/** * matter.js 0.8.0-edge 2014-07-29 * http://brm.io/matter-js/ * License: MIT */ /** * The MIT License (MIT) * * Copyright (c) 2014 Liam Brummitt * * Permission is hereby granted, free of charge, to any person obtaining a copy * of this software and associated documentation files (the "Software"), to deal * in the Software without restriction, including without limitation the rights * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell * copies of the Software, and to permit persons to whom the Software is * furnished to do so, subject to the following conditions: * * The above copyright notice and this permission notice shall be included in * all copies or substantial portions of the Software. * * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN * THE SOFTWARE. */ (function() { var Matter = {}; // Begin Matter namespace closure // All Matter modules are included below during build // Outro.js then closes at the end of the file // Begin src/body/Body.js /** * The `Matter.Body` module contains methods for creating and manipulating body models. * A `Matter.Body` is a rigid body that can be simulated by a `Matter.Engine`. * Factories for commonly used body configurations (such as rectangles, circles and other polygons) can be found in the module `Matter.Bodies`. * * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * @class Body */ var Body = {}; (function() { Body._inertiaScale = 4; var _nextCollidingGroupId = 1, _nextNonCollidingGroupId = -1; /** * Creates a new rigid body model. The options parameter is an object that specifies any properties you wish to override the defaults. * All properties have default values, and many are pre-calculated automatically based on other properties. * See the properites section below for detailed information on what you can pass via the `options` object. * @method create * @param {} options * @return {body} body */ Body.create = function(options) { var defaults = { id: Common.nextId(), type: 'body', label: 'Body', angle: 0, vertices: Vertices.fromPath('L 0 0 L 40 0 L 40 40 L 0 40'), position: { x: 0, y: 0 }, force: { x: 0, y: 0 }, torque: 0, positionImpulse: { x: 0, y: 0 }, constraintImpulse: { x: 0, y: 0, angle: 0 }, speed: 0, angularSpeed: 0, velocity: { x: 0, y: 0 }, angularVelocity: 0, isStatic: false, isSleeping: false, motion: 0, sleepThreshold: 60, density: 0.001, restitution: 0, friction: 0.1, frictionAir: 0.01, collisionFilter: { category: 0x0001, mask: 0xFFFFFFFF, group: 0 }, slop: 0.05, timeScale: 1, render: { visible: true, sprite: { xScale: 1, yScale: 1 }, lineWidth: 1.5 } }; var body = Common.extend(defaults, options); _initProperties(body, options); return body; }; /** * Returns the next unique group index for which bodies will collide. * If `isNonColliding` is `true`, returns the next unique group index for which bodies will _not_ collide. * See `body.collisionFilter` for more information. * @method nextGroup * @param {bool} [isNonColliding=false] * @return {Number} Unique group index */ Body.nextGroup = function(isNonColliding) { if (isNonColliding) return _nextNonCollidingGroupId--; return _nextCollidingGroupId++; }; /** * Initialises body properties. * @method _initProperties * @private * @param {body} body * @param {} options */ var _initProperties = function(body, options) { // init required properties body.bounds = body.bounds || Bounds.create(body.vertices); body.positionPrev = body.positionPrev || Vector.clone(body.position); body.anglePrev = body.anglePrev || body.angle; // must use setters for the more complicated properties Body.setVertices(body, body.vertices); Body.setStatic(body, body.isStatic); Sleeping.set(body, body.isSleeping); Vertices.rotate(body.vertices, body.angle, body.position); Axes.rotate(body.axes, body.angle); Bounds.update(body.bounds, body.vertices, body.velocity); // allow options to override the automatically calculated properties body.axes = options.axes || body.axes; body.area = options.area || body.area; Body.setMass(body, options.mass || body.mass); Body.setInertia(body, options.inertia || body.inertia); // render properties var defaultFillStyle = (body.isStatic ? '#eeeeee' : Common.choose(['#556270', '#4ECDC4', '#C7F464', '#FF6B6B', '#C44D58'])), defaultStrokeStyle = Common.shadeColor(defaultFillStyle, -20); body.render.fillStyle = body.render.fillStyle || defaultFillStyle; body.render.strokeStyle = body.render.strokeStyle || defaultStrokeStyle; }; /** * Sets the body as static, including isStatic flag and setting mass and inertia to Infinity. * @method setStatic * @param {body} body * @param {bool} isStatic */ Body.setStatic = function(body, isStatic) { body.isStatic = isStatic; if (isStatic) { body.restitution = 0; body.friction = 1; body.mass = body.inertia = body.density = Infinity; body.inverseMass = body.inverseInertia = 0; body.positionPrev.x = body.position.x; body.positionPrev.y = body.position.y; body.anglePrev = body.angle; body.angularVelocity = 0; body.speed = 0; body.angularSpeed = 0; body.motion = 0; } }; /** * Sets the mass of the body. Inverse mass and density are automatically updated to reflect the change. * @method setMass * @param {body} body * @param {number} mass */ Body.setMass = function(body, mass) { body.mass = mass; body.inverseMass = 1 / body.mass; body.density = body.mass / body.area; }; /** * Sets the density of the body. Mass is automatically updated to reflect the change. * @method setDensity * @param {body} body * @param {number} density */ Body.setDensity = function(body, density) { Body.setMass(body, density * body.area); body.density = density; }; /** * Sets the moment of inertia (i.e. second moment of area) of the body of the body. * Inverse inertia is automatically updated to reflect the change. Mass is not changed. * @method setInertia * @param {body} body * @param {number} inertia */ Body.setInertia = function(body, inertia) { body.inertia = inertia; body.inverseInertia = 1 / body.inertia; }; /** * Sets the body's vertices and updates body properties accordingly, including inertia, area and mass (with respect to `body.density`). * Vertices will be automatically transformed to be orientated around their centre of mass as the origin. * They are then automatically translated to world space based on `body.position`. * * The `vertices` argument should be passed as an array of `Matter.Vector` points (or a `Matter.Vertices` array). * Vertices must form a convex hull, concave hulls are not supported. * * @method setVertices * @param {body} body * @param {vector[]} vertices */ Body.setVertices = function(body, vertices) { // change vertices if (vertices[0].body === body) { body.vertices = vertices; } else { body.vertices = Vertices.create(vertices, body); } // update properties body.axes = Axes.fromVertices(body.vertices); body.area = Vertices.area(body.vertices); Body.setMass(body, body.density * body.area); // orient vertices around the centre of mass at origin (0, 0) var centre = Vertices.centre(body.vertices); Vertices.translate(body.vertices, centre, -1); // update inertia while vertices are at origin (0, 0) Body.setInertia(body, Body._inertiaScale * Vertices.inertia(body.vertices, body.mass)); // update geometry Vertices.translate(body.vertices, body.position); Bounds.update(body.bounds, body.vertices, body.velocity); }; /** * Sets the position of the body instantly. Velocity, angle, force etc. are unchanged. * @method setPosition * @param {body} body * @param {vector} position */ Body.setPosition = function(body, position) { var delta = Vector.sub(position, body.position); body.position.x = position.x; body.position.y = position.y; body.positionPrev.x += delta.x; body.positionPrev.y += delta.y; Vertices.translate(body.vertices, delta); Bounds.update(body.bounds, body.vertices, body.velocity); }; /** * Sets the angle of the body instantly. Angular velocity, position, force etc. are unchanged. * @method setAngle * @param {body} body * @param {number} angle */ Body.setAngle = function(body, angle) { var delta = angle - body.angle; body.angle = angle; body.anglePrev += delta; Vertices.rotate(body.vertices, delta, body.position); Axes.rotate(body.axes, delta); Bounds.update(body.bounds, body.vertices, body.velocity); }; /** * Sets the linear velocity of the body instantly. Position, angle, force etc. are unchanged. See also `Body.applyForce`. * @method setVelocity * @param {body} body * @param {vector} velocity */ Body.setVelocity = function(body, velocity) { body.positionPrev.x = body.position.x - velocity.x; body.positionPrev.y = body.position.y - velocity.y; body.velocity.x = velocity.x; body.velocity.y = velocity.y; body.speed = Vector.magnitude(body.velocity); }; /** * Sets the angular velocity of the body instantly. Position, angle, force etc. are unchanged. See also `Body.applyForce`. * @method setAngularVelocity * @param {body} body * @param {number} velocity */ Body.setAngularVelocity = function(body, velocity) { body.anglePrev = body.angle - velocity; body.angularVelocity = velocity; body.angularSpeed = Math.abs(body.angularVelocity); }; /** * Moves a body by a given vector relative to its current position, without imparting any velocity. * @method translate * @param {body} body * @param {vector} translation */ Body.translate = function(body, translation) { Body.setPosition(body, Vector.add(body.position, translation)); }; /** * Rotates a body by a given angle relative to its current angle, without imparting any angular velocity. * @method rotate * @param {body} body * @param {number} rotation */ Body.rotate = function(body, rotation) { Body.setAngle(body, body.angle + rotation); }; /** * Scales the body, including updating physical properties (mass, area, axes, inertia), from a world-space point (default is body centre). * @method scale * @param {body} body * @param {number} scaleX * @param {number} scaleY * @param {vector} [point] */ Body.scale = function(body, scaleX, scaleY, point) { // scale vertices Vertices.scale(body.vertices, scaleX, scaleY, point); // update properties body.axes = Axes.fromVertices(body.vertices); body.area = Vertices.area(body.vertices); Body.setMass(body, body.density * body.area); // update inertia (requires vertices to be at origin) Vertices.translate(body.vertices, { x: -body.position.x, y: -body.position.y }); Body.setInertia(body, Vertices.inertia(body.vertices, body.mass)); Vertices.translate(body.vertices, { x: body.position.x, y: body.position.y }); // update bounds Bounds.update(body.bounds, body.vertices, body.velocity); }; /** * Zeroes the `body.force` and `body.torque` force buffers. * @method resetForcesAll * @param {body[]} bodies */ Body.resetForcesAll = function(bodies) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; // reset force buffers body.force.x = 0; body.force.y = 0; body.torque = 0; } }; /** * Applys a mass dependant force to all given bodies. * @method applyGravityAll * @param {body[]} bodies * @param {vector} gravity */ Body.applyGravityAll = function(bodies, gravity) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (body.isStatic || body.isSleeping) continue; // apply gravity body.force.y += body.mass * gravity.y * 0.001; body.force.x += body.mass * gravity.x * 0.001; } }; /** * Applys `Body.update` to all given `bodies`. * @method updateAll * @param {body[]} bodies * @param {number} deltaTime * The amount of time elapsed between updates * @param {number} timeScale * @param {number} correction * The Verlet correction factor (deltaTime / lastDeltaTime) * @param {bounds} worldBounds */ Body.updateAll = function(bodies, deltaTime, timeScale, correction, worldBounds) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (body.isStatic || body.isSleeping) continue; // don't update out of world bodies // TODO: viewports if (body.bounds.max.x < worldBounds.min.x || body.bounds.min.x > worldBounds.max.x || body.bounds.max.y < worldBounds.min.y || body.bounds.min.y > worldBounds.max.y) continue; Body.update(body, deltaTime, timeScale, correction); } }; /** * Performs a simulation step for the given `body`, including updating position and angle using Verlet integration. * @method update * @param {body} body * @param {number} deltaTime * @param {number} timeScale * @param {number} correction */ Body.update = function(body, deltaTime, timeScale, correction) { var deltaTimeSquared = Math.pow(deltaTime * timeScale * body.timeScale, 2); // from the previous step var frictionAir = 1 - body.frictionAir * timeScale * body.timeScale, velocityPrevX = body.position.x - body.positionPrev.x, velocityPrevY = body.position.y - body.positionPrev.y; // update velocity with verlet integration body.velocity.x = (velocityPrevX * frictionAir * correction) + (body.force.x / body.mass) * deltaTimeSquared; body.velocity.y = (velocityPrevY * frictionAir * correction) + (body.force.y / body.mass) * deltaTimeSquared; body.positionPrev.x = body.position.x; body.positionPrev.y = body.position.y; body.position.x += body.velocity.x; body.position.y += body.velocity.y; // update angular velocity with verlet integration body.angularVelocity = ((body.angle - body.anglePrev) * frictionAir * correction) + (body.torque / body.inertia) * deltaTimeSquared; body.anglePrev = body.angle; body.angle += body.angularVelocity; // track speed and acceleration body.speed = Vector.magnitude(body.velocity); body.angularSpeed = Math.abs(body.angularVelocity); // transform the body geometry Vertices.translate(body.vertices, body.velocity); if (body.angularVelocity !== 0) { Vertices.rotate(body.vertices, body.angularVelocity, body.position); Axes.rotate(body.axes, body.angularVelocity); } Bounds.update(body.bounds, body.vertices, body.velocity); }; /** * Applies a force to a body from a given world-space position, including resulting torque. * @method applyForce * @param {body} body * @param {vector} position * @param {vector} force */ Body.applyForce = function(body, position, force) { body.force.x += force.x; body.force.y += force.y; var offset = { x: position.x - body.position.x, y: position.y - body.position.y }; body.torque += (offset.x * force.y - offset.y * force.x) * body.inverseInertia; }; /* * * Properties Documentation * */ /** * An integer `Number` uniquely identifying number generated in `Body.create` by `Common.nextId`. * * @property id * @type number */ /** * A `String` denoting the type of object. * * @property type * @type string * @default "body" */ /** * An arbitrary `String` name to help the user identify and manage bodies. * * @property label * @type string * @default "Body" */ /** * A `Number` specifying the angle of the body, in radians. * * @property angle * @type number * @default 0 */ /** * An array of `Vector` objects that specify the convex hull of the rigid body. * These should be provided about the origin `(0, 0)`. E.g. * * [{ x: 0, y: 0 }, { x: 25, y: 50 }, { x: 50, y: 0 }] * * When passed via `Body.create`, the verticies are translated relative to `body.position` (i.e. world-space, and constantly updated by `Body.update` during simulation). * The `Vector` objects are also augmented with additional properties required for efficient collision detection. * * Other properties such as `inertia` and `bounds` are automatically calculated from the passed vertices (unless provided via `options`). * Concave hulls are not currently supported. The module `Matter.Vertices` contains useful methods for working with vertices. * * @property vertices * @type vector[] */ /** * A `Vector` that specifies the current world-space position of the body. * * @property position * @type vector * @default { x: 0, y: 0 } */ /** * A `Vector` that specifies the force to apply in the current step. It is zeroed after every `Body.update`. See also `Body.applyForce`. * * @property force * @type vector * @default { x: 0, y: 0 } */ /** * A `Number` that specifies the torque (turning force) to apply in the current step. It is zeroed after every `Body.update`. * * @property torque * @type number * @default 0 */ /** * A `Number` that _measures_ the current speed of the body after the last `Body.update`. It is read-only and always positive (it's the magnitude of `body.velocity`). * * @readOnly * @property speed * @type number * @default 0 */ /** * A `Number` that _measures_ the current angular speed of the body after the last `Body.update`. It is read-only and always positive (it's the magnitude of `body.angularVelocity`). * * @readOnly * @property angularSpeed * @type number * @default 0 */ /** * A `Vector` that _measures_ the current velocity of the body after the last `Body.update`. It is read-only. * If you need to modify a body's velocity directly, you should either apply a force or simply change the body's `position` (as the engine uses position-Verlet integration). * * @readOnly * @property velocity * @type vector * @default { x: 0, y: 0 } */ /** * A `Number` that _measures_ the current angular velocity of the body after the last `Body.update`. It is read-only. * If you need to modify a body's angular velocity directly, you should apply a torque or simply change the body's `angle` (as the engine uses position-Verlet integration). * * @readOnly * @property angularVelocity * @type number * @default 0 */ /** * A flag that indicates whether a body is considered static. A static body can never change position or angle and is completely fixed. * If you need to set a body as static after its creation, you should use `Body.setStatic` as this requires more than just setting this flag. * * @property isStatic * @type boolean * @default false */ /** * A flag that indicates whether the body is considered sleeping. A sleeping body acts similar to a static body, except it is only temporary and can be awoken. * If you need to set a body as sleeping, you should use `Sleeping.set` as this requires more than just setting this flag. * * @property isSleeping * @type boolean * @default false */ /** * A `Number` that _measures_ the amount of movement a body currently has (a combination of `speed` and `angularSpeed`). It is read-only and always positive. * It is used and updated by the `Matter.Sleeping` module during simulation to decide if a body has come to rest. * * @readOnly * @property motion * @type number * @default 0 */ /** * A `Number` that defines the number of updates in which this body must have near-zero velocity before it is set as sleeping by the `Matter.Sleeping` module (if sleeping is enabled by the engine). * * @property sleepThreshold * @type number * @default 60 */ /** * A `Number` that defines the density of the body, that is its mass per unit area. * If you pass the density via `Body.create` the `mass` property is automatically calculated for you based on the size (area) of the object. * This is generally preferable to simply setting mass and allows for more intuitive definition of materials (e.g. rock has a higher density than wood). * * @property density * @type number * @default 0.001 */ /** * A `Number` that defines the mass of the body, although it may be more appropriate to specify the `density` property instead. * If you modify this value, you must also modify the `body.inverseMass` property (`1 / mass`). * * @property mass * @type number */ /** * A `Number` that defines the inverse mass of the body (`1 / mass`). * If you modify this value, you must also modify the `body.mass` property. * * @property inverseMass * @type number */ /** * A `Number` that defines the moment of inertia (i.e. second moment of area) of the body. * It is automatically calculated from the given convex hull (`vertices` array) and density in `Body.create`. * If you modify this value, you must also modify the `body.inverseInertia` property (`1 / inertia`). * * @property inertia * @type number */ /** * A `Number` that defines the inverse moment of inertia of the body (`1 / inertia`). * If you modify this value, you must also modify the `body.inertia` property. * * @property inverseInertia * @type number */ /** * A `Number` that defines the restitution (elasticity) of the body. The value is always positive and is in the range `(0, 1)`. * A value of `0` means collisions may be perfectly inelastic and no bouncing may occur. * A value of `0.8` means the body may bounce back with approximately 80% of its kinetic energy. * Note that collision response is based on _pairs_ of bodies, and that `restitution` values are _combined_ with the following formula: * * Math.max(bodyA.restitution, bodyB.restitution) * * @property restitution * @type number * @default 0 */ /** * A `Number` that defines the friction of the body. The value is always positive and is in the range `(0, 1)`. * A value of `0` means that the body may slide indefinitely. * A value of `1` means the body may come to a stop almost instantly after a force is applied. * * The effects of the value may be non-linear. * High values may be unstable depending on the body. * The engine uses a Coulomb friction model including static and kinetic friction. * Note that collision response is based on _pairs_ of bodies, and that `friction` values are _combined_ with the following formula: * * Math.min(bodyA.friction, bodyB.friction) * * @property friction * @type number * @default 0.1 */ /** * A `Number` that defines the air friction of the body (air resistance). * A value of `0` means the body will never slow as it moves through space. * The higher the value, the faster a body slows when moving through space. * The effects of the value are non-linear. * * @property frictionAir * @type number * @default 0.01 */ /** * An `Object` that specifies the collision filtering properties of this body. * * Collisions between two bodies will obey the following rules: * - If the two bodies have the same non-zero value of `collisionFilter.group`, * they will always collide if the value is positive, and they will never collide * if the value is negative. * - If the two bodies have different values of `collisionFilter.group` or if one * (or both) of the bodies has a value of 0, then the category/mask rules apply as follows: * * Each body belongs to a collision category, given by `collisionFilter.category`. This * value is used as a bit field and the category should have only one bit set, meaning that * the value of this property is a power of two in the range [1, 2^31]. Thus, there are 32 * different collision categories available. * * Each body also defines a collision bitmask, given by `collisionFilter.mask` which specifies * the categories it collides with (the value is the bitwise AND value of all these categories). * * Using the category/mask rules, two bodies `A` and `B` collide if each includes the other's * category in its mask, i.e. `(categoryA & maskB) !== 0` and `(categoryB & maskA) !