common.choose(['#f19648', '#f5d259', '#f55a3c', '#063e7b', '#ececd1']); return Bodies.fromVertices(x, y, Common.choose([arrow, chevron, star, horseShoe]), { render: { fillStyle: color, @@ -2055,8 +2054,7 @@ Example.doublePendulum = function() { options: { width: 800, height: 600, - wireframes: false, - background: '#0f0f13' + wireframes: false } }); @@ -2083,9 +2081,6 @@ Example.doublePendulum = function() { }); }); - pendulum.bodies[0].render.strokeStyle = '#4a485b'; - pendulum.bodies[1].render.strokeStyle = '#4a485b'; - world.gravity.scale = 0.002; Composites.chain(pendulum, 0.45, 0, -0.45, 0, { @@ -2419,17 +2414,17 @@ Example.friction = function() { ]); World.add(world, [ - Bodies.rectangle(300, 180, 700, 20, { isStatic: true, angle: Math.PI * 0.06 }), + Bodies.rectangle(300, 180, 700, 20, { isStatic: true, angle: Math.PI * 0.06, render: { fillStyle: '#060a19' } }), Bodies.rectangle(300, 70, 40, 40, { friction: 0.001 }) ]); World.add(world, [ - Bodies.rectangle(300, 350, 700, 20, { isStatic: true, angle: Math.PI * 0.06 }), + Bodies.rectangle(300, 350, 700, 20, { isStatic: true, angle: Math.PI * 0.06, render: { fillStyle: '#060a19' } }), Bodies.rectangle(300, 250, 40, 40, { friction: 0.0005 }) ]); World.add(world, [ - Bodies.rectangle(300, 520, 700, 20, { isStatic: true, angle: Math.PI * 0.06 }), + Bodies.rectangle(300, 520, 700, 20, { isStatic: true, angle: Math.PI * 0.06, render: { fillStyle: '#060a19' } }), Bodies.rectangle(300, 430, 40, 40, { friction: 0 }) ]); @@ -2760,15 +2755,15 @@ Example.manipulation = function() { Runner.run(runner, engine); // add bodies - var bodyA = Bodies.rectangle(100, 200, 50, 50, { isStatic: true }), + var bodyA = Bodies.rectangle(100, 200, 50, 50, { isStatic: true, render: { fillStyle: '#060a19' } }), bodyB = Bodies.rectangle(200, 200, 50, 50), bodyC = Bodies.rectangle(300, 200, 50, 50), bodyD = Bodies.rectangle(400, 200, 50, 50), bodyE = Bodies.rectangle(550, 200, 50, 50), bodyF = Bodies.rectangle(700, 200, 50, 50), - bodyG = Bodies.circle(400, 100, 25), - partA = Bodies.rectangle(600, 200, 120, 50), - partB = Bodies.rectangle(660, 200, 50, 190), + bodyG = Bodies.circle(400, 100, 25, { render: { fillStyle: '#060a19' } }), + partA = Bodies.rectangle(600, 200, 120, 50, { render: { fillStyle: '#060a19' } }), + partB = Bodies.rectangle(660, 200, 50, 190, { render: { fillStyle: '#060a19' } }), compound = Body.create({ parts: [partA, partB], isStatic: true @@ -3103,8 +3098,7 @@ Example.ragdoll = function() { options: { width: 800, height: 600, - showAngleIndicator: true, - background: '#0f0f13' + showAngleIndicator: true } }); @@ -3121,7 +3115,9 @@ Example.ragdoll = function() { return Bodies.rectangle(x - 50, y + column * 50, 100, 1000, { isStatic: true, render: { - fillStyle: '#222' + fillStyle: '#060a19', + strokeStyle: '#ffffff', + lineWidth: 1 } }); }); @@ -3131,7 +3127,7 @@ Example.ragdoll = function() { var sides = Math.round(Common.random(1, 8)), options = { render: { - fillStyle: Common.choose(['#006BA6', '#0496FF', '#D81159', '#8F2D56']) + fillStyle: Common.choose(['#f19648', '#f5d259', '#f55a3c', '#063e7b', '#ececd1']) } }; @@ -4054,8 +4050,7 @@ Example.sensors = function() { options: { width: 800, height: 600, - wireframes: false, - background: '#111' + wireframes: false } }); @@ -4066,14 +4061,14 @@ Example.sensors = function() { Runner.run(runner, engine); // add bodies - var redColor = '#C44D58', - greenColor = '#C7F464'; + var colorA = '#f55a3c', + colorB = '#f5d259'; var collider = Bodies.rectangle(400, 300, 500, 50, { isSensor: true, isStatic: true, render: { - strokeStyle: redColor, + strokeStyle: colorA, fillStyle: 'transparent', lineWidth: 1 } @@ -4081,11 +4076,11 @@ Example.sensors = function() { World.add(world, [ collider, - Bodies.rectangle(400, 620, 800, 50, { + Bodies.rectangle(400, 600, 800, 50, { isStatic: true, render: { - fillStyle: 'transparent', - lineWidth: 1 + fillStyle: '#060a19', + lineWidth: 0 } }) ]); @@ -4093,7 +4088,7 @@ Example.sensors = function() { World.add(world, Bodies.circle(400, 40, 30, { render: { - strokeStyle: greenColor, + strokeStyle: colorB, fillStyle: 