/** * matter.js 0.7.0-edge 2014-05-01 * http://brm.io/matter-js/ * License: MIT */ /** * The MIT License (MIT) * * Copyright (c) 2014 Liam Brummitt * * Permission is hereby granted, free of charge, to any person obtaining a copy * of this software and associated documentation files (the "Software"), to deal * in the Software without restriction, including without limitation the rights * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell * copies of the Software, and to permit persons to whom the Software is * furnished to do so, subject to the following conditions: * * The above copyright notice and this permission notice shall be included in * all copies or substantial portions of the Software. * * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN * THE SOFTWARE. */ (function() { var Matter = {}; // Begin Matter namespace closure // All Matter modules are included below during build // Outro.js then closes at the end of the file // Begin src/body/Body.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Body */ var Body = {}; (function() { var _nextGroupId = 1; /** * Description to be written. * @method create * @param {} options * @return {body} body */ Body.create = function(options) { var defaults = { id: Common.nextId(), type: 'body', label: 'Body', angle: 0, position: { x: 0, y: 0 }, force: { x: 0, y: 0 }, torque: 0, positionImpulse: { x: 0, y: 0 }, constraintImpulse: { x: 0, y: 0, angle: 0 }, speed: 0, angularSpeed: 0, velocity: { x: 0, y: 0 }, angularVelocity: 0, isStatic: false, isSleeping: false, motion: 0, sleepThreshold: 60, density: 0.001, restitution: 0, friction: 0.1, frictionAir: 0.01, groupId: 0, slop: 0.05, timeScale: 1, render: { visible: true, sprite: { xScale: 1, yScale: 1 }, path: 'L 0 0 L 40 0 L 40 40 L 0 40', lineWidth: 1.5 } }; var body = Common.extend(defaults, options); _initProperties(body); return body; }; /** * Description * @method nextGroupId * @return {Number} Unique groupID */ Body.nextGroupId = function() { return _nextGroupId++; }; /** * Initialises body properties * @method _initProperties * @private * @param {body} body */ var _initProperties = function(body) { // calculated properties body.vertices = body.vertices || Vertices.fromPath(body.render.path); body.axes = body.axes || Axes.fromVertices(body.vertices); body.area = Vertices.area(body.vertices); body.bounds = Bounds.create(body.vertices); body.mass = body.mass || (body.density * body.area); body.inverseMass = 1 / body.mass; body.inertia = body.inertia || Vertices.inertia(body.vertices, body.mass); body.inverseInertia = 1 / body.inertia; body.positionPrev = body.positionPrev || { x: body.position.x, y: body.position.y }; body.anglePrev = body.anglePrev || body.angle; body.render.fillStyle = body.render.fillStyle || (body.isStatic ? '#eeeeee' : Common.choose(['#556270', '#4ECDC4', '#C7F464', '#FF6B6B', '#C44D58'])); body.render.strokeStyle = body.render.strokeStyle || Common.shadeColor(body.render.fillStyle, -20); // update geometry Vertices.create(body.vertices, body); var centre = Vertices.centre(body.vertices); Vertices.translate(body.vertices, body.position); Vertices.translate(body.vertices, centre, -1); Vertices.rotate(body.vertices, body.angle, body.position); Axes.rotate(body.axes, body.angle); Bounds.update(body.bounds, body.vertices, body.velocity); Body.setStatic(body, body.isStatic); Sleeping.set(body, body.isSleeping); }; /** * Sets the body as static, including isStatic flag and setting mass and inertia to Infinity * @method setStatic * @param {bool} isStatic */ Body.setStatic = function(body, isStatic) { body.isStatic = isStatic; if (isStatic) { body.restitution = 0; body.friction = 1; body.mass = body.inertia = body.density = Infinity; body.inverseMass = body.inverseInertia = 0; body.render.lineWidth = 1; body.positionPrev.x = body.position.x; body.positionPrev.y = body.position.y; body.anglePrev = body.angle; body.angularVelocity = 0; body.speed = 0; body.angularSpeed = 0; body.motion = 0; } }; /** * Description * @method resetForcesAll * @param {body[]} bodies */ Body.resetForcesAll = function(bodies) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; // reset force buffers body.force.x = 0; body.force.y = 0; body.torque = 0; } }; /** * Description * @method applyGravityAll * @param {body[]} bodies * @param {vector} gravity */ Body.applyGravityAll = function(bodies, gravity) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (body.isStatic || body.isSleeping) continue; // apply gravity body.force.y += body.mass * gravity.y * 0.001; body.force.x += body.mass * gravity.x * 0.001; } }; /** * Description * @method updateAll * @param {body[]} bodies * @param {number} deltaTime * @param {number} correction * @param {bounds} worldBounds */ Body.updateAll = function(bodies, deltaTime, correction, worldBounds) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (body.isStatic || body.isSleeping) continue; // don't update out of world bodies // TODO: viewports if (body.bounds.max.x < worldBounds.min.x || body.bounds.min.x > worldBounds.max.x || body.bounds.max.y < worldBounds.min.y || body.bounds.min.y > worldBounds.max.y) continue; Body.update(body, deltaTime, correction); } }; /** * Description * @method update * @param {body} body * @param {number} deltaTime * @param {number} correction */ Body.update = function(body, deltaTime, correction) { var deltaTimeSquared = deltaTime * deltaTime * body.timeScale; // from the previous step var frictionAir = 1 - body.frictionAir, velocityPrevX = body.position.x - body.positionPrev.x, velocityPrevY = body.position.y - body.positionPrev.y; // update velocity with verlet integration body.velocity.x = (velocityPrevX * frictionAir * correction) + (body.force.x / body.mass) * deltaTimeSquared; body.velocity.y = (velocityPrevY * frictionAir * correction) + (body.force.y / body.mass) * deltaTimeSquared; body.positionPrev.x = body.position.x; body.positionPrev.y = body.position.y; body.position.x += body.velocity.x; body.position.y += body.velocity.y; // update angular velocity with verlet integration body.angularVelocity = ((body.angle - body.anglePrev) * frictionAir * correction) + (body.torque / body.inertia) * deltaTimeSquared; body.anglePrev = body.angle; body.angle += body.angularVelocity; // track speed and acceleration body.speed = Vector.magnitude(body.velocity); body.angularSpeed = Math.abs(body.angularVelocity); // transform the body geometry Vertices.translate(body.vertices, body.velocity); if (body.angularVelocity !== 0) { Vertices.rotate(body.vertices, body.angularVelocity, body.position); Axes.rotate(body.axes, body.angularVelocity); } Bounds.update(body.bounds, body.vertices, body.velocity); }; /** * Description * @method applyForce * @param {body} body * @param {vector} position * @param {vector} force */ Body.applyForce = function(body, position, force) { body.force.x += force.x; body.force.y += force.y; var offset = { x: position.x - body.position.x, y: position.y - body.position.y }; body.torque += (offset.x * force.y - offset.y * force.x) * body.inverseInertia; }; /** * Description * @method translate * @param {body} body * @param {vector} translation */ Body.translate = function(body, translation) { body.positionPrev.x += translation.x; body.positionPrev.y += translation.y; body.position.x += translation.x; body.position.y += translation.y; Vertices.translate(body.vertices, translation); Bounds.update(body.bounds, body.vertices, body.velocity); }; /** * Description * @method rotate * @param {body} body * @param {number} angle */ Body.rotate = function(body, angle) { body.anglePrev += angle; body.angle += angle; Vertices.rotate(body.vertices, angle, body.position); Axes.rotate(body.axes, angle); Bounds.update(body.bounds, body.vertices, body.velocity); }; /** * Scales the body, including updating physical properties (mass, area, axes, inertia), from a point (default is centre) * @method translate * @param {body} body * @param {number} scaleX * @param {number} scaleY * @param {vector} point */ Body.scale = function(body, scaleX, scaleY, point) { // scale vertices Vertices.scale(body.vertices, scaleX, scaleY, point); // update properties body.axes = Axes.fromVertices(body.vertices); body.area = Vertices.area(body.vertices); body.mass = body.density * body.area; body.inverseMass = 1 / body.mass; // update inertia (requires vertices to be at origin) Vertices.translate(body.vertices, { x: -body.position.x, y: -body.position.y }); body.inertia = Vertices.inertia(body.vertices, body.mass); body.inverseInertia = 1 / body.inertia; Vertices.translate(body.vertices, { x: body.position.x, y: body.position.y }); // update bounds Bounds.update(body.bounds, body.vertices, body.velocity); }; })(); ; // End src/body/Body.js // Begin src/body/Composite.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Composite */ // TODO: composite translate, rotate var Composite = {}; (function() { /** * Description * @method create * @param {} options * @return {composite} A new composite */ Composite.create = function(options) { return Common.extend({ id: Common.nextId(), type: 'composite', parent: null, isModified: false, bodies: [], constraints: [], composites: [], label: 'Composite' }, options); }; /** * Sets the composite's `isModified` flag. * If `updateParents` is true, all parents will be set (default: false). * If `updateChildren` is true, all children will be set (default: false). * @method setModified * @param {composite} composite * @param {boolean} isModified * @param {boolean} updateParents * @param {boolean} updateChildren */ Composite.setModified = function(composite, isModified, updateParents, updateChildren) { composite.isModified = isModified; if (updateParents && composite.parent) { Composite.setModified(composite.parent, isModified, updateParents, updateChildren); } if (updateChildren) { for(var i = 0; i < composite.composites.length; i++) { var childComposite = composite.composites[i]; Composite.setModified(childComposite, isModified, updateParents, updateChildren); } } }; /** * Generic add function. Adds one or many body(s), constraint(s) or a composite(s) to the given composite. * @method add * @param {composite} composite * @param {} object * @return {composite} The original composite with the objects added */ Composite.add = function(composite, object) { var objects = [].concat(object); for (var i = 0; i < objects.length; i++) { var obj = objects[i]; switch (obj.type) { case 'body': Composite.addBody(composite, obj); break; case 'constraint': Composite.addConstraint(composite, obj); break; case 'composite': Composite.addComposite(composite, obj); break; case 'mouseConstraint': Composite.addConstraint(composite, obj.constraint); break; } } return composite; }; /** * Generic remove function. Removes one or many body(s), constraint(s) or a composite(s) to the given composite. * Optionally searching its children recursively. * @method remove * @param {composite} composite * @param {} object * @param {boolean} deep * @return {composite} The original composite with the objects removed */ Composite.remove = function(composite, object, deep) { var objects = [].concat(object); for (var i = 0; i < objects.length; i++) { var obj = objects[i]; switch (obj.type) { case 'body': Composite.removeBody(composite, obj, deep); break; case 'constraint': Composite.removeConstraint(composite, obj, deep); break; case 'composite': Composite.removeComposite(composite, obj, deep); break; case 'mouseConstraint': Composite.removeConstraint(composite, obj.constraint); break; } } return composite; }; /** * Description * @method addComposite * @param {composite} compositeA * @param {composite} compositeB * @return {composite} The original compositeA with the objects from compositeB added */ Composite.addComposite = function(compositeA, compositeB) { compositeA.composites.push(compositeB); compositeB.parent = compositeA; Composite.setModified(compositeA, true, true, false); return compositeA; }; /** * Removes a composite from the given composite, and optionally searching its children recursively * @method removeComposite * @param {composite} compositeA * @param {composite} compositeB * @param {boolean} deep * @return {composite} The original compositeA with the composite removed */ Composite.removeComposite = function(compositeA, compositeB, deep) { var position = compositeA.composites.indexOf(compositeB); if (position !== -1) { Composite.removeCompositeAt(compositeA, position); Composite.setModified(compositeA, true, true, false); } if (deep) { for (var i = 0; i < compositeA.composites.length; i++){ Composite.removeComposite(compositeA.composites[i], compositeB, true); } } return compositeA; }; /** * Removes a composite from the given composite * @method removeCompositeAt * @param {composite} composite * @param {number} position * @return {composite} The original composite with the composite removed */ Composite.removeCompositeAt = function(composite, position) { composite.composites.splice(position, 1); Composite.setModified(composite, true, true, false); return composite; }; /** * Description * @method addBody * @param {composite} composite * @param {body} body * @return {composite} The original composite with the body added */ Composite.addBody = function(composite, body) { composite.bodies.push(body); Composite.setModified(composite, true, true, false); return composite; }; /** * Removes a body from the given composite, and optionally searching its children recursively * @method removeBody * @param {composite} composite * @param {body} body * @param {boolean} deep * @return {composite} The original composite with the body removed */ Composite.removeBody = function(composite, body, deep) { var position = composite.bodies.indexOf(body); if (position !