== 0` * are both true. * * @property collisionFilter * @type object */ /** * An Integer `Number`, that specifies the collision group this body belongs to. * See `body.collisionFilter` for more information. * * @property collisionFilter.group * @type object * @default 0 */ /** * A bit field that specifies the collision category this body belongs to. * The category value should have only one bit set, for example `0x0001`. * This means there are up to 32 unique collision categories available. * See `body.collisionFilter` for more information. * * @property collisionFilter.category * @type object * @default 1 */ /** * A bit mask that specifies the collision categories this body may collide with. * See `body.collisionFilter` for more information. * * @property collisionFilter.mask * @type object * @default -1 */ /** * A `Number` that specifies a tolerance on how far a body is allowed to 'sink' or rotate into other bodies. * Avoid changing this value unless you understand the purpose of `slop` in physics engines. * The default should generally suffice, although very large bodies may require larger values for stable stacking. * * @property slop * @type number * @default 0.05 */ /** * A `Number` that allows per-body time scaling, e.g. a force-field where bodies inside are in slow-motion, while others are at full speed. * * @property timeScale * @type number * @default 1 */ /** * An `Object` that defines the rendering properties to be consumed by the module `Matter.Render`. * * @property render * @type object */ /** * A flag that indicates if the body should be rendered. * * @property render.visible * @type boolean * @default true */ /** * An `Object` that defines the sprite properties to use when rendering, if any. * * @property render.sprite * @type object */ /** * An `String` that defines the path to the image to use as the sprite texture, if any. * * @property render.sprite.texture * @type string */ /** * A `Number` that defines the scaling in the x-axis for the sprite, if any. * * @property render.sprite.xScale * @type number * @default 1 */ /** * A `Number` that defines the scaling in the y-axis for the sprite, if any. * * @property render.sprite.yScale * @type number * @default 1 */ /** * A `Number` that defines the line width to use when rendering the body outline (if a sprite is not defined). * A value of `0` means no outline will be rendered. * * @property render.lineWidth * @type number * @default 1.5 */ /** * A `String` that defines the fill style to use when rendering the body (if a sprite is not defined). * It is the same as when using a canvas, so it accepts CSS style property values. * * @property render.fillStyle * @type string * @default a random colour */ /** * A `String` that defines the stroke style to use when rendering the body outline (if a sprite is not defined). * It is the same as when using a canvas, so it accepts CSS style property values. * * @property render.strokeStyle * @type string * @default a random colour */ /** * An array of unique axis vectors (edge normals) used for collision detection. * These are automatically calculated from the given convex hull (`vertices` array) in `Body.create`. * They are constantly updated by `Body.update` during the simulation. * * @property axes * @type vector[] */ /** * A `Number` that _measures_ the area of the body's convex hull, calculated at creation by `Body.create`. * * @property area * @type string * @default */ /** * A `Bounds` object that defines the AABB region for the body. * It is automatically calculated from the given convex hull (`vertices` array) in `Body.create` and constantly updated by `Body.update` during simulation. * * @property bounds * @type bounds */ })(); ; // End src/body/Body.js // Begin src/body/Composite.js /** * The `Matter.Composite` module contains methods for creating and manipulating composite bodies. * A composite body is a collection of `Matter.Body`, `Matter.Constraint` and other `Matter.Composite`, therefore composites form a tree structure. * It is important to use the functions in this module to modify composites, rather than directly modifying their properties. * Note that the `Matter.World` object is also a type of `Matter.Composite` and as such all composite methods here can also operate on a `Matter.World`. * * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Composite */ // TODO: composite translate, rotate var Composite = {}; (function() { /** * Creates a new composite. The options parameter is an object that specifies any properties you wish to override the defaults. * See the properites section below for detailed information on what you can pass via the `options` object. * @method create * @param {} [options] * @return {composite} A new composite */ Composite.create = function(options) { return Common.extend({ id: Common.nextId(), type: 'composite', parent: null, isModified: false, bodies: [], constraints: [], composites: [], label: 'Composite' }, options); }; /** * Sets the composite's `isModified` flag. * If `updateParents` is true, all parents will be set (default: false). * If `updateChildren` is true, all children will be set (default: false). * @method setModified * @param {composite} composite * @param {boolean} isModified * @param {boolean} [updateParents=false] * @param {boolean} [updateChildren=false] */ Composite.setModified = function(composite, isModified, updateParents, updateChildren) { composite.isModified = isModified; if (updateParents && composite.parent) { Composite.setModified(composite.parent, isModified, updateParents, updateChildren); } if (updateChildren) { for(var i = 0; i < composite.composites.length; i++) { var childComposite = composite.composites[i]; Composite.setModified(childComposite, isModified, updateParents, updateChildren); } } }; /** * Generic add function. Adds one or many body(s), constraint(s) or a composite(s) to the given composite. * Triggers `beforeAdd` and `afterAdd` events on the `composite`. * @method add * @param {composite} composite * @param {} object * @return {composite} The original composite with the objects added */ Composite.add = function(composite, object) { var objects = [].concat(object); Events.trigger(composite, 'beforeAdd', { object: object }); for (var i = 0; i < objects.length; i++) { var obj = objects[i]; switch (obj.type) { case 'body': Composite.addBody(composite, obj); break; case 'constraint': Composite.addConstraint(composite, obj); break; case 'composite': Composite.addComposite(composite, obj); break; case 'mouseConstraint': Composite.addConstraint(composite, obj.constraint); break; } } Events.trigger(composite, 'afterAdd', { object: object }); return composite; }; /** * Generic remove function. Removes one or many body(s), constraint(s) or a composite(s) to the given composite. * Optionally searching its children recursively. * Triggers `beforeRemove` and `afterRemove` events on the `composite`. * @method remove * @param {composite} composite * @param {} object * @param {boolean} [deep=false] * @return {composite} The original composite with the objects removed */ Composite.remove = function(composite, object, deep) { var objects = [].concat(object); Events.trigger(composite, 'beforeRemove', { object: object }); for (var i = 0; i < objects.length; i++) { var obj = objects[i]; switch (obj.type) { case 'body': Composite.removeBody(composite, obj, deep); break; case 'constraint': Composite.removeConstraint(composite, obj, deep); break; case 'composite': Composite.removeComposite(composite, obj, deep); break; case 'mouseConstraint': Composite.removeConstraint(composite, obj.constraint); break; } } Events.trigger(composite, 'afterRemove', { object: object }); return composite; }; /** * Adds a composite to the given composite * @private * @method addComposite * @param {composite} compositeA * @param {composite} compositeB * @return {composite} The original compositeA with the objects from compositeB added */ Composite.addComposite = function(compositeA, compositeB) { compositeA.composites.push(compositeB); compositeB.parent = compositeA; Composite.setModified(compositeA, true, true, false); return compositeA; }; /** * Removes a composite from the given composite, and optionally searching its children recursively * @private * @method removeComposite * @param {composite} compositeA * @param {composite} compositeB * @param {boolean} [deep=false] * @return {composite} The original compositeA with the composite removed */ Composite.removeComposite = function(compositeA, compositeB, deep) { var position = Common.indexOf(compositeA.composites, compositeB); if (position !== -1) { Composite.removeCompositeAt(compositeA, position); Composite.setModified(compositeA, true, true, false); } if (deep) { for (var i = 0; i < compositeA.composites.length; i++){ Composite.removeComposite(compositeA.composites[i], compositeB, true); } } return compositeA; }; /** * Removes a composite from the given composite * @private * @method removeCompositeAt * @param {composite} composite * @param {number} position * @return {composite} The original composite with the composite removed */ Composite.removeCompositeAt = function(composite, position) { composite.composites.splice(position, 1); Composite.setModified(composite, true, true, false); return composite; }; /** * Adds a body to the given composite * @private * @method addBody * @param {composite} composite * @param {body} body * @return {composite} The original composite with the body added */ Composite.addBody = function(composite, body) { composite.bodies.push(body); Composite.setModified(composite, true, true, false); return composite; }; /** * Removes a body from the given composite, and optionally searching its children recursively * @private * @method removeBody * @param {composite} composite * @param {body} body * @param {boolean} [deep=false] * @return {composite} The original composite with the body removed */ Composite.removeBody = function(composite, body, deep) { var position = Common.indexOf(composite.bodies, body); if (position !== -1) { Composite.removeBodyAt(composite, position); Composite.setModified(composite, true, true, false); } if (deep) { for (var i = 0; i < composite.composites.length; i++){ Composite.removeBody(composite.composites[i], body, true); } } return composite; }; /** * Removes a body from the given composite * @private * @method removeBodyAt * @param {composite} composite * @param {number} position * @return {composite} The original composite with the body removed */ Composite.removeBodyAt = function(composite, position) { composite.bodies.splice(position, 1); Composite.setModified(composite, true, true, false); return composite; }; /** * Adds a constraint to the given composite * @private * @method addConstraint * @param {composite} composite * @param {constraint} constraint * @return {composite} The original composite with the constraint added */ Composite.addConstraint = function(composite, constraint) { composite.constraints.push(constraint); Composite.setModified(composite, true, true, false); return composite; }; /** * Removes a constraint from the given composite, and optionally searching its children recursively * @private * @method removeConstraint * @param {composite} composite * @param {constraint} constraint * @param {boolean} [deep=false] * @return {composite} The original composite with the constraint removed */ Composite.removeConstraint = function(composite, constraint, deep) { var position = Common.indexOf(composite.constraints, constraint); if (position !== -1) { Composite.removeConstraintAt(composite, position); } if (deep) { for (var i = 0; i < composite.composites.length; i++){ Composite.removeConstraint(composite.composites[i], constraint, true); } } return composite; }; /** * Removes a body from the given composite * @private * @method removeConstraintAt * @param {composite} composite * @param {number} position * @return {composite} The original composite with the constraint removed */ Composite.removeConstraintAt = function(composite, position) { composite.constraints.splice(position, 1); Composite.setModified(composite, true, true, false); return composite; }; /** * Removes all bodies, constraints and composites from the given composite * Optionally clearing its children recursively * @method clear * @param {world} world * @param {boolean} keepStatic * @param {boolean} [deep=false] */ Composite.clear = function(composite, keepStatic, deep) { if (deep) { for (var i = 0; i < composite.composites.length; i++){ Composite.clear(composite.composites[i], keepStatic, true); } } if (keepStatic) { composite.bodies = composite.bodies.filter(function(body) { return body.isStatic; }); } else { composite.bodies.length = 0; } composite.constraints.length = 0; composite.composites.length = 0; Composite.setModified(composite, true, true, false); return composite; }; /** * Returns all bodies in the given composite, including all bodies in its children, recursively * @method allBodies * @param {composite} composite * @return {body[]} All the bodies */ Composite.allBodies = function(composite) { var bodies = [].concat(composite.bodies); for (var i = 0; i < composite.composites.length; i++) bodies = bodies.concat(Composite.allBodies(composite.composites[i])); return bodies; }; /** * Returns all constraints in the given composite, including all constraints in its children, recursively * @method allConstraints * @param {composite} composite * @return {constraint[]} All the constraints */ Composite.allConstraints = function(composite) { var constraints = [].concat(composite.constraints); for (var i = 0; i < composite.composites.length; i++) constraints = constraints.concat(Composite.allConstraints(composite.composites[i])); return constraints; }; /** * Returns all composites in the given composite, including all composites in its children, recursively * @method allComposites * @param {composite} composite * @return {composite[]} All the composites */ Composite.allComposites = function(composite) { var composites = [].concat(composite.composites); for (var i = 0; i < composite.composites.length; i++) composites = composites.concat(Composite.allComposites(composite.composites[i])); return composites; }; /** * Searches the composite recursively for an object matching the type and id supplied, null if not found * @method get * @param {composite} composite * @param {number} id * @param {string} type * @return {object} The requested object, if found */ Composite.get = function(composite, id, type) { var objects, object; switch (type) { case 'body': objects = Composite.allBodies(composite); break; case 'constraint': objects = Composite.allConstraints(composite); break; case 'composite': objects = Composite.allComposites(composite).concat(composite); break; } if (!objects) return null; object = objects.filter(function(object) { return object.id.toString() === id.toString(); }); return object.length === 0 ? null : object[0]; }; /** * Moves the given object(s) from compositeA to compositeB (equal to a remove followed by an add) * @method move * @param {compositeA} compositeA * @param {object[]} objects * @param {compositeB} compositeB * @return {composite} Returns compositeA */ Composite.move = function(compositeA, objects, compositeB) { Composite.remove(compositeA, objects); Composite.add(compositeB, objects); return compositeA; }; /** * Assigns new ids for all objects in the composite, recursively * @method rebase * @param {composite} composite * @return {composite} Returns composite */ Composite.rebase = function(composite) { var objects = Composite.allBodies(composite) .concat(Composite.allConstraints(composite)) .concat(Composite.allComposites(composite)); for (var i = 0; i < objects.length; i++) { objects[i].id = Common.nextId(); } Composite.setModified(composite, true, true, false); return composite; }; /* * * Events Documentation * */ /** * Fired when a call to `Composite.add` is made, before objects have been added. * * @event beforeAdd * @param {} event An event object * @param {} event.object The object(s) to be added (may be a single body, constraint, composite or a mixed array of these) * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when a call to `Composite.add` is made, after objects have been added. * * @event afterAdd * @param {} event An event object * @param {} event.object The object(s) that have been added (may be a single body, constraint, composite or a mixed array of these) * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when a call to `Composite.remove` is made, before objects have been removed. * * @event beforeRemove * @param {} event An event object * @param {} event.object The object(s) to be removed (may be a single body, constraint, composite or a mixed array of these) * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when a call to `Composite.remove` is made, after objects have been removed. * * @event afterRemove * @param {} event An event object * @param {} event.object The object(s) that have been removed (may be a single body, constraint, composite or a mixed array of these) * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /* * * Properties Documentation * */ /** * An integer `Number` uniquely identifying number generated in `Composite.create` by `Common.nextId`. * * @property id * @type number */ /** * A `String` denoting the type of object. * * @property type * @type string * @default "composite" */ /** * An arbitrary `String` name to help the user identify and manage composites. * * @property label * @type string * @default "Composite" */ /** * A flag that specifies whether the composite has been modified during the current step. * Most `Matter.Composite` methods will automatically set this flag to `true` to inform the engine of changes to be handled. * If you need to change it manually, you should use the `Composite.setModified` method. * * @property isModified * @type boolean * @default false */ /** * The `Composite` that is the parent of this composite. It is automatically managed by the `Matter.Composite` methods. * * @property parent * @type composite * @default null */ /** * An array of `Body` that are _direct_ children of this composite. * To add or remove bodies you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property. * If you wish to recursively find all descendants, you should use the `Composite.allBodies` method. * * @property bodies * @type body[] * @default [] */ /** * An array of `Constraint` that are _direct_ children of this composite. * To add or remove constraints you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property. * If you wish to recursively find all descendants, you should use the `Composite.allConstraints` method. * * @property constraints * @type constraint[] * @default [] */ /** * An array of `Composite` that are _direct_ children of this composite. * To add or remove composites you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property. * If you wish to recursively find all descendants, you should use the `Composite.allComposites` method. * * @property composites * @type composite[] * @default [] */ })(); ; // End src/body/Composite.js // Begin src/body/World.js /** * The `Matter.World` module contains methods for creating and manipulating the world composite. * A `Matter.World` is a `Matter.Composite` body, which is a collection of `Matter.Body`, `Matter.Constraint` and other `Matter.Composite`. * A `Matter.World` has a few additional properties including `gravity` and `bounds`. * It is important to use the functions in the `Matter.Composite` module to modify the world composite, rather than directly modifying its properties. * There are also a few methods here that alias those in `Matter.Composite` for easier readability. * * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class World */ var World = {}; (function() { /** * Creates a new world composite. The options parameter is an object that specifies any properties you wish to override the defaults. * See the properites section below for detailed information on what you can pass via the `options` object. * @method create * @constructor * @param {} options * @return {world} A new world */ World.create = function(options) { var composite = Composite.create(); var defaults = { label: 'World', gravity: { x: 0, y: 1 }, bounds: { min: { x: 0, y: 0 }, max: { x: 800, y: 600 } } }; return Common.extend(composite, defaults, options); }; // World is a Composite body // see src/module/Outro.js for these aliases: /** * An alias for Composite.clear since World is also a Composite * @method clear * @param {world} world * @param {boolean} keepStatic */ /** * An alias for Composite.add since World is also a Composite * @method addComposite * @param {world} world * @param {composite} composite * @return {world} The original world with the objects from composite added */ /** * An alias for Composite.addBody since World is also a Composite * @method addBody * @param {world} world * @param {body} body * @return {world} The original world with the body added */ /** * An alias for Composite.addConstraint since World is also a Composite * @method addConstraint * @param {world} world * @param {constraint} constraint * @return {world} The original world with the constraint added */ })(); ; // End src/body/World.js // Begin src/collision/Contact.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Contact */ var Contact = {}; (function() { /** * Description * @method create * @param {vertex} vertex * @return {contact} A new contact */ Contact.create = function(vertex) { return { id: Contact.id(vertex), vertex: vertex, normalImpulse: 0, tangentImpulse: 0 }; }; /** * Description * @method id * @param {vertex} vertex * @return {Number} Unique contactID */ Contact.id = function(vertex) { return vertex.body.id + '_' + vertex.index; }; })(); ; // End src/collision/Contact.js // Begin src/collision/Detector.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Detector */ // TODO: speculative contacts var Detector = {}; (function() { /** * Description * @method collisions * @param {pair[]} broadphasePairs * @param {engine} engine * @return {array} collisions */ Detector.collisions = function(broadphasePairs, engine) { var collisions = [], metrics = engine.metrics, pairsTable = engine.pairs.table; for (var i = 0; i < broadphasePairs.length; i++) { var bodyA = broadphasePairs[i][0], bodyB = broadphasePairs[i][1]; if ((bodyA.isStatic || bodyA.isSleeping) && (bodyB.isStatic || bodyB.isSleeping)) continue; if (!Detector.canCollide(bodyA.collisionFilter, bodyB.collisionFilter)) continue; metrics.midphaseTests += 1; // mid phase if (Bounds.overlaps(bodyA.bounds, bodyB.bounds)) { // find a previous collision we could reuse var pairId = Pair.id(bodyA, bodyB), pair = pairsTable[pairId], previousCollision; if (pair && pair.isActive) { previousCollision = pair.collision; } else { previousCollision = null; } // narrow phase var collision = SAT.collides(bodyA, bodyB, previousCollision); metrics.narrowphaseTests += 1; if (collision.reused) metrics.narrowReuseCount += 1; if (collision.collided) { collisions.push(collision); metrics.narrowDetections += 1; } } } return collisions; }; /** * Description * @method bruteForce * @param {body[]} bodies * @param {engine} engine * @return {array} collisions */ Detector.bruteForce = function(bodies, engine) { var collisions = [], metrics = engine.metrics, pairsTable = engine.pairs.table; for (var i = 0; i < bodies.length; i++) { for (var j = i + 1; j < bodies.length; j++) { var bodyA = bodies[i], bodyB = bodies[j]; // NOTE: could share a function for the below, but may drop performance? if ((bodyA.isStatic || bodyA.isSleeping) && (bodyB.isStatic || bodyB.isSleeping)) continue; if (!Detector.canCollide(bodyA.collisionFilter, bodyB.collisionFilter)) continue; metrics.midphaseTests += 1; // mid phase if (Bounds.overlaps(bodyA.bounds, bodyB.bounds)) { // find a previous collision we could reuse var pairId = Pair.id(bodyA, bodyB), pair = pairsTable[pairId], previousCollision; if (pair && pair.isActive) { previousCollision = pair.collision; } else { previousCollision = null; } // narrow phase var collision = SAT.collides(bodyA, bodyB, previousCollision); metrics.narrowphaseTests += 1; if (collision.reused) metrics.narrowReuseCount += 1; if (collision.collided) { collisions.push(collision); metrics.narrowDetections += 1; } } } } return collisions; }; /** * Returns `true` if both supplied collision filters will allow a collision to occur. * See `body.collisionFilter` for more information. * @method canCollide * @param {} filterA * @param {} filterB * @return {bool} `true` if collision can occur */ Detector.canCollide = function(filterA, filterB) { if (filterA.group === filterB.group && filterA.group !