'transparent', lineWidth: 1 } @@ -4107,9 +4102,9 @@ Example.sensors = function() { var pair = pairs[i]; if (pair.bodyA === collider) { - pair.bodyB.render.strokeStyle = redColor; + pair.bodyB.render.strokeStyle = colorA; } else if (pair.bodyB === collider) { - pair.bodyA.render.strokeStyle = redColor; + pair.bodyA.render.strokeStyle = colorA; } } }); @@ -4121,9 +4116,9 @@ Example.sensors = function() { var pair = pairs[i]; if (pair.bodyA === collider) { - pair.bodyB.render.strokeStyle = greenColor; + pair.bodyB.render.strokeStyle = colorB; } else if (pair.bodyB === collider) { - pair.bodyA.render.strokeStyle = greenColor; + pair.bodyA.render.strokeStyle = colorB; } } }); @@ -4322,7 +4317,7 @@ Example.slingshot = function() { Runner.run(runner, engine); // add bodies - var ground = Bodies.rectangle(395, 600, 815, 50, { isStatic: true }), + var ground = Bodies.rectangle(395, 600, 815, 50, { isStatic: true, render: { fillStyle: '#060a19' } }), rockOptions = { density: 0.004 }, rock = Bodies.polygon(170, 450, 8, 20, rockOptions), anchor = { x: 170, y: 450 }, @@ -4336,7 +4331,7 @@ Example.slingshot = function() { return Bodies.rectangle(x, y, 25, 40); }); - var ground2 = Bodies.rectangle(610, 250, 200, 20, { isStatic: true }); + var ground2 = Bodies.rectangle(610, 250, 200, 20, { isStatic: true, render: { fillStyle: '#060a19' } }); var pyramid2 = Composites.pyramid(550, 0, 5, 10, 0, 0, function(x, y) { return Bodies.rectangle(x, y, 25, 40); @@ -4515,7 +4510,6 @@ Example.sprites = function() { options: { width: 800, height: 600, - background: '#0f0f13', showAngleIndicator: false, wireframes: false } @@ -4741,7 +4735,7 @@ Example.staticFriction = function() { Runner.run(runner, engine); // add bodies - var body = Bodies.rectangle(400, 500, 200, 60, { isStatic: true, chamfer: 10 }), + var body = Bodies.rectangle(400, 500, 200, 60, { isStatic: true, chamfer: 10, render: { fillStyle: '#060a19' } }), size = 50, counter = -1; @@ -5046,7 +5040,7 @@ Example.svg = function() { (function(i) { $.get('./svg/' + svgs[i] + '.svg').done(function(data) { var vertexSets = [], - color = Common.choose(['#556270', '#4ECDC4', '#C7F464', '#FF6B6B', '#C44D58']); + color = Common.choose(['#f19648', '#f5d259', '#f55a3c', '#063e7b', '#ececd1']); $(data).find('path').each(function(i, path) { var points = Svg.pathToVertices(path, 30); @@ -5066,7 +5060,7 @@ Example.svg = function() { $.get('./svg/svg.svg').done(function(data) { var vertexSets = [], - color = Common.choose(['#556270', '#4ECDC4', '#C7F464', '#FF6B6B', '#C44D58']); + color = Common.choose(['#f19648', '#f5d259', '#f55a3c', '#063e7b', '#ececd1']); $(data).find('path').each(function(i, path) { vertexSets.push(Svg.pathToVertices(path, 30)); @@ -5182,8 +5176,8 @@ Example.terrain = function() { terrain = Bodies.fromVertices(400, 350, vertexSets, { isStatic: true, render: { - fillStyle: '#2e2b44', - strokeStyle: '#2e2b44', + fillStyle: '#060a19', + strokeStyle: '#060a19', lineWidth: 1 } }, true); diff --git a/package-lock.json b/package-lock.json index ebcd1a8..76b2e73 100644 --- a/package-lock.json +++ b/package-lock.json @@ -1,6 +1,6 @@ { "name": "matter-js", - "version": "0.14.2", + "version": "0.15.0", "lockfileVersion": 1, "requires": true, "dependencies": { diff --git a/package.json b/package.json index ec365ce..ffba293 100644 --- a/package.json +++ b/package.json @@ -1,6 +1,6 @@ { "name": "matter-js", - "version": "0.14.2", + "version": "0.15.0", "license": "MIT", "homepage": "http://brm.io/matter-js/", "author": "Liam Brummitt (http://brm.io/)", From 3089b41f30500794d01ec21062edaad47099ef24 Mon Sep 17 00:00:00 2001 From: liabru Date: Mon, 28 Dec 2020 16:11:39 +0000 Subject: [PATCH 19/23] updated readme --- README.md | 122 ++++++++++++++++++++++++++++-------------------------- 1 file changed, 64 insertions(+), 58 deletions(-) diff --git a/README.md b/README.md index 9c8fc2f..b5745b5 100644 --- a/README.md +++ b/README.md @@ -1,10 +1,10 @@ -Matter.js +Matter.js > *Matter.js* is a JavaScript 2D rigid body physics engine for the web -[brm.io/matter-js](http://brm.io/matter-js/) +[brm.io/matter-js](https://brm.io/matter-js/) -[Demos](#demos) - [Gallery](#gallery) - [Features](#features) - [Plugins](#plugins) - [Install](#install) - [Usage](#usage) - [Examples](#examples) - [Docs](#documentation) - [Wiki](https://github.com/liabru/matter-js/wiki) - [References](#references) - [License](#license) +[Demos](#demos) ・ [Gallery](#gallery) ・ [Features](#features) ・ [Plugins](#plugins) ・ [Install](#install) ・ [Usage](#usage) ・ [Examples](#examples) ・ [Docs](#documentation) ・ [Wiki](https://github.com/liabru/matter-js/wiki) ・ [References](#references) ・ [License](#license) [![Build Status](https://travis-ci.org/liabru/matter-js.png?branch=master)](https://travis-ci.org/liabru/matter-js) @@ -14,51 +14,55 @@ + + +
@@ -69,16 +73,18 @@ See how others are using matter.js physics -- [Les métamorphoses de Mr. Kalia](http://lab212.org/Les-metamorphoses-de-Mr-Kalia) by Lab212 for Google -- [4ify](http://pauliescanlon.io/4ify-channel-4-rebrand-2/) by Supernatural for Channel 4 -- [Adobe Analytics Live Stream](http://adobefirehose.mediarain.com/) by Rain for Adobe -- [Blood Sweat & Tools Interactive](http://bloodsweatandtools.discovery.ca/gamebench/) by Jam3 for Discovery -- [Oracle OpenWorld Experiment](http://theappslab.com/2016/10/10/how-i-attended-oracle-openworld-2016/) by Ed Jones for Oracle -- [Pablo The Flamingo](http://pablotheflamingo.com/) by Nathan Gordon -- [Goblins and Grottos](http://store.steampowered.com/app/389190) by Psychic Software -- [masQueLaCara](https://www.instagram.com/p/BCFqCs6JNsq/) by Zach Lieberman for Art Blocks Houston -- [#GIFMYLIVE](http://bonhommeparis.com/en/projects/arte-gifmylive) by Bonhomme for Arte -- [Hype](http://tumult.com/hype/pro/) by Tumult +- [Patrick Heng](https://patrickheng.com/) by Patrick Heng +- [USELESS](https://useless.london/) by Nice and Serious +- [Secret 7](https://secret-7.com/) by Goodness +- [New Company](https://www.new.company/) by New Company +- [Game of The Year](https://gameoftheyear.withgoogle.com/) by Google +- [Pablo The Flamingo](https://pablotheflamingo.com/) by Nathan Gordon +- [Les métamorphoses de Mr. Kalia](https://lab212.org/oeuvres/2:art/18/Les-metamorphoses-de-Mr-Kalia) by Lab212 +- [Phaser](https://phaser.io/) by Photon Storm +- [Sorry I Have No Filter](https://sorryihavenofilter.com/pages/about/) by Jessica Walsh +- [Fuse](https://fuse.blog/) by Fuse +- [Glyphfinder](https://www.glyphfinder.com/) by überdosis +- [Isolation](https://isolation.is/postcards/my-week) by sabato studio - [more...](https://github.com/liabru/matter-js/wiki/Gallery) ### Features @@ -131,7 +137,7 @@ See the list of [tutorials](https://github.com/liabru/matter-js/wiki/Tutorials). ### Examples See the [examples](https://github.com/liabru/matter-js/tree/master/examples) directory which contains the source for all [demos](#demos). -There are even more examples on [codepen](http://codepen.io/collection/Fuagy/). +There are even more examples on [codepen](https://codepen.io/collection/Fuagy/). ### Plugins @@ -144,11 +150,11 @@ The engine can be extended through plugins, see these resources: ### Documentation -See the [API Documentation](http://brm.io/matter-js/docs/) and the [wiki](https://github.com/liabru/matter-js/wiki) +See the [API Documentation](https://brm.io/matter-js/docs/) and the [wiki](https://github.com/liabru/matter-js/wiki) ### Building and Contributing -To build you must first install [node.js](http://nodejs.org/), then run +To build you must first install [node.js](https://nodejs.org/), then run npm install @@ -168,7 +174,7 @@ See the wiki page on [References](https://github.com/liabru/matter-js/wiki/Refer ### License -Matter.js is licensed under [The MIT License (MIT)](http://opensource.org/licenses/MIT) +Matter.js is licensed under [The MIT License (MIT)](https://opensource.org/licenses/MIT) Copyright (c) 2014 Liam Brummitt This license is also supplied with the release and source code. From f71d4c0a50d5263cd313c34c46084cd0baf82e15 Mon Sep 17 00:00:00 2001 From: liabru Date: Mon, 28 Dec 2020 16:12:33 +0000 Subject: [PATCH 20/23] remove bower.json --- bower.json | 27 --------------------------- 1 file changed, 27 deletions(-) delete mode 100644 bower.json diff --git a/bower.json b/bower.json deleted file mode 100644 index 1782d51..0000000 --- a/bower.json +++ /dev/null @@ -1,27 +0,0 @@ -{ - "name": "Matter", - "version": "0.14.2", - "homepage": "https://github.com/liabru/matter-js", - "authors": [ - "Liam Brummitt (http://brm.io/)" - ], - "description": "a 2D rigid body physics engine for the web", - "main": "build/matter.js", - "keywords": [ - "javascript", - "canvas", - "html5", - "physics", - "physics engine", - "game engine", - "rigid body physics" - ], - "license": "MIT", - "ignore": [ - "**/.