== -1) { Composite.removeBodyAt(composite, position); Composite.setModified(composite, true, true, false); } if (deep) { for (var i = 0; i < composite.composites.length; i++){ Composite.removeBody(composite.composites[i], body, true); } } return composite; }; /** * Removes a body from the given composite * @method removeBodyAt * @param {composite} composite * @param {number} position * @return {composite} The original composite with the body removed */ Composite.removeBodyAt = function(composite, position) { composite.bodies.splice(position, 1); Composite.setModified(composite, true, true, false); return composite; }; /** * Description * @method addConstraint * @param {composite} composite * @param {constraint} constraint * @return {composite} The original composite with the constraint added */ Composite.addConstraint = function(composite, constraint) { composite.constraints.push(constraint); Composite.setModified(composite, true, true, false); return composite; }; /** * Removes a constraint from the given composite, and optionally searching its children recursively * @method removeConstraint * @param {composite} composite * @param {constraint} constraint * @param {boolean} deep * @return {composite} The original composite with the constraint removed */ Composite.removeConstraint = function(composite, constraint, deep) { var position = composite.constraints.indexOf(constraint); if (position !== -1) { Composite.removeConstraintAt(composite, position); } if (deep) { for (var i = 0; i < composite.composites.length; i++){ Composite.removeConstraint(composite.composites[i], constraint, true); } } return composite; }; /** * Removes a body from the given composite * @method removeConstraintAt * @param {composite} composite * @param {number} position * @return {composite} The original composite with the constraint removed */ Composite.removeConstraintAt = function(composite, position) { composite.constraints.splice(position, 1); Composite.setModified(composite, true, true, false); return composite; }; /** * Removes all bodies, constraints and composites from the given composite * Optionally clearing its children recursively * @method clear * @param {world} world * @param {boolean} keepStatic * @param {boolean} deep */ Composite.clear = function(composite, keepStatic, deep) { if (deep) { for (var i = 0; i < composite.composites.length; i++){ Composite.clear(composite.composites[i], keepStatic, true); } } if (keepStatic) { composite.bodies = composite.bodies.filter(function(body) { return body.isStatic; }); } else { composite.bodies.length = 0; } composite.constraints.length = 0; composite.composites.length = 0; Composite.setModified(composite, true, true, false); return composite; }; /** * Returns all bodies in the given composite, including all bodies in its children, recursively * @method allBodies * @param {composite} composite * @return {body[]} All the bodies */ Composite.allBodies = function(composite) { var bodies = [].concat(composite.bodies); for (var i = 0; i < composite.composites.length; i++) bodies = bodies.concat(Composite.allBodies(composite.composites[i])); return bodies; }; /** * Returns all constraints in the given composite, including all constraints in its children, recursively * @method allConstraints * @param {composite} composite * @return {constraint[]} All the constraints */ Composite.allConstraints = function(composite) { var constraints = [].concat(composite.constraints); for (var i = 0; i < composite.composites.length; i++) constraints = constraints.concat(Composite.allConstraints(composite.composites[i])); return constraints; }; /** * Returns all composites in the given composite, including all composites in its children, recursively * @method allComposites * @param {composite} composite * @return {composite[]} All the composites */ Composite.allComposites = function(composite) { var composites = [].concat(composite.composites); for (var i = 0; i < composite.composites.length; i++) composites = composites.concat(Composite.allComposites(composite.composites[i])); return composites; }; /** * Searches the composite recursively for an object matching the type and id supplied, null if not found * @method get * @param {composite} composite * @param {number} id * @param {string} type * @return {object} The requested object, if found */ Composite.get = function(composite, id, type) { var objects, object; switch (type) { case 'body': objects = Composite.allBodies(composite); break; case 'constraint': objects = Composite.allConstraints(composite); break; case 'composite': objects = Composite.allComposites(composite).concat(composite); break; } if (!objects) return null; object = objects.filter(function(object) { return object.id.toString() === id.toString(); }); return object.length === 0 ? null : object[0]; }; /** * Moves the given object(s) from compositeA to compositeB (equal to a remove followed by an add) * @method move * @param {compositeA} compositeA * @param {object[]} objects * @param {compositeB} compositeB * @return {composite} Returns compositeA */ Composite.move = function(compositeA, objects, compositeB) { Composite.remove(compositeA, objects); Composite.add(compositeB, objects); return compositeA; }; /** * Assigns new ids for all objects in the composite, recursively * @method rebase * @param {composite} composite * @return {composite} Returns composite */ Composite.rebase = function(composite) { var objects = Composite.allBodies(composite) .concat(Composite.allConstraints(composite)) .concat(Composite.allComposites(composite)); for (var i = 0; i < objects.length; i++) { objects[i].id = Common.nextId(); } Composite.setModified(composite, true, true, false); return composite; }; })(); ; // End src/body/Composite.js // Begin src/body/World.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class World */ var World = {}; (function() { /** * Description * @method create * @constructor * @param {} options * @return {world} A new world */ World.create = function(options) { var composite = Composite.create(); var defaults = { label: 'World', gravity: { x: 0, y: 1 }, bounds: { min: { x: 0, y: 0 }, max: { x: 800, y: 600 } } }; return Common.extend(composite, defaults, options); }; // World is a Composite body // see src/module/Outro.js for these aliases: /** * An alias for Composite.clear since World is also a Composite (see Outro.js) * @method clear * @param {world} world * @param {boolean} keepStatic */ /** * An alias for Composite.add since World is also a Composite (see Outro.js) * @method addComposite * @param {world} world * @param {composite} composite * @return {world} The original world with the objects from composite added */ /** * An alias for Composite.addBody since World is also a Composite (see Outro.js) * @method addBody * @param {world} world * @param {body} body * @return {world} The original world with the body added */ /** * An alias for Composite.addConstraint since World is also a Composite (see Outro.js) * @method addConstraint * @param {world} world * @param {constraint} constraint * @return {world} The original world with the constraint added */ })(); ; // End src/body/World.js // Begin src/collision/Contact.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Contact */ var Contact = {}; (function() { /** * Description * @method create * @param {vertex} vertex * @return {contact} A new contact */ Contact.create = function(vertex) { return { id: Contact.id(vertex), vertex: vertex, normalImpulse: 0, tangentImpulse: 0 }; }; /** * Description * @method id * @param {vertex} vertex * @return {Number} Unique contactID */ Contact.id = function(vertex) { return vertex.body.id + '_' + vertex.index; }; })(); ; // End src/collision/Contact.js // Begin src/collision/Detector.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Detector */ // TODO: speculative contacts var Detector = {}; (function() { /** * Description * @method collisions * @param {pair[]} broadphasePairs * @param {engine} engine * @return {array} collisions */ Detector.collisions = function(broadphasePairs, engine) { var collisions = [], metrics = engine.metrics, pairsTable = engine.pairs.table; for (var i = 0; i < broadphasePairs.length; i++) { var bodyA = broadphasePairs[i][0], bodyB = broadphasePairs[i][1]; // NOTE: could share a function for the below, but may drop performance? if (bodyA.groupId && bodyB.groupId && bodyA.groupId === bodyB.groupId) continue; if ((bodyA.isStatic || bodyA.isSleeping) && (bodyB.isStatic || bodyB.isSleeping)) continue; metrics.midphaseTests += 1; // mid phase if (Bounds.overlaps(bodyA.bounds, bodyB.bounds)) { // find a previous collision we could reuse var pairId = Pair.id(bodyA, bodyB), pair = pairsTable[pairId], previousCollision; if (pair && pair.isActive) { previousCollision = pair.collision; } else { previousCollision = null; } // narrow phase var collision = SAT.collides(bodyA, bodyB, previousCollision); metrics.narrowphaseTests += 1; if (collision.reused) metrics.narrowReuseCount += 1; if (collision.collided) { collisions.push(collision); metrics.narrowDetections += 1; } } } return collisions; }; /** * Description * @method bruteForce * @param {body[]} bodies * @param {engine} engine * @return {array} collisions */ Detector.bruteForce = function(bodies, engine) { var collisions = [], metrics = engine.metrics, pairsTable = engine.pairs.table; for (var i = 0; i < bodies.length; i++) { for (var j = i + 1; j < bodies.length; j++) { var bodyA = bodies[i], bodyB = bodies[j]; // NOTE: could share a function for the below, but may drop performance? if (bodyA.groupId && bodyB.groupId && bodyA.groupId === bodyB.groupId) continue; if ((bodyA.isStatic || bodyA.isSleeping) && (bodyB.isStatic || bodyB.isSleeping)) continue; metrics.midphaseTests += 1; // mid phase if (Bounds.overlaps(bodyA.bounds, bodyB.bounds)) { // find a previous collision we could reuse var pairId = Pair.id(bodyA, bodyB), pair = pairsTable[pairId], previousCollision; if (pair && pair.isActive) { previousCollision = pair.collision; } else { previousCollision = null; } // narrow phase var collision = SAT.collides(bodyA, bodyB, previousCollision); metrics.narrowphaseTests += 1; if (collision.reused) metrics.narrowReuseCount += 1; if (collision.collided) { collisions.push(collision); metrics.narrowDetections += 1; } } } } return collisions; }; })(); ; // End src/collision/Detector.js // Begin src/collision/Grid.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Grid */ var Grid = {}; (function() { /** * Description * @method create * @param {number} bucketWidth * @param {number} bucketHeight * @return {grid} A new grid */ Grid.create = function(bucketWidth, bucketHeight) { return { buckets: {}, pairs: {}, pairsList: [], bucketWidth: bucketWidth || 48, bucketHeight: bucketHeight || 48 }; }; /** * Description * @method update * @param {grid} grid * @param {body[]} bodies * @param {engine} engine * @param {boolean} forceUpdate */ Grid.update = function(grid, bodies, engine, forceUpdate) { var i, col, row, world = engine.world, buckets = grid.buckets, bucket, bucketId, metrics = engine.metrics, gridChanged = false; metrics.broadphaseTests = 0; for (i = 0; i < bodies.length; i++) { var body = bodies[i]; if (body.isSleeping && !forceUpdate) continue; // don't update out of world bodies if (body.bounds.max.x < 0 || body.bounds.min.x > world.bounds.width || body.bounds.max.y < 0 || body.bounds.min.y > world.bounds.height) continue; var newRegion = _getRegion(grid, body); // if the body has changed grid region if (!body.region || newRegion.id !== body.region.id || forceUpdate) { metrics.broadphaseTests += 1; if (!body.region || forceUpdate) body.region = newRegion; var union = _regionUnion(newRegion, body.region); // update grid buckets affected by region change // iterate over the union of both regions for (col = union.startCol; col <= union.endCol; col++) { for (row = union.startRow; row <= union.endRow; row++) { bucketId = _getBucketId(col, row); bucket = buckets[bucketId]; var isInsideNewRegion = (col >= newRegion.startCol && col <= newRegion.endCol && row >= newRegion.startRow && row <= newRegion.endRow); var isInsideOldRegion = (col >= body.region.startCol && col <= body.region.endCol && row >= body.region.startRow && row <= body.region.endRow); // remove from old region buckets if (!isInsideNewRegion && isInsideOldRegion) { if (isInsideOldRegion) { if (bucket) _bucketRemoveBody(grid, bucket, body); } } // add to new region buckets if (body.region === newRegion || (isInsideNewRegion && !isInsideOldRegion) || forceUpdate) { if (!bucket) bucket = _createBucket(buckets, bucketId); _bucketAddBody(grid, bucket, body); } } } // set the new region body.region = newRegion; // flag changes so we can update pairs gridChanged = true; } } // update pairs list only if pairs changed (i.e. a body changed region) if (gridChanged) grid.pairsList = _createActivePairsList(grid); }; /** * Description * @method clear * @param {grid} grid */ Grid.clear = function(grid) { grid.buckets = {}; grid.pairs = {}; grid.pairsList = []; }; /** * Description * @method _regionUnion * @private * @param {} regionA * @param {} regionB * @return CallExpression */ var _regionUnion = function(regionA, regionB) { var startCol = Math.min(regionA.startCol, regionB.startCol), endCol = Math.max(regionA.endCol, regionB.endCol), startRow = Math.min(regionA.startRow, regionB.startRow), endRow = Math.max(regionA.endRow, regionB.endRow); return _createRegion(startCol, endCol, startRow, endRow); }; /** * Description * @method _getRegion * @private * @param {} grid * @param {} body * @return CallExpression */ var _getRegion = function(grid, body) { var bounds = body.bounds, startCol = Math.floor(bounds.min.x / grid.bucketWidth), endCol = Math.floor(bounds.max.x / grid.bucketWidth), startRow = Math.floor(bounds.min.y / grid.bucketHeight), endRow = Math.floor(bounds.max.y / grid.bucketHeight); return _createRegion(startCol, endCol, startRow, endRow); }; /** * Description * @method _createRegion * @private * @param {} startCol * @param {} endCol * @param {} startRow * @param {} endRow * @return ObjectExpression */ var _createRegion = function(startCol, endCol, startRow, endRow) { return { id: startCol + ',' + endCol + ',' + startRow + ',' + endRow, startCol: startCol, endCol: endCol, startRow: startRow, endRow: endRow }; }; /** * Description * @method _getBucketId * @private * @param {} column * @param {} row * @return BinaryExpression */ var _getBucketId = function(column, row) { return column + ',' + row; }; /** * Description * @method _createBucket * @private * @param {} buckets * @param {} bucketId * @return bucket */ var _createBucket = function(buckets, bucketId) { var bucket = buckets[bucketId] = []; return bucket; }; /** * Description * @method _bucketAddBody * @private * @param {} grid * @param {} bucket * @param {} body */ var _bucketAddBody = function(grid, bucket, body) { // add new pairs for (var i = 0; i < bucket.length; i++) { var bodyB = bucket[i]; if (body.id === bodyB.id || (body.isStatic && bodyB.isStatic)) continue; // keep track of the number of buckets the pair exists in // important for Grid.update to work var pairId = Pair.id(body, bodyB), pair = grid.pairs[pairId]; if (pair) { pair[2] += 1; } else { grid.pairs[pairId] = [body, bodyB, 1]; } } // add to bodies (after pairs, otherwise pairs with self) bucket.push(body); }; /** * Description * @method _bucketRemoveBody * @private * @param {} grid * @param {} bucket * @param {} body */ var _bucketRemoveBody = function(grid, bucket, body) { // remove from bucket bucket.splice(bucket.indexOf(body), 1); // update pair counts for (var i = 0; i < bucket.length; i++) { // keep track of the number of buckets the pair exists in // important for _createActivePairsList to work var bodyB = bucket[i], pairId = Pair.id(body, bodyB), pair = grid.pairs[pairId]; if (pair) pair[2] -= 1; } }; /** * Description * @method _createActivePairsList * @private * @param {} grid * @return pairs */ var _createActivePairsList = function(grid) { var pairKeys, pair, pairs = []; // grid.pairs is used as a hashmap pairKeys = Common.keys(grid.pairs); // iterate over grid.pairs for (var k = 0; k < pairKeys.length; k++) { pair = grid.pairs[pairKeys[k]]; // if pair exists in at least one bucket // it is a pair that needs further collision testing so push it if (pair[2] > 0) { pairs.push(pair); } else { delete grid.pairs[pairKeys[k]]; } } return pairs; }; })(); ; // End src/collision/Grid.js // Begin src/collision/Pair.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Pair */ var Pair = {}; (function() { /** * Description * @method create * @param {collision} collision * @return {pair} A new pair */ Pair.create = function(collision, timestamp) { var bodyA = collision.bodyA, bodyB = collision.bodyB; var pair = { id: Pair.id(bodyA, bodyB), bodyA: bodyA, bodyB: bodyB, contacts: {}, activeContacts: [], separation: 0, isActive: true, timeCreated: timestamp, timeUpdated: timestamp, inverseMass: bodyA.inverseMass + bodyB.inverseMass, friction: Math.min(bodyA.friction, bodyB.friction), restitution: Math.max(bodyA.restitution, bodyB.restitution), slop: Math.max(bodyA.slop, bodyB.slop) }; Pair.update(pair, collision, timestamp); return pair; }; /** * Description * @method update * @param {pair} pair * @param {collision} collision */ Pair.update = function(pair, collision, timestamp) { var contacts = pair.contacts, supports = collision.supports, activeContacts = pair.activeContacts; pair.collision = collision; activeContacts.length = 0; if (collision.collided) { for (var i = 0; i < supports.length; i++) { var support = supports[i], contactId = Contact.id(support), contact = contacts[contactId]; if (contact) { activeContacts.push(contact); } else { activeContacts.push(contacts[contactId] = Contact.create(support)); } } pair.separation = collision.depth; Pair.setActive(pair, true, timestamp); } else { if (pair.isActive === true) Pair.setActive(pair, false, timestamp); } }; /** * Description * @method setActive * @param {pair} pair * @param {bool} isActive */ Pair.setActive = function(pair, isActive, timestamp) { if (isActive) { pair.isActive = true; pair.timeUpdated = timestamp; } else { pair.isActive = false; pair.activeContacts.length = 0; } }; /** * Description * @method id * @param {body} bodyA * @param {body} bodyB * @return {number} Unique pairId */ Pair.id = function(bodyA, bodyB) { if (bodyA.id < bodyB.id) { return bodyA.id + '_' + bodyB.id; } else { return bodyB.id + '_' + bodyA.id; } }; })(); ; // End src/collision/Pair.js // Begin src/collision/Pairs.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Pairs */ var Pairs = {}; (function() { var _pairMaxIdleLife = 1000; /** * Creates a new pairs structure * @method create * @param {object} options * @return {pairs} A new pairs structure */ Pairs.create = function(options) { return Common.extend({ table: {}, list: [], collisionStart: [], collisionActive: [], collisionEnd: [] }, options); }; /** * Description * @method update * @param {object} pairs * @param {collision[]} collisions */ Pairs.update = function(pairs, collisions, timestamp) { var pairsList = pairs.list, pairsTable = pairs.table, collisionStart = pairs.collisionStart, collisionEnd = pairs.collisionEnd, collisionActive = pairs.collisionActive, activePairIds = [], collision, pairId, pair, i; // clear collision state arrays, but maintain old reference collisionStart.length = 0; collisionEnd.length = 0; collisionActive.length = 0; for (i = 0; i < collisions.length; i++) { collision = collisions[i]; if (collision.collided) { pairId = Pair.id(collision.bodyA, collision.bodyB); activePairIds.push(pairId); pair = pairsTable[pairId]; if (pair) { // pair already exists (but may or may not be active) if (pair.isActive) { // pair exists and is active collisionActive.push(pair); } else { // pair exists but was inactive, so a collision has just started again collisionStart.push(pair); } // update the pair Pair.update(pair, collision, timestamp); } else { // pair did not exist, create a new pair pair = Pair.create(collision, timestamp); pairsTable[pairId] = pair; // push the new pair collisionStart.push(pair); pairsList.push(pair); } } } // deactivate previously active pairs that are now inactive for (i = 0; i < pairsList.length; i++) { pair = pairsList[i]; if (pair.isActive && activePairIds.indexOf(pair.id) === -1) { Pair.setActive(pair, false, timestamp); collisionEnd.push(pair); } } }; /** * Description * @method removeOld * @param {object} pairs */ Pairs.removeOld = function(pairs, timestamp) { var pairsList = pairs.list, pairsTable = pairs.table, indexesToRemove = [], pair, collision, pairIndex, i; for (i = 0; i < pairsList.length; i++) { pair = pairsList[i]; collision = pair.collision; // never remove sleeping pairs if (collision.bodyA.isSleeping || collision.bodyB.isSleeping) { pair.timeUpdated = timestamp; continue; } // if pair is inactive for too long, mark it to be removed if (timestamp - pair.timeUpdated > _pairMaxIdleLife) { indexesToRemove.push(i); } } // remove marked pairs for (i = 0; i < indexesToRemove.length; i++) { pairIndex = indexesToRemove[i] - i; pair = pairsList[pairIndex]; delete pairsTable[pair.id]; pairsList.splice(pairIndex, 1); } }; /** * Clears the given pairs structure * @method create * @param {object} options * @param {pairs} pairs */ Pairs.clear = function(pairs) { pairs.table = {}; pairs.list.length = 0; pairs.collisionStart.length = 0; pairs.collisionActive.length = 0; pairs.collisionEnd.length = 0; return pairs; }; })(); ; // End src/collision/Pairs.js // Begin src/collision/Query.js /** * Functions for performing collision queries * * @class Query */ var Query = {}; (function() { /** * Casts a ray segment against a set of bodies and returns all collisions, ray width is optional. Intersection points are not provided. * @method ray * @param {body[]} bodies * @param {vector} startPoint * @param {vector} endPoint * @return {object[]} Collisions */ Query.ray = function(bodies, startPoint, endPoint, rayWidth) { rayWidth = rayWidth || Number.MIN_VALUE; var rayAngle = Vector.angle(startPoint, endPoint), rayLength = Vector.magnitude(Vector.sub(startPoint, endPoint)), rayX = (endPoint.x + startPoint.x) * 0.5, rayY = (endPoint.y + startPoint.y) * 0.5, ray = Bodies.rectangle(rayX, rayY, rayLength, rayWidth, { angle: rayAngle }), collisions = []; for (var i = 0; i < bodies.length; i++) { var bodyA = bodies[i]; if (Bounds.overlaps(bodyA.bounds, ray.bounds)) { var collision = SAT.collides(bodyA, ray); if (collision.collided) { collision.body = collision.bodyA = collision.bodyB = bodyA; collisions.push(collision); } } } return collisions; }; /** * Returns all bodies whose bounds are inside (or outside if set) the given set of bounds, from the given set of bodies * @method region * @param {body[]} bodies * @param {bounds} bounds * @param {bool} outside * @return {body[]} The bodies matching the query */ Query.region = function(bodies, bounds, outside) { var result = []; for (var i = 0; i < bodies.length; i++) { var body = bodies[i], overlaps = Bounds.overlaps(body.bounds, bounds); if ((overlaps && !outside) || (!overlaps && outside)) result.push(body); } return result; }; })(); ; // End src/collision/Query.js // Begin src/collision/Resolver.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Resolver */ var Resolver = {}; (function() { var _restingThresh = 4, _positionDampen = 0.2, _positionWarming = 0.6; /** * Description * @method solvePosition * @param {pair[]} pairs * @param {number} timeScale */ Resolver.solvePosition = function(pairs, timeScale) { var i, pair, collision, bodyA, bodyB, vertex, vertexCorrected, normal, bodyBtoA; // find impulses required to resolve penetration for (i = 0; i < pairs.length; i++) { pair = pairs[i]; if (!pair.isActive) continue; collision = pair.collision; bodyA = collision.bodyA; bodyB = collision.bodyB; vertex = collision.supports[0]; vertexCorrected = collision.supportCorrected; normal = collision.normal; // get current separation between body edges involved in collision bodyBtoA = Vector.sub(Vector.add(bodyB.positionImpulse, vertex), Vector.add(bodyA.positionImpulse, vertexCorrected)); pair.separation = Vector.dot(normal, bodyBtoA); } for (i = 0; i < pairs.length; i++) { pair = pairs[i]; if (!pair.isActive) continue; collision = pair.collision; bodyA = collision.bodyA; bodyB = collision.bodyB; normal = collision.normal; positionImpulse = ((pair.separation * _positionDampen) - pair.slop) * timeScale; if (bodyA.isStatic || bodyB.isStatic) positionImpulse *= 2; if (!(bodyA.isStatic || bodyA.isSleeping)) { bodyA.positionImpulse.x += normal.x * positionImpulse; bodyA.positionImpulse.y += normal.y * positionImpulse; } if (!(bodyB.isStatic || bodyB.isSleeping)) { bodyB.positionImpulse.x -= normal.x * positionImpulse; bodyB.positionImpulse.y -= normal.y * positionImpulse; } } }; /** * Description * @method postSolvePosition * @param {body[]} bodies */ Resolver.postSolvePosition = function(bodies) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (body.positionImpulse.x !== 0 || body.positionImpulse.y !== 0) { // move the body without changing velocity body.position.x += body.positionImpulse.x; body.position.y += body.positionImpulse.y; body.positionPrev.x += body.positionImpulse.x; body.positionPrev.y += body.positionImpulse.y; // update body geometry Vertices.translate(body.vertices, body.positionImpulse); Bounds.update(body.bounds, body.vertices, body.velocity); // dampen accumulator to warm the next step body.positionImpulse.x *= _positionWarming; body.positionImpulse.y *= _positionWarming; } } }; /** * Description * @method preSolveVelocity * @param {pair[]} pairs */ Resolver.preSolveVelocity = function(pairs) { var impulse = {}, i, j, pair, contacts, collision, bodyA, bodyB, normal, tangent, contact, contactVertex, normalImpulse, tangentImpulse, offset; for (i = 0; i < pairs.length; i++) { pair = pairs[i]; if (!pair.isActive) continue; contacts = pair.activeContacts; collision = pair.collision; bodyA = collision.bodyA; bodyB = collision.bodyB; normal = collision.normal; tangent = collision.tangent; // resolve each contact for (j = 0; j < contacts.length; j++) { contact = contacts[j]; contactVertex = contact.vertex; normalImpulse = contact.normalImpulse; tangentImpulse = contact.tangentImpulse; // total impulse from contact impulse.x = (normal.x * normalImpulse) + (tangent.x * tangentImpulse); impulse.y = (normal.y * normalImpulse) + (tangent.y * tangentImpulse); // apply impulse from contact if (!(bodyA.isStatic || bodyA.isSleeping)) { offset = Vector.sub(contactVertex, bodyA.position); bodyA.positionPrev.x += impulse.x * bodyA.inverseMass; bodyA.positionPrev.y += impulse.y * bodyA.inverseMass; bodyA.anglePrev += Vector.cross(offset, impulse) * bodyA.inverseInertia; } if (!