== 0) return filterA.group > 0; return (filterA.mask & filterB.category) !== 0 && (filterB.mask & filterA.category) !== 0; }; })(); ; // End src/collision/Detector.js // Begin src/collision/Grid.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Grid */ var Grid = {}; (function() { /** * Description * @method create * @param {} options * @return {grid} A new grid */ Grid.create = function(options) { var defaults = { controller: Grid, detector: Detector.collisions, buckets: {}, pairs: {}, pairsList: [], bucketWidth: 48, bucketHeight: 48 }; return Common.extend(defaults, options); }; /** * Description * @method update * @param {grid} grid * @param {body[]} bodies * @param {engine} engine * @param {boolean} forceUpdate */ Grid.update = function(grid, bodies, engine, forceUpdate) { var i, col, row, world = engine.world, buckets = grid.buckets, bucket, bucketId, metrics = engine.metrics, gridChanged = false; metrics.broadphaseTests = 0; for (i = 0; i < bodies.length; i++) { var body = bodies[i]; if (body.isSleeping && !forceUpdate) continue; // don't update out of world bodies if (body.bounds.max.x < 0 || body.bounds.min.x > world.bounds.width || body.bounds.max.y < 0 || body.bounds.min.y > world.bounds.height) continue; var newRegion = _getRegion(grid, body); // if the body has changed grid region if (!body.region || newRegion.id !== body.region.id || forceUpdate) { metrics.broadphaseTests += 1; if (!body.region || forceUpdate) body.region = newRegion; var union = _regionUnion(newRegion, body.region); // update grid buckets affected by region change // iterate over the union of both regions for (col = union.startCol; col <= union.endCol; col++) { for (row = union.startRow; row <= union.endRow; row++) { bucketId = _getBucketId(col, row); bucket = buckets[bucketId]; var isInsideNewRegion = (col >= newRegion.startCol && col <= newRegion.endCol && row >= newRegion.startRow && row <= newRegion.endRow); var isInsideOldRegion = (col >= body.region.startCol && col <= body.region.endCol && row >= body.region.startRow && row <= body.region.endRow); // remove from old region buckets if (!isInsideNewRegion && isInsideOldRegion) { if (isInsideOldRegion) { if (bucket) _bucketRemoveBody(grid, bucket, body); } } // add to new region buckets if (body.region === newRegion || (isInsideNewRegion && !isInsideOldRegion) || forceUpdate) { if (!bucket) bucket = _createBucket(buckets, bucketId); _bucketAddBody(grid, bucket, body); } } } // set the new region body.region = newRegion; // flag changes so we can update pairs gridChanged = true; } } // update pairs list only if pairs changed (i.e. a body changed region) if (gridChanged) grid.pairsList = _createActivePairsList(grid); }; /** * Description * @method clear * @param {grid} grid */ Grid.clear = function(grid) { grid.buckets = {}; grid.pairs = {}; grid.pairsList = []; }; /** * Description * @method _regionUnion * @private * @param {} regionA * @param {} regionB * @return CallExpression */ var _regionUnion = function(regionA, regionB) { var startCol = Math.min(regionA.startCol, regionB.startCol), endCol = Math.max(regionA.endCol, regionB.endCol), startRow = Math.min(regionA.startRow, regionB.startRow), endRow = Math.max(regionA.endRow, regionB.endRow); return _createRegion(startCol, endCol, startRow, endRow); }; /** * Description * @method _getRegion * @private * @param {} grid * @param {} body * @return CallExpression */ var _getRegion = function(grid, body) { var bounds = body.bounds, startCol = Math.floor(bounds.min.x / grid.bucketWidth), endCol = Math.floor(bounds.max.x / grid.bucketWidth), startRow = Math.floor(bounds.min.y / grid.bucketHeight), endRow = Math.floor(bounds.max.y / grid.bucketHeight); return _createRegion(startCol, endCol, startRow, endRow); }; /** * Description * @method _createRegion * @private * @param {} startCol * @param {} endCol * @param {} startRow * @param {} endRow * @return ObjectExpression */ var _createRegion = function(startCol, endCol, startRow, endRow) { return { id: startCol + ',' + endCol + ',' + startRow + ',' + endRow, startCol: startCol, endCol: endCol, startRow: startRow, endRow: endRow }; }; /** * Description * @method _getBucketId * @private * @param {} column * @param {} row * @return BinaryExpression */ var _getBucketId = function(column, row) { return column + ',' + row; }; /** * Description * @method _createBucket * @private * @param {} buckets * @param {} bucketId * @return bucket */ var _createBucket = function(buckets, bucketId) { var bucket = buckets[bucketId] = []; return bucket; }; /** * Description * @method _bucketAddBody * @private * @param {} grid * @param {} bucket * @param {} body */ var _bucketAddBody = function(grid, bucket, body) { // add new pairs for (var i = 0; i < bucket.length; i++) { var bodyB = bucket[i]; if (body.id === bodyB.id || (body.isStatic && bodyB.isStatic)) continue; // keep track of the number of buckets the pair exists in // important for Grid.update to work var pairId = Pair.id(body, bodyB), pair = grid.pairs[pairId]; if (pair) { pair[2] += 1; } else { grid.pairs[pairId] = [body, bodyB, 1]; } } // add to bodies (after pairs, otherwise pairs with self) bucket.push(body); }; /** * Description * @method _bucketRemoveBody * @private * @param {} grid * @param {} bucket * @param {} body */ var _bucketRemoveBody = function(grid, bucket, body) { // remove from bucket bucket.splice(Common.indexOf(bucket, body), 1); // update pair counts for (var i = 0; i < bucket.length; i++) { // keep track of the number of buckets the pair exists in // important for _createActivePairsList to work var bodyB = bucket[i], pairId = Pair.id(body, bodyB), pair = grid.pairs[pairId]; if (pair) pair[2] -= 1; } }; /** * Description * @method _createActivePairsList * @private * @param {} grid * @return pairs */ var _createActivePairsList = function(grid) { var pairKeys, pair, pairs = []; // grid.pairs is used as a hashmap pairKeys = Common.keys(grid.pairs); // iterate over grid.pairs for (var k = 0; k < pairKeys.length; k++) { pair = grid.pairs[pairKeys[k]]; // if pair exists in at least one bucket // it is a pair that needs further collision testing so push it if (pair[2] > 0) { pairs.push(pair); } else { delete grid.pairs[pairKeys[k]]; } } return pairs; }; })(); ; // End src/collision/Grid.js // Begin src/collision/Pair.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Pair */ var Pair = {}; (function() { /** * Description * @method create * @param {collision} collision * @return {pair} A new pair */ Pair.create = function(collision, timestamp) { var bodyA = collision.bodyA, bodyB = collision.bodyB; var pair = { id: Pair.id(bodyA, bodyB), bodyA: bodyA, bodyB: bodyB, contacts: {}, activeContacts: [], separation: 0, isActive: true, timeCreated: timestamp, timeUpdated: timestamp, inverseMass: bodyA.inverseMass + bodyB.inverseMass, friction: Math.min(bodyA.friction, bodyB.friction), restitution: Math.max(bodyA.restitution, bodyB.restitution), slop: Math.max(bodyA.slop, bodyB.slop) }; Pair.update(pair, collision, timestamp); return pair; }; /** * Description * @method update * @param {pair} pair * @param {collision} collision */ Pair.update = function(pair, collision, timestamp) { var contacts = pair.contacts, supports = collision.supports, activeContacts = pair.activeContacts; pair.collision = collision; activeContacts.length = 0; if (collision.collided) { for (var i = 0; i < supports.length; i++) { var support = supports[i], contactId = Contact.id(support), contact = contacts[contactId]; if (contact) { activeContacts.push(contact); } else { activeContacts.push(contacts[contactId] = Contact.create(support)); } } pair.separation = collision.depth; Pair.setActive(pair, true, timestamp); } else { if (pair.isActive === true) Pair.setActive(pair, false, timestamp); } }; /** * Description * @method setActive * @param {pair} pair * @param {bool} isActive */ Pair.setActive = function(pair, isActive, timestamp) { if (isActive) { pair.isActive = true; pair.timeUpdated = timestamp; } else { pair.isActive = false; pair.activeContacts.length = 0; } }; /** * Description * @method id * @param {body} bodyA * @param {body} bodyB * @return {number} Unique pairId */ Pair.id = function(bodyA, bodyB) { if (bodyA.id < bodyB.id) { return bodyA.id + '_' + bodyB.id; } else { return bodyB.id + '_' + bodyA.id; } }; })(); ; // End src/collision/Pair.js // Begin src/collision/Pairs.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Pairs */ var Pairs = {}; (function() { var _pairMaxIdleLife = 1000; /** * Creates a new pairs structure * @method create * @param {object} options * @return {pairs} A new pairs structure */ Pairs.create = function(options) { return Common.extend({ table: {}, list: [], collisionStart: [], collisionActive: [], collisionEnd: [] }, options); }; /** * Description * @method update * @param {object} pairs * @param {collision[]} collisions */ Pairs.update = function(pairs, collisions, timestamp) { var pairsList = pairs.list, pairsTable = pairs.table, collisionStart = pairs.collisionStart, collisionEnd = pairs.collisionEnd, collisionActive = pairs.collisionActive, activePairIds = [], collision, pairId, pair, i; // clear collision state arrays, but maintain old reference collisionStart.length = 0; collisionEnd.length = 0; collisionActive.length = 0; for (i = 0; i < collisions.length; i++) { collision = collisions[i]; if (collision.collided) { pairId = Pair.id(collision.bodyA, collision.bodyB); activePairIds.push(pairId); pair = pairsTable[pairId]; if (pair) { // pair already exists (but may or may not be active) if (pair.isActive) { // pair exists and is active collisionActive.push(pair); } else { // pair exists but was inactive, so a collision has just started again collisionStart.push(pair); } // update the pair Pair.update(pair, collision, timestamp); } else { // pair did not exist, create a new pair pair = Pair.create(collision, timestamp); pairsTable[pairId] = pair; // push the new pair collisionStart.push(pair); pairsList.push(pair); } } } // deactivate previously active pairs that are now inactive for (i = 0; i < pairsList.length; i++) { pair = pairsList[i]; if (pair.isActive && Common.indexOf(activePairIds, pair.id) === -1) { Pair.setActive(pair, false, timestamp); collisionEnd.push(pair); } } }; /** * Description * @method removeOld * @param {object} pairs */ Pairs.removeOld = function(pairs, timestamp) { var pairsList = pairs.list, pairsTable = pairs.table, indexesToRemove = [], pair, collision, pairIndex, i; for (i = 0; i < pairsList.length; i++) { pair = pairsList[i]; collision = pair.collision; // never remove sleeping pairs if (collision.bodyA.isSleeping || collision.bodyB.isSleeping) { pair.timeUpdated = timestamp; continue; } // if pair is inactive for too long, mark it to be removed if (timestamp - pair.timeUpdated > _pairMaxIdleLife) { indexesToRemove.push(i); } } // remove marked pairs for (i = 0; i < indexesToRemove.length; i++) { pairIndex = indexesToRemove[i] - i; pair = pairsList[pairIndex]; delete pairsTable[pair.id]; pairsList.splice(pairIndex, 1); } }; /** * Clears the given pairs structure * @method create * @param {object} options * @param {pairs} pairs */ Pairs.clear = function(pairs) { pairs.table = {}; pairs.list.length = 0; pairs.collisionStart.length = 0; pairs.collisionActive.length = 0; pairs.collisionEnd.length = 0; return pairs; }; })(); ; // End src/collision/Pairs.js // Begin src/collision/Query.js /** * The `Matter.Query` module contains methods for performing collision queries. * * @class Query */ var Query = {}; (function() { /** * Casts a ray segment against a set of bodies and returns all collisions, ray width is optional. Intersection points are not provided. * @method ray * @param {body[]} bodies * @param {vector} startPoint * @param {vector} endPoint * @param {number} [rayWidth] * @return {object[]} Collisions */ Query.ray = function(bodies, startPoint, endPoint, rayWidth) { rayWidth = rayWidth || Number.MIN_VALUE; var rayAngle = Vector.angle(startPoint, endPoint), rayLength = Vector.magnitude(Vector.sub(startPoint, endPoint)), rayX = (endPoint.x + startPoint.x) * 0.5, rayY = (endPoint.y + startPoint.y) * 0.5, ray = Bodies.rectangle(rayX, rayY, rayLength, rayWidth, { angle: rayAngle }), collisions = []; for (var i = 0; i < bodies.length; i++) { var bodyA = bodies[i]; if (Bounds.overlaps(bodyA.bounds, ray.bounds)) { var collision = SAT.collides(bodyA, ray); if (collision.collided) { collision.body = collision.bodyA = collision.bodyB = bodyA; collisions.push(collision); } } } return collisions; }; /** * Returns all bodies whose bounds are inside (or outside if set) the given set of bounds, from the given set of bodies. * @method region * @param {body[]} bodies * @param {bounds} bounds * @param {bool} [outside=false] * @return {body[]} The bodies matching the query */ Query.region = function(bodies, bounds, outside) { var result = []; for (var i = 0; i < bodies.length; i++) { var body = bodies[i], overlaps = Bounds.overlaps(body.bounds, bounds); if ((overlaps && !outside) || (!overlaps && outside)) result.push(body); } return result; }; })(); ; // End src/collision/Query.js // Begin src/collision/Resolver.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Resolver */ var Resolver = {}; (function() { var _restingThresh = 4, _positionDampen = 0.2, _positionWarming = 0.6; /** * Description * @method solvePosition * @param {pair[]} pairs * @param {number} timeScale */ Resolver.solvePosition = function(pairs, timeScale) { var i, pair, collision, bodyA, bodyB, vertex, vertexCorrected, normal, bodyBtoA; // find impulses required to resolve penetration for (i = 0; i < pairs.length; i++) { pair = pairs[i]; if (!pair.isActive) continue; collision = pair.collision; bodyA = collision.bodyA; bodyB = collision.bodyB; vertex = collision.supports[0]; vertexCorrected = collision.supportCorrected; normal = collision.normal; // get current separation between body edges involved in collision bodyBtoA = Vector.sub(Vector.add(bodyB.positionImpulse, vertex), Vector.add(bodyA.positionImpulse, vertexCorrected)); pair.separation = Vector.dot(normal, bodyBtoA); } for (i = 0; i < pairs.length; i++) { pair = pairs[i]; if (!pair.isActive) continue; collision = pair.collision; bodyA = collision.bodyA; bodyB = collision.bodyB; normal = collision.normal; positionImpulse = ((pair.separation * _positionDampen) - pair.slop) * timeScale; if (bodyA.isStatic || bodyB.isStatic) positionImpulse *= 2; if (!(bodyA.isStatic || bodyA.isSleeping)) { bodyA.positionImpulse.x += normal.x * positionImpulse; bodyA.positionImpulse.y += normal.y * positionImpulse; } if (!(bodyB.isStatic || bodyB.isSleeping)) { bodyB.positionImpulse.x -= normal.x * positionImpulse; bodyB.positionImpulse.y -= normal.y * positionImpulse; } } }; /** * Description * @method postSolvePosition * @param {body[]} bodies */ Resolver.postSolvePosition = function(bodies) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (body.positionImpulse.x !== 0 || body.positionImpulse.y !== 0) { // move the body without changing velocity body.position.x += body.positionImpulse.x; body.position.y += body.positionImpulse.y; body.positionPrev.x += body.positionImpulse.x; body.positionPrev.y += body.positionImpulse.y; // update body geometry Vertices.translate(body.vertices, body.positionImpulse); Bounds.update(body.bounds, body.vertices, body.velocity); // dampen accumulator to warm the next step body.positionImpulse.x *= _positionWarming; body.positionImpulse.y *= _positionWarming; } } }; /** * Description * @method preSolveVelocity * @param {pair[]} pairs */ Resolver.preSolveVelocity = function(pairs) { var impulse = {}, i, j, pair, contacts, collision, bodyA, bodyB, normal, tangent, contact, contactVertex, normalImpulse, tangentImpulse, offset; for (i = 0; i < pairs.length; i++) { pair = pairs[i]; if (!pair.isActive) continue; contacts = pair.activeContacts; collision = pair.collision; bodyA = collision.bodyA; bodyB = collision.bodyB; normal = collision.normal; tangent = collision.tangent; // resolve each contact for (j = 0; j < contacts.length; j++) { contact = contacts[j]; contactVertex = contact.vertex; normalImpulse = contact.normalImpulse; tangentImpulse = contact.tangentImpulse; // total impulse from contact impulse.x = (normal.x * normalImpulse) + (tangent.x * tangentImpulse); impulse.y = (normal.y * normalImpulse) + (tangent.y * tangentImpulse); // apply impulse from contact if (!(bodyA.isStatic || bodyA.isSleeping)) { offset = Vector.sub(contactVertex, bodyA.position); bodyA.positionPrev.x += impulse.x * bodyA.inverseMass; bodyA.positionPrev.y += impulse.y * bodyA.inverseMass; bodyA.anglePrev += Vector.cross(offset, impulse) * bodyA.inverseInertia; } if (!(bodyB.isStatic || bodyB.isSleeping)) { offset = Vector.sub(contactVertex, bodyB.position); bodyB.positionPrev.x -= impulse.x * bodyB.inverseMass; bodyB.positionPrev.y -= impulse.y * bodyB.inverseMass; bodyB.anglePrev -= Vector.cross(offset, impulse) * bodyB.inverseInertia; } } } }; /** * Description * @method solveVelocity * @param {pair[]} pairs */ Resolver.solveVelocity = function(pairs, timeScale) { var impulse = {}, timeScaleSquared = timeScale * timeScale; for (var i = 0; i < pairs.length; i++) { var pair = pairs[i]; if (!pair.isActive) continue; var collision = pair.collision, bodyA = collision.bodyA, bodyB = collision.bodyB, normal = collision.normal, tangent = collision.tangent, contacts = pair.activeContacts, contactShare = 1 / contacts.length; // update body velocities bodyA.velocity.x = bodyA.position.x - bodyA.positionPrev.x; bodyA.velocity.y = bodyA.position.y - bodyA.positionPrev.y; bodyB.velocity.x = bodyB.position.x - bodyB.positionPrev.x; bodyB.velocity.y = bodyB.position.y - bodyB.positionPrev.y; bodyA.angularVelocity = bodyA.angle - bodyA.anglePrev; bodyB.angularVelocity = bodyB.angle - bodyB.anglePrev; // resolve each contact for (var j = 0; j < contacts.length; j++) { var contact = contacts[j], contactVertex = contact.vertex, offsetA = Vector.sub(contactVertex, bodyA.position), offsetB = Vector.sub(contactVertex, bodyB.position), velocityPointA = Vector.add(bodyA.velocity, Vector.mult(Vector.perp(offsetA), bodyA.angularVelocity)), velocityPointB = Vector.add(bodyB.velocity, Vector.mult(Vector.perp(offsetB), bodyB.angularVelocity)), relativeVelocity = Vector.sub(velocityPointA, velocityPointB), normalVelocity = Vector.dot(normal, relativeVelocity); var tangentVelocity = Vector.dot(tangent, relativeVelocity), tangentSpeed = Math.abs(tangentVelocity), tangentVelocityDirection = Common.sign(tangentVelocity); // raw impulses var normalImpulse = (1 + pair.restitution) * normalVelocity, normalForce = Common.clamp(pair.separation + normalVelocity, 0, 1); // coulomb friction var tangentImpulse = tangentVelocity; if (tangentSpeed > normalForce * pair.friction * timeScaleSquared) tangentImpulse = normalForce * pair.friction * timeScaleSquared * tangentVelocityDirection; // modify impulses accounting for mass, inertia and offset var oAcN = Vector.cross(offsetA, normal), oBcN = Vector.cross(offsetB, normal), share = contactShare / (pair.inverseMass + bodyA.inverseInertia * oAcN * oAcN + bodyB.inverseInertia * oBcN * oBcN); normalImpulse *= share; tangentImpulse *= share; // handle high velocity and resting collisions separately if (normalVelocity < 0 && normalVelocity * normalVelocity > _restingThresh * timeScaleSquared) { // high velocity so clear cached contact impulse contact.normalImpulse = 0; contact.tangentImpulse = 0; } else { // solve resting collision constraints using Erin Catto's method (GDC08) // impulse constraint, tends to 0 var contactNormalImpulse = contact.normalImpulse; contact.normalImpulse = Math.min(contact.normalImpulse + normalImpulse, 0); normalImpulse = contact.normalImpulse - contactNormalImpulse; // tangent impulse, tends to -maxFriction or maxFriction var contactTangentImpulse = contact.tangentImpulse; contact.tangentImpulse = Common.clamp(contact.tangentImpulse + tangentImpulse, -tangentSpeed, tangentSpeed); tangentImpulse = contact.tangentImpulse - contactTangentImpulse; } // total impulse from contact impulse.x = (normal.x * normalImpulse) + (tangent.x * tangentImpulse); impulse.y = (normal.y * normalImpulse) + (tangent.y * tangentImpulse); // apply impulse from contact if (!(bodyA.isStatic || bodyA.isSleeping)) { bodyA.positionPrev.x += impulse.x * bodyA.inverseMass; bodyA.positionPrev.y += impulse.y * bodyA.inverseMass; bodyA.anglePrev += Vector.cross(offsetA, impulse) * bodyA.inverseInertia; } if (!(bodyB.isStatic || bodyB.isSleeping)) { bodyB.positionPrev.x -= impulse.x * bodyB.inverseMass; bodyB.positionPrev.y -= impulse.y * bodyB.inverseMass; bodyB.anglePrev -= Vector.cross(offsetB, impulse) * bodyB.inverseInertia; } } } }; })(); ; // End src/collision/Resolver.js // Begin src/collision/SAT.