*", - "node_modules", - "bower_components", - "test", - "tests" - ] -} From 07927162fc508011c3f677bdf00bf0b153cbe3e6 Mon Sep 17 00:00:00 2001 From: liabru Date: Wed, 30 Dec 2020 22:28:08 +0000 Subject: [PATCH 21/23] add support for > and >= operators in plugin version ranges --- src/core/Plugin.js | 65 +++++++++++++++++++++++++--------------------- 1 file changed, 36 insertions(+), 29 deletions(-) diff --git a/src/core/Plugin.js b/src/core/Plugin.js index 013939a..d3265c7 100644 --- a/src/core/Plugin.js +++ b/src/core/Plugin.js @@ -266,6 +266,8 @@ var Common = require('./Common'); * Only the following range types are supported: * - Tilde ranges e.g. `~1.2.3` * - Caret ranges e.g. `^1.2.3` + * - Greater than ranges e.g. `>1.2.3` + * - Greater than or equal ranges e.g. `>=1.2.3` * - Exact version e.g. `1.2.3` * - Any version `*` * @method versionParse @@ -273,29 +275,28 @@ var Common = require('./Common'); * @return {object} The version range parsed into its components. */ Plugin.versionParse = function(range) { - var pattern = /^\*|[\^~]?\d+\.\d+\.\d+(-[0-9A-Za-z-]+)?$/; + var pattern = /^(\*)|(\^|~|>=|>)?\s*((\d+)\.(\d+)\.(\d+))(-[0-9A-Za-z-]+)?$/; if (!pattern.test(range)) { Common.warn('Plugin.versionParse:', range, 'is not a valid version or range.'); } - var identifiers = range.split('-'); - range = identifiers[0]; - - var isRange = isNaN(Number(range[0])), - version = isRange ? range.substr(1) : range, - parts = Common.map(version.split('.'), function(part) { - return Number(part); - }); + var parts = pattern.exec(range); + var major = Number(parts[4]); + var minor = Number(parts[5]); + var patch = Number(parts[6]); return { - isRange: isRange, - version: version, + isRange: Boolean(parts[1] || parts[2]), + version: parts[3], range: range, - operator: isRange ? range[0] : '', - parts: parts, - prerelease: identifiers[1], - number: parts[0] * 1e8 + parts[1] * 1e4 + parts[2] + operator: parts[1] || parts[2] || '', + major: major, + minor: minor, + patch: patch, + parts: [major, minor, patch], + prerelease: parts[7], + number: major * 1e8 + minor * 1e4 + patch }; }; @@ -311,30 +312,36 @@ var Common = require('./Common'); Plugin.versionSatisfies = function(version, range) { range = range || '*'; - var rangeParsed = Plugin.versionParse(range), - rangeParts = rangeParsed.parts, - versionParsed = Plugin.versionParse(version), - versionParts = versionParsed.parts; + var r = Plugin.versionParse(range), + v = Plugin.versionParse(version); - if (rangeParsed.isRange) { - if (rangeParsed.operator === '*' || version === '*') { + if (r.isRange) { + if (r.operator === '*' || version === '*') { return true; } - if (rangeParsed.operator === '~') { - return versionParts[0] === rangeParts[0] && versionParts[1] === rangeParts[1] && versionParts[2] >= rangeParts[2]; + if (r.operator === '>') { + return v.number > r.number; } - if (rangeParsed.operator === '^') { - if (rangeParts[0] > 0) { - return versionParts[0] === rangeParts[0] && versionParsed.number >= rangeParsed.number; + if (r.operator === '>=') { + return v.number >= r.number; + } + + if (r.operator === '~') { + return v.major === r.major && v.minor === r.minor && v.patch >= r.patch; + } + + if (r.operator === '^') { + if (r.major > 0) { + return v.major === r.major && v.number >= r.number; } - if (rangeParts[1] > 0) { - return versionParts[1] === rangeParts[1] && versionParts[2] >= rangeParts[2]; + if (r.minor > 0) { + return v.minor === r.minor && v.patch >= r.patch; } - return versionParts[2] === rangeParts[2]; + return v.patch === r.patch; } } From 