(bodyB.isStatic || bodyB.isSleeping)) { offset = Vector.sub(contactVertex, bodyB.position); bodyB.positionPrev.x -= impulse.x * bodyB.inverseMass; bodyB.positionPrev.y -= impulse.y * bodyB.inverseMass; bodyB.anglePrev -= Vector.cross(offset, impulse) * bodyB.inverseInertia; } } } }; /** * Description * @method solveVelocity * @param {pair[]} pairs */ Resolver.solveVelocity = function(pairs) { var impulse = {}; for (var i = 0; i < pairs.length; i++) { var pair = pairs[i]; if (!pair.isActive) continue; var collision = pair.collision, bodyA = collision.bodyA, bodyB = collision.bodyB, normal = collision.normal, tangent = collision.tangent, contacts = pair.activeContacts, contactShare = 1 / contacts.length; // update body velocities bodyA.velocity.x = bodyA.position.x - bodyA.positionPrev.x; bodyA.velocity.y = bodyA.position.y - bodyA.positionPrev.y; bodyB.velocity.x = bodyB.position.x - bodyB.positionPrev.x; bodyB.velocity.y = bodyB.position.y - bodyB.positionPrev.y; bodyA.angularVelocity = bodyA.angle - bodyA.anglePrev; bodyB.angularVelocity = bodyB.angle - bodyB.anglePrev; // resolve each contact for (var j = 0; j < contacts.length; j++) { var contact = contacts[j], contactVertex = contact.vertex, offsetA = Vector.sub(contactVertex, bodyA.position), offsetB = Vector.sub(contactVertex, bodyB.position), velocityPointA = Vector.add(bodyA.velocity, Vector.mult(Vector.perp(offsetA), bodyA.angularVelocity)), velocityPointB = Vector.add(bodyB.velocity, Vector.mult(Vector.perp(offsetB), bodyB.angularVelocity)), relativeVelocity = Vector.sub(velocityPointA, velocityPointB), normalVelocity = Vector.dot(normal, relativeVelocity); var tangentVelocity = Vector.dot(tangent, relativeVelocity), tangentSpeed = Math.abs(tangentVelocity), tangentVelocityDirection = Common.sign(tangentVelocity); // raw impulses var normalImpulse = (1 + pair.restitution) * normalVelocity, normalForce = Common.clamp(pair.separation + normalVelocity, 0, 1); // coulomb friction var tangentImpulse = tangentVelocity; if (tangentSpeed > normalForce * pair.friction) tangentImpulse = normalForce * pair.friction * tangentVelocityDirection; // modify impulses accounting for mass, inertia and offset var oAcN = Vector.cross(offsetA, normal), oBcN = Vector.cross(offsetB, normal), share = contactShare / (pair.inverseMass + bodyA.inverseInertia * oAcN * oAcN + bodyB.inverseInertia * oBcN * oBcN); normalImpulse *= share; tangentImpulse *= share; // handle high velocity and resting collisions separately if (normalVelocity < 0 && normalVelocity * normalVelocity > _restingThresh) { // high velocity so clear cached contact impulse contact.normalImpulse = 0; contact.tangentImpulse = 0; } else { // solve resting collision constraints using Erin Catto's method (GDC08) // impulse constraint, tends to 0 var contactNormalImpulse = contact.normalImpulse; contact.normalImpulse = Math.min(contact.normalImpulse + normalImpulse, 0); normalImpulse = contact.normalImpulse - contactNormalImpulse; // tangent impulse, tends to -maxFriction or maxFriction var contactTangentImpulse = contact.tangentImpulse; contact.tangentImpulse = Common.clamp(contact.tangentImpulse + tangentImpulse, -tangentSpeed, tangentSpeed); tangentImpulse = contact.tangentImpulse - contactTangentImpulse; } // total impulse from contact impulse.x = (normal.x * normalImpulse) + (tangent.x * tangentImpulse); impulse.y = (normal.y * normalImpulse) + (tangent.y * tangentImpulse); // apply impulse from contact if (!(bodyA.isStatic || bodyA.isSleeping)) { bodyA.positionPrev.x += impulse.x * bodyA.inverseMass; bodyA.positionPrev.y += impulse.y * bodyA.inverseMass; bodyA.anglePrev += Vector.cross(offsetA, impulse) * bodyA.inverseInertia; } if (!(bodyB.isStatic || bodyB.isSleeping)) { bodyB.positionPrev.x -= impulse.x * bodyB.inverseMass; bodyB.positionPrev.y -= impulse.y * bodyB.inverseMass; bodyB.anglePrev -= Vector.cross(offsetB, impulse) * bodyB.inverseInertia; } } } }; })(); ; // End src/collision/Resolver.js // Begin src/collision/SAT.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class SAT */ // TODO: true circles and curves var SAT = {}; (function() { /** * Description * @method collides * @param {body} bodyA * @param {body} bodyB * @param {collision} previousCollision * @return {collision} collision */ SAT.collides = function(bodyA, bodyB, previousCollision) { var overlapAB, overlapBA, minOverlap, collision, prevCol = previousCollision, canReusePrevCol = false; if (prevCol) { // estimate total motion var motion = bodyA.speed * bodyA.speed + bodyA.angularSpeed * bodyA.angularSpeed + bodyB.speed * bodyB.speed + bodyB.angularSpeed * bodyB.angularSpeed; // we may be able to (partially) reuse collision result // but only safe if collision was resting canReusePrevCol = prevCol && prevCol.collided && motion < 0.2; // reuse collision object collision = prevCol; } else { collision = { collided: false, bodyA: bodyA, bodyB: bodyB }; } if (prevCol && canReusePrevCol) { // if we can reuse the collision result // we only need to test the previously found axis var axes = [prevCol.bodyA.axes[prevCol.axisNumber]]; minOverlap = _overlapAxes(prevCol.bodyA.vertices, prevCol.bodyB.vertices, axes); collision.reused = true; if (minOverlap.overlap <= 0) { collision.collided = false; return collision; } } else { // if we can't reuse a result, perform a full SAT test overlapAB = _overlapAxes(bodyA.vertices, bodyB.vertices, bodyA.axes); if (overlapAB.overlap <= 0) { collision.collided = false; return collision; } overlapBA = _overlapAxes(bodyB.vertices, bodyA.vertices, bodyB.axes); if (overlapBA.overlap <= 0) { collision.collided = false; return collision; } if (overlapAB.overlap < overlapBA.overlap) { minOverlap = overlapAB; collision.bodyA = bodyA; collision.bodyB = bodyB; } else { minOverlap = overlapBA; collision.bodyA = bodyB; collision.bodyB = bodyA; } // important for reuse later collision.axisNumber = minOverlap.axisNumber; } collision.collided = true; collision.normal = minOverlap.axis; collision.depth = minOverlap.overlap; bodyA = collision.bodyA; bodyB = collision.bodyB; // ensure normal is facing away from bodyA if (Vector.dot(collision.normal, Vector.sub(bodyB.position, bodyA.position)) > 0) collision.normal = Vector.neg(collision.normal); collision.tangent = Vector.perp(collision.normal); collision.penetration = { x: collision.normal.x * collision.depth, y: collision.normal.y * collision.depth }; // find support points, there is always either exactly one or two var verticesB = _findSupports(bodyA, bodyB, collision.normal), supports = [verticesB[0]]; if (Vertices.contains(bodyA.vertices, verticesB[1])) { supports.push(verticesB[1]); } else { var verticesA = _findSupports(bodyB, bodyA, Vector.neg(collision.normal)); if (Vertices.contains(bodyB.vertices, verticesA[0])) { supports.push(verticesA[0]); } if (supports.length < 2 && Vertices.contains(bodyB.vertices, verticesA[1])) { supports.push(verticesA[1]); } } collision.supports = supports; collision.supportCorrected = Vector.sub(verticesB[0], collision.penetration); return collision; }; /** * Description * @method _overlapAxes * @private * @param {} verticesA * @param {} verticesB * @param {} axes * @return result */ var _overlapAxes = function(verticesA, verticesB, axes) { var projectionA = {}, projectionB = {}, result = { overlap: Number.MAX_VALUE }, overlap, axis; for (var i = 0; i < axes.length; i++) { axis = axes[i]; _projectToAxis(projectionA, verticesA, axis); _projectToAxis(projectionB, verticesB, axis); overlap = projectionA.min < projectionB.min ? projectionA.max - projectionB.min : projectionB.max - projectionA.min; if (overlap <= 0) { result.overlap = overlap; return result; } if (overlap < result.overlap) { result.overlap = overlap; result.axis = axis; result.axisNumber = i; } } return result; }; /** * Description * @method _projectToAxis * @private * @param {} projection * @param {} vertices * @param {} axis */ var _projectToAxis = function(projection, vertices, axis) { var min = Vector.dot(vertices[0], axis), max = min; for (var i = 1; i < vertices.length; i += 1) { var dot = Vector.dot(vertices[i], axis); if (dot > max) { max = dot; } else if (dot < min) { min = dot; } } projection.min = min; projection.max = max; }; /** * Description * @method _findSupports * @private * @param {} bodyA * @param {} bodyB * @param {} normal * @return ArrayExpression */ var _findSupports = function(bodyA, bodyB, normal) { var nearestDistance = Number.MAX_VALUE, vertexToBody = { x: 0, y: 0 }, vertices = bodyB.vertices, bodyAPosition = bodyA.position, distance, vertex, vertexA = vertices[0], vertexB = vertices[1]; // find closest vertex on bodyB for (var i = 0; i < vertices.length; i++) { vertex = vertices[i]; vertexToBody.x = vertex.x - bodyAPosition.x; vertexToBody.y = vertex.y - bodyAPosition.y; distance = -Vector.dot(normal, vertexToBody); if (distance < nearestDistance) { nearestDistance = distance; vertexA = vertex; } } // find next closest vertex using the two connected to it var prevIndex = vertexA.index - 1 >= 0 ? vertexA.index - 1 : vertices.length - 1; vertex = vertices[prevIndex]; vertexToBody.x = vertex.x - bodyAPosition.x; vertexToBody.y = vertex.y - bodyAPosition.y; nearestDistance = -Vector.dot(normal, vertexToBody); vertexB = vertex; var nextIndex = (vertexA.index + 1) % vertices.length; vertex = vertices[nextIndex]; vertexToBody.x = vertex.x - bodyAPosition.x; vertexToBody.y = vertex.y - bodyAPosition.y; distance = -Vector.dot(normal, vertexToBody); if (distance < nearestDistance) { nearestDistance = distance; vertexB = vertex; } return [vertexA, vertexB]; }; })(); ; // End src/collision/SAT.js // Begin src/constraint/Constraint.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Constraint */ // TODO: fix instabillity issues with torque // TODO: linked constraints // TODO: breakable constraints // TODO: collidable constraints // TODO: allow constrained bodies to sleep // TODO: handle 0 length constraints properly // TODO: impulse caching and warming var Constraint = {}; (function() { var _minLength = 0.000001, _minDifference = 0.001; /** * Description * @method create * @param {} options * @return {constraint} constraint */ Constraint.create = function(options) { var constraint = options; // if bodies defined but no points, use body centre if (constraint.bodyA && !constraint.pointA) constraint.pointA = { x: 0, y: 0 }; if (constraint.bodyB && !constraint.pointB) constraint.pointB = { x: 0, y: 0 }; // calculate static length using initial world space points var initialPointA = constraint.bodyA ? Vector.add(constraint.bodyA.position, constraint.pointA) : constraint.pointA, initialPointB = constraint.bodyB ? Vector.add(constraint.bodyB.position, constraint.pointB) : constraint.pointB, length = Vector.magnitude(Vector.sub(initialPointA, initialPointB)); constraint.length = constraint.length || length || _minLength; // render var render = { visible: true, lineWidth: 2, strokeStyle: '#666' }; constraint.render = Common.extend(render, constraint.render); // option defaults constraint.id = constraint.id || Common.nextId(); constraint.label = constraint.label || 'Constraint'; constraint.type = 'constraint'; constraint.stiffness = constraint.stiffness || 1; constraint.angularStiffness = constraint.angularStiffness || 0; constraint.angleA = constraint.bodyA ? constraint.bodyA.angle : constraint.angleA; constraint.angleB = constraint.bodyB ? constraint.bodyB.angle : constraint.angleB; return constraint; }; /** * Description * @method solveAll * @param {constraint[]} constraints * @param {number} timeScale */ Constraint.solveAll = function(constraints, timeScale) { for (var i = 0; i < constraints.length; i++) { Constraint.solve(constraints[i], timeScale); } }; /** * Description * @method solve * @param {constraint} constraint * @param {number} timeScale */ Constraint.solve = function(constraint, timeScale) { var bodyA = constraint.bodyA, bodyB = constraint.bodyB, pointA = constraint.pointA, pointB = constraint.pointB; // update reference angle if (bodyA && !bodyA.isStatic) { constraint.pointA = Vector.rotate(pointA, bodyA.angle - constraint.angleA); constraint.angleA = bodyA.angle; } // update reference angle if (bodyB && !bodyB.isStatic) { constraint.pointB = Vector.rotate(pointB, bodyB.angle - constraint.angleB); constraint.angleB = bodyB.angle; } var pointAWorld = pointA, pointBWorld = pointB; if (bodyA) pointAWorld = Vector.add(bodyA.position, pointA); if (bodyB) pointBWorld = Vector.add(bodyB.position, pointB); if (!pointAWorld || !pointBWorld) return; var delta = Vector.sub(pointAWorld, pointBWorld), currentLength = Vector.magnitude(delta); // prevent singularity if (currentLength === 0) currentLength = _minLength; // solve distance constraint with Gauss-Siedel method var difference = (currentLength - constraint.length) / currentLength, normal = Vector.div(delta, currentLength), force = Vector.mult(delta, difference * 0.5 * constraint.stiffness * timeScale * timeScale); // if difference is very small, we can skip if (Math.abs(1 - (currentLength / constraint.length)) < _minDifference * timeScale) return; var velocityPointA, velocityPointB, offsetA, offsetB, oAn, oBn, bodyADenom, bodyBDenom; if (bodyA && !bodyA.isStatic) { // point body offset offsetA = { x: pointAWorld.x - bodyA.position.x + force.x, y: pointAWorld.y - bodyA.position.y + force.y }; // update velocity bodyA.velocity.x = bodyA.position.x - bodyA.positionPrev.x; bodyA.velocity.y = bodyA.position.y - bodyA.positionPrev.y; bodyA.angularVelocity = bodyA.angle - bodyA.anglePrev; // find point velocity and body mass velocityPointA = Vector.add(bodyA.velocity, Vector.mult(Vector.perp(offsetA), bodyA.angularVelocity)); oAn = Vector.dot(offsetA, normal); bodyADenom = bodyA.inverseMass + bodyA.inverseInertia * oAn * oAn; } else { velocityPointA = { x: 0, y: 0 }; bodyADenom = bodyA ? bodyA.inverseMass : 0; } if (bodyB && !bodyB.isStatic) { // point body offset offsetB = { x: pointBWorld.x - bodyB.position.x - force.x, y: pointBWorld.y - bodyB.position.y - force.y }; // update velocity bodyB.velocity.x = bodyB.position.x - bodyB.positionPrev.x; bodyB.velocity.y = bodyB.position.y - bodyB.positionPrev.y; bodyB.angularVelocity = bodyB.angle - bodyB.anglePrev; // find point velocity and body mass velocityPointB = Vector.add(bodyB.velocity, Vector.mult(Vector.perp(offsetB), bodyB.angularVelocity)); oBn = Vector.dot(offsetB, normal); bodyBDenom = bodyB.inverseMass + bodyB.inverseInertia * oBn * oBn; } else { velocityPointB = { x: 0, y: 0 }; bodyBDenom = bodyB ? bodyB.inverseMass : 0; } var relativeVelocity = Vector.sub(velocityPointB, velocityPointA), normalImpulse = Vector.dot(normal, relativeVelocity) / (bodyADenom + bodyBDenom); if (normalImpulse > 0) normalImpulse = 0; var normalVelocity = { x: normal.x * normalImpulse, y: normal.y * normalImpulse }; var torque; if (bodyA && !bodyA.isStatic) { torque = Vector.cross(offsetA, normalVelocity) * bodyA.inverseInertia * (1 - constraint.angularStiffness); Sleeping.set(bodyA, false); // clamp to prevent instabillity // TODO: solve this properlly torque = Common.clamp(torque, -0.01, 0.01); // keep track of applied impulses for post solving bodyA.constraintImpulse.x -= force.x; bodyA.constraintImpulse.y -= force.y; bodyA.constraintImpulse.angle += torque; // apply forces bodyA.position.x -= force.x; bodyA.position.y -= force.y; bodyA.angle += torque; } if (bodyB && !bodyB.isStatic) { torque = Vector.cross(offsetB, normalVelocity) * bodyB.inverseInertia * (1 - constraint.angularStiffness); Sleeping.set(bodyB, false); // clamp to prevent instabillity // TODO: solve this properlly torque = Common.clamp(torque, -0.01, 0.01); // keep track of applied impulses for post solving bodyB.constraintImpulse.x += force.x; bodyB.constraintImpulse.y += force.y; bodyB.constraintImpulse.angle -= torque; // apply forces bodyB.position.x += force.x; bodyB.position.y += force.y; bodyB.angle -= torque; } }; /** * Performs body updates required after solving constraints * @method postSolveAll * @param {body[]} bodies */ Constraint.postSolveAll = function(bodies) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i], impulse = body.constraintImpulse; // update geometry and reset Vertices.translate(body.vertices, impulse); if (impulse.angle !