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class SAT */ // TODO: true circles and curves var SAT = {}; (function() { /** * Description * @method collides * @param {body} bodyA * @param {body} bodyB * @param {collision} previousCollision * @return {collision} collision */ SAT.collides = function(bodyA, bodyB, previousCollision) { var overlapAB, overlapBA, minOverlap, collision, prevCol = previousCollision, canReusePrevCol = false; if (prevCol) { // estimate total motion var motion = bodyA.speed * bodyA.speed + bodyA.angularSpeed * bodyA.angularSpeed + bodyB.speed * bodyB.speed + bodyB.angularSpeed * bodyB.angularSpeed; // we may be able to (partially) reuse collision result // but only safe if collision was resting canReusePrevCol = prevCol && prevCol.collided && motion < 0.2; // reuse collision object collision = prevCol; } else { collision = { collided: false, bodyA: bodyA, bodyB: bodyB }; } if (prevCol && canReusePrevCol) { // if we can reuse the collision result // we only need to test the previously found axis var axes = [prevCol.bodyA.axes[prevCol.axisNumber]]; minOverlap = _overlapAxes(prevCol.bodyA.vertices, prevCol.bodyB.vertices, axes); collision.reused = true; if (minOverlap.overlap <= 0) { collision.collided = false; return collision; } } else { // if we can't reuse a result, perform a full SAT test overlapAB = _overlapAxes(bodyA.vertices, bodyB.vertices, bodyA.axes); if (overlapAB.overlap <= 0) { collision.collided = false; return collision; } overlapBA = _overlapAxes(bodyB.vertices, bodyA.vertices, bodyB.axes); if (overlapBA.overlap <= 0) { collision.collided = false; return collision; } if (overlapAB.overlap < overlapBA.overlap) { minOverlap = overlapAB; collision.bodyA = bodyA; collision.bodyB = bodyB; } else { minOverlap = overlapBA; collision.bodyA = bodyB; collision.bodyB = bodyA; } // important for reuse later collision.axisNumber = minOverlap.axisNumber; } collision.collided = true; collision.normal = minOverlap.axis; collision.depth = minOverlap.overlap; bodyA = collision.bodyA; bodyB = collision.bodyB; // ensure normal is facing away from bodyA if (Vector.dot(collision.normal, Vector.sub(bodyB.position, bodyA.position)) > 0) collision.normal = Vector.neg(collision.normal); collision.tangent = Vector.perp(collision.normal); collision.penetration = { x: collision.normal.x * collision.depth, y: collision.normal.y * collision.depth }; // find support points, there is always either exactly one or two var verticesB = _findSupports(bodyA, bodyB, collision.normal), supports = collision.supports || []; supports.length = 0; // find the supports from bodyB that are inside bodyA if (Vertices.contains(bodyA.vertices, verticesB[0])) supports.push(verticesB[0]); if (Vertices.contains(bodyA.vertices, verticesB[1])) supports.push(verticesB[1]); // find the supports from bodyA that are inside bodyB if (supports.length < 2) { var verticesA = _findSupports(bodyB, bodyA, Vector.neg(collision.normal)); if (Vertices.contains(bodyB.vertices, verticesA[0])) supports.push(verticesA[0]); if (supports.length < 2 && Vertices.contains(bodyB.vertices, verticesA[1])) supports.push(verticesA[1]); } // account for the edge case of overlapping but no vertex containment if (supports.length < 2) supports = [verticesB[0]]; collision.supports = supports; collision.supportCorrected = Vector.sub(supports[0], collision.penetration); return collision; }; /** * Description * @method _overlapAxes * @private * @param {} verticesA * @param {} verticesB * @param {} axes * @return result */ var _overlapAxes = function(verticesA, verticesB, axes) { var projectionA = {}, projectionB = {}, result = { overlap: Number.MAX_VALUE }, overlap, axis; for (var i = 0; i < axes.length; i++) { axis = axes[i]; _projectToAxis(projectionA, verticesA, axis); _projectToAxis(projectionB, verticesB, axis); overlap = projectionA.min < projectionB.min ? projectionA.max - projectionB.min : projectionB.max - projectionA.min; if (overlap <= 0) { result.overlap = overlap; return result; } if (overlap < result.overlap) { result.overlap = overlap; result.axis = axis; result.axisNumber = i; } } return result; }; /** * Description * @method _projectToAxis * @private * @param {} projection * @param {} vertices * @param {} axis */ var _projectToAxis = function(projection, vertices, axis) { var min = Vector.dot(vertices[0], axis), max = min; for (var i = 1; i < vertices.length; i += 1) { var dot = Vector.dot(vertices[i], axis); if (dot > max) { max = dot; } else if (dot < min) { min = dot; } } projection.min = min; projection.max = max; }; /** * Description * @method _findSupports * @private * @param {} bodyA * @param {} bodyB * @param {} normal * @return ArrayExpression */ var _findSupports = function(bodyA, bodyB, normal) { var nearestDistance = Number.MAX_VALUE, vertexToBody = { x: 0, y: 0 }, vertices = bodyB.vertices, bodyAPosition = bodyA.position, distance, vertex, vertexA = vertices[0], vertexB = vertices[1]; // find closest vertex on bodyB for (var i = 0; i < vertices.length; i++) { vertex = vertices[i]; vertexToBody.x = vertex.x - bodyAPosition.x; vertexToBody.y = vertex.y - bodyAPosition.y; distance = -Vector.dot(normal, vertexToBody); if (distance < nearestDistance) { nearestDistance = distance; vertexA = vertex; } } // find next closest vertex using the two connected to it var prevIndex = vertexA.index - 1 >= 0 ? vertexA.index - 1 : vertices.length - 1; vertex = vertices[prevIndex]; vertexToBody.x = vertex.x - bodyAPosition.x; vertexToBody.y = vertex.y - bodyAPosition.y; nearestDistance = -Vector.dot(normal, vertexToBody); vertexB = vertex; var nextIndex = (vertexA.index + 1) % vertices.length; vertex = vertices[nextIndex]; vertexToBody.x = vertex.x - bodyAPosition.x; vertexToBody.y = vertex.y - bodyAPosition.y; distance = -Vector.dot(normal, vertexToBody); if (distance < nearestDistance) { nearestDistance = distance; vertexB = vertex; } return [vertexA, vertexB]; }; })(); ; // End src/collision/SAT.js // Begin src/constraint/Constraint.js /** * The `Matter.Constraint` module contains methods for creating and manipulating constraints. * Constraints are used for specifying that a fixed distance must be maintained between two bodies (or a body and a fixed world-space position). * The stiffness of constraints can be modified to create springs or elastic. * * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Constraint */ // TODO: fix instabillity issues with torque // TODO: linked constraints // TODO: breakable constraints // TODO: collidable constraints // TODO: allow constrained bodies to sleep // TODO: handle 0 length constraints properly // TODO: impulse caching and warming var Constraint = {}; (function() { var _minLength = 0.000001, _minDifference = 0.001; /** * Creates a new constraint. * All properties have default values, and many are pre-calculated automatically based on other properties. * See the properites section below for detailed information on what you can pass via the `options` object. * @method create * @param {} options * @return {constraint} constraint */ Constraint.create = function(options) { var constraint = options; // if bodies defined but no points, use body centre if (constraint.bodyA && !constraint.pointA) constraint.pointA = { x: 0, y: 0 }; if (constraint.bodyB && !constraint.pointB) constraint.pointB = { x: 0, y: 0 }; // calculate static length using initial world space points var initialPointA = constraint.bodyA ? Vector.add(constraint.bodyA.position, constraint.pointA) : constraint.pointA, initialPointB = constraint.bodyB ? Vector.add(constraint.bodyB.position, constraint.pointB) : constraint.pointB, length = Vector.magnitude(Vector.sub(initialPointA, initialPointB)); constraint.length = constraint.length || length || _minLength; // render var render = { visible: true, lineWidth: 2, strokeStyle: '#666' }; constraint.render = Common.extend(render, constraint.render); // option defaults constraint.id = constraint.id || Common.nextId(); constraint.label = constraint.label || 'Constraint'; constraint.type = 'constraint'; constraint.stiffness = constraint.stiffness || 1; constraint.angularStiffness = constraint.angularStiffness || 0; constraint.angleA = constraint.bodyA ? constraint.bodyA.angle : constraint.angleA; constraint.angleB = constraint.bodyB ? constraint.bodyB.angle : constraint.angleB; return constraint; }; /** * Description * @private * @method solveAll * @param {constraint[]} constraints * @param {number} timeScale */ Constraint.solveAll = function(constraints, timeScale) { for (var i = 0; i < constraints.length; i++) { Constraint.solve(constraints[i], timeScale); } }; /** * Description * @private * @method solve * @param {constraint} constraint * @param {number} timeScale */ Constraint.solve = function(constraint, timeScale) { var bodyA = constraint.bodyA, bodyB = constraint.bodyB, pointA = constraint.pointA, pointB = constraint.pointB; // update reference angle if (bodyA && !bodyA.isStatic) { constraint.pointA = Vector.rotate(pointA, bodyA.angle - constraint.angleA); constraint.angleA = bodyA.angle; } // update reference angle if (bodyB && !bodyB.isStatic) { constraint.pointB = Vector.rotate(pointB, bodyB.angle - constraint.angleB); constraint.angleB = bodyB.angle; } var pointAWorld = pointA, pointBWorld = pointB; if (bodyA) pointAWorld = Vector.add(bodyA.position, pointA); if (bodyB) pointBWorld = Vector.add(bodyB.position, pointB); if (!pointAWorld || !pointBWorld) return; var delta = Vector.sub(pointAWorld, pointBWorld), currentLength = Vector.magnitude(delta); // prevent singularity if (currentLength === 0) currentLength = _minLength; // solve distance constraint with Gauss-Siedel method var difference = (currentLength - constraint.length) / currentLength, normal = Vector.div(delta, currentLength), force = Vector.mult(delta, difference * 0.5 * constraint.stiffness * timeScale * timeScale); // if difference is very small, we can skip if (Math.abs(1 - (currentLength / constraint.length)) < _minDifference * timeScale) return; var velocityPointA, velocityPointB, offsetA, offsetB, oAn, oBn, bodyADenom, bodyBDenom; if (bodyA && !bodyA.isStatic) { // point body offset offsetA = { x: pointAWorld.x - bodyA.position.x + force.x, y: pointAWorld.y - bodyA.position.y + force.y }; // update velocity bodyA.velocity.x = bodyA.position.x - bodyA.positionPrev.x; bodyA.velocity.y = bodyA.position.y - bodyA.positionPrev.y; bodyA.angularVelocity = bodyA.angle - bodyA.anglePrev; // find point velocity and body mass velocityPointA = Vector.add(bodyA.velocity, Vector.mult(Vector.perp(offsetA), bodyA.angularVelocity)); oAn = Vector.dot(offsetA, normal); bodyADenom = bodyA.inverseMass + bodyA.inverseInertia * oAn * oAn; } else { velocityPointA = { x: 0, y: 0 }; bodyADenom = bodyA ? bodyA.inverseMass : 0; } if (bodyB && !bodyB.isStatic) { // point body offset offsetB = { x: pointBWorld.x - bodyB.position.x - force.x, y: pointBWorld.y - bodyB.position.y - force.y }; // update velocity bodyB.velocity.x = bodyB.position.x - bodyB.positionPrev.x; bodyB.velocity.y = bodyB.position.y - bodyB.positionPrev.y; bodyB.angularVelocity = bodyB.angle - bodyB.anglePrev; // find point velocity and body mass velocityPointB = Vector.add(bodyB.velocity, Vector.mult(Vector.perp(offsetB), bodyB.angularVelocity)); oBn = Vector.dot(offsetB, normal); bodyBDenom = bodyB.inverseMass + bodyB.inverseInertia * oBn * oBn; } else { velocityPointB = { x: 0, y: 0 }; bodyBDenom = bodyB ? bodyB.inverseMass : 0; } var relativeVelocity = Vector.sub(velocityPointB, velocityPointA), normalImpulse = Vector.dot(normal, relativeVelocity) / (bodyADenom + bodyBDenom); if (normalImpulse > 0) normalImpulse = 0; var normalVelocity = { x: normal.x * normalImpulse, y: normal.y * normalImpulse }; var torque; if (bodyA && !bodyA.isStatic) { torque = Vector.cross(offsetA, normalVelocity) * bodyA.inverseInertia * (1 - constraint.angularStiffness); Sleeping.set(bodyA, false); // clamp to prevent instabillity // TODO: solve this properlly torque = Common.clamp(torque, -0.01, 0.01); // keep track of applied impulses for post solving bodyA.constraintImpulse.x -= force.x; bodyA.constraintImpulse.y -= force.y; bodyA.constraintImpulse.angle += torque; // apply forces bodyA.position.x -= force.x; bodyA.position.y -= force.y; bodyA.angle += torque; } if (bodyB && !bodyB.isStatic) { torque = Vector.cross(offsetB, normalVelocity) * bodyB.inverseInertia * (1 - constraint.angularStiffness); Sleeping.set(bodyB, false); // clamp to prevent instabillity // TODO: solve this properlly torque = Common.clamp(torque, -0.01, 0.01); // keep track of applied impulses for post solving bodyB.constraintImpulse.x += force.x; bodyB.constraintImpulse.y += force.y; bodyB.constraintImpulse.angle -= torque; // apply forces bodyB.position.x += force.x; bodyB.position.y += force.y; bodyB.angle -= torque; } }; /** * Performs body updates required after solving constraints * @private * @method postSolveAll * @param {body[]} bodies */ Constraint.postSolveAll = function(bodies) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i], impulse = body.constraintImpulse; // update geometry and reset Vertices.translate(body.vertices, impulse); if (impulse.angle !== 0) { Vertices.rotate(body.vertices, impulse.angle, body.position); Axes.rotate(body.axes, impulse.angle); impulse.angle = 0; } Bounds.update(body.bounds, body.vertices); impulse.x = 0; impulse.y = 0; } }; /* * * Properties Documentation * */ /** * An integer `Number` uniquely identifying number generated in `Composite.create` by `Common.nextId`. * * @property id * @type number */ /** * A `String` denoting the type of object. * * @property type * @type string * @default "constraint" */ /** * An arbitrary `String` name to help the user identify and manage bodies. * * @property label * @type string * @default "Constraint" */ /** * An `Object` that defines the rendering properties to be consumed by the module `Matter.Render`. * * @property render * @type object */ /** * A flag that indicates if the constraint should be rendered. * * @property render.visible * @type boolean * @default true */ /** * A `Number` that defines the line width to use when rendering the constraint outline. * A value of `0` means no outline will be rendered. * * @property render.lineWidth * @type number * @default 2 */ /** * A `String` that defines the stroke style to use when rendering the constraint outline. * It is the same as when using a canvas, so it accepts CSS style property values. * * @property render.strokeStyle * @type string * @default a random colour */ /** * The first possible `Body` that this constraint is attached to. * * @property bodyA * @type body * @default null */ /** * The second possible `Body` that this constraint is attached to. * * @property bodyB * @type body * @default null */ /** * A `Vector` that specifies the offset of the constraint from center of the `constraint.bodyA` if defined, otherwise a world-space position. * * @property pointA * @type vector * @default { x: 0, y: 0 } */ /** * A `Vector` that specifies the offset of the constraint from center of the `constraint.bodyA` if defined, otherwise a world-space position. * * @property pointB * @type vector * @default { x: 0, y: 0 } */ /** * A `Number` that specifies the stiffness of the constraint, i.e. the rate at which it returns to its resting `constraint.length`. * A value of `1` means the constraint should be very stiff. * A value of `0.2` means the constraint acts like a soft spring. * * @property stiffness * @type number * @default 1 */ /** * A `Number` that specifies the target resting length of the constraint. * It is calculated automatically in `Constraint.create` from intial positions of the `constraint.bodyA` and `constraint.bodyB`. * * @property length * @type number */ })(); ; // End src/constraint/Constraint.js // Begin src/constraint/MouseConstraint.js /** * The `Matter.MouseConstraint` module contains methods for creating mouse constraints. * Mouse constraints are used for allowing user interaction, providing the ability to move bodies via the mouse or touch. * * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class MouseConstraint */ var MouseConstraint = {}; (function() { /** * Creates a new mouse constraint. * All properties have default values, and many are pre-calculated automatically based on other properties. * See the properites section below for detailed information on what you can pass via the `options` object. * @method create * @param {engine} engine * @param {} options * @return {MouseConstraint} A new MouseConstraint */ MouseConstraint.create = function(engine, options) { var mouse = (options && options.mouse) || Mouse.create(engine.render.canvas); var constraint = Constraint.create({ label: 'Mouse Constraint', pointA: mouse.position, pointB: { x: 0, y: 0 }, length: 0.01, stiffness: 0.1, angularStiffness: 1, render: { strokeStyle: '#90EE90', lineWidth: 3 } }); var defaults = { type: 'mouseConstraint', mouse: mouse, dragBody: null, dragPoint: null, constraint: constraint, collisionFilter: { category: 0x0001, mask: 0xFFFFFFFF, group: 0 } }; var mouseConstraint = Common.extend(defaults, options); Events.on(engine, 'tick', function(event) { var allBodies = Composite.allBodies(engine.world); MouseConstraint.update(mouseConstraint, allBodies); _triggerEvents(mouseConstraint); }); return mouseConstraint; }; /** * Updates the given mouse constraint. * @private * @method update * @param {MouseConstraint} mouseConstraint * @param {body[]} bodies */ MouseConstraint.update = function(mouseConstraint, bodies) { var mouse = mouseConstraint.mouse, constraint = mouseConstraint.constraint; if (mouse.button === 0) { if (!constraint.bodyB) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (Bounds.contains(body.bounds, mouse.position) && Vertices.contains(body.vertices, mouse.position) && Detector.canCollide(body.collisionFilter, mouseConstraint.collisionFilter)) { constraint.pointA = mouse.position; constraint.bodyB = body; constraint.pointB = { x: mouse.position.x - body.position.x, y: mouse.position.y - body.position.y }; constraint.angleB = body.angle; Sleeping.set(body, false); } } } } else { constraint.bodyB = null; constraint.pointB = null; } if (constraint.bodyB) { Sleeping.set(constraint.bodyB, false); constraint.pointA = mouse.position; } }; /** * Triggers mouse constraint events * @method _triggerEvents * @private * @param {mouse} mouse */ var _triggerEvents = function(mouseConstraint) { var mouse = mouseConstraint.mouse, mouseEvents = mouse.sourceEvents; if (mouseEvents.mousemove) Events.trigger(mouseConstraint, 'mousemove', { mouse: mouse }); if (mouseEvents.mousedown) Events.trigger(mouseConstraint, 'mousedown', { mouse: mouse }); if (mouseEvents.mouseup) Events.trigger(mouseConstraint, 'mouseup', { mouse: mouse }); // reset the mouse state ready for the next step Mouse.clearSourceEvents(mouse); }; /* * * Events Documentation * */ /** * Fired when the mouse has moved (or a touch moves) during the last step * * @event mousemove * @param {} event An event object * @param {mouse} event.mouse The engine's mouse instance * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when the mouse is down (or a touch has started) during the last step * * @event mousedown * @param {} event An event object * @param {mouse} event.mouse The engine's mouse instance * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when the mouse is up (or a touch has ended) during the last step * * @event mouseup * @param {} event An event object * @param {mouse} event.mouse The engine's mouse instance * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /* * * Properties Documentation * */ /** * A `String` denoting the type of object. * * @property type * @type string * @default "constraint" */ /** * The `Mouse` instance in use. If not supplied in `MouseConstraint.create`, one will be created. * * @property mouse * @type mouse * @default mouse */ /** * The `Body` that is currently being moved by the user, or `null` if no body. * * @property dragBody * @type body * @default null */ /** * The `Vector` offset at which the drag started relative to the `dragBody`, if any. * * @property dragPoint * @type body * @default null */ /** * The `Constraint` object that is used to move the body during interaction. * * @property constraint * @type constraint */ /** * An `Object` that specifies the collision filter properties. * The collision filter allows the user to define which types of body this mouse constraint can interact with. * See `body.collisionFilter` for more information. * * @property collisionFilter * @type object */ })(); ; // End src/constraint/MouseConstraint.js // Begin src/core/Common.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Common */ var Common = {}; (function() { Common._nextId = 0; Common._seed = 0; /** * Description * @method extend * @param {} obj * @param {boolean} deep * @return {} obj extended */ Common.extend = function(obj, deep) { var argsStart, args, deepClone; if (typeof deep === 'boolean') { argsStart = 2; deepClone = deep; } else { argsStart = 1; deepClone = true; } args = Array.prototype.slice.call(arguments, argsStart); for (var i = 0; i < args.length; i++) { var source = args[i]; if (source) { for (var prop in source) { if (deepClone && source[prop] && source[prop].constructor === Object) { if (!obj[prop] || obj[prop].constructor === Object) { obj[prop] = obj[prop] || {}; Common.extend(obj[prop], deepClone, source[prop]); } else { obj[prop] = source[prop]; } } else { obj[prop] = source[prop]; } } } } return obj; }; /** * Creates a new clone of the object, if deep is true references will also be cloned * @method clone * @param {} obj * @param {bool} deep * @return {} obj cloned */ Common.clone = function(obj, deep) { return Common.extend({}, deep, obj); }; /** * Description * @method keys * @param {} obj * @return {string[]} keys */ Common.keys = function(obj) { if (Object.keys) return Object.keys(obj); // avoid hasOwnProperty for performance var keys = []; for (var key in obj) keys.push(key); return keys; }; /** * Description * @method values * @param {} obj * @return {array} Array of the objects property values */ Common.values = function(obj) { var values = []; if (Object.keys) { var keys = Object.keys(obj); for (var i = 0; i < keys.length; i++) { values.push(obj[keys[i]]); } return values; } // avoid hasOwnProperty for performance for (var key in obj) values.push(obj[key]); return values; }; /** * Description * @method shadeColor * @param {string} color * @param {number} percent * @return {string} A hex colour string made by lightening or darkening color by percent */ Common.shadeColor = function(color, percent) { // http://stackoverflow.com/questions/5560248/programmatically-lighten-or-darken-a-hex-color var colorInteger = parseInt(color.slice(1),16), amount = Math.round(2.55 * percent), R = (colorInteger >> 16) + amount, B = (colorInteger >> 8 & 0x00FF) + amount, G = (colorInteger & 0x0000FF) + amount; return "#" + (0x1000000 + (R < 255 ? R < 1 ? 0 : R :255) * 0x10000 + (B < 255 ? B < 1 ? 0 : B : 255) * 0x100 + (G < 255 ? G < 1 ? 