31d0ace631629ad5914f1805272fde46a3af60f0 Mon Sep 17 00:00:00 2001 From: liabru Date: Wed, 30 Dec 2020 23:03:38 +0000 Subject: [PATCH 22/23] added support for example versioning in tests --- test/Browser.spec.js | 9 ++++++++- test/Examples.spec.js | 10 +++++++++- 2 files changed, 17 insertions(+), 2 deletions(-) diff --git a/test/Browser.spec.js b/test/Browser.spec.js index e927160..bcc8c27 100644 --- a/test/Browser.spec.js +++ b/test/Browser.spec.js @@ -5,9 +5,16 @@ jest.setTimeout(120 * 1000); const puppeteer = require('puppeteer-core'); const Example = require('../examples/index'); +const MatterBuild = require('../build/matter'); +const { versionSatisfies } = require('../src/core/Plugin'); const fs = require('fs'); -const examples = Object.keys(Example); +const examples = Object.keys(Example).filter(key => { + const buildVersion = MatterBuild.version; + const exampleFor = Example[key].for; + return versionSatisfies(buildVersion, exampleFor); +}); + const browserPath = '/Applications/Google\ Chrome.app/Contents/MacOS/Google\ Chrome'; const demoPagePath = 'http://localhost:8000/'; const totalUpdates = 5; diff --git a/test/Examples.spec.js b/test/Examples.spec.js index 289cd2b..3bf3a64 100644 --- a/test/Examples.spec.js +++ b/test/Examples.spec.js @@ -7,13 +7,21 @@ const { comparisonReport, toMatchExtrinsics, toMatchIntrinsics } = require('./Te const Example = require('../examples/index'); const MatterBuild = require('../build/matter'); +const { versionSatisfies } = require('../src/core/Plugin'); const Worker = require('jest-worker').default; const testComparison = process.env.COMPARE === 'true'; const saveComparison = process.env.SAVE === 'true'; const excludeExamples = ['svg', 'terrain']; const excludeJitter = ['stack', 'circleStack', 'restitution', 'staticFriction', 'friction', 'newtonsCradle', 'catapult']; -const examples = Object.keys(Example).filter(key => !excludeExamples.includes(key)); + +const examples = Object.keys(Example).filter(key => { + const excluded = excludeExamples.includes(key); + const buildVersion = MatterBuild.version; + const exampleFor = Example[key].for; + const supported = versionSatisfies(buildVersion, exampleFor); + return !excluded && supported; +}); const runExamples = async useDev => { const worker = new Worker(require.resolve('./ExampleWorker'), { From 142b7de720eea9c91183cc9920c8f6a0bf830c97 Mon Sep 17 00:00:00 2001 From: liabru Date: Wed, 30 Dec 2020 23:18:38 +0000 Subject: [PATCH 23/23] added version targets for examples --- examples/airFriction.js | 6 ++++-- examples/avalanche.js | 6 ++++-- examples/ballPool.js | 6 ++++-- examples/bridge.js | 6 ++++-- examples/broadphase.js | 6 ++++-- examples/car.js | 6 ++++-- examples/catapult.js | 6 ++++-- examples/chains.js | 6 ++++-- examples/circleStack.js | 6 ++++-- examples/cloth.js | 6 ++++-- examples/collisionFiltering.js | 6 ++++-- examples/compositeManipulation.js | 6 ++++-- examples/compound.js | 6 ++++-- examples/compoundStack.js | 6 ++++-- examples/concave.js | 6 ++++-- examples/constraints.js | 6 ++++-- examples/doublePendulum.js | 6 ++++-- examples/events.js | 6 ++++-- examples/friction.js | 6 ++++-- examples/gravity.js | 6 ++++-- examples/gyro.js | 6 ++++-- examples/manipulation.js | 6 ++++-- examples/mixed.js | 6 ++++-- examples/newtonsCradle.js | 6 ++++-- examples/pyramid.js | 6 ++++-- examples/ragdoll.js | 6 ++++-- examples/raycasting.js | 6 ++++-- examples/restitution.js | 6 ++++-- examples/rounded.js | 6 ++++-- examples/sensors.js | 6 ++++-- examples/sleeping.js | 6 ++++-- examples/slingshot.js | 6 ++++-- examples/softBody.js | 6 ++++-- examples/sprites.js | 6 ++++-- examples/stack.js | 6 ++++-- examples/staticFriction.js | 6 ++++-- examples/stress.js | 6 ++++-- examples/stress2.js | 6 ++++-- examples/svg.js | 6 ++++-- examples/terrain.js | 6 ++++-- examples/timescale.js | 6 ++++-- examples/views.js | 6 ++++-- examples/wreckingBall.js | 6 ++++-- 43 files changed, 172 insertions(+), 86 deletions(-) diff --git a/examples/airFriction.js b/examples/airFriction.js index c943b0e..eae934b 100644 --- a/examples/airFriction.js +++ b/examples/airFriction.js @@ -80,6 +80,8 @@ Example.airFriction = function() { }; }; +Example.airFriction.