== 0) { Vertices.rotate(body.vertices, impulse.angle, body.position); Axes.rotate(body.axes, impulse.angle); impulse.angle = 0; } Bounds.update(body.bounds, body.vertices); impulse.x = 0; impulse.y = 0; } }; })(); ; // End src/constraint/Constraint.js // Begin src/constraint/MouseConstraint.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class MouseConstraint */ var MouseConstraint = {}; (function() { /** * Description * @method create * @param {engine} engine * @param {} options * @return {MouseConstraint} A new MouseConstraint */ MouseConstraint.create = function(engine, options) { var mouse = engine.input.mouse; var constraint = Constraint.create({ label: 'Mouse Constraint', pointA: mouse.position, pointB: { x: 0, y: 0 }, length: 0.01, stiffness: 0.1, angularStiffness: 1, render: { strokeStyle: '#90EE90', lineWidth: 3 } }); var defaults = { type: 'mouseConstraint', mouse: mouse, dragBody: null, dragPoint: null, constraint: constraint }; var mouseConstraint = Common.extend(defaults, options); Events.on(engine, 'tick', function(event) { var allBodies = Composite.allBodies(engine.world); MouseConstraint.update(mouseConstraint, allBodies); }); return mouseConstraint; }; /** * Description * @method update * @param {MouseConstraint} mouseConstraint * @param {body[]} bodies */ MouseConstraint.update = function(mouseConstraint, bodies) { var mouse = mouseConstraint.mouse, constraint = mouseConstraint.constraint; if (mouse.button === 0) { if (!constraint.bodyB) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (Bounds.contains(body.bounds, mouse.position) && Vertices.contains(body.vertices, mouse.position)) { constraint.pointA = mouse.position; constraint.bodyB = body; constraint.pointB = { x: mouse.position.x - body.position.x, y: mouse.position.y - body.position.y }; constraint.angleB = body.angle; Sleeping.set(body, false); } } } } else { constraint.bodyB = null; constraint.pointB = null; } if (constraint.bodyB) { Sleeping.set(constraint.bodyB, false); constraint.pointA = mouse.position; } }; })(); ; // End src/constraint/MouseConstraint.js // Begin src/core/Common.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Common */ var Common = {}; (function() { Common._nextId = 0; /** * Description * @method extend * @param {} obj * @param {boolean} deep * @return {} obj extended */ Common.extend = function(obj, deep) { var argsStart, args, deepClone; if (typeof deep === 'boolean') { argsStart = 2; deepClone = deep; } else { argsStart = 1; deepClone = true; } args = Array.prototype.slice.call(arguments, argsStart); for (var i = 0; i < args.length; i++) { var source = args[i]; if (source) { for (var prop in source) { if (deepClone && source[prop] && source[prop].constructor === Object) { if (!obj[prop] || obj[prop].constructor === Object) { obj[prop] = obj[prop] || {}; Common.extend(obj[prop], deepClone, source[prop]); } else { obj[prop] = source[prop]; } } else { obj[prop] = source[prop]; } } } } return obj; }; /** * Creates a new clone of the object, if deep is true references will also be cloned * @method clone * @param {} obj * @param {bool} deep * @return {} obj cloned */ Common.clone = function(obj, deep) { return Common.extend({}, deep, obj); }; /** * Description * @method keys * @param {} obj * @return {string[]} keys */ Common.keys = function(obj) { if (Object.keys) return Object.keys(obj); // avoid hasOwnProperty for performance var keys = []; for (var key in obj) keys.push(key); return keys; }; /** * Description * @method values * @param {} obj * @return {array} Array of the objects property values */ Common.values = function(obj) { var values = []; if (Object.keys) { var keys = Object.keys(obj); for (var i = 0; i < keys.length; i++) { values.push(obj[keys[i]]); } return values; } // avoid hasOwnProperty for performance for (var key in obj) values.push(obj[key]); return values; }; /** * Description * @method shadeColor * @param {string} color * @param {number} percent * @return {string} A hex colour string made by lightening or darkening color by percent */ Common.shadeColor = function(color, percent) { // http://stackoverflow.com/questions/5560248/programmatically-lighten-or-darken-a-hex-color var colorInteger = parseInt(color.slice(1),16), amount = Math.round(2.55 * percent), R = (colorInteger >> 16) + amount, B = (colorInteger >> 8 & 0x00FF) + amount, G = (colorInteger & 0x0000FF) + amount; return "#" + (0x1000000 + (R < 255 ? R < 1 ? 0 : R :255) * 0x10000 + (B < 255 ? B < 1 ? 0 : B : 255) * 0x100 + (G < 255 ? G < 1 ? 0 : G : 255)).toString(16).slice(1); }; /** * Description * @method shuffle * @param {array} array * @return {array} array shuffled randomly */ Common.shuffle = function(array) { for (var i = array.length - 1; i > 0; i--) { var j = Math.floor(Math.random() * (i + 1)); var temp = array[i]; array[i] = array[j]; array[j] = temp; } return array; }; /** * Description * @method choose * @param {array} choices * @return {object} A random choice object from the array */ Common.choose = function(choices) { return choices[Math.floor(Math.random() * choices.length)]; }; /** * Description * @method isElement * @param {object} obj * @return {boolean} True if the object is a HTMLElement, otherwise false */ Common.isElement = function(obj) { // http://stackoverflow.com/questions/384286/javascript-isdom-how-do-you-check-if-a-javascript-object-is-a-dom-object try { return obj instanceof HTMLElement; } catch(e){ return (typeof obj==="object") && (obj.nodeType===1) && (typeof obj.style === "object") && (typeof obj.ownerDocument ==="object"); } }; /** * Description * @method clamp * @param {number} value * @param {number} min * @param {number} max * @return {number} The value clamped between min and max inclusive */ Common.clamp = function(value, min, max) { if (value < min) return min; if (value > max) return max; return value; }; /** * Description * @method sign * @param {number} value * @return {number} -1 if negative, +1 if 0 or positive */ Common.sign = function(value) { return value < 0 ? -1 : 1; }; /** * Description * @method now * @return {number} the current timestamp (high-res if avaliable) */ Common.now = function() { // http://stackoverflow.com/questions/221294/how-do-you-get-a-timestamp-in-javascript // https://gist.github.com/davidwaterston/2982531 var perf = window.performance; if (perf) { perf.now = perf.now || perf.webkitNow || perf.msNow || perf.oNow || perf.mozNow; return +(perf.now()); } return +(new Date()); }; /** * Description * @method random * @param {number} min * @param {number} max * @return {number} A random number between min and max inclusive */ Common.random = function(min, max) { return min + Math.random() * (max - min); }; /** * Converts a CSS hex colour string into an integer * @method colorToNumber * @param {string} colorString * @return {number} An integer representing the CSS hex string */ Common.colorToNumber = function(colorString) { colorString = colorString.replace('#',''); if (colorString.length == 3) { colorString = colorString.charAt(0) + colorString.charAt(0) + colorString.charAt(1) + colorString.charAt(1) + colorString.charAt(2) + colorString.charAt(2); } return parseInt(colorString, 16); }; /** * A wrapper for console.log, for providing errors and warnings * @method log * @param {string} message * @param {string} type */ Common.log = function(message, type) { if (!console || !console.log) return; var style; switch (type) { case 'warn': style = 'color: coral'; break; case 'error': style = 'color: red'; break; } console.log('%c [Matter] ' + type + ': ' + message, style); }; /** * Returns the next unique sequential ID * @method nextId * @return {Number} Unique sequential ID */ Common.nextId = function() { return Common._nextId++; }; })(); ; // End src/core/Common.js // Begin src/core/Engine.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Engine */ // TODO: viewports var Engine = {}; (function() { var _fps = 60, _deltaSampleSize = _fps, _delta = 1000 / _fps; var _requestAnimationFrame = window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || window.msRequestAnimationFrame || function(callback){ window.setTimeout(function() { callback(Common.now()); }, _delta); }; /** * Description * @method create * @param {HTMLElement} element * @param {object} options * @return {engine} engine */ Engine.create = function(element, options) { // options may be passed as the first (and only) argument options = Common.isElement(element) ? options : element; element = Common.isElement(element) ? element : null; var defaults = { enabled: true, positionIterations: 6, velocityIterations: 4, constraintIterations: 2, enableSleeping: false, timeScale: 1, input: {}, events: [], timing: { fps: _fps, timestamp: 0, delta: _delta, correction: 1, deltaMin: 1000 / _fps, deltaMax: 1000 / (_fps * 0.5), timeScale: 1 }, render: { element: element, controller: Render } }; var engine = Common.extend(defaults, options); engine.render = engine.render.controller.create(engine.render); engine.world = World.create(engine.world); engine.pairs = Pairs.create(); engine.metrics = engine.metrics || Metrics.create(); engine.input.mouse = engine.input.mouse || Mouse.create(engine.render.canvas); engine.broadphase = engine.broadphase || { current: 'grid', grid: { controller: Grid, instance: Grid.create(), detector: Detector.collisions }, bruteForce: { detector: Detector.bruteForce } }; return engine; }; /** * Description * @method run * @param {engine} engine */ Engine.run = function(engine) { var timing = engine.timing, delta, correction, counterTimestamp = 0, frameCounter = 0, deltaHistory = [], timeScalePrev = 1; (function render(timestamp){ _requestAnimationFrame(render); if (!engine.enabled) return; // timestamp is undefined on the first update timestamp = timestamp || 0; // create an event object var event = { timestamp: timestamp }; Events.trigger(engine, 'beforeTick', event); delta = (timestamp - timing.timestamp) || _delta; // optimistically filter delta over a few frames, to improve stability deltaHistory.push(delta); deltaHistory = deltaHistory.slice(-_deltaSampleSize); delta = Math.min.apply(null, deltaHistory); // limit delta delta = delta < timing.deltaMin ? timing.deltaMin : delta; delta = delta > timing.deltaMax ? timing.deltaMax : delta; // time correction for delta correction = delta / timing.delta; // time correction for time scaling if (timeScalePrev !== 0) correction *= timing.timeScale / timeScalePrev; if (timing.timeScale === 0) correction = 0; timeScalePrev = timing.timeScale; // update engine timing object timing.timestamp = timestamp; timing.correction = correction; timing.delta = delta; // fps counter frameCounter += 1; if (timestamp - counterTimestamp >= 1000) { timing.fps = frameCounter * ((timestamp - counterTimestamp) / 1000); counterTimestamp = timestamp; frameCounter = 0; } Events.trigger(engine, 'tick beforeUpdate', event); // if world has been modified, clear the render scene graph if (engine.world.isModified) engine.render.controller.clear(engine.render); // update Engine.update(engine, delta, correction); // trigger events that may have occured during the step _triggerCollisionEvents(engine); _triggerMouseEvents(engine); Events.trigger(engine, 'afterUpdate beforeRender', event); // render if (engine.render.options.enabled) engine.render.controller.world(engine); Events.trigger(engine, 'afterTick afterRender', event); })(); }; /** * Description * @method update * @param {engine} engine * @param {number} delta * @param {number} correction * @return engine */ Engine.update = function(engine, delta, correction) { var world = engine.world, timing = engine.timing, broadphase = engine.broadphase[engine.broadphase.current], broadphasePairs = [], i; // get lists of all bodies and constraints, no matter what composites they are in var allBodies = Composite.allBodies(world), allConstraints = Composite.allConstraints(world); // reset metrics logging Metrics.reset(engine.metrics); // if sleeping enabled, call the sleeping controller if (engine.enableSleeping) Sleeping.update(allBodies); // applies gravity to all bodies Body.applyGravityAll(allBodies, world.gravity); // update all body position and rotation by integration Body.updateAll(allBodies, delta * timing.timeScale, correction, world.bounds); // update all constraints for (i = 0; i < engine.constraintIterations; i++) { Constraint.solveAll(allConstraints, timing.timeScale); } Constraint.postSolveAll(allBodies); // broadphase pass: find potential collision pairs if (broadphase.controller) { // if world is dirty, we must flush the whole grid if (world.isModified) broadphase.controller.clear(broadphase.instance); // update the grid buckets based on current bodies broadphase.controller.update(broadphase.instance, allBodies, engine, world.isModified); broadphasePairs = broadphase.instance.pairsList; } else { // if no broadphase set, we just pass all bodies broadphasePairs = allBodies; } // narrowphase pass: find actual collisions, then create or update collision pairs var collisions = broadphase.detector(broadphasePairs, engine); // update collision pairs var pairs = engine.pairs, timestamp = timing.timestamp; Pairs.update(pairs, collisions, timestamp); Pairs.removeOld(pairs, timestamp); // wake up bodies involved in collisions if (engine.enableSleeping) Sleeping.afterCollisions(pairs.list); // iteratively resolve velocity between collisions Resolver.preSolveVelocity(pairs.list); for (i = 0; i < engine.velocityIterations; i++) { Resolver.solveVelocity(pairs.list); } // iteratively resolve position between collisions for (i = 0; i < engine.positionIterations; i++) { Resolver.solvePosition(pairs.list, timing.timeScale); } Resolver.postSolvePosition(allBodies); // update metrics log Metrics.update(engine.metrics, engine); // clear force buffers Body.resetForcesAll(allBodies); // clear all composite modified flags if (world.isModified) Composite.setModified(world, false, false, true); return engine; }; /** * Description * @method merge * @param {engine} engineA * @param {engine} engineB */ Engine.merge = function(engineA, engineB) { Common.extend(engineA, engineB); if (engineB.world) { engineA.world = engineB.world; Engine.clear(engineA); var bodies = Composite.allBodies(engineA.world); for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; Sleeping.set(body, false); body.id = Common.nextId(); } } }; /** * Description * @method clear * @param {engine} engine */ Engine.clear = function(engine) { var world = engine.world; Pairs.clear(engine.pairs); var broadphase = engine.broadphase[engine.broadphase.current]; if (broadphase.controller) { var bodies = Composite.allBodies(world); broadphase.controller.clear(broadphase.instance); broadphase.controller.update(broadphase.instance, bodies, engine, true); } }; /** * Triggers mouse events * @method _triggerMouseEvents * @private * @param {engine} engine */ var _triggerMouseEvents = function(engine) { var mouse = engine.input.mouse, mouseEvents = mouse.sourceEvents; if (mouseEvents.mousemove) { Events.trigger(engine, 'mousemove', { mouse: mouse }); } if (mouseEvents.mousedown) { Events.trigger(engine, 'mousedown', { mouse: mouse }); } if (mouseEvents.mouseup) { Events.trigger(engine, 'mouseup', { mouse: mouse }); } // reset the mouse state ready for the next step Mouse.clearSourceEvents(mouse); }; /** * Triggers collision events * @method _triggerMouseEvents * @private * @param {engine} engine */ var _triggerCollisionEvents = function(engine) { var pairs = engine.pairs; if (pairs.collisionStart.length > 0) { Events.trigger(engine, 'collisionStart', { pairs: pairs.collisionStart }); } if (pairs.collisionActive.length > 0) { Events.trigger(engine, 'collisionActive', { pairs: pairs.collisionActive }); } if (pairs.collisionEnd.length > 0) { Events.trigger(engine, 'collisionEnd', { pairs: pairs.collisionEnd }); } }; /* * * Events Documentation * */ /** * Fired at the start of a tick, before any updates to the engine or timing * * @event beforeTick * @param {} event An event object * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine timing updated, but just before engine state updated * * @event tick * @param {} event An event object * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired just before an update * * @event beforeUpdate * @param {} event An event object * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine update and all collision events * * @event afterUpdate * @param {} event An event object * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired just before rendering * * @event beforeRender * @param {} event An event object * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after rendering * * @event afterRender * @param {} event An event object * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine update and after rendering * * @event afterTick * @param {} event An event object * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when the mouse has moved (or a touch moves) during the last step * * @event mousemove * @param {} event An event object * @param {mouse} event.mouse The engine's mouse instance * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when the mouse is down (or a touch has started) during the last step * * @event mousedown * @param {} event An event object * @param {mouse} event.mouse The engine's mouse instance * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when the mouse is up (or a touch has ended) during the last step * * @event mouseup * @param {} event An event object * @param {mouse} event.mouse The engine's mouse instance * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine update, provides a list of all pairs that have started to collide in the current tick (if any) * * @event collisionStart * @param {} event An event object * @param {} event.pairs List of affected pairs * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine update, provides a list of all pairs that are colliding in the current tick (if any) * * @event collisionActive * @param {} event An event object * @param {} event.pairs List of affected pairs * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine update, provides a list of all pairs that have ended collision in the current tick (if any) * * @event collisionEnd * @param {} event An event object * @param {} event.pairs List of affected pairs * @param {DOMHighResTimeStamp} event.timestamp The timestamp of the current tick * @param {} event.source The source object of the event * @param {} event.name The name of the event */ })(); ; // End src/core/Engine.js // Begin src/core/Events.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Events */ var Events = {}; (function() { /** * Subscribes a callback function to the given object's eventName * @method on * @param {} object * @param {string} eventNames * @param {function} callback */ Events.on = function(object, eventNames, callback) { var names = eventNames.split(' '), name; for (var i = 0; i < names.length; i++) { name = names[i]; object.events = object.events || {}; object.events[name] = object.events[name] || []; object.events[name].push(callback); } return callback; }; /** * Removes the given event callback. If no callback, clears all callbacks in eventNames. If no eventNames, clears all events. * @method off * @param {} object * @param {string} eventNames * @param {function} callback */ Events.off = function(object, eventNames, callback) { if (!eventNames) { object.events = {}; return; } // handle Events.off(object, callback) if (typeof eventNames === 'function') { callback = eventNames; eventNames = Common.keys(object.events).join(' '); } var names = eventNames.split(' '); for (var i = 0; i < names.length; i++) { var callbacks = object.events[names[i]], newCallbacks = []; if (callback) { for (var j = 0; j < callbacks.length; j++) { if (callbacks[j] !== callback) newCallbacks.push(callbacks[j]); } } object.events[names[i]] = newCallbacks; } }; /** * Fires all the callbacks subscribed to the given object's eventName, in the order they subscribed, if any * @method trigger * @param {} object * @param {string} eventNames * @param {} event */ Events.trigger = function(object, eventNames, event) { var names, name, callbacks, eventClone; if (object.events) { if (!event) event = {}; names = eventNames.split(' '); for (var i = 0; i < names.length; i++) { name = names[i]; callbacks = object.events[name]; if (callbacks) { eventClone = Common.clone(event, false); eventClone.name = name; eventClone.source = object; for (var j = 0; j < callbacks.length; j++) { callbacks[j].apply(object, [eventClone]); } } } } }; })(); ; // End src/core/Events.js // Begin src/core/Metrics.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Metrics */ var Metrics = {}; (function() { /** * Description * @method create * @return {metrics} A new metrics */ Metrics.create = function() { return { extended: false, narrowDetections: 0, narrowphaseTests: 0, narrowReuse: 0, narrowReuseCount: 0, midphaseTests: 0, broadphaseTests: 0, narrowEff: 0.0001, midEff: 0.0001, broadEff: 0.0001, collisions: 0, buckets: 0, bodies: 0, pairs: 0 }; }; /** * Description * @method reset * @param {metrics} metrics */ Metrics.reset = function(metrics) { if (metrics.extended) { metrics.narrowDetections = 0; metrics.narrowphaseTests = 0; metrics.narrowReuse = 0; metrics.narrowReuseCount = 0; metrics.midphaseTests = 0; metrics.broadphaseTests = 0; metrics.narrowEff = 0; metrics.midEff = 0; metrics.broadEff = 0; metrics.collisions = 0; metrics.buckets = 0; metrics.pairs = 0; metrics.bodies = 0; } }; /** * Description * @method update * @param {metrics} metrics * @param {engine} engine */ Metrics.update = function(metrics, engine) { if (metrics.extended) { var world = engine.world, broadphase = engine.broadphase[engine.broadphase.current], bodies = Composite.allBodies(world); metrics.collisions = metrics.narrowDetections; metrics.pairs = engine.pairs.list.length; metrics.bodies = bodies.length; metrics.midEff = (metrics.narrowDetections / (metrics.midphaseTests || 1)).toFixed(2); metrics.narrowEff = (metrics.narrowDetections / (metrics.narrowphaseTests || 1)).toFixed(2); metrics.broadEff = (1 - (metrics.broadphaseTests / (bodies.length || 1))).toFixed(2); metrics.narrowReuse = (metrics.narrowReuseCount / (metrics.narrowphaseTests || 1)).toFixed(2); //if (broadphase.instance) // metrics.buckets = Common.keys(broadphase.instance.buckets).length; } }; })(); ; // End src/core/Metrics.js // Begin src/core/Mouse.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Mouse */ var Mouse; (function() { /** * Description * @param {HTMLElement} element */ Mouse = function(element) { var mouse = this; this.element = element || document.body; this.position = { x: 0, y: 0 }; this.mousedownPosition = { x: 0, y: 0 }; this.mouseupPosition = { x: 0, y: 0 }; this.offset = { x: 0, y: 0 }; this.button = -1; this.sourceEvents = { mousemove: null, mousedown: null, mouseup: null }; this.mousemove = function(event) { var position = _getRelativeMousePosition(event, mouse.element), touches = event.changedTouches; if (touches) { mouse.button = 0; event.preventDefault(); } mouse.position.x = position.x + mouse.offset.x; mouse.position.y = position.y + mouse.offset.y; mouse.sourceEvents.mousemove = event; }; this.mousedown = function(event) { var position = _getRelativeMousePosition(event, mouse.element), touches = event.changedTouches; if (touches) { mouse.button = 0; event.preventDefault(); } else { mouse.button = event.button; } mouse.position.x = position.x + mouse.offset.x; mouse.position.y = position.y + mouse.offset.y; mouse.mousedownPosition.x = position.x + mouse.offset.x; mouse.mousedownPosition.y = position.y + mouse.offset.y; mouse.sourceEvents.mousedown = event; }; this.mouseup = function(event) { var position = _getRelativeMousePosition(event, mouse.element), touches = event.changedTouches; if (touches) { event.preventDefault(); } mouse.button = -1; mouse.position.x = position.x + mouse.offset.x; mouse.position.y = position.y + mouse.offset.y; mouse.mouseupPosition.x = position.x + mouse.offset.x; mouse.mouseupPosition.y = position.y + mouse.offset.y; mouse.sourceEvents.mouseup = event; }; Mouse.setElement(mouse, mouse.element); }; /** * Description * @method create * @param {HTMLElement} element * @return {mouse} A new mouse */ Mouse.create = function(element) { return new Mouse(element); }; /** * Sets the element the mouse is bound to (and relative to) * @method setElement * @param {mouse} mouse * @param {HTMLElement} element */ Mouse.setElement = function(mouse, element) { mouse.element = element; element.addEventListener('mousemove', mouse.mousemove); element.addEventListener('mousedown', mouse.mousedown); element.addEventListener('mouseup', mouse.mouseup); element.addEventListener('touchmove', mouse.mousemove); element.addEventListener('touchstart', mouse.mousedown); element.addEventListener('touchend', mouse.mouseup); }; /** * Clears all captured source events * @method clearSourceEvents * @param {mouse} mouse */ Mouse.clearSourceEvents = function(mouse) { mouse.sourceEvents.mousemove = null; mouse.sourceEvents.mousedown = null; mouse.sourceEvents.mouseup = null; }; /** * Description * @method _getRelativeMousePosition * @private * @param {} event * @param {} element * @return ObjectExpression */ var _getRelativeMousePosition = function(event, element) { var elementBounds = element.getBoundingClientRect(), scrollX = (window.pageXOffset !== undefined) ? window.pageXOffset : (document.documentElement || document.body.parentNode || document.body).scrollLeft, scrollY = (window.pageYOffset !== undefined) ? window.pageYOffset : (document.documentElement || document.body.parentNode || document.body).scrollTop, touches = event.changedTouches, x, y; if (touches) { x = touches[0].pageX - elementBounds.left - scrollX; y = touches[0].pageY - elementBounds.top - scrollY; } else { x = event.pageX - elementBounds.left - scrollX; y = event.pageY - elementBounds.top - scrollY; } return { x: x / (element.clientWidth / element.width), y: y / (element.clientHeight / element.height) }; }; })(); ; // End src/core/Mouse.js // Begin src/core/Sleeping.