0 : G : 255)).toString(16).slice(1); }; /** * Description * @method shuffle * @param {array} array * @return {array} array shuffled randomly */ Common.shuffle = function(array) { for (var i = array.length - 1; i > 0; i--) { var j = Math.floor(Common.random() * (i + 1)); var temp = array[i]; array[i] = array[j]; array[j] = temp; } return array; }; /** * Description * @method choose * @param {array} choices * @return {object} A random choice object from the array */ Common.choose = function(choices) { return choices[Math.floor(Common.random() * choices.length)]; }; /** * Description * @method isElement * @param {object} obj * @return {boolean} True if the object is a HTMLElement, otherwise false */ Common.isElement = function(obj) { // http://stackoverflow.com/questions/384286/javascript-isdom-how-do-you-check-if-a-javascript-object-is-a-dom-object try { return obj instanceof HTMLElement; } catch(e){ return (typeof obj==="object") && (obj.nodeType===1) && (typeof obj.style === "object") && (typeof obj.ownerDocument ==="object"); } }; /** * Description * @method clamp * @param {number} value * @param {number} min * @param {number} max * @return {number} The value clamped between min and max inclusive */ Common.clamp = function(value, min, max) { if (value < min) return min; if (value > max) return max; return value; }; /** * Description * @method sign * @param {number} value * @return {number} -1 if negative, +1 if 0 or positive */ Common.sign = function(value) { return value < 0 ? -1 : 1; }; /** * Description * @method now * @return {number} the current timestamp (high-res if avaliable) */ Common.now = function() { // http://stackoverflow.com/questions/221294/how-do-you-get-a-timestamp-in-javascript // https://gist.github.com/davidwaterston/2982531 var perf = window.performance; if (perf) { perf.now = perf.now || perf.webkitNow || perf.msNow || perf.oNow || perf.mozNow; return +(perf.now()); } return +(new Date()); }; /** * Description * @method random * @param {number} min * @param {number} max * @return {number} A random number between min and max inclusive */ Common.random = function(min, max) { min = (typeof min !== "undefined") ? min : 0; max = (typeof max !== "undefined") ? max : 1; return min + _seededRandom() * (max - min); }; /** * Converts a CSS hex colour string into an integer * @method colorToNumber * @param {string} colorString * @return {number} An integer representing the CSS hex string */ Common.colorToNumber = function(colorString) { colorString = colorString.replace('#',''); if (colorString.length == 3) { colorString = colorString.charAt(0) + colorString.charAt(0) + colorString.charAt(1) + colorString.charAt(1) + colorString.charAt(2) + colorString.charAt(2); } return parseInt(colorString, 16); }; /** * A wrapper for console.log, for providing errors and warnings * @method log * @param {string} message * @param {string} type */ Common.log = function(message, type) { if (!console || !console.log) return; var style; switch (type) { case 'warn': style = 'color: coral'; break; case 'error': style = 'color: red'; break; } console.log('%c [Matter] ' + type + ': ' + message, style); }; /** * Returns the next unique sequential ID * @method nextId * @return {Number} Unique sequential ID */ Common.nextId = function() { return Common._nextId++; }; /** * A cross browser compatible indexOf implementation * @method indexOf * @param {array} haystack * @param {object} needle */ Common.indexOf = function(haystack, needle) { if (haystack.indexOf) return haystack.indexOf(needle); for (var i = 0; i < haystack.length; i++) { if (haystack[i] === needle) return i; } return -1; }; var _seededRandom = function() { // https://gist.github.com/ngryman/3830489 Common._seed = (Common._seed * 9301 + 49297) % 233280; return Common._seed / 233280; }; })(); ; // End src/core/Common.js // Begin src/core/Engine.js /** * The `Matter.Engine` module contains methods for creating and manipulating engines. * An engine is a controller that manages updating and rendering the simulation of the world. * See `Matter.Runner` for an optional game loop utility. * * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Engine */ var Engine = {}; (function() { var _fps = 60, _delta = 1000 / _fps; /** * Creates a new engine. The options parameter is an object that specifies any properties you wish to override the defaults. * All properties have default values, and many are pre-calculated automatically based on other properties. * See the properites section below for detailed information on what you can pass via the `options` object. * @method create * @param {HTMLElement} element * @param {object} [options] * @return {engine} engine */ Engine.create = function(element, options) { // options may be passed as the first (and only) argument options = Common.isElement(element) ? options : element; element = Common.isElement(element) ? element : null; var defaults = { enabled: true, positionIterations: 6, velocityIterations: 4, constraintIterations: 2, enableSleeping: false, events: [], timing: { fps: _fps, timestamp: 0, delta: _delta, correction: 1, deltaMin: 1000 / _fps, deltaMax: 1000 / (_fps * 0.5), timeScale: 1, isFixed: false, frameRequestId: 0 }, render: { element: element, controller: Render }, broadphase: { controller: Grid } }; var engine = Common.extend(defaults, options); engine.render = engine.render.controller.create(engine.render); engine.world = World.create(engine.world); engine.pairs = Pairs.create(); engine.metrics = engine.metrics || Metrics.create(); engine.broadphase = engine.broadphase.controller.create(engine.broadphase); return engine; }; /** * Moves the simulation forward in time by `delta` ms. * Triggers `beforeUpdate` and `afterUpdate` events. * Triggers `collisionStart`, `collisionActive` and `collisionEnd` events. * @method update * @param {engine} engine * @param {number} delta * @param {number} [correction] */ Engine.update = function(engine, delta, correction) { correction = (typeof correction !== 'undefined') ? correction : 1; var world = engine.world, timing = engine.timing, broadphase = engine.broadphase, broadphasePairs = [], i; // increment timestamp timing.timestamp += delta * timing.timeScale; timing.correction = correction; // create an event object var event = { timestamp: engine.timing.timestamp }; Events.trigger(engine, 'beforeUpdate', event); // get lists of all bodies and constraints, no matter what composites they are in var allBodies = Composite.allBodies(world), allConstraints = Composite.allConstraints(world); // reset metrics logging Metrics.reset(engine.metrics); // if sleeping enabled, call the sleeping controller if (engine.enableSleeping) Sleeping.update(allBodies, timing.timeScale); // applies gravity to all bodies Body.applyGravityAll(allBodies, world.gravity); // update all body position and rotation by integration Body.updateAll(allBodies, delta, timing.timeScale, correction, world.bounds); // update all constraints for (i = 0; i < engine.constraintIterations; i++) { Constraint.solveAll(allConstraints, timing.timeScale); } Constraint.postSolveAll(allBodies); // broadphase pass: find potential collision pairs if (broadphase.controller) { // if world is dirty, we must flush the whole grid if (world.isModified) broadphase.controller.clear(broadphase); // update the grid buckets based on current bodies broadphase.controller.update(broadphase, allBodies, engine, world.isModified); broadphasePairs = broadphase.pairsList; } else { // if no broadphase set, we just pass all bodies broadphasePairs = allBodies; } // narrowphase pass: find actual collisions, then create or update collision pairs var collisions = broadphase.detector(broadphasePairs, engine); // update collision pairs var pairs = engine.pairs, timestamp = timing.timestamp; Pairs.update(pairs, collisions, timestamp); Pairs.removeOld(pairs, timestamp); // wake up bodies involved in collisions if (engine.enableSleeping) Sleeping.afterCollisions(pairs.list, timing.timeScale); // trigger collision events if (pairs.collisionStart.length > 0) Events.trigger(engine, 'collisionStart', { pairs: pairs.collisionStart }); // iteratively resolve velocity between collisions Resolver.preSolveVelocity(pairs.list); for (i = 0; i < engine.velocityIterations; i++) { Resolver.solveVelocity(pairs.list, timing.timeScale); } // iteratively resolve position between collisions for (i = 0; i < engine.positionIterations; i++) { Resolver.solvePosition(pairs.list, timing.timeScale); } Resolver.postSolvePosition(allBodies); // trigger collision events if (pairs.collisionActive.length > 0) Events.trigger(engine, 'collisionActive', { pairs: pairs.collisionActive }); if (pairs.collisionEnd.length > 0) Events.trigger(engine, 'collisionEnd', { pairs: pairs.collisionEnd }); // update metrics log Metrics.update(engine.metrics, engine); // clear force buffers Body.resetForcesAll(allBodies); // clear all composite modified flags if (world.isModified) Composite.setModified(world, false, false, true); Events.trigger(engine, 'afterUpdate', event); return engine; }; /** * Renders the world by calling its defined renderer `engine.render.controller`. Triggers `beforeRender` and `afterRender` events. * @method render * @param {engine} engineA * @param {engine} engineB */ Engine.render = function(engine) { // create an event object var event = { timestamp: engine.timing.timestamp }; Events.trigger(engine, 'beforeRender', event); engine.render.controller.world(engine); Events.trigger(engine, 'afterRender', event); }; /** * Merges two engines by keeping the configuration of `engineA` but replacing the world with the one from `engineB`. * @method merge * @param {engine} engineA * @param {engine} engineB */ Engine.merge = function(engineA, engineB) { Common.extend(engineA, engineB); if (engineB.world) { engineA.world = engineB.world; Engine.clear(engineA); var bodies = Composite.allBodies(engineA.world); for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; Sleeping.set(body, false); body.id = Common.nextId(); } } }; /** * Clears the engine including the world, pairs and broadphase. * @method clear * @param {engine} engine */ Engine.clear = function(engine) { var world = engine.world; Pairs.clear(engine.pairs); var broadphase = engine.broadphase; if (broadphase.controller) { var bodies = Composite.allBodies(world); broadphase.controller.clear(broadphase); broadphase.controller.update(broadphase, bodies, engine, true); } }; /** * An alias for `Runner.run`, see `Matter.Runner` for more information. * @method run * @param {engine} engine */ /* * * Events Documentation * */ /** * Fired at the start of a tick, before any updates to the engine or timing * * @event beforeTick * @param {} event An event object * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine timing updated, but just before engine state updated * * @event tick * @param {} event An event object * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired just before an update * * @event beforeUpdate * @param {} event An event object * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine update and all collision events * * @event afterUpdate * @param {} event An event object * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired just before rendering * * @event beforeRender * @param {} event An event object * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after rendering * * @event afterRender * @param {} event An event object * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine update and after rendering * * @event afterTick * @param {} event An event object * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine update, provides a list of all pairs that have started to collide in the current tick (if any) * * @event collisionStart * @param {} event An event object * @param {} event.pairs List of affected pairs * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine update, provides a list of all pairs that are colliding in the current tick (if any) * * @event collisionActive * @param {} event An event object * @param {} event.pairs List of affected pairs * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine update, provides a list of all pairs that have ended collision in the current tick (if any) * * @event collisionEnd * @param {} event An event object * @param {} event.pairs List of affected pairs * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /* * * Properties Documentation * */ /** * A flag that specifies whether the engine is running or not. * * @property enabled * @type boolean * @default true */ /** * An integer `Number` that specifies the number of position iterations to perform each update. * The higher the value, the higher quality the simulation will be at the expense of performance. * * @property positionIterations * @type number * @default 6 */ /** * An integer `Number` that specifies the number of velocity iterations to perform each update. * The higher the value, the higher quality the simulation will be at the expense of performance. * * @property velocityIterations * @type number * @default 4 */ /** * An integer `Number` that specifies the number of constraint iterations to perform each update. * The higher the value, the higher quality the simulation will be at the expense of performance. * The default value of `2` is usually very adequate. * * @property constraintIterations * @type number * @default 2 */ /** * A flag that specifies whether the engine should allow sleeping via the `Matter.Sleeping` module. * Sleeping can improve stability and performance, but often at the expense of accuracy. * * @property enableSleeping * @type boolean * @default false */ /** * An `Object` containing properties regarding the timing systems of the engine. * * @property timing * @type object */ /** * A `Number` that specifies the global scaling factor of time for all bodies. * A value of `0` freezes the simulation. * A value of `0.1` gives a slow-motion effect. * A value of `1.2` gives a speed-up effect. * * @property timing.timeScale * @type number * @default 1 */ /** * A `Number` that specifies the current simulation-time in milliseconds starting from `0`. * It is incremented on every `Engine.update` by the `timing.delta`. * * @property timing.timestamp * @type number * @default 0 */ /** * A `Boolean` that specifies if the `Engine.run` game loop should use a fixed timestep (otherwise it is variable). * If timing is fixed, then the apparant simulation speed will change depending on the frame rate (but behaviour will be deterministic). * If the timing is variable, then the apparant simulation speed will be constant (approximately, but at the cost of determininism). * * @property timing.isFixed * @type boolean * @default false */ /** * A `Number` that specifies the time step between updates in milliseconds. * If `engine.timing.isFixed` is set to `true`, then `delta` is fixed. * If it is `false`, then `delta` can dynamically change to maintain the correct apparant simulation speed. * * @property timing.delta * @type number * @default 1000 / 60 */ /** * A `Number` that specifies the time correction factor to apply to the current timestep. * It is automatically handled when using `Engine.run`, but is also only optional even if you use your own game loop. * The value is defined as `delta / lastDelta`, i.e. the percentage change of `delta` between steps. * This value is always `1` (no correction) when frame rate is constant or `engine.timing.isFixed` is `true`. * If the framerate and hence `delta` are changing, then correction should be applied to the current update to account for the change. * See the paper on Time Corrected Verlet for more information. * * @property timing.correction * @type number * @default 1 */ /** * An instance of a `Render` controller. The default value is a `Matter.Render` instance created by `Engine.create`. * One may also develop a custom renderer module based on `Matter.Render` and pass an instance of it to `Engine.create` via `options.render`. * * A minimal custom renderer object must define at least three functions: `create`, `clear` and `world` (see `Matter.Render`). * It is also possible to instead pass the _module_ reference via `options.render.controller` and `Engine.create` will instantiate one for you. * * @property render * @type render * @default a Matter.Render instance */ /** * An instance of a broadphase controller. The default value is a `Matter.Grid` instance created by `Engine.create`. * * @property broadphase * @type grid * @default a Matter.Grid instance */ /** * A `World` composite object that will contain all simulated bodies and constraints. * * @property world * @type world * @default a Matter.World instance */ })(); ; // End src/core/Engine.js // Begin src/core/Events.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Events */ var Events = {}; (function() { /** * Subscribes a callback function to the given object's `eventName`. * @method on * @param {} object * @param {string} eventNames * @param {function} callback */ Events.on = function(object, eventNames, callback) { var names = eventNames.split(' '), name; for (var i = 0; i < names.length; i++) { name = names[i]; object.events = object.events || {}; object.events[name] = object.events[name] || []; object.events[name].push(callback); } return callback; }; /** * Removes the given event callback. If no callback, clears all callbacks in `eventNames`. If no `eventNames`, clears all events. * @method off * @param {} object * @param {string} eventNames * @param {function} callback */ Events.off = function(object, eventNames, callback) { if (!eventNames) { object.events = {}; return; } // handle Events.off(object, callback) if (typeof eventNames === 'function') { callback = eventNames; eventNames = Common.keys(object.events).join(' '); } var names = eventNames.split(' '); for (var i = 0; i < names.length; i++) { var callbacks = object.events[names[i]], newCallbacks = []; if (callback) { for (var j = 0; j < callbacks.length; j++) { if (callbacks[j] !== callback) newCallbacks.push(callbacks[j]); } } object.events[names[i]] = newCallbacks; } }; /** * Fires all the callbacks subscribed to the given object's `eventName`, in the order they subscribed, if any. * @method trigger * @param {} object * @param {string} eventNames * @param {} event */ Events.trigger = function(object, eventNames, event) { var names, name, callbacks, eventClone; if (object.events) { if (!event) event = {}; names = eventNames.split(' '); for (var i = 0; i < names.length; i++) { name = names[i]; callbacks = object.events[name]; if (callbacks) { eventClone = Common.clone(event, false); eventClone.name = name; eventClone.source = object; for (var j = 0; j < callbacks.length; j++) { callbacks[j].apply(object, [eventClone]); } } } } }; })(); ; // End src/core/Events.js // Begin src/core/Metrics.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Metrics */ var Metrics = {}; (function() { /** * Description * @method create * @return {metrics} A new metrics */ Metrics.create = function() { return { extended: false, narrowDetections: 0, narrowphaseTests: 0, narrowReuse: 0, narrowReuseCount: 0, midphaseTests: 0, broadphaseTests: 0, narrowEff: 0.0001, midEff: 0.0001, broadEff: 0.0001, collisions: 0, buckets: 0, bodies: 0, pairs: 0 }; }; /** * Description * @method reset * @param {metrics} metrics */ Metrics.reset = function(metrics) { if (metrics.extended) { metrics.narrowDetections = 0; metrics.narrowphaseTests = 0; metrics.narrowReuse = 0; metrics.narrowReuseCount = 0; metrics.midphaseTests = 0; metrics.broadphaseTests = 0; metrics.narrowEff = 0; metrics.midEff = 0; metrics.broadEff = 0; metrics.collisions = 0; metrics.buckets = 0; metrics.pairs = 0; metrics.bodies = 0; } }; /** * Description * @method update * @param {metrics} metrics * @param {engine} engine */ Metrics.update = function(metrics, engine) { if (metrics.extended) { var world = engine.world, broadphase = engine.broadphase[engine.broadphase.current], bodies = Composite.allBodies(world); metrics.collisions = metrics.narrowDetections; metrics.pairs = engine.pairs.list.length; metrics.bodies = bodies.length; metrics.midEff = (metrics.narrowDetections / (metrics.midphaseTests || 1)).toFixed(2); metrics.narrowEff = (metrics.narrowDetections / (metrics.narrowphaseTests || 1)).toFixed(2); metrics.broadEff = (1 - (metrics.broadphaseTests / (bodies.length || 1))).toFixed(2); metrics.narrowReuse = (metrics.narrowReuseCount / (metrics.narrowphaseTests || 1)).toFixed(2); //if (broadphase.instance) // metrics.buckets = Common.keys(broadphase.instance.buckets).length; } }; })(); ; // End src/core/Metrics.js // Begin src/core/Mouse.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Mouse */ var Mouse = {}; (function() { /** * Description * @method create * @param {HTMLElement} element * @return {mouse} A new mouse */ Mouse.create = function(element) { var mouse = {}; mouse.element = element || document.body; mouse.absolute = { x: 0, y: 0 }; mouse.position = { x: 0, y: 0 }; mouse.mousedownPosition = { x: 0, y: 0 }; mouse.mouseupPosition = { x: 0, y: 0 }; mouse.offset = { x: 0, y: 0 }; mouse.scale = { x: 1, y: 1 }; mouse.wheelDelta = 0; mouse.button = -1; mouse.sourceEvents = { mousemove: null, mousedown: null, mouseup: null, mousewheel: null }; mouse.mousemove = function(event) { var position = _getRelativeMousePosition(event, mouse.element), touches = event.changedTouches; if (touches) { mouse.button = 0; event.preventDefault(); } mouse.absolute.x = position.x; mouse.absolute.y = position.y; mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; mouse.sourceEvents.mousemove = event; }; mouse.mousedown = function(event) { var position = _getRelativeMousePosition(event, mouse.element), touches = event.changedTouches; if (touches) { mouse.button = 0; event.preventDefault(); } else { mouse.button = event.button; } mouse.absolute.x = position.x; mouse.absolute.y = position.y; mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; mouse.mousedownPosition.x = mouse.position.x; mouse.mousedownPosition.y = mouse.position.y; mouse.sourceEvents.mousedown = event; }; mouse.mouseup = function(event) { var position = _getRelativeMousePosition(event, mouse.element), touches = event.changedTouches; if (touches) { event.preventDefault(); } mouse.button = -1; mouse.absolute.x = position.x; mouse.absolute.y = position.y; mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; mouse.mouseupPosition.x = mouse.position.x; mouse.mouseupPosition.y = mouse.position.y; mouse.sourceEvents.mouseup = event; }; mouse.mousewheel = function(event) { mouse.wheelDelta = Math.max(-1, Math.min(1, event.wheelDelta || -event.detail)); event.preventDefault(); }; Mouse.setElement(mouse, mouse.element); return mouse; }; /** * Sets the element the mouse is bound to (and relative to) * @method setElement * @param {mouse} mouse * @param {HTMLElement} element */ Mouse.setElement = function(mouse, element) { mouse.element = element; element.addEventListener('mousemove', mouse.mousemove); element.addEventListener('mousedown', mouse.mousedown); element.addEventListener('mouseup', mouse.mouseup); element.addEventListener("mousewheel", mouse.mousewheel); element.addEventListener("DOMMouseScroll", mouse.mousewheel); element.addEventListener('touchmove', mouse.mousemove); element.addEventListener('touchstart', mouse.mousedown); element.addEventListener('touchend', mouse.mouseup); }; /** * Clears all captured source events * @method clearSourceEvents * @param {mouse} mouse */ Mouse.clearSourceEvents = function(mouse) { mouse.sourceEvents.mousemove = null; mouse.sourceEvents.mousedown = null; mouse.sourceEvents.mouseup = null; mouse.sourceEvents.mousewheel = null; mouse.wheelDelta = 0; }; /** * Sets the offset * @method setOffset * @param {mouse} mouse */ Mouse.setOffset = function(mouse, offset) { mouse.offset.x = offset.x; mouse.offset.y = offset.y; mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; }; /** * Sets the scale * @method setScale * @param {mouse} mouse */ Mouse.setScale = function(mouse, scale) { mouse.scale.x = scale.x; mouse.scale.y = scale.y; mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; }; /** * Description * @method _getRelativeMousePosition * @private * @param {} event * @param {} element * @return ObjectExpression */ var _getRelativeMousePosition = function(event, element) { var elementBounds = element.getBoundingClientRect(), rootNode = (document.documentElement || document.body.parentNode || document.body), scrollX = (window.pageXOffset !== undefined) ? window.pageXOffset : rootNode.scrollLeft, scrollY = (window.pageYOffset !== undefined) ? window.pageYOffset : rootNode.scrollTop, touches = event.changedTouches, x, y; if (touches) { x = touches[0].pageX - elementBounds.left - scrollX; y = touches[0].pageY - elementBounds.top - scrollY; } else { x = event.pageX - elementBounds.left - scrollX; y = event.pageY - elementBounds.top - scrollY; } return { x: x / (element.clientWidth / element.width), y: y / (element.clientHeight / element.height) }; }; })(); ; // End src/core/Mouse.js // Begin src/core/Runner.js /** * The `Matter.Runner` module is an optional utility which provides a game loop, * that handles updating and rendering a `Matter.Engine` for you within a browser. * Note that the method `Engine.run` is an alias for `Runner.run`. * * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Runner */ var Runner = {}; (function() { var _fps = 60, _deltaSampleSize = _fps, _delta = 1000 / _fps; var _requestAnimationFrame = window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || window.msRequestAnimationFrame || function(callback){ window.setTimeout(function() { callback(Common.now()); }, _delta); }; var _cancelAnimationFrame = window.cancelAnimationFrame || window.mozCancelAnimationFrame || window.webkitCancelAnimationFrame || window.msCancelAnimationFrame; /** * Provides a basic game loop that handles updating the engine for you. * Calls `Engine.update` and `Engine.render` on the `requestAnimationFrame` event automatically. * Handles time correction and non-fixed dynamic timing (if enabled). * Triggers `beforeTick`, `tick` and `afterTick` events. * @method run * @param {engine} engine */ Runner.run = function(engine) { var counterTimestamp = 0, frameCounter = 0, deltaHistory = [], timePrev, timeScalePrev = 1; (function render(time){ var timing = engine.timing, delta, correction; timing.frameRequestId = _requestAnimationFrame(render); if (!engine.enabled) return; // create an event object var event = { timestamp: time }; Events.trigger(engine, 'beforeTick', event); if (timing.isFixed) { // fixed timestep delta = timing.delta; } else { // dynamic timestep based on wall clock between calls delta = (time - timePrev) || timing.delta; timePrev = time; // optimistically filter delta over a few frames, to improve stability deltaHistory.push(delta); deltaHistory = deltaHistory.slice(-_deltaSampleSize); delta = Math.min.apply(null, deltaHistory); // limit delta delta = delta < timing.deltaMin ? timing.deltaMin : delta; delta = delta > timing.deltaMax ? timing.deltaMax : delta; // time correction for delta correction = delta / timing.delta; // update engine timing object timing.delta = delta; } // time correction for time scaling if (timeScalePrev !== 0) correction *= timing.timeScale / timeScalePrev; if (timing.timeScale === 0) correction = 0; timeScalePrev = timing.timeScale; // fps counter frameCounter += 1; if (time - counterTimestamp >= 1000) { timing.fps = frameCounter * ((time - counterTimestamp) / 1000); counterTimestamp = time; frameCounter = 0; } Events.trigger(engine, 'tick', event); // if world has been modified, clear the render scene graph if (engine.world.isModified) engine.render.controller.clear(engine.render); // update Engine.update(engine, delta, correction); // render Engine.render(engine); Events.trigger(engine, 'afterTick', event); })(); }; /** * Ends execution of `Runner.run` on the given `engine`, by canceling the animation frame request event loop. * If you wish to only temporarily pause the engine, see `engine.enabled` instead. * @method stop * @param {engine} engine */ Runner.stop = function(engine) { _cancelAnimationFrame(engine.timing.frameRequestId); }; })(); ; // End src/core/Runner.js // Begin src/core/Sleeping.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Sleeping */ var Sleeping = {}; (function() { Sleeping._motionWakeThreshold = 0.18; Sleeping._motionSleepThreshold = 0.08; Sleeping._minBias = 0.9; /** * Puts bodies to sleep or wakes them up depending on their motion. * @method update * @param {body[]} bodies * @param {number} timeScale */ Sleeping.update = function(bodies, timeScale) { var timeFactor = timeScale * timeScale * timeScale; // update bodies sleeping status for (var i = 0; i < bodies.length; i++) { var body = bodies[i], motion = body.speed * body.speed + body.angularSpeed * body.angularSpeed; // wake up bodies if they have a force applied if (body.force.x > 0 || body.force.y > 0) { Sleeping.set(body, false); continue; } var minMotion = Math.min(body.motion, motion), maxMotion = Math.max(body.motion, motion); // biased average motion estimation between frames body.motion = Sleeping._minBias * minMotion + (1 - Sleeping._minBias) * maxMotion; if (body.sleepThreshold > 0 && body.motion < Sleeping._motionSleepThreshold * timeFactor) { body.sleepCounter += 1; if (body.sleepCounter >= body.sleepThreshold) Sleeping.set(body, true); } else if (body.sleepCounter > 0) { body.sleepCounter -= 1; } } }; /** * Given a set of colliding pairs, wakes the sleeping bodies involved. * @method afterCollisions * @param {pair[]} pairs * @param {number} timeScale */ Sleeping.afterCollisions = function(pairs, timeScale) { var timeFactor = timeScale * timeScale * timeScale; // wake up bodies involved in collisions for (var i = 0; i < pairs.length; i++) { var pair = pairs[i]; // don't wake inactive pairs if (!pair.isActive) continue; var collision = pair.collision, bodyA = collision.bodyA, bodyB = collision.bodyB; // don't wake if at least one body is static if ((bodyA.isSleeping && bodyB.isSleeping) || bodyA.isStatic || bodyB.isStatic) continue; if (bodyA.isSleeping || bodyB.isSleeping) { var sleepingBody = (bodyA.isSleeping && !bodyA.isStatic) ? bodyA : bodyB, movingBody = sleepingBody === bodyA ? bodyB : bodyA; if (!sleepingBody.isStatic && movingBody.motion > Sleeping._motionWakeThreshold * timeFactor) { Sleeping.set(sleepingBody, false); } } } }; /** * Description * @method set * @param {body} body * @param {boolean} isSleeping */ Sleeping.set = function(body, isSleeping) { if (isSleeping) { body.isSleeping = true; body.sleepCounter = body.sleepThreshold; body.positionImpulse.x = 0; body.positionImpulse.y = 0; body.positionPrev.x = body.position.x; body.positionPrev.y = body.position.y; body.anglePrev = body.angle; body.speed = 0; body.angularSpeed = 0; body.motion = 0; } else { body.isSleeping = false; body.sleepCounter = 0; } }; })(); ; // End src/core/Sleeping.js // Begin src/factory/Bodies.js /** * The `Matter.Bodies` module contains factory methods for creating rigid body models * with commonly used body configurations (such as rectangles, circles and other polygons). * * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Bodies */ // TODO: true circle bodies var Bodies = {}; (function() { /** * Creates a new rigid body model with a rectangle hull. * The options parameter is an object that specifies any properties you wish to override the defaults. * See the properites section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. * @method rectangle * @param {number} x * @param {number} y * @param {number} width * @param {number} height * @param {object} [options] * @return {body} A new rectangle body */ Bodies.rectangle = function(x, y, width, height, options) { options = options || {}; var rectangle = { label: 'Rectangle Body', position: { x: x, y: y }, vertices: Vertices.fromPath('L 0 0 L ' + width + ' 0 L ' + width + ' ' + height + ' L 0 ' + height) }; if (options.chamfer) { var chamfer = options.chamfer; rectangle.vertices = Vertices.chamfer(rectangle.vertices, chamfer.radius, chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); delete options.chamfer; } return Body.create(Common.extend({}, rectangle, options)); }; /** * Creates a new rigid body model with a trapezoid hull. * The options parameter is an object that specifies any properties you wish to override the defaults. * See the properites section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. * @method trapezoid * @param {number} x * @param {number} y * @param {number} width * @param {number} height * @param {number} slope * @param {object} [options] * @return {body} A new trapezoid body */ Bodies.trapezoid = function(x, y, width, height, slope, options) { options = options || {}; slope *= 0.5; var roof = (1 - (slope * 2)) * width; var x1 = width * slope, x2 = x1 + roof, x3 = x2 + x1; var trapezoid = { label: 'Trapezoid Body', position: { x: x, y: y }, vertices: Vertices.fromPath('L 0 0 L ' + x1 + ' ' + (-height) + ' L ' + x2 + ' ' + (-height) + ' L ' + x3 + ' 0') }; if (options.chamfer) { var chamfer = options.chamfer; trapezoid.vertices = Vertices.chamfer(trapezoid.vertices, chamfer.radius, chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); delete options.chamfer; } return Body.create(Common.extend({}, trapezoid, options)); }; /** * Creates a new rigid body model with a circle hull. * The options parameter is an object that specifies any properties you wish to override the defaults. * See the properites section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. * @method circle * @param {number} x * @param {number} y * @param {number} radius * @param {object} [options] * @param {number} maxSides * @return {body} A new circle body */ Bodies.circle = function(x, y, radius, options, maxSides) { options = options || {}; options.label = 'Circle Body'; // approximate circles with polygons until true circles implemented in SAT maxSides = maxSides || 25; var sides = Math.ceil(Math.max(10, Math.min(maxSides, radius))); // optimisation: always use even number of sides (half the number of unique axes) if (sides % 2 === 1) sides += 1; // flag for better rendering options.circleRadius = radius; return Bodies.polygon(x, y, sides, radius, options); }; /** * Creates a new rigid body model with a regular polygon hull with the given number of sides. * The options parameter is an object that specifies any properties you wish to override the defaults. * See the properites section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. * @method polygon * @param {number} x * @param {number} y * @param {number} sides * @param {number} radius * @param {object} [options] * @return {body} A new regular polygon body */ Bodies.polygon = function(x, y, sides, radius, options) { options = options || {}; if (sides < 3) return Bodies.circle(x, y, radius, options); var theta = 2 * Math.PI / sides, path = '', offset = theta * 0.5; for (var i = 0; i < sides; i += 1) { var angle = offset + (i * theta), xx = Math.cos(angle) * radius, yy = Math.sin(angle) * radius; path += 'L ' + xx.toFixed(3) + ' ' + yy.toFixed(3) + ' '; } var polygon = { label: 'Polygon Body', position: { x: x, y: y }, vertices: Vertices.fromPath(path) }; if (options.chamfer) { var chamfer = options.chamfer; polygon.vertices = Vertices.chamfer(polygon.vertices, chamfer.radius, chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); delete options.chamfer; } return Body.create(Common.extend({}, polygon, options)); }; })(); ; // End src/factory/Bodies.js // Begin src/factory/Composites.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Composites */ var Composites = {}; (function() { /** * Description * @method stack * @param {number} xx * @param {number} yy * @param {number} columns * @param {number} rows * @param {number} columnGap * @param {number} rowGap * @param {function} callback * @return {composite} A new composite containing objects created in the callback */ Composites.stack = function(xx, yy, columns, rows, columnGap, rowGap, callback) { var stack = Composite.create({ label: 'Stack' }), x = xx, y = yy, lastBody, i = 0; for (var row = 0; row < rows; row++) { var maxHeight = 0; for (var column = 0; column < columns; column++) { var body = callback(x, y, column, row, lastBody, i); if (body) { var bodyHeight = body.bounds.max.y - body.bounds.min.y, bodyWidth = body.bounds.max.x - body.bounds.min.x; if (bodyHeight > maxHeight) maxHeight = bodyHeight; Body.translate(body, { x: bodyWidth * 0.5, y: bodyHeight * 0.5 }); x = body.bounds.max.x + columnGap; Composite.addBody(stack, body); lastBody = body; i += 1; } } y += maxHeight + rowGap; x = xx; } return stack; }; /** * Description * @method chain * @param {composite} composite * @param {number} xOffsetA * @param {number} yOffsetA * @param {number} xOffsetB * @param {number} yOffsetB * @param {object} options * @return {composite} A new composite containing objects chained together with constraints */ Composites.chain = function(composite, xOffsetA, yOffsetA, xOffsetB, yOffsetB, options) { var bodies = composite.bodies; for (var i = 1; i < bodies.length; i++) { var bodyA = bodies[i - 1], bodyB = bodies[i], bodyAHeight = bodyA.bounds.max.y - bodyA.bounds.min.y, bodyAWidth = bodyA.bounds.max.x - bodyA.bounds.min.x, bodyBHeight = bodyB.bounds.max.y - bodyB.bounds.min.y, bodyBWidth = bodyB.bounds.max.x - bodyB.bounds.min.x; var defaults = { bodyA: bodyA, pointA: { x: bodyAWidth * xOffsetA, y: bodyAHeight * yOffsetA }, bodyB: bodyB, pointB: { x: bodyBWidth * xOffsetB, y: bodyBHeight * yOffsetB } }; var constraint = Common.extend(defaults, options); Composite.addConstraint(composite, Constraint.create(constraint)); } composite.label += ' Chain'; return composite; }; /** * Connects bodies in the composite with constraints in a grid pattern, with optional cross braces * @method mesh * @param {composite} composite * @param {number} columns * @param {number} rows * @param {boolean} crossBrace * @param {object} options * @return {composite} The composite containing objects meshed together with constraints */ Composites.mesh = function(composite, columns, rows, crossBrace, options) { var bodies = composite.bodies, row, col, bodyA, bodyB, bodyC; for (row = 0; row < rows; row++) { for (col = 0; col < columns; col++) { if (col > 0) { bodyA = bodies[(col - 1) + (row * columns)]; bodyB = bodies[col + (row * columns)]; Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyA, bodyB: bodyB }, options))); } } for (col = 0; col < columns; col++) { if (row > 0) { bodyA = bodies[col + ((row - 1) * columns)]; bodyB = bodies[col + (row * columns)]; Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyA, bodyB: bodyB }, options))); if (crossBrace && col > 0) { bodyC = bodies[(col - 1) + ((row - 1) * columns)]; Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyC, bodyB: bodyB }, options))); } if (crossBrace && col < columns - 1) { bodyC = bodies[(col + 1) + ((row - 1) * columns)]; Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyC, bodyB: bodyB }, options))); } } } } composite.label += ' Mesh'; return composite; }; /** * Description * @method pyramid * @param {number} xx * @param {number} yy * @param {number} columns * @param {number} rows * @param {number} columnGap * @param {number} rowGap * @param {function} callback * @return {composite} A new composite containing objects created in the callback */ Composites.pyramid = function(xx, yy, columns, rows, columnGap, rowGap, callback) { return Composites.stack(xx, yy, columns, rows, columnGap, rowGap, function(x, y, column, row, lastBody, i) { var actualRows = Math.min(rows, Math.ceil(columns / 2)), lastBodyWidth = lastBody ? lastBody.bounds.max.x - lastBody.bounds.min.x : 0; if (row > actualRows) return; // reverse row order row = actualRows - row; var start = row, end = columns - 1 - row; if (column < start || column > end) return; // retroactively fix the first body's position, since width was unknown if (i === 1) { Body.translate(lastBody, { x: (column + (columns % 2 === 1 ? 1 : -1)) * lastBodyWidth, y: 0 }); } var xOffset = lastBody ? column * lastBodyWidth : 0; return callback(xx + xOffset + column * columnGap, y, column, row, lastBody, i); }); }; /** * Description * @method newtonsCradle * @param {number} xx * @param {number} yy * @param {number} number * @param {number} size * @param {number} length * @return {composite} A new composite newtonsCradle body */ Composites.newtonsCradle = function(xx, yy, number, size, length) { var newtonsCradle = Composite.create({ label: 'Newtons Cradle' }); for (var i = 0; i < number; i++) { var separation = 1.9, circle = Bodies.circle(xx + i * (size * separation), yy + length, size, { inertia: 99999, restitution: 1, friction: 0, frictionAir: 0.0001, slop: 0.01 }), constraint = Constraint.create({ pointA: { x: xx + i * (size * separation), y: yy }, bodyB: circle }); Composite.addBody(newtonsCradle, circle); Composite.addConstraint(newtonsCradle, constraint); } return newtonsCradle; }; /** * Description * @method car * @param {number} xx * @param {number} yy * @param {number} width * @param {number} height * @param {number} wheelSize * @return {composite} A new composite car body */ Composites.car = function(xx, yy, width, height, wheelSize) { var group = Body.nextGroup(true), wheelBase = -20, wheelAOffset = -width * 0.5 + wheelBase, wheelBOffset = width * 0.5 - wheelBase, wheelYOffset = 0; var car = Composite.create({ label: 'Car' }), body = Bodies.trapezoid(xx, yy, width, height, 0.3, { collisionFilter: { group: group }, friction: 0.01, chamfer: { radius: 10 } }); var wheelA = Bodies.circle(xx + wheelAOffset, yy + wheelYOffset, wheelSize, { collisionFilter: { group: group }, restitution: 0.5, friction: 0.9, density: 0.01 }); var wheelB = Bodies.circle(xx + wheelBOffset, yy + wheelYOffset, wheelSize, { collisionFilter: { group: group }, restitution: 0.5, friction: 0.9, density: 0.01 }); var axelA = Constraint.create({ bodyA: body, pointA: { x: wheelAOffset, y: wheelYOffset }, bodyB: wheelA, stiffness: 0.5 }); var axelB = Constraint.create({ bodyA: body, pointA: { x: wheelBOffset, y: wheelYOffset }, bodyB: wheelB, stiffness: 0.5 }); Composite.addBody(car, body); Composite.addBody(car, wheelA); Composite.addBody(car, wheelB); Composite.addConstraint(car, axelA); Composite.addConstraint(car, axelB); return car; }; /** * Creates a simple soft body like object * @method softBody * @param {number} xx * @param {number} yy * @param {number} columns * @param {number} rows * @param {number} columnGap * @param {number} rowGap * @param {boolean} crossBrace * @param {number} particleRadius * @param {} particleOptions * @param {} constraintOptions * @return {composite} A new composite softBody */ Composites.softBody = function(xx, yy, columns, rows, columnGap, rowGap, crossBrace, particleRadius, particleOptions, constraintOptions) { particleOptions = Common.extend({ inertia: Infinity }, particleOptions); constraintOptions = Common.extend({ stiffness: 0.4 }, constraintOptions); var softBody = Composites.stack(xx, yy, columns, rows, columnGap, rowGap, function(x, y, column, row) { return Bodies.circle(x, y, particleRadius, particleOptions); }); Composites.mesh(softBody, columns, rows, crossBrace, constraintOptions); softBody.label = 'Soft Body'; return softBody; }; })(); ; // End src/factory/Composites.js // Begin src/geometry/Axes.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Axes */ var Axes = {}; (function() { /** * Description * @method fromVertices * @param {vertices} vertices * @return {axes} A new axes from the given vertices */ Axes.fromVertices = function(vertices) { var axes = {}; // find the unique axes, using edge normal gradients for (var i = 0; i < vertices.length; i++) { var j = (i + 1) % vertices.length, normal = Vector.normalise({ x: vertices[j].y - vertices[i].y, y: vertices[i].x - vertices[j].x }), gradient = (normal.y === 0) ? Infinity : (normal.x / normal.y); // limit precision gradient = gradient.toFixed(3).toString(); axes[gradient] = normal; } return Common.values(axes); }; /** * Description * @method rotate * @param {axes} axes * @param {number} angle */ Axes.rotate = function(axes, angle) { if (angle === 0) return; var cos = Math.cos(angle), sin = Math.sin(angle); for (var i = 0; i < axes.length; i++) { var axis = axes[i], xx; xx = axis.x * cos - axis.y * sin; axis.y = axis.x * sin + axis.y * cos; axis.x = xx; } }; })(); ; // End src/geometry/Axes.js // Begin src/geometry/Bounds.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Bounds */ var Bounds = {}; (function() { /** * Description * @method create * @param {vertices} vertices * @return {bounds} A new bounds object */ Bounds.create = function(vertices) { var bounds = { min: { x: 0, y: 0 }, max: { x: 0, y: 0 } }; if (vertices) Bounds.update(bounds, vertices); return bounds; }; /** * Description * @method update * @param {bounds} bounds * @param {vertices} vertices * @param {vector} velocity */ Bounds.update = function(bounds, vertices, velocity) { bounds.min.x = Number.MAX_VALUE; bounds.max.x = Number.MIN_VALUE; bounds.min.y = Number.MAX_VALUE; bounds.max.y = Number.MIN_VALUE; for (var i = 0; i < vertices.length; i++) { var vertex = vertices[i]; if (vertex.x > bounds.max.x) bounds.max.x = vertex.x; if (vertex.x < bounds.min.x) bounds.min.x = vertex.x; if (vertex.y > bounds.max.y) bounds.max.y = vertex.y; if (vertex.y < bounds.min.y) bounds.min.y = vertex.y; } if (velocity) { if (velocity.x > 0) { bounds.max.x += velocity.x; } else { bounds.min.x += velocity.x; } if (velocity.y > 0) { bounds.max.y += velocity.y; } else { bounds.min.y += velocity.y; } } }; /** * Description * @method contains * @param {bounds} bounds * @param {vector} point * @return {boolean} True if the bounds contain the point, otherwise false */ Bounds.contains = function(bounds, point) { return point.x >= bounds.min.x && point.x <= bounds.max.x && point.y >= bounds.min.y && point.y <= bounds.max.y; }; /** * Description * @method overlaps * @param {bounds} boundsA * @param {bounds} boundsB * @return {boolean} True if the bounds overlap, otherwise false */ Bounds.overlaps = function(boundsA, boundsB) { return (boundsA.min.x <= boundsB.max.x && boundsA.max.x >= boundsB.min.x && boundsA.max.y >= boundsB.min.y && boundsA.min.y <= boundsB.max.y); }; /** * Translates the bounds by the given vector * @method translate * @param {bounds} bounds * @param {vector} vector */ Bounds.translate = function(bounds, vector) { bounds.min.x += vector.x; bounds.max.x += vector.x; bounds.min.y += vector.y; bounds.max.y += vector.y; }; /** * Shifts the bounds to the given position * @method shift * @param {bounds} bounds * @param {vector} position */ Bounds.shift = function(bounds, position) { var deltaX = bounds.max.x - bounds.min.x, deltaY = bounds.max.y - bounds.min.y; bounds.min.x = position.x; bounds.max.x = position.x + deltaX; bounds.min.y = position.y; bounds.max.y = position.y + deltaY; }; })(); ; // End src/geometry/Bounds.js // Begin src/geometry/Vector.js /** * The `Matter.Vector` module contains methods for creating and manipulating vectors. * Vectors are the basis of all the geometry related operations in the engine. * A `Matter.Vector` object is of the form `{ x: 0, y: 0 }`. * * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Vector */ // TODO: consider params for reusing vector objects var Vector = {}; (function() { /** * Returns a new vector with `x` and `y` copied from the given `vector`. * @method clone * @param {vector} vector * @return {vector} A new cloned vector */ Vector.clone = function(vector) { return { x: vector.x, y: vector.y }; }; /** * Returns the magnitude (length) of a vector. * @method magnitude * @param {vector} vector * @return {number} The magnitude of the vector */ Vector.magnitude = function(vector) { return Math.sqrt((vector.x * vector.x) + (vector.y * vector.y)); }; /** * Returns the magnitude (length) of a vector (therefore saving a `sqrt` operation). * @method magnitudeSquared * @param {vector} vector * @return {number} The squared magnitude of the vector */ Vector.magnitudeSquared = function(vector) { return (vector.x * vector.x) + (vector.y * vector.y); }; /** * Rotates the vector about (0, 0) by specified angle. * @method rotate * @param {vector} vector * @param {number} angle * @return {vector} A new vector rotated about (0, 0) */ Vector.rotate = function(vector, angle) { var cos = Math.cos(angle), sin = Math.sin(angle); return { x: vector.x * cos - vector.y * sin, y: vector.x * sin + vector.y * cos }; }; /** * Rotates the vector about a specified point by specified angle. * @method rotateAbout * @param {vector} vector * @param {number} angle * @param {vector} point * @return {vector} A new vector rotated about the point */ Vector.rotateAbout = function(vector, angle, point) { var cos = Math.cos(angle), sin = Math.sin(angle); return { x: point.x + ((vector.x - point.x) * cos - (vector.y - point.y) * sin), y: point.y + ((vector.x - point.x) * sin + (vector.y - point.y) * cos) }; }; /** * Normalises a vector (such that its magnitude is `1`). * @method normalise * @param {vector} vector * @return {vector} A new vector normalised */ Vector.normalise = function(vector) { var magnitude = Vector.magnitude(vector); if (magnitude === 0) return { x: 0, y: 0 }; return { x: vector.x / magnitude, y: vector.y / magnitude }; }; /** * Returns the dot-product of two vectors. * @method dot * @param {vector} vectorA * @param {vector} vectorB * @return {number} The dot product of the two vectors */ Vector.dot = function(vectorA, vectorB) { return (vectorA.x * vectorB.x) + (vectorA.y * vectorB.y); }; /** * Returns the cross-product of two vectors. * @method cross * @param {vector} vectorA * @param {vector} vectorB * @return {number} The cross product of the two vectors */ Vector.cross = function(vectorA, vectorB) { return (vectorA.x * vectorB.y) - (vectorA.y * vectorB.x); }; /** * Adds the two vectors. * @method add * @param {vector} vectorA * @param {vector} vectorB * @return {vector} A new vector of vectorA and vectorB added */ Vector.add = function(vectorA, vectorB) { return { x: vectorA.x + vectorB.x, y: vectorA.y + vectorB.y }; }; /** * Subtracts the two vectors. * @method sub * @param {vector} vectorA * @param {vector} vectorB * @return {vector} A new vector of vectorA and vectorB subtracted */ Vector.sub = function(vectorA, vectorB) { return { x: vectorA.x - vectorB.x, y: vectorA.y - vectorB.y }; }; /** * Multiplies a vector and a scalar. * @method mult * @param {vector} vector * @param {number} scalar * @return {vector} A new vector multiplied by scalar */ Vector.mult = function(vector, scalar) { return { x: vector.x * scalar, y: vector.y * scalar }; }; /** * Divides a vector and a scalar. * @method div * @param {vector} vector * @param {number} scalar * @return {vector} A new vector divided by scalar */ Vector.div = function(vector, scalar) { return { x: vector.x / scalar, y: vector.y / scalar }; }; /** * Returns the perpendicular vector. Set `negate` to true for the perpendicular in the opposite direction. * @method perp * @param {vector} vector * @param {bool} [negate=false] * @return {vector} The perpendicular vector */ Vector.perp = function(vector, negate) { negate = negate === true ? -1 : 1; return { x: negate * -vector.y, y: negate * vector.x }; }; /** * Negates both components of a vector such that it points in the opposite direction. * @method neg * @param {vector} vector * @return {vector} The negated vector */ Vector.neg = function(vector) { return { x: -vector.x, y: -vector.y }; }; /** * Returns the angle in radians between the two vectors relative to the x-axis. * @method angle * @param {vector} vectorA * @param {vector} vectorB * @return {number} The angle in radians */ Vector.angle = function(vectorA, vectorB) { return Math.atan2(vectorB.y - vectorA.y, vectorB.x - vectorA.x); }; })(); ; // End src/geometry/Vector.js // Begin src/geometry/Vertices.js /** * The `Matter.Vertices` module contains methods for creating and manipulating sets of vertices. * A set of vertices is an array of `Matter.Vector` with additional indexing properties inserted by `Vertices.create`. * A `Matter.Body` maintains a set of vertices to represent the shape of the object (its convex hull). * * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Vertices */ // TODO: convex decomposition - http://mnbayazit.com/406/bayazit var Vertices = {}; (function() { /** * Creates a new set of `Matter.Body` compatible vertices. * The `points` argument accepts an array of `Matter.Vector` points orientated around the origin `(0, 0)`, for example: * * [{ x: 0, y: 0 }, { x: 25, y: 50 }, { x: 50, y: 0 }] * * The `Vertices.create` method returns a new array of vertices, which are similar to Matter.Vector objects, * but with some additional references required for efficient collision detection routines. * * Note that the `body` argument is not optional, a `Matter.Body` reference must be provided. * * @method create * @param {vector[]} points * @param {body} body */ Vertices.create = function(points, body) { var vertices = []; for (var i = 0; i < points.length; i++) { var point = points[i], vertex = {}; vertex.x = point.x; vertex.y = point.y; vertex.index = i; vertex.body = body; vertices.push(vertex); } return vertices; }; /** * Parses a _simple_ SVG-style path into a `Matter.Vertices` object for the given `Matter.Body`. * @method fromPath * @param {string} path * @param {body} body * @return {vertices} vertices */ Vertices.fromPath = function(path, body) { var pathPattern = /L\s*([\-\d\.]*)\s*([\-\d\.]*)/ig, points = []; path.replace(pathPattern, function(match, x, y) { points.push({ x: parseFloat(x, 10), y: parseFloat(y, 10) }); }); return Vertices.create(points, body); }; /** * Returns the centre (centroid) of the set of vertices. * @method centre * @param {vertices} vertices * @return {vector} The centre point */ Vertices.centre = function(vertices) { var area = Vertices.area(vertices, true), centre = { x: 0, y: 0 }, cross, temp, j; for (var i = 0; i < vertices.length; i++) { j = (i + 1) % vertices.length; cross = Vector.cross(vertices[i], vertices[j]); temp = Vector.mult(Vector.add(vertices[i], vertices[j]), cross); centre = Vector.add(centre, temp); } return Vector.div(centre, 6 * area); }; /** * Returns the area of the set of vertices. * @method area * @param {vertices} vertices * @param {bool} signed * @return {number} The area */ Vertices.area = function(vertices, signed) { var area = 0, j = vertices.length - 1; for (var i = 0; i < vertices.length; i++) { area += (vertices[j].x - vertices[i].x) * (vertices[j].y + vertices[i].y); j = i; } if (signed) return area / 2; return Math.abs(area) / 2; }; /** * Returns the moment of inertia (second moment of area) of the set of vertices given the total mass. * @method inertia * @param {vertices} vertices * @param {number} mass * @return {number} The polygon's moment of inertia */ Vertices.inertia = function(vertices, mass) { var numerator = 0, denominator = 0, v = vertices, cross, j; // find the polygon's moment of inertia, using second moment of area // http://www.physicsforums.com/showthread.php?t=25293 for (var n = 0; n < v.length; n++) { j = (n + 1) % v.length; cross = Math.abs(Vector.cross(v[j], v[n])); numerator += cross * (Vector.dot(v[j], v[j]) + Vector.dot(v[j], v[n]) + Vector.dot(v[n], v[n])); denominator += cross; } return (mass / 6) * (numerator / denominator); }; /** * Translates the set of vertices in-place. * @method translate * @param {vertices} vertices * @param {vector} vector * @param {number} scalar */ Vertices.translate = function(vertices, vector, scalar) { var i; if (scalar) { for (i = 0; i < vertices.length; i++) { vertices[i].x += vector.x * scalar; vertices[i].y += vector.y * scalar; } } else { for (i = 0; i < vertices.length; i++) { vertices[i].x += vector.x; vertices[i].y += vector.y; } } return vertices; }; /** * Rotates the set of vertices in-place. * @method rotate * @param {vertices} vertices * @param {number} angle * @param {vector} point */ Vertices.rotate = function(vertices, angle, point) { if (angle === 0) return; var cos = Math.cos(angle), sin = Math.sin(angle); for (var i = 0; i < vertices.length; i++) { var vertice = vertices[i], dx = vertice.x - point.x, dy = vertice.y - point.y; vertice.x = point.x + (dx * cos - dy * sin); vertice.y = point.y + (dx * sin + dy * cos); } return vertices; }; /** * Returns `true` if the `point` is inside the set of `vertices`. * @method contains * @param {vertices} vertices * @param {vector} point * @return {boolean} True if the vertices contains point, otherwise false */ Vertices.contains = function(vertices, point) { for (var i = 0; i < vertices.length; i++) { var vertice = vertices[i], nextVertice = vertices[(i + 1) % vertices.length]; if ((point.x - vertice.x) * (nextVertice.y - vertice.y) + (point.y - vertice.y) * (vertice.x - nextVertice.x) > 0) { return false; } } return true; }; /** * Scales the vertices from a point (default is centre) in-place. * @method scale * @param {vertices} vertices * @param {number} scaleX * @param {number} scaleY * @param {vector} point */ Vertices.scale = function(vertices, scaleX, scaleY, point) { if (scaleX === 1 && scaleY === 1) return vertices; point = point || Vertices.centre(vertices); var vertex, delta; for (var i = 0; i < vertices.length; i++) { vertex = vertices[i]; delta = Vector.sub(vertex, point); vertices[i].x = point.x + delta.x * scaleX; vertices[i].y = point.y + delta.y * scaleY; } return vertices; }; /** * Chamfers a set of vertices by giving them rounded corners, returns a new set of vertices. * The radius parameter is a single number or an array to specify the radius for each vertex. * @method chamfer * @param {vertices} vertices * @param {number[]} radius * @param {number} quality * @param {number} qualityMin * @param {number} qualityMax */ Vertices.chamfer = function(vertices, radius, quality, qualityMin, qualityMax) { radius = radius || [8]; if (!radius.length) radius = [radius]; // quality defaults to -1, which is auto quality = (typeof quality !== 'undefined') ? quality : -1; qualityMin = qualityMin || 2; qualityMax = qualityMax || 14; var centre = Vertices.centre(vertices), newVertices = []; for (var i = 0; i < vertices.length; i++) { var prevVertex = vertices[i - 1 >= 0 ? i - 1 : vertices.length - 1], vertex = vertices[i], nextVertex = vertices[(i + 1) % vertices.length], currentRadius = radius[i < radius.length ? i : radius.length - 1]; if (currentRadius === 0) { newVertices.push(vertex); continue; } var prevNormal = Vector.normalise({ x: vertex.y - prevVertex.y, y: prevVertex.x - vertex.x }); var nextNormal = Vector.normalise({ x: nextVertex.y - vertex.y, y: vertex.x - nextVertex.x }); var diagonalRadius = Math.sqrt(2 * Math.pow(currentRadius, 2)), radiusVector = Vector.mult(Common.clone(prevNormal), currentRadius), midNormal = Vector.normalise(Vector.mult(Vector.add(prevNormal, nextNormal), 0.5)), scaledVertex = Vector.sub(vertex, Vector.mult(midNormal, diagonalRadius)); var precision = quality; if (quality === -1) { // automatically decide precision precision = Math.pow(currentRadius, 0.32) * 1.75; } precision = Common.clamp(precision, qualityMin, qualityMax); // use an even value for precision, more likely to reduce axes by using symmetry if (precision % 2 === 1) precision += 1; var alpha = Math.acos(Vector.dot(prevNormal, nextNormal)), theta = alpha / precision; for (var j = 0; j < precision; j++) { newVertices.push(Vector.add(Vector.rotate(radiusVector, theta * j), scaledVertex)); } } return newVertices; }; })(); ; // End src/geometry/Vertices.js // Begin src/render/Render.js /** * The `Matter.Render` module is the default `render.controller` used by a `Matter.Engine`. * This renderer is HTML5 canvas based and supports a number of drawing options including sprites and viewports. * * It is possible develop a custom renderer module based on `Matter.Render` and pass an instance of it to `Engine.create` via `options.render`. * A minimal custom renderer object must define at least three functions: `create`, `clear` and `world` (see `Matter.Render`). * * See also `Matter.RenderPixi` for an alternate WebGL, scene-graph based renderer. * * @class Render */ var Render = {}; (function() { /** * Creates a new renderer. The options parameter is an object that specifies any properties you wish to override the defaults. * All properties have default values, and many are pre-calculated automatically based on other properties. * See the properites section below for detailed information on what you can pass via the `options` object. * @method create * @param {object} [options] * @return {render} A new renderer */ Render.create = function(options) { var defaults = { controller: Render, element: null, canvas: null, options: { width: 800, height: 600, background: '#fafafa', wireframeBackground: '#222', hasBounds: false, enabled: true, wireframes: true, showSleeping: true, showDebug: false, showBroadphase: false, showBounds: false, showVelocity: false, showCollisions: false, showAxes: false, showPositions: false, showAngleIndicator: false, showIds: false, showShadows: false } }; var render = Common.extend(defaults, options); render.canvas = render.canvas || _createCanvas(render.options.width, render.options.height); render.context = render.canvas.getContext('2d'); render.textures = {}; render.bounds = render.bounds || { min: { x: 0, y: 0 }, max: { x: render.options.width, y: render.options.height } }; Render.setBackground(render, render.options.background); if (Common.isElement(render.element)) { render.element.appendChild(render.canvas); } else { Common.log('No "render.element" passed, "render.canvas" was not inserted into document.', 'warn'); } return render; }; /** * Clears the renderer. In this implementation, this is a noop. * @method clear * @param {RenderPixi} render */ Render.clear = function(render) { // nothing required to clear this renderer implentation // if a scene graph is required, clear it here (see RenderPixi.js) }; /** * Sets the background CSS property of the canvas * @method setBackground * @param {render} render * @param {string} background */ Render.setBackground = function(render, background) { if (render.currentBackground !== background) { var cssBackground = background; if (/(jpg|gif|png)$/.test(background)) cssBackground = 'url(' + background + ')'; render.canvas.style.background = cssBackground; render.canvas.style.backgroundSize = "contain"; render.currentBackground = background; } }; /** * Renders the given `engine`'s `Matter.World` object. * This is the entry point for all rendering and should be called every time the scene changes. * @method world * @param {engine} engine */ Render.world = function(engine) { var render = engine.render, world = engine.world, canvas = render.canvas, context = render.context, options = render.options, allBodies = Composite.allBodies(world), allConstraints = Composite.allConstraints(world), bodies = [], constraints = [], i; if (options.wireframes) { Render.setBackground(render, options.wireframeBackground); } else { Render.setBackground(render, options.background); } // clear the canvas with a transparent fill, to allow the canvas background to show context.globalCompositeOperation = 'source-in'; context.fillStyle = "transparent"; context.fillRect(0, 0, canvas.width, canvas.height); context.globalCompositeOperation = 'source-over'; // handle bounds var boundsWidth = render.bounds.max.x - render.bounds.min.x, boundsHeight = render.bounds.max.y - render.bounds.min.y, boundsScaleX = boundsWidth / render.options.width, boundsScaleY = boundsHeight / render.options.height; if (options.hasBounds) { // filter out bodies that are not in view for (i = 0; i < allBodies.length; i++) { var body = allBodies[i]; if (Bounds.overlaps(body.bounds, render.bounds)) bodies.push(body); } // filter out constraints that are not in view for (i = 0; i < allConstraints.length; i++) { var constraint = allConstraints[i], bodyA = constraint.bodyA, bodyB = constraint.bodyB, pointAWorld = constraint.pointA, pointBWorld = constraint.pointB; if (bodyA) pointAWorld = Vector.add(bodyA.position, constraint.pointA); if (bodyB) pointBWorld = Vector.add(bodyB.position, constraint.pointB); if (!pointAWorld || !pointBWorld) continue; if (Bounds.contains(render.bounds, pointAWorld) || Bounds.contains(render.bounds, pointBWorld)) constraints.push(constraint); } // transform the view context.scale(1 / boundsScaleX, 1 / boundsScaleY); context.translate(-render.bounds.min.x, -render.bounds.min.y); } else { constraints = allConstraints; bodies = allBodies; } if (!options.wireframes || (engine.enableSleeping && options.showSleeping)) { // fully featured rendering of bodies Render.bodies(engine, bodies, context); } else { // optimised method for wireframes only Render.bodyWireframes(engine, bodies, context); } if (options.showBounds) Render.bodyBounds(engine, bodies, context); if (options.showAxes || options.showAngleIndicator) Render.bodyAxes(engine, bodies, context); if (options.showPositions) Render.bodyPositions(engine, bodies, context); if (options.showVelocity) Render.bodyVelocity(engine, bodies, context); if (options.showIds) Render.bodyIds(engine, bodies, context); if (options.showCollisions) Render.collisions(engine, engine.pairs.list, context); Render.constraints(constraints, context); if (options.showBroadphase && engine.broadphase.controller === Grid) Render.grid(engine, engine.broadphase, context); if (options.showDebug) Render.debug(engine, context); if (options.hasBounds) { // revert view transforms context.setTransform(1, 0, 0, 1, 0, 0); } }; /** * Description * @private * @method debug * @param {engine} engine * @param {RenderingContext} context */ Render.debug = function(engine, context) { var c = context, world = engine.world, render = engine.render, options = render.options, bodies = Composite.allBodies(world), space = " "; if (engine.timing.timestamp - (render.debugTimestamp || 0) >= 500) { var text = ""; text += "fps: " + Math.round(engine.timing.fps) + space; if (engine.metrics.extended) { text += "delta: " + engine.timing.delta.toFixed(3) + space; text += "correction: " + engine.timing.correction.toFixed(3) + space; text += "bodies: " + bodies.length + space; if (engine.broadphase.controller === Grid) text += "buckets: " + engine.metrics.buckets + space; text += "\n"; text += "collisions: " + engine.metrics.collisions + space; text += "pairs: " + engine.pairs.list.length + space; text += "broad: " + engine.metrics.broadEff + space; text += "mid: " + engine.metrics.midEff + space; text += "narrow: " + engine.metrics.narrowEff + space; } render.debugString = text; render.debugTimestamp = engine.timing.timestamp; } if (render.debugString) { c.font = "12px Arial"; if (options.wireframes) { c.fillStyle = 'rgba(255,255,255,0.5)'; } else { c.fillStyle = 'rgba(0,0,0,0.5)'; } var split = render.debugString.split('\n'); for (var i = 0; i < split.length; i++) { c.fillText(split[i], 50, 50 + i * 18); } } }; /** * Description * @private * @method constraints * @param {constraint[]} constraints * @param {RenderingContext} context */ Render.constraints = function(constraints, context) { var c = context; for (var i = 0; i < constraints.length; i++) { var constraint = constraints[i]; if (!constraint.render.visible || !constraint.pointA || !constraint.pointB) continue; var bodyA = constraint.bodyA, bodyB = constraint.bodyB; if (bodyA) { c.beginPath(); c.moveTo(bodyA.position.x + constraint.pointA.x, bodyA.position.y + constraint.pointA.y); } else { c.beginPath(); c.moveTo(constraint.pointA.x, constraint.pointA.y); } if (bodyB) { c.lineTo(bodyB.position.x + constraint.pointB.x, bodyB.position.y + constraint.pointB.y); } else { c.lineTo(constraint.pointB.x, constraint.pointB.y); } c.lineWidth = constraint.render.lineWidth; c.strokeStyle = constraint.render.strokeStyle; c.stroke(); } }; /** * Description * @private * @method bodyShadows * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyShadows = function(engine, bodies, context) { var c = context, render = engine.render, options = render.options; for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (!body.render.visible) continue; if (body.circleRadius) { c.beginPath(); c.arc(body.position.x, body.position.y, body.circleRadius, 0, 2 * Math.PI); c.closePath(); } else { c.beginPath(); c.moveTo(body.vertices[0].x, body.vertices[0].y); for (var j = 1; j < body.vertices.length; j++) { c.lineTo(body.vertices[j].x, body.vertices[j].y); } c.closePath(); } var distanceX = body.position.x - render.options.width * 0.5, distanceY = body.position.y - render.options.height * 0.2, distance = Math.abs(distanceX) + Math.abs(distanceY); c.shadowColor = 'rgba(0,0,0,0.15)'; c.shadowOffsetX = 0.05 * distanceX; c.shadowOffsetY = 0.05 * distanceY; c.shadowBlur = 1 + 12 * Math.min(1, distance / 1000); c.fill(); c.shadowColor = null; c.shadowOffsetX = null; c.shadowOffsetY = null; c.shadowBlur = null; } }; /** * Description * @private * @method bodies * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodies = function(engine, bodies, context) { var c = context, render = engine.render, options = render.options, i; for (i = 0; i < bodies.length; i++) { var body = bodies[i]; if (!body.render.visible) continue; if (body.render.sprite && body.render.sprite.texture && !options.wireframes) { // body sprite var sprite = body.render.sprite, texture = _getTexture(render, sprite.texture); if (options.showSleeping && body.isSleeping) c.globalAlpha = 0.5; c.translate(body.position.x, body.position.y); c.rotate(body.angle); c.drawImage(texture, texture.width * -0.5 * sprite.xScale, texture.height * -0.5 * sprite.yScale, texture.width * sprite.xScale, texture.height * sprite.yScale); // revert translation, hopefully faster than save / restore c.rotate(-body.angle); c.translate(-body.position.x, -body.position.y); if (options.showSleeping && body.isSleeping) c.globalAlpha = 1; } else { // body polygon if (body.circleRadius) { c.beginPath(); c.arc(body.position.x, body.position.y, body.circleRadius, 0, 2 * Math.PI); } else { c.beginPath(); c.moveTo(body.vertices[0].x, body.vertices[0].y); for (var j = 1; j < body.vertices.length; j++) { c.lineTo(body.vertices[j].x, body.vertices[j].y); } c.closePath(); } if (!options.wireframes) { if (options.showSleeping && body.isSleeping) { c.fillStyle = Common.shadeColor(body.render.fillStyle, 50); } else { c.fillStyle = body.render.fillStyle; } c.lineWidth = body.render.lineWidth; c.strokeStyle = body.render.strokeStyle; c.fill(); c.stroke(); } else { c.lineWidth = 1; c.strokeStyle = '#bbb'; if (options.showSleeping && body.isSleeping) c.strokeStyle = 'rgba(255,255,255,0.2)'; c.stroke(); } } } }; /** * Optimised method for drawing body wireframes in one pass * @private * @method bodyWireframes * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyWireframes = function(engine, bodies, context) { var c = context, i, j; c.beginPath(); for (i = 0; i < bodies.length; i++) { var body = bodies[i]; if (!body.render.visible) continue; c.moveTo(body.vertices[0].x, body.vertices[0].y); for (j = 1; j < body.vertices.length; j++) { c.lineTo(body.vertices[j].x, body.vertices[j].y); } c.lineTo(body.vertices[0].x, body.vertices[0].y); } c.lineWidth = 1; c.strokeStyle = '#bbb'; c.stroke(); }; /** * Draws body bounds * @private * @method bodyBounds * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyBounds = function(engine, bodies, context) { var c = context, render = engine.render, options = render.options; c.beginPath(); for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (body.render.visible) c.rect(body.bounds.min.x, body.bounds.min.y, body.bounds.max.x - body.bounds.min.x, body.bounds.max.y - body.bounds.min.y); } if (options.wireframes) { c.strokeStyle = 'rgba(255,255,255,0.08)'; } else { c.strokeStyle = 'rgba(0,0,0,0.1)'; } c.lineWidth = 1; c.stroke(); }; /** * Draws body angle indicators and axes * @private * @method bodyAxes * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyAxes = function(engine, bodies, context) { var c = context, render = engine.render, options = render.options, i, j; c.beginPath(); for (i = 0; i < bodies.length; i++) { var body = bodies[i]; if (!body.render.visible) continue; if (options.showAxes) { // render all axes for (j = 0; j < body.axes.length; j++) { var axis = body.axes[j]; c.moveTo(body.position.x, body.position.y); c.lineTo(body.position.x + axis.x * 20, body.position.y + axis.y * 20); } } else { // render a single axis indicator c.moveTo(body.position.x, body.position.y); c.lineTo((body.vertices[0].x + body.vertices[body.vertices.length-1].x) / 2, (body.vertices[0].y + body.vertices[body.vertices.length-1].y) / 2); } } if (options.wireframes) { c.strokeStyle = 'indianred'; } else { c.strokeStyle = 'rgba(0,0,0,0.3)'; } c.lineWidth = 1; c.stroke(); }; /** * Draws body positions * @private * @method bodyPositions * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyPositions = function(engine, bodies, context) { var c = context, render = engine.render, options = render.options, body, i; c.beginPath(); // render current positions for (i = 0; i < bodies.length; i++) { body = bodies[i]; if (body.render.visible) { c.arc(body.position.x, body.position.y, 3, 0, 2 * Math.PI, false); c.closePath(); } } if (options.wireframes) { c.fillStyle = 'indianred'; } else { c.fillStyle = 'rgba(0,0,0,0.5)'; } c.fill(); c.beginPath(); // render previous positions for (i = 0; i < bodies.length; i++) { body = bodies[i]; if (body.render.visible) { c.arc(body.positionPrev.x, body.positionPrev.y, 2, 0, 2 * Math.PI, false); c.closePath(); } } c.fillStyle = 'rgba(255,165,0,0.8)'; c.fill(); }; /** * Draws body velocity * @private * @method bodyVelocity * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyVelocity = function(engine, bodies, context) { var c = context, render = engine.render, options = render.options; c.beginPath(); for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (!body.render.visible) continue; c.moveTo(body.position.x, body.position.y); c.lineTo(body.position.x + (body.position.x - body.positionPrev.x) * 2, body.position.y + (body.position.y - body.positionPrev.y) * 2); } c.lineWidth = 3; c.strokeStyle = 'cornflowerblue'; c.stroke(); }; /** * Draws body ids * @private * @method bodyIds * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyIds = function(engine, bodies, context) { var c = context; for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (!body.render.visible) continue; c.font = "12px Arial"; c.fillStyle = 'rgba(255,255,255,0.5)'; c.fillText(body.id, body.position.x + 10, body.position.y - 10); } }; /** * Description * @private * @method collisions * @param {engine} engine * @param {pair[]} pairs * @param {RenderingContext} context */ Render.collisions = function(engine, pairs, context) { var c = context, options = engine.render.options, pair, collision, i, j; c.beginPath(); // render collision positions for (i = 0; i < pairs.length; i++) { pair = pairs[i]; collision = pair.collision; for (j = 0; j < pair.activeContacts.length; j++) { var contact = pair.activeContacts[j], vertex = contact.vertex; c.rect(vertex.x - 1.5, vertex.y - 1.5, 3.5, 3.5); } } if (options.wireframes) { c.fillStyle = 'rgba(255,255,255,0.7)'; } else { c.fillStyle = 'orange'; } c.fill(); c.beginPath(); // render collision normals for (i = 0; i < pairs.length; i++) { pair = pairs[i]; collision = pair.collision; if (pair.activeContacts.length > 0) { var normalPosX = pair.activeContacts[0].vertex.x, normalPosY = pair.activeContacts[0].vertex.y; if (pair.activeContacts.length === 2) { normalPosX = (pair.activeContacts[0].vertex.x + pair.activeContacts[1].vertex.x) / 2; normalPosY = (pair.activeContacts[0].vertex.y + pair.activeContacts[1].vertex.y) / 2; } c.moveTo(normalPosX - collision.normal.x * 8, normalPosY - collision.normal.y * 8); c.lineTo(normalPosX, normalPosY); } } if (options.wireframes) { c.strokeStyle = 'rgba(255,165,0,0.7)'; } else { c.strokeStyle = 'orange'; } c.lineWidth = 1; c.stroke(); }; /** * Description * @private * @method grid * @param {engine} engine * @param {grid} grid * @param {RenderingContext} context */ Render.grid = function(engine, grid, context) { var c = context, options = engine.render.options; if (options.wireframes) { c.strokeStyle = 'rgba(255,180,0,0.1)'; } else { c.strokeStyle = 'rgba(255,180,0,0.5)'; } c.beginPath(); var bucketKeys = Common.keys(grid.buckets); for (var i = 0; i < bucketKeys.length; i++) { var bucketId = bucketKeys[i]; if (grid.buckets[bucketId].length < 2) continue; var region = bucketId.split(','); c.rect(0.5 + parseInt(region[0], 10) * grid.bucketWidth, 0.5 + parseInt(region[1], 10) * grid.bucketHeight, grid.bucketWidth, grid.bucketHeight); } c.lineWidth = 1; c.stroke(); }; /** * Description * @private * @method inspector * @param {inspector} inspector * @param {RenderingContext} context */ Render.inspector = function(inspector, context) { var engine = inspector.engine, selected = inspector.selected, c = context, render = engine.render, options = render.options, bounds; if (options.hasBounds) { var boundsWidth = render.bounds.max.x - render.bounds.min.x, boundsHeight = render.bounds.max.y - render.bounds.min.y, boundsScaleX = boundsWidth / render.options.width, boundsScaleY = boundsHeight / render.options.height; context.scale(1 / boundsScaleX, 1 / boundsScaleY); context.translate(-render.bounds.min.x, -render.bounds.min.y); } for (var i = 0; i < selected.length; i++) { var item = selected[i].data; context.translate(0.5, 0.5); context.lineWidth = 1; context.strokeStyle = 'rgba(255,165,0,0.9)'; context.setLineDash([1,2]); switch (item.type) { case 'body': // render body selections bounds = item.bounds; context.beginPath(); context.rect(Math.floor(bounds.min.x - 3), Math.floor(bounds.min.y - 3), Math.floor(bounds.max.x - bounds.min.x + 6), Math.floor(bounds.max.y - bounds.min.y + 6)); context.closePath(); context.stroke(); break; case 'constraint': // render constraint selections var point = item.pointA; if (item.bodyA) point = item.pointB; context.beginPath(); context.arc(point.x, point.y, 10, 0, 2 * Math.PI); context.closePath(); context.stroke(); break; } context.setLineDash([0]); context.translate(-0.5, -0.5); } // render selection region if (inspector.selectStart !== null) { context.translate(0.5, 0.5); context.lineWidth = 1; context.strokeStyle = 'rgba(255,165,0,0.6)'; context.fillStyle = 'rgba(255,165,0,0.1)'; bounds = inspector.selectBounds; context.beginPath(); context.rect(Math.floor(bounds.min.x), Math.floor(bounds.min.y), Math.floor(bounds.max.x - bounds.min.x), Math.floor(bounds.max.y - bounds.min.y)); context.closePath(); context.stroke(); context.fill(); context.translate(-0.5, -0.5); } if (options.hasBounds) context.setTransform(1, 0, 0, 1, 0, 0); }; /** * Description * @method _createCanvas * @private * @param {} width * @param {} height * @return canvas */ var _createCanvas = function(width, height) { var canvas = document.createElement('canvas'); canvas.width = width; canvas.height = height; canvas.oncontextmenu = function() { return false; }; canvas.onselectstart = function() { return false; }; return canvas; }; /** * Gets the requested texture (an Image) via its path * @method _getTexture * @private * @param {render} render * @param {string} imagePath * @return {Image} texture */ var _getTexture = function(render, imagePath) { var image = render.textures[imagePath]; if (image) return image; image = render.textures[imagePath] = new Image(); image.src = imagePath; return image; }; /* * * Properties Documentation * */ /** * A back-reference to the `Matter.Render` module. * * @property controller * @type render */ /** * A reference to the element where the canvas is to be inserted (if `render.canvas` has not been specified) * * @property element * @type HTMLElement * @default null */ /** * The canvas element to render to. If not specified, one will be created if `render.element` has been specified. * * @property canvas * @type HTMLCanvasElement * @default null */ /** * The configuration options of the renderer. * * @property options * @type {} */ /** * The target width in pixels of the `render.canvas` to be created. * * @property options.width * @type number * @default 800 */ /** * The target height in pixels of the `render.canvas` to be created. * * @property options.height * @type number * @default 600 */ /** * A flag that specifies if `render.bounds` should be used when rendering. * * @property options.hasBounds * @type boolean * @default false */ /** * A `Bounds` object that specifies the drawing view region. * Rendering will be automatically transformed and scaled to fit within the canvas size (`render.options.width` and `render.options.height`). * This allows for creating views that can pan or zoom around the scene. * You must also set `render.options.hasBounds` to `true` to enable bounded rendering. * * @property bounds * @type bounds */ /** * The 2d rendering context from the `render.canvas` element. * * @property context * @type CanvasRenderingContext2D */ /** * The sprite texture cache. * * @property textures * @type {} */ })(); ; // End src/render/Render.js // Begin src/render/RenderPixi.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class RenderPixi */ var RenderPixi = {}; (function() { /** * Creates a new Pixi.js WebGL renderer * @method create * @param {object} options * @return {RenderPixi} A new renderer */ RenderPixi.create = function(options) { var defaults = { controller: RenderPixi, element: null, canvas: null, options: { width: 800, height: 600, background: '#fafafa', wireframeBackground: '#222', hasBounds: false, enabled: true, wireframes: true, showSleeping: true, showDebug: false, showBroadphase: false, showBounds: false, showVelocity: false, showCollisions: false, showAxes: false, showPositions: false, showAngleIndicator: false, showIds: false, showShadows: false } }; var render = Common.extend(defaults, options), transparent = !render.options.wireframes && render.options.background === 'transparent'; // init pixi render.context = new PIXI.WebGLRenderer(render.options.width, render.options.height, render.canvas, transparent, true); render.canvas = render.context.view; render.container = new PIXI.DisplayObjectContainer(); render.stage = new PIXI.Stage(); render.stage.addChild(render.container); render.bounds = render.bounds || { min: { x: 0, y: 0 }, max: { x: render.options.width, y: render.options.height } }; // caches render.textures = {}; render.sprites = {}; render.primitives = {}; // use a sprite batch for performance render.spriteBatch = new PIXI.SpriteBatch(); render.container.addChild(render.spriteBatch); // insert canvas if (Common.isElement(render.element)) { render.element.appendChild(render.canvas); } else { Common.log('No "render.element" passed, "render.canvas" was not inserted into document.', 'warn'); } // prevent menus on canvas render.canvas.oncontextmenu = function() { return false; }; render.canvas.onselectstart = function() { return false; }; return render; }; /** * Clears the scene graph * @method clear * @param {RenderPixi} render */ RenderPixi.clear = function(render) { var container = render.container, spriteBatch = render.spriteBatch; // clear stage container while (container.children[0]) { container.removeChild(container.children[0]); } // clear sprite batch while (spriteBatch.children[0]) { spriteBatch.removeChild(spriteBatch.children[0]); } var bgSprite = render.sprites['bg-0']; // clear caches render.textures = {}; render.sprites = {}; render.primitives = {}; // set background sprite render.sprites['bg-0'] = bgSprite; if (bgSprite) spriteBatch.addChildAt(bgSprite, 0); // add sprite batch back into container render.container.addChild(render.spriteBatch); // reset background state render.currentBackground = null; // reset bounds transforms container.scale.set(1, 1); container.position.set(0, 0); }; /** * Sets the background of the canvas * @method setBackground * @param {RenderPixi} render * @param {string} background */ RenderPixi.setBackground = function(render, background) { if (render.currentBackground !== background) { var isColor = background.indexOf && background.indexOf('#') !== -1, bgSprite = render.sprites['bg-0']; if (isColor) { // if solid background color var color = Common.colorToNumber(background); render.stage.setBackgroundColor(color); // remove background sprite if existing if (bgSprite) render.spriteBatch.removeChild(bgSprite); } else { // initialise background sprite if needed if (!bgSprite) { var texture = _getTexture(render, background); bgSprite = render.sprites['bg-0'] = new PIXI.Sprite(texture); bgSprite.position.x = 0; bgSprite.position.y = 0; render.spriteBatch.addChildAt(bgSprite, 0); } } render.currentBackground = background; } }; /** * Description * @method world * @param {engine} engine */ RenderPixi.world = function(engine) { var render = engine.render, world = engine.world, context = render.context, stage = render.stage, container = render.container, options = render.options, bodies = Composite.allBodies(world), allConstraints = Composite.allConstraints(world), constraints = [], i; if (options.wireframes) { RenderPixi.setBackground(render, options.wireframeBackground); } else { RenderPixi.setBackground(render, options.background); } // handle bounds var boundsWidth = render.bounds.max.x - render.bounds.min.x, boundsHeight = render.bounds.max.y - render.bounds.min.y, boundsScaleX = boundsWidth / render.options.width, boundsScaleY = boundsHeight / render.options.height; if (options.hasBounds) { // Hide bodies that are not in view for (i = 0; i < bodies.length; i++) { var body = bodies[i]; body.render.sprite.visible = Bounds.overlaps(body.bounds, render.bounds); } // filter out constraints that are not in view for (i = 0; i < allConstraints.length; i++) { var constraint = allConstraints[i], bodyA = constraint.bodyA, bodyB = constraint.bodyB, pointAWorld = constraint.pointA, pointBWorld = constraint.pointB; if (bodyA) pointAWorld = Vector.add(bodyA.position, constraint.pointA); if (bodyB) pointBWorld = Vector.add(bodyB.position, constraint.pointB); if (!pointAWorld || !pointBWorld) continue; if (Bounds.contains(render.bounds, pointAWorld) || Bounds.contains(render.bounds, pointBWorld)) constraints.push(constraint); } // transform the view container.scale.set(1 / boundsScaleX, 1 / boundsScaleY); container.position.set(-render.bounds.min.x * (1 / boundsScaleX), -render.bounds.min.y * (1 / boundsScaleY)); } else { constraints = allConstraints; } for (i = 0; i < bodies.length; i++) RenderPixi.body(engine, bodies[i]); for (i = 0; i < constraints.length; i++) RenderPixi.constraint(engine, constraints[i]); context.render(stage); }; /** * Description * @method constraint * @param {engine} engine * @param {constraint} constraint */ RenderPixi.constraint = function(engine, constraint) { var render = engine.render, bodyA = constraint.bodyA, bodyB = constraint.bodyB, pointA = constraint.pointA, pointB = constraint.pointB, container = render.container, constraintRender = constraint.render, primitiveId = 'c-' + constraint.id, primitive = render.primitives[primitiveId]; // initialise constraint primitive if not existing if (!primitive) primitive = render.primitives[primitiveId] = new PIXI.Graphics(); // don't render if constraint does not have two end points if (!constraintRender.visible || !constraint.pointA || !constraint.pointB) { primitive.clear(); return; } // add to scene graph if not already there if (Common.indexOf(container.children, primitive) === -1) container.addChild(primitive); // render the constraint on every update, since they can change dynamically primitive.clear(); primitive.beginFill(0, 0); primitive.lineStyle(constraintRender.lineWidth, Common.colorToNumber(constraintRender.strokeStyle), 1); if (bodyA) { primitive.moveTo(bodyA.position.x + pointA.x, bodyA.position.y + pointA.y); } else { primitive.moveTo(pointA.x, pointA.y); } if (bodyB) { primitive.lineTo(bodyB.position.x + pointB.x, bodyB.position.y + pointB.y); } else { primitive.lineTo(pointB.x, pointB.y); } primitive.endFill(); }; /** * Description * @method body * @param {engine} engine * @param {body} body */ RenderPixi.body = function(engine, body) { var render = engine.render, bodyRender = body.render; if (!bodyRender.visible) return; if (bodyRender.sprite && bodyRender.sprite.texture) { var spriteId = 'b-' + body.id, sprite = render.sprites[spriteId], spriteBatch = render.spriteBatch; // initialise body sprite if not existing if (!sprite) sprite = render.sprites[spriteId] = _createBodySprite(render, body); // add to scene graph if not already there if (Common.indexOf(spriteBatch.children, sprite) === -1) spriteBatch.addChild(sprite); // update body sprite sprite.position.x = body.position.x; sprite.position.y = body.position.y; sprite.rotation = body.angle; } else { var primitiveId = 'b-' + body.id, primitive = render.primitives[primitiveId], container = render.container; // initialise body primitive if not existing if (!primitive) { primitive = render.primitives[primitiveId] = _createBodyPrimitive(render, body); primitive.initialAngle = body.angle; } // add to scene graph if not already there if (Common.indexOf(container.children, primitive) === -1) container.addChild(primitive); // update body primitive primitive.position.x = body.position.x; primitive.position.y = body.position.y; primitive.rotation = body.angle - primitive.initialAngle; } }; /** * Creates a body sprite * @method _createBodySprite * @private * @param {RenderPixi} render * @param {body} body * @return {PIXI.Sprite} sprite */ var _createBodySprite = function(render, body) { var bodyRender = body.render, texturePath = bodyRender.sprite.texture, texture = _getTexture(render, texturePath), sprite = new PIXI.Sprite(texture); sprite.anchor.x = 0.5; sprite.anchor.y = 0.5; return sprite; }; /** * Creates a body primitive * @method _createBodyPrimitive * @private * @param {RenderPixi} render * @param {body} body * @return {PIXI.Graphics} graphics */ var _createBodyPrimitive = function(render, body) { var bodyRender = body.render, options = render.options, primitive = new PIXI.Graphics(); primitive.clear(); if (!options.wireframes) { primitive.beginFill(Common.colorToNumber(bodyRender.fillStyle), 1); primitive.lineStyle(body.render.lineWidth, Common.colorToNumber(bodyRender.strokeStyle), 1); } else { primitive.beginFill(0, 0); primitive.lineStyle(1, Common.colorToNumber('#bbb'), 1); } primitive.moveTo(body.vertices[0].x - body.position.x, body.vertices[0].y - body.position.y); for (var j = 1; j < body.vertices.length; j++) { primitive.lineTo(body.vertices[j].x - body.position.x, body.vertices[j].y - body.position.y); } primitive.lineTo(body.vertices[0].x - body.position.x, body.vertices[0].y - body.position.y); primitive.endFill(); // angle indicator if (options.showAngleIndicator || options.showAxes) { primitive.beginFill(0, 0); if (options.wireframes) { primitive.lineStyle(1, Common.colorToNumber('#CD5C5C'), 1); } else { primitive.lineStyle(1, Common.colorToNumber(body.render.strokeStyle)); } primitive.moveTo(0, 0); primitive.lineTo(((body.vertices[0].x + body.vertices[body.vertices.length-1].x) / 2) - body.position.x, ((body.vertices[0].y + body.vertices[body.vertices.length-1].y) / 2) - body.position.y); primitive.endFill(); } return primitive; }; /** * Gets the requested texture (a PIXI.Texture) via its path * @method _getTexture * @private * @param {RenderPixi} render * @param {string} imagePath * @return {PIXI.Texture} texture */ var _getTexture = function(render, imagePath) { var texture = render.textures[imagePath]; if (!texture) texture = render.textures[imagePath] = PIXI.Texture.fromImage(imagePath); return texture; }; })(); ; // End src/render/RenderPixi.js // aliases World.add = Composite.add; World.remove = Composite.remove; World.addComposite = Composite.addComposite; World.addBody = Composite.addBody; World.addConstraint = Composite.addConstraint; World.clear = Composite.clear; Engine.run = Runner.run; // exports Matter.Body = Body; Matter.Composite = Composite; Matter.World = World; Matter.Contact = Contact; Matter.Detector = Detector; Matter.Grid = Grid; Matter.Pairs = Pairs; Matter.Pair = Pair; Matter.Resolver = Resolver; Matter.SAT = SAT; Matter.Constraint = Constraint; Matter.MouseConstraint = MouseConstraint; Matter.Common = Common; Matter.Engine = Engine; Matter.Metrics = Metrics; Matter.Mouse = Mouse; Matter.Sleeping = Sleeping; Matter.Bodies = Bodies; Matter.Composites = Composites; Matter.Axes = Axes; Matter.Bounds = Bounds; Matter.Vector = Vector; Matter.Vertices = Vertices; Matter.Render = Render; Matter.RenderPixi = RenderPixi; Matter.Events = Events; Matter.Query = Query; Matter.Runner = Runner; // CommonJS module if (typeof exports !== 'undefined') { if (typeof module !== 'undefined' && module.exports) { exports = module.exports = Matter; } exports.Matter = Matter; } // AMD module if (typeof define === 'function' && define.amd) { define('Matter', [], function () { return Matter; }); } // browser if (typeof window === 'object' && typeof window.document === 'object') { window.Matter = Matter; } // End Matter namespace closure })();