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.airFriction; +} diff --git a/examples/avalanche.js b/examples/avalanche.js index b79b525..6f6aea6 100644 --- a/examples/avalanche.js +++ b/examples/avalanche.js @@ -91,6 +91,8 @@ Example.avalanche = function() { }; }; +Example.avalanche.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.avalanche; +} diff --git a/examples/ballPool.js b/examples/ballPool.js index f6ac267..1aa7d0b 100644 --- a/examples/ballPool.js +++ b/examples/ballPool.js @@ -99,6 +99,8 @@ Example.ballPool = function() { }; }; +Example.ballPool.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.ballPool; +} diff --git a/examples/bridge.js b/examples/bridge.js index e77f58a..ea4b587 100644 --- a/examples/bridge.js +++ b/examples/bridge.js @@ -124,6 +124,8 @@ Example.bridge = function() { }; }; +Example.bridge.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.bridge; +} diff --git a/examples/broadphase.js b/examples/broadphase.js index 82d0048..bcd89f0 100644 --- a/examples/broadphase.js +++ b/examples/broadphase.js @@ -95,6 +95,8 @@ Example.broadphase = function() { }; }; +Example.broadphase.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.broadphase; +} diff --git a/examples/car.js b/examples/car.js index 76fb5b6..a4fb873 100644 --- a/examples/car.js +++ b/examples/car.js @@ -89,6 +89,8 @@ Example.car = function() { }; }; +Example.car.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.car; +} diff --git a/examples/catapult.js b/examples/catapult.js index 2ebfb55..0d5ec72 100644 --- a/examples/catapult.js +++ b/examples/catapult.js @@ -96,6 +96,8 @@ Example.catapult = function() { }; }; +Example.catapult.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.catapult; +} diff --git a/examples/chains.js b/examples/chains.js index 6c150e5..2b088ef 100644 --- a/examples/chains.js +++ b/examples/chains.js @@ -122,6 +122,8 @@ Example.chains = function() { }; }; +Example.chains.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.chains; +} diff --git a/examples/circleStack.js b/examples/circleStack.js index 95a396d..4e56bfd 100644 --- a/examples/circleStack.js +++ b/examples/circleStack.js @@ -81,6 +81,8 @@ Example.circleStack = function() { }; }; +Example.circleStack.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.circleStack; +} diff --git a/examples/cloth.js b/examples/cloth.js index da6e163..187fd05 100644 --- a/examples/cloth.js +++ b/examples/cloth.js @@ -84,6 +84,8 @@ Example.cloth = function() { }; }; +Example.cloth.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.cloth; +} diff --git a/examples/collisionFiltering.js b/examples/collisionFiltering.js index 67e5bf1..ad9a953 100644 --- a/examples/collisionFiltering.js +++ b/examples/collisionFiltering.js @@ -154,6 +154,8 @@ Example.collisionFiltering = function() { }; }; +Example.collisionFiltering.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.collisionFiltering; +} diff --git a/examples/compositeManipulation.js b/examples/compositeManipulation.js index 5058b45..6be50f4 100644 --- a/examples/compositeManipulation.js +++ b/examples/compositeManipulation.js @@ -107,6 +107,8 @@ Example.compositeManipulation = function() { }; }; +Example.compositeManipulation.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.compositeManipulation; +} diff --git a/examples/compound.js b/examples/compound.js index e6a0bdf..1d504ff 100644 --- a/examples/compound.js +++ b/examples/compound.js @@ -106,6 +106,8 @@ Example.compound = function() { }; }; +Example.compound.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.compound; +} diff --git a/examples/compoundStack.js b/examples/compoundStack.js index 66c2020..d534585 100644 --- a/examples/compoundStack.js +++ b/examples/compoundStack.js @@ -89,6 +89,8 @@ Example.compoundStack = function() { }; }; +Example.compoundStack.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.compoundStack; +} diff --git a/examples/concave.js b/examples/concave.js index 3289a49..1029463 100644 --- a/examples/concave.js +++ b/examples/concave.js @@ -95,6 +95,8 @@ Example.concave = function() { }; }; +Example.concave.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.concave; +} diff --git a/examples/constraints.js b/examples/constraints.js index 1255607..b8d63aa 100644 --- a/examples/constraints.js +++ b/examples/constraints.js @@ -179,6 +179,8 @@ Example.constraints = function() { }; }; +Example.constraints.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.constraints; +} diff --git a/examples/doublePendulum.js b/examples/doublePendulum.js index dd84a0f..76d8df5 100644 --- a/examples/doublePendulum.js +++ b/examples/doublePendulum.js @@ -148,6 +148,8 @@ Example.doublePendulum = function() { }; }; +Example.doublePendulum.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.doublePendulum; +} diff --git a/examples/events.js b/examples/events.js index 0ebfd0e..8904d27 100644 --- a/examples/events.js +++ b/examples/events.js @@ -178,6 +178,8 @@ Example.events = function() { }; }; +Example.events.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.events; +} diff --git a/examples/friction.js b/examples/friction.js index 7502b73..afee05b 100644 --- a/examples/friction.js +++ b/examples/friction.js @@ -90,6 +90,8 @@ Example.friction = function() { }; }; +Example.friction.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.friction; +} diff --git a/examples/gravity.js b/examples/gravity.js index 1018564..0df0b72 100644 --- a/examples/gravity.js +++ b/examples/gravity.js @@ -96,6 +96,8 @@ Example.gravity = function() { }; }; +Example.gravity.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.gravity; +} diff --git a/examples/gyro.js b/examples/gyro.js index 8b93a77..596bac9 100644 --- a/examples/gyro.js +++ b/examples/gyro.js @@ -130,6 +130,8 @@ Example.gyro = function() { }; }; +Example.gyro.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.gyro; +} diff --git a/examples/manipulation.js b/examples/manipulation.js index 8c407cb..e2d45de 100644 --- a/examples/manipulation.js +++ b/examples/manipulation.js @@ -140,6 +140,8 @@ Example.manipulation = function() { }; }; +Example.manipulation.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.manipulation; +} diff --git a/examples/mixed.js b/examples/mixed.js index 8784b3e..0bbbde9 100644 --- a/examples/mixed.js +++ b/examples/mixed.js @@ -105,6 +105,8 @@ Example.mixed = function() { }; }; +Example.mixed.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.mixed; +} diff --git a/examples/newtonsCradle.js b/examples/newtonsCradle.js index 00b2f42..4aab940 100644 --- a/examples/newtonsCradle.js +++ b/examples/newtonsCradle.js @@ -76,6 +76,8 @@ Example.newtonsCradle = function() { }; }; +Example.newtonsCradle.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.newtonsCradle; +} diff --git a/examples/pyramid.js b/examples/pyramid.js index 66dbe6b..dd4482d 100644 --- a/examples/pyramid.js +++ b/examples/pyramid.js @@ -81,6 +81,8 @@ Example.pyramid = function() { }; }; +Example.pyramid.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.pyramid; +} diff --git a/examples/ragdoll.js b/examples/ragdoll.js index a7ea8dd..4cb9a1f 100644 --- a/examples/ragdoll.js +++ b/examples/ragdoll.js @@ -498,6 +498,8 @@ Example.ragdoll.ragdoll = function(x, y, scale, options) { return person; }; +Example.ragdoll.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.ragdoll; +} diff --git a/examples/raycasting.js b/examples/raycasting.js index 883434a..39bbb6a 100644 --- a/examples/raycasting.js +++ b/examples/raycasting.js @@ -135,6 +135,8 @@ Example.raycasting = function() { }; }; +Example.raycasting.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.raycasting; +} diff --git a/examples/restitution.js b/examples/restitution.js index 86ad286..3fa6ca4 100644 --- a/examples/restitution.js +++ b/examples/restitution.js @@ -85,6 +85,8 @@ Example.restitution = function() { }; }; +Example.restitution.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.restitution; +} diff --git a/examples/rounded.js b/examples/rounded.js index d4dc144..0d041a0 100644 --- a/examples/rounded.js +++ b/examples/rounded.js @@ -109,6 +109,8 @@ Example.rounded = function() { }; }; +Example.rounded.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.rounded; +} diff --git a/examples/sensors.js b/examples/sensors.js index a034b9b..750186f 100644 --- a/examples/sensors.js +++ b/examples/sensors.js @@ -130,6 +130,8 @@ Example.sensors = function() { }; }; +Example.sensors.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.sensors; +} diff --git a/examples/sleeping.js b/examples/sleeping.js index 147eb5d..e8de790 100644 --- a/examples/sleeping.js +++ b/examples/sleeping.js @@ -104,6 +104,8 @@ Example.sleeping = function() { }; }; +Example.sleeping.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.sleeping; +} diff --git a/examples/slingshot.js b/examples/slingshot.js index df2f6f3..1f59829 100644 --- a/examples/slingshot.js +++ b/examples/slingshot.js @@ -100,6 +100,8 @@ Example.slingshot = function() { }; }; +Example.slingshot.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.slingshot; +} diff --git a/examples/softBody.js b/examples/softBody.js index 81b8eb7..f16e3de 100644 --- a/examples/softBody.js +++ b/examples/softBody.js @@ -85,6 +85,8 @@ Example.softBody = function() { }; }; +Example.softBody.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.softBody; +} diff --git a/examples/sprites.js b/examples/sprites.js index 1bdbba5..07ecc33 100644 --- a/examples/sprites.js +++ b/examples/sprites.js @@ -112,6 +112,8 @@ Example.sprites = function() { }; }; +Example.sprites.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.sprites; +} diff --git a/examples/stack.js b/examples/stack.js index fc198d9..008b368 100644 --- a/examples/stack.js +++ b/examples/stack.js @@ -81,6 +81,8 @@ Example.stack = function() { }; }; +Example.stack.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.stack; +} diff --git a/examples/staticFriction.js b/examples/staticFriction.js index 3366c5d..a42b5cc 100644 --- a/examples/staticFriction.js +++ b/examples/staticFriction.js @@ -106,6 +106,8 @@ Example.staticFriction = function() { }; }; +Example.staticFriction.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.staticFriction; +} diff --git a/examples/stress.js b/examples/stress.js index eb4ff3e..5888981 100644 --- a/examples/stress.js +++ b/examples/stress.js @@ -79,6 +79,8 @@ Example.stress = function() { }; }; +Example.stress.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.stress; +} diff --git a/examples/stress2.js b/examples/stress2.js index e2c46e7..b0ed57d 100644 --- a/examples/stress2.js +++ b/examples/stress2.js @@ -79,6 +79,8 @@ Example.stress2 = function() { }; }; +Example.stress2.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.stress2; +} diff --git a/examples/svg.js b/examples/svg.js index 41b5764..80a6d8c 100644 --- a/examples/svg.js +++ b/examples/svg.js @@ -124,6 +124,8 @@ Example.svg = function() { }; }; +Example.svg.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.svg; +} diff --git a/examples/terrain.js b/examples/terrain.js index f6f54af..4235967 100644 --- a/examples/terrain.js +++ b/examples/terrain.js @@ -105,6 +105,8 @@ Example.terrain = function() { }; }; +Example.terrain.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.terrain; +} diff --git a/examples/timescale.js b/examples/timescale.js index 7274924..1749a5c 100644 --- a/examples/timescale.js +++ b/examples/timescale.js @@ -151,6 +151,8 @@ Example.timescale = function() { }; }; +Example.timescale.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.timescale; +} diff --git a/examples/views.js b/examples/views.js index 0d5cdfd..4d1785d 100644 --- a/examples/views.js +++ b/examples/views.js @@ -182,6 +182,8 @@ Example.views = function() { }; }; +Example.views.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.views; +} diff --git a/examples/wreckingBall.js b/examples/wreckingBall.js index fd4f1bc..8a90316 100644 --- a/examples/wreckingBall.js +++ b/examples/wreckingBall.js @@ -93,6 +93,8 @@ Example.wreckingBall = function() { }; }; +Example.wreckingBall.for = '>=0.14.2'; + if (typeof module !== 'undefined') { - module.exports = Example[Object.keys(Example)[0]]; -} \ No newline at end of file + module.exports = Example.wreckingBall; +}