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Sleeping */ var Sleeping = {}; (function() { var _motionWakeThreshold = 0.18, _motionSleepThreshold = 0.08, _minBias = 0.9; /** * Description * @method update * @param {body[]} bodies */ Sleeping.update = function(bodies) { // update bodies sleeping status for (var i = 0; i < bodies.length; i++) { var body = bodies[i], motion = body.speed * body.speed + body.angularSpeed * body.angularSpeed; // wake up bodies if they have a force applied if (body.force.x > 0 || body.force.y > 0) { Sleeping.set(body, false); continue; } var minMotion = Math.min(body.motion, motion), maxMotion = Math.max(body.motion, motion); // biased average motion estimation between frames body.motion = _minBias * minMotion + (1 - _minBias) * maxMotion; if (body.sleepThreshold > 0 && body.motion < _motionSleepThreshold) { body.sleepCounter += 1; if (body.sleepCounter >= body.sleepThreshold) Sleeping.set(body, true); } else if (body.sleepCounter > 0) { body.sleepCounter -= 1; } } }; /** * Description * @method afterCollisions * @param {pair[]} pairs */ Sleeping.afterCollisions = function(pairs) { // wake up bodies involved in collisions for (var i = 0; i < pairs.length; i++) { var pair = pairs[i]; // don't wake inactive pairs if (!pair.isActive) continue; var collision = pair.collision, bodyA = collision.bodyA, bodyB = collision.bodyB; // don't wake if at least one body is static if ((bodyA.isSleeping && bodyB.isSleeping) || bodyA.isStatic || bodyB.isStatic) continue; if (bodyA.isSleeping || bodyB.isSleeping) { var sleepingBody = (bodyA.isSleeping && !bodyA.isStatic) ? bodyA : bodyB, movingBody = sleepingBody === bodyA ? bodyB : bodyA; if (!sleepingBody.isStatic && movingBody.motion > _motionWakeThreshold) { Sleeping.set(sleepingBody, false); } } } }; /** * Description * @method set * @param {body} body * @param {boolean} isSleeping */ Sleeping.set = function(body, isSleeping) { if (isSleeping) { body.isSleeping = true; body.sleepCounter = body.sleepThreshold; body.positionImpulse.x = 0; body.positionImpulse.y = 0; body.positionPrev.x = body.position.x; body.positionPrev.y = body.position.y; body.anglePrev = body.angle; body.speed = 0; body.angularSpeed = 0; body.motion = 0; } else { body.isSleeping = false; body.sleepCounter = 0; } }; })(); ; // End src/core/Sleeping.js // Begin src/factory/Bodies.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Bodies */ // TODO: true circle bodies var Bodies = {}; (function() { /** * Description * @method rectangle * @param {number} x * @param {number} y * @param {number} width * @param {number} height * @param {object} options * @return {body} A new rectangle body */ Bodies.rectangle = function(x, y, width, height, options) { options = options || {}; var rectangle = { label: 'Rectangle Body', position: { x: x, y: y }, render: { path: 'L 0 0 L ' + width + ' 0 L ' + width + ' ' + height + ' L 0 ' + height } }; return Body.create(Common.extend({}, rectangle, options)); }; /** * Description * @method trapezoid * @param {number} x * @param {number} y * @param {number} width * @param {number} height * @param {number} slope * @param {object} options * @return {body} A new trapezoid body */ Bodies.trapezoid = function(x, y, width, height, slope, options) { options = options || {}; slope *= 0.5; var roof = (1 - (slope * 2)) * width; var x1 = width * slope, x2 = x1 + roof, x3 = x2 + x1; var trapezoid = { label: 'Trapezoid Body', position: { x: x, y: y }, render: { path: 'L 0 0 L ' + x1 + ' ' + (-height) + ' L ' + x2 + ' ' + (-height) + ' L ' + x3 + ' 0' } }; return Body.create(Common.extend({}, trapezoid, options)); }; /** * Description * @method circle * @param {number} x * @param {number} y * @param {number} radius * @param {object} options * @param {number} maxSides * @return {body} A new circle body */ Bodies.circle = function(x, y, radius, options, maxSides) { options = options || {}; options.label = 'Circle Body'; // approximate circles with polygons until true circles implemented in SAT maxSides = maxSides || 25; var sides = Math.ceil(Math.max(10, Math.min(maxSides, radius))); // optimisation: always use even number of sides (half the number of unique axes) if (sides % 2 === 1) sides += 1; // flag for better rendering options.circleRadius = radius; return Bodies.polygon(x, y, sides, radius, options); }; /** * Description * @method polygon * @param {number} x * @param {number} y * @param {number} sides * @param {number} radius * @param {object} options * @return {body} A new regular polygon body */ Bodies.polygon = function(x, y, sides, radius, options) { options = options || {}; if (sides < 3) return Bodies.circle(x, y, radius, options); var theta = 2 * Math.PI / sides, path = '', offset = theta * 0.5; for (var i = 0; i < sides; i += 1) { var angle = offset + (i * theta), xx = Math.cos(angle) * radius, yy = Math.sin(angle) * radius; path += 'L ' + xx.toFixed(3) + ' ' + yy.toFixed(3) + ' '; } var polygon = { label: 'Polygon Body', position: { x: x, y: y }, render: { path: path } }; return Body.create(Common.extend({}, polygon, options)); }; })(); ; // End src/factory/Bodies.js // Begin src/factory/Composites.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Composites */ var Composites = {}; (function() { /** * Description * @method stack * @param {number} xx * @param {number} yy * @param {number} columns * @param {number} rows * @param {number} columnGap * @param {number} rowGap * @param {function} callback * @return {composite} A new composite containing objects created in the callback */ Composites.stack = function(xx, yy, columns, rows, columnGap, rowGap, callback) { var stack = Composite.create({ label: 'Stack' }), x = xx, y = yy, lastBody, i = 0; for (var row = 0; row < rows; row++) { var maxHeight = 0; for (var column = 0; column < columns; column++) { var body = callback(x, y, column, row, lastBody, i); if (body) { var bodyHeight = body.bounds.max.y - body.bounds.min.y, bodyWidth = body.bounds.max.x - body.bounds.min.x; if (bodyHeight > maxHeight) maxHeight = bodyHeight; Body.translate(body, { x: bodyWidth * 0.5, y: bodyHeight * 0.5 }); x = body.bounds.max.x + columnGap; Composite.addBody(stack, body); lastBody = body; i += 1; } } y += maxHeight + rowGap; x = xx; } return stack; }; /** * Description * @method chain * @param {composite} composite * @param {number} xOffsetA * @param {number} yOffsetA * @param {number} xOffsetB * @param {number} yOffsetB * @param {object} options * @return {composite} A new composite containing objects chained together with constraints */ Composites.chain = function(composite, xOffsetA, yOffsetA, xOffsetB, yOffsetB, options) { var bodies = composite.bodies; for (var i = 1; i < bodies.length; i++) { var bodyA = bodies[i - 1], bodyB = bodies[i], bodyAHeight = bodyA.bounds.max.y - bodyA.bounds.min.y, bodyAWidth = bodyA.bounds.max.x - bodyA.bounds.min.x, bodyBHeight = bodyB.bounds.max.y - bodyB.bounds.min.y, bodyBWidth = bodyB.bounds.max.x - bodyB.bounds.min.x; var defaults = { bodyA: bodyA, pointA: { x: bodyAWidth * xOffsetA, y: bodyAHeight * yOffsetA }, bodyB: bodyB, pointB: { x: bodyBWidth * xOffsetB, y: bodyBHeight * yOffsetB } }; var constraint = Common.extend(defaults, options); Composite.addConstraint(composite, Constraint.create(constraint)); } composite.label += ' Chain'; return composite; }; /** * Connects bodies in the composite with constraints in a grid pattern, with optional cross braces * @method mesh * @param {composite} composite * @param {number} columns * @param {number} rows * @param {boolean} crossBrace * @param {object} options * @return {composite} The composite containing objects meshed together with constraints */ Composites.mesh = function(composite, columns, rows, crossBrace, options) { var bodies = composite.bodies, row, col, bodyA, bodyB, bodyC; for (row = 0; row < rows; row++) { for (col = 0; col < columns; col++) { if (col > 0) { bodyA = bodies[(col - 1) + (row * columns)]; bodyB = bodies[col + (row * columns)]; Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyA, bodyB: bodyB }, options))); } } for (col = 0; col < columns; col++) { if (row > 0) { bodyA = bodies[col + ((row - 1) * columns)]; bodyB = bodies[col + (row * columns)]; Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyA, bodyB: bodyB }, options))); if (crossBrace && col > 0) { bodyC = bodies[(col - 1) + ((row - 1) * columns)]; Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyC, bodyB: bodyB }, options))); } if (crossBrace && col < columns - 1) { bodyC = bodies[(col + 1) + ((row - 1) * columns)]; Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyC, bodyB: bodyB }, options))); } } } } composite.label += ' Mesh'; return composite; }; /** * Description * @method pyramid * @param {number} xx * @param {number} yy * @param {number} columns * @param {number} rows * @param {number} columnGap * @param {number} rowGap * @param {function} callback * @return {composite} A new composite containing objects created in the callback */ Composites.pyramid = function(xx, yy, columns, rows, columnGap, rowGap, callback) { return Composites.stack(xx, yy, columns, rows, columnGap, rowGap, function(x, y, column, row, lastBody, i) { var actualRows = Math.min(rows, Math.ceil(columns / 2)), lastBodyWidth = lastBody ? lastBody.bounds.max.x - lastBody.bounds.min.x : 0; if (row > actualRows) return; // reverse row order row = actualRows - row; var start = row, end = columns - 1 - row; if (column < start || column > end) return; // retroactively fix the first body's position, since width was unknown if (i === 1) { Body.translate(lastBody, { x: (column + (columns % 2 === 1 ? 1 : -1)) * lastBodyWidth, y: 0 }); } var xOffset = lastBody ? column * lastBodyWidth : 0; return callback(xx + xOffset + column * columnGap, y, column, row, lastBody, i); }); }; /** * Description * @method newtonsCradle * @param {number} xx * @param {number} yy * @param {number} number * @param {number} size * @param {number} length * @return {composite} A new composite newtonsCradle body */ Composites.newtonsCradle = function(xx, yy, number, size, length) { var newtonsCradle = Composite.create({ label: 'Newtons Cradle' }); for (var i = 0; i < number; i++) { var separation = 1.9, circle = Bodies.circle(xx + i * (size * separation), yy + length, size, { inertia: 99999, restitution: 1, friction: 0, frictionAir: 0.0001, slop: 0.01 }), constraint = Constraint.create({ pointA: { x: xx + i * (size * separation), y: yy }, bodyB: circle }); Composite.addBody(newtonsCradle, circle); Composite.addConstraint(newtonsCradle, constraint); } return newtonsCradle; }; /** * Description * @method car * @param {number} xx * @param {number} yy * @param {number} width * @param {number} height * @param {number} wheelSize * @return {composite} A new composite car body */ Composites.car = function(xx, yy, width, height, wheelSize) { var groupId = Body.nextGroupId(), wheelBase = -20, wheelAOffset = -width * 0.5 + wheelBase, wheelBOffset = width * 0.5 - wheelBase, wheelYOffset = 0; var car = Composite.create({ label: 'Car' }), body = Bodies.trapezoid(xx, yy, width, height, 0.3, { groupId: groupId, friction: 0.01 }); var wheelA = Bodies.circle(xx + wheelAOffset, yy + wheelYOffset, wheelSize, { groupId: groupId, restitution: 0.5, friction: 0.9, density: 0.01 }); var wheelB = Bodies.circle(xx + wheelBOffset, yy + wheelYOffset, wheelSize, { groupId: groupId, restitution: 0.5, friction: 0.9, density: 0.01 }); var axelA = Constraint.create({ bodyA: body, pointA: { x: wheelAOffset, y: wheelYOffset }, bodyB: wheelA, stiffness: 0.5 }); var axelB = Constraint.create({ bodyA: body, pointA: { x: wheelBOffset, y: wheelYOffset }, bodyB: wheelB, stiffness: 0.5 }); Composite.addBody(car, body); Composite.addBody(car, wheelA); Composite.addBody(car, wheelB); Composite.addConstraint(car, axelA); Composite.addConstraint(car, axelB); return car; }; /** * Creates a simple soft body like object * @method softBody * @param {number} xx * @param {number} yy * @param {number} columns * @param {number} rows * @param {number} columnGap * @param {number} rowGap * @param {boolean} crossBrace * @param {number} particleRadius * @param {} particleOptions * @param {} constraintOptions * @return {composite} A new composite softBody */ Composites.softBody = function(xx, yy, columns, rows, columnGap, rowGap, crossBrace, particleRadius, particleOptions, constraintOptions) { particleOptions = Common.extend({ inertia: Infinity }, particleOptions); constraintOptions = Common.extend({ stiffness: 0.4 }, constraintOptions); var softBody = Composites.stack(xx, yy, columns, rows, columnGap, rowGap, function(x, y, column, row) { return Bodies.circle(x, y, particleRadius, particleOptions); }); Composites.mesh(softBody, columns, rows, crossBrace, constraintOptions); softBody.label = 'Soft Body'; return softBody; }; })(); ; // End src/factory/Composites.js // Begin src/geometry/Axes.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Axes */ var Axes = {}; (function() { /** * Description * @method fromVertices * @param {vertices} vertices * @return {axes} A new axes from the given vertices */ Axes.fromVertices = function(vertices) { var axes = {}; // find the unique axes, using edge normal gradients for (var i = 0; i < vertices.length; i++) { var j = (i + 1) % vertices.length, normal = Vector.normalise({ x: vertices[j].y - vertices[i].y, y: vertices[i].x - vertices[j].x }), gradient = (normal.y === 0) ? Infinity : (normal.x / normal.y); // limit precision gradient = gradient.toFixed(3).toString(); axes[gradient] = normal; } return Common.values(axes); }; /** * Description * @method rotate * @param {axes} axes * @param {number} angle */ Axes.rotate = function(axes, angle) { if (angle === 0) return; var cos = Math.cos(angle), sin = Math.sin(angle); for (var i = 0; i < axes.length; i++) { var axis = axes[i], xx; xx = axis.x * cos - axis.y * sin; axis.y = axis.x * sin + axis.y * cos; axis.x = xx; } }; })(); ; // End src/geometry/Axes.js // Begin src/geometry/Bounds.js /** * _Internal Class_, not generally used outside of the engine's internals. * * @class Bounds */ var Bounds = {}; (function() { /** * Description * @method create * @param {vertices} vertices * @return {bounds} A new bounds object */ Bounds.create = function(vertices) { var bounds = { min: { x: 0, y: 0 }, max: { x: 0, y: 0 } }; if (vertices) Bounds.update(bounds, vertices); return bounds; }; /** * Description * @method update * @param {bounds} bounds * @param {vertices} vertices * @param {vector} velocity */ Bounds.update = function(bounds, vertices, velocity) { bounds.min.x = Number.MAX_VALUE; bounds.max.x = Number.MIN_VALUE; bounds.min.y = Number.MAX_VALUE; bounds.max.y = Number.MIN_VALUE; for (var i = 0; i < vertices.length; i++) { var vertex = vertices[i]; if (vertex.x > bounds.max.x) bounds.max.x = vertex.x; if (vertex.x < bounds.min.x) bounds.min.x = vertex.x; if (vertex.y > bounds.max.y) bounds.max.y = vertex.y; if (vertex.y < bounds.min.y) bounds.min.y = vertex.y; } if (velocity) { if (velocity.x > 0) { bounds.max.x += velocity.x; } else { bounds.min.x += velocity.x; } if (velocity.y > 0) { bounds.max.y += velocity.y; } else { bounds.min.y += velocity.y; } } }; /** * Description * @method contains * @param {bounds} bounds * @param {vector} point * @return {boolean} True if the bounds contain the point, otherwise false */ Bounds.contains = function(bounds, point) { return point.x >= bounds.min.x && point.x <= bounds.max.x && point.y >= bounds.min.y && point.y <= bounds.max.y; }; /** * Description * @method overlaps * @param {bounds} boundsA * @param {bounds} boundsB * @return {boolean} True if the bounds overlap, otherwise false */ Bounds.overlaps = function(boundsA, boundsB) { return (boundsA.min.x <= boundsB.max.x && boundsA.max.x >= boundsB.min.x && boundsA.max.y >= boundsB.min.y && boundsA.min.y <= boundsB.max.y); }; /** * Translates the bounds by the given vector * @method translate * @param {bounds} bounds * @param {vector} vector */ Bounds.translate = function(bounds, vector) { bounds.min.x += vector.x; bounds.max.x += vector.x; bounds.min.y += vector.y; bounds.max.y += vector.y; }; /** * Shifts the bounds to the given position * @method shift * @param {bounds} bounds * @param {vector} position */ Bounds.shift = function(bounds, position) { var deltaX = bounds.max.x - bounds.min.x, deltaY = bounds.max.y - bounds.min.y; bounds.min.x = position.x; bounds.max.x = position.x + deltaX; bounds.min.y = position.y; bounds.max.y = position.y + deltaY; }; })(); ; // End src/geometry/Bounds.js // Begin src/geometry/Vector.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Vector */ // TODO: consider params for reusing vector objects var Vector = {}; (function() { /** * Description * @method magnitude * @param {vector} vector * @return {number} The magnitude of the vector */ Vector.magnitude = function(vector) { return Math.sqrt((vector.x * vector.x) + (vector.y * vector.y)); }; /** * Description * @method magnitudeSquared * @param {vector} vector * @return {number} The squared magnitude of the vector */ Vector.magnitudeSquared = function(vector) { return (vector.x * vector.x) + (vector.y * vector.y); }; /** * Description * @method rotate * @param {vector} vector * @param {number} angle * @return {vector} A new vector rotated */ Vector.rotate = function(vector, angle) { var cos = Math.cos(angle), sin = Math.sin(angle); return { x: vector.x * cos - vector.y * sin, y: vector.x * sin + vector.y * cos }; }; /** * Description * @method rotateAbout * @param {vector} vector * @param {number} angle * @param {vector} point * @return {vector} A new vector rotated about the point */ Vector.rotateAbout = function(vector, angle, point) { var cos = Math.cos(angle), sin = Math.sin(angle); return { x: point.x + ((vector.x - point.x) * cos - (vector.y - point.y) * sin), y: point.y + ((vector.x - point.x) * sin + (vector.y - point.y) * cos) }; }; /** * Description * @method normalise * @param {vector} vector * @return {vector} A new vector normalised */ Vector.normalise = function(vector) { var magnitude = Vector.magnitude(vector); if (magnitude === 0) return { x: 0, y: 0 }; return { x: vector.x / magnitude, y: vector.y / magnitude }; }; /** * Description * @method dot * @param {vector} vectorA * @param {vector} vectorB * @return {number} The dot product of the two vectors */ Vector.dot = function(vectorA, vectorB) { return (vectorA.x * vectorB.x) + (vectorA.y * vectorB.y); }; /** * Description * @method cross * @param {vector} vectorA * @param {vector} vectorB * @return {number} The cross product of the two vectors */ Vector.cross = function(vectorA, vectorB) { return (vectorA.x * vectorB.y) - (vectorA.y * vectorB.x); }; /** * Description * @method add * @param {vector} vectorA * @param {vector} vectorB * @return {vector} A new vector added */ Vector.add = function(vectorA, vectorB) { return { x: vectorA.x + vectorB.x, y: vectorA.y + vectorB.y }; }; /** * Description * @method sub * @param {vector} vectorA * @param {vector} vectorB * @return {vector} A new vector subtracted */ Vector.sub = function(vectorA, vectorB) { return { x: vectorA.x - vectorB.x, y: vectorA.y - vectorB.y }; }; /** * Description * @method mult * @param {vector} vector * @param {number} scalar * @return {vector} A new vector multiplied by scalar */ Vector.mult = function(vector, scalar) { return { x: vector.x * scalar, y: vector.y * scalar }; }; /** * Description * @method div * @param {vector} vector * @param {number} scalar * @return {vector} A new vector divided by scalar */ Vector.div = function(vector, scalar) { return { x: vector.x / scalar, y: vector.y / scalar }; }; /** * Description * @method perp * @param {vector} vector * @param {bool} negate * @return {vector} The perpendicular vector */ Vector.perp = function(vector, negate) { negate = negate === true ? -1 : 1; return { x: negate * -vector.y, y: negate * vector.x }; }; /** * Description * @method neg * @param {vector} vector * @return {vector} The negated vector */ Vector.neg = function(vector) { return { x: -vector.x, y: -vector.y }; }; /** * Returns the angle in radians between the two vectors relative to the x-axis * @method angle * @param {vector} vectorA * @param {vector} vectorB * @return {number} The angle in radians */ Vector.angle = function(vectorA, vectorB) { return Math.atan2(vectorB.y - vectorA.y, vectorB.x - vectorA.x); }; })(); ; // End src/geometry/Vector.js // Begin src/geometry/Vertices.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Vertices */ // TODO: convex decomposition - http://mnbayazit.com/406/bayazit var Vertices = {}; (function() { /** * Description * @method create * @param {vertices} vertices * @param {body} body */ Vertices.create = function(vertices, body) { for (var i = 0; i < vertices.length; i++) { vertices[i].index = i; vertices[i].body = body; } }; /** * Description * @method fromPath * @param {string} path * @return {vertices} vertices */ Vertices.fromPath = function(path) { var pathPattern = /L\s*([\-\d\.]*)\s*([\-\d\.]*)/ig, vertices = []; path.replace(pathPattern, function(match, x, y) { vertices.push({ x: parseFloat(x, 10), y: parseFloat(y, 10) }); }); return vertices; }; /** * Description * @method centre * @param {vertices} vertices * @return {vector} The centre point */ Vertices.centre = function(vertices) { var cx = 0, cy = 0; for (var i = 0; i < vertices.length; i++) { cx += vertices[i].x; cy += vertices[i].y; } return { x: cx / vertices.length, y: cy / vertices.length }; }; /** * Description * @method area * @param {vertices} vertices * @return {number} The area */ Vertices.area = function(vertices) { var area = 0, j = vertices.length - 1; for (var i = 0; i < vertices.length; i++) { area += (vertices[j].x - vertices[i].x) * (vertices[j].y + vertices[i].y); j = i; } return Math.abs(area) / 2; }; /** * Description * @method inertia * @param {vertices} vertices * @param {number} mass * @return {number} The polygon's moment of inertia, using second moment of area */ Vertices.inertia = function(vertices, mass) { var numerator = 0, denominator = 0, v = vertices, cross, j; // find the polygon's moment of inertia, using second moment of area // http://www.physicsforums.com/showthread.php?t=25293 for (var n = 0; n < v.length; n++) { j = (n + 1) % v.length; cross = Math.abs(Vector.cross(v[j], v[n])); numerator += cross * (Vector.dot(v[j], v[j]) + Vector.dot(v[j], v[n]) + Vector.dot(v[n], v[n])); denominator += cross; } return (mass / 6) * (numerator / denominator); }; /** * Description * @method translate * @param {vertices} vertices * @param {vector} vector * @param {number} scalar */ Vertices.translate = function(vertices, vector, scalar) { var i; if (scalar) { for (i = 0; i < vertices.length; i++) { vertices[i].x += vector.x * scalar; vertices[i].y += vector.y * scalar; } } else { for (i = 0; i < vertices.length; i++) { vertices[i].x += vector.x; vertices[i].y += vector.y; } } }; /** * Description * @method rotate * @param {vertices} vertices * @param {number} angle * @param {vector} point */ Vertices.rotate = function(vertices, angle, point) { if (angle === 0) return; var cos = Math.cos(angle), sin = Math.sin(angle); for (var i = 0; i < vertices.length; i++) { var vertice = vertices[i], dx = vertice.x - point.x, dy = vertice.y - point.y; vertice.x = point.x + (dx * cos - dy * sin); vertice.y = point.y + (dx * sin + dy * cos); } }; /** * Description * @method contains * @param {vertices} vertices * @param {vector} point * @return {boolean} True if the vertices contains point, otherwise false */ Vertices.contains = function(vertices, point) { for (var i = 0; i < vertices.length; i++) { var vertice = vertices[i], nextVertice = vertices[(i + 1) % vertices.length]; if ((point.x - vertice.x) * (nextVertice.y - vertice.y) + (point.y - vertice.y) * (vertice.x - nextVertice.x) > 0) { return false; } } return true; }; /** * Scales the vertices from a point (default is centre) * @method scale * @param {vertices} vertices * @param {number} scaleX * @param {number} scaleY * @param {vector} point */ Vertices.scale = function(vertices, scaleX, scaleY, point) { if (scaleX === 1 && scaleY === 1) return vertices; point = point || Vertices.centre(vertices); var vertex, delta; for (var i = 0; i < vertices.length; i++) { vertex = vertices[i]; delta = Vector.sub(vertex, point); vertices[i].x = point.x + delta.x * scaleX; vertices[i].y = point.y + delta.y * scaleY; } return vertices; }; })(); ; // End src/geometry/Vertices.js // Begin src/render/Render.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Render */ // TODO: viewports // TODO: two.js, pixi.js var Render = {}; (function() { /** * Description * @method create * @param {object} options * @return {render} A new renderer */ Render.create = function(options) { var defaults = { controller: Render, element: null, canvas: null, options: { width: 800, height: 600, background: '#fafafa', wireframeBackground: '#222', hasBounds: false, enabled: true, wireframes: true, showSleeping: true, showDebug: false, showBroadphase: false, showBounds: false, showVelocity: false, showCollisions: false, showAxes: false, showPositions: false, showAngleIndicator: false, showIds: false, showShadows: false } }; var render = Common.extend(defaults, options); render.canvas = render.canvas || _createCanvas(render.options.width, render.options.height); render.context = render.canvas.getContext('2d'); render.textures = {}; render.bounds = render.bounds || { min: { x: 0, y: 0 }, max: { x: render.options.width, y: render.options.height } }; Render.setBackground(render, render.options.background); if (Common.isElement(render.element)) { render.element.appendChild(render.canvas); } else { Common.log('No "render.element" passed, "render.canvas" was not inserted into document.', 'warn'); } return render; }; /** * Clears the renderer. In this implementation, this is a noop. * @method clear * @param {RenderPixi} render */ Render.clear = function(render) { // nothing required to clear this renderer implentation // if a scene graph is required, clear it here (see RenderPixi.js) }; /** * Sets the background CSS property of the canvas * @method setBackground * @param {render} render * @param {string} background */ Render.setBackground = function(render, background) { if (render.currentBackground !== background) { var cssBackground = background; if (/(jpg|gif|png)$/.test(background)) cssBackground = 'url(' + background + ')'; render.canvas.style.background = cssBackground; render.canvas.style.backgroundSize = "contain"; render.currentBackground = background; } }; /** * Description * @method world * @param {engine} engine */ Render.world = function(engine) { var render = engine.render, world = engine.world, canvas = render.canvas, context = render.context, options = render.options, allBodies = Composite.allBodies(world), allConstraints = Composite.allConstraints(world), bodies = [], constraints = [], i; if (options.wireframes) { Render.setBackground(render, options.wireframeBackground); } else { Render.setBackground(render, options.background); } // clear the canvas with a transparent fill, to allow the canvas background to show context.globalCompositeOperation = 'source-in'; context.fillStyle = "transparent"; context.fillRect(0, 0, canvas.width, canvas.height); context.globalCompositeOperation = 'source-over'; // handle bounds if (options.hasBounds) { // filter out bodies that are not in view for (i = 0; i < allBodies.length; i++) { var body = allBodies[i]; if (Bounds.overlaps(body.bounds, render.bounds)) bodies.push(body); } // filter out constraints that are not in view for (i = 0; i < allConstraints.length; i++) { var constraint = allConstraints[i], bodyA = constraint.bodyA, bodyB = constraint.bodyB, pointAWorld = constraint.pointA, pointBWorld = constraint.pointB; if (bodyA) pointAWorld = Vector.add(bodyA.position, constraint.pointA); if (bodyB) pointBWorld = Vector.add(bodyB.position, constraint.pointB); if (!pointAWorld || !pointBWorld) continue; if (Bounds.contains(render.bounds, pointAWorld) || Bounds.contains(render.bounds, pointBWorld)) constraints.push(constraint); } // translate the view context.translate(-render.bounds.min.x, -render.bounds.min.y); } else { constraints = allConstraints; bodies = allBodies; } if (!options.wireframes || (engine.enableSleeping && options.showSleeping)) { // fully featured rendering of bodies Render.bodies(engine, bodies, context); } else { // optimised method for wireframes only Render.bodyWireframes(engine, bodies, context); } if (options.showBounds) Render.bodyBounds(engine, bodies, context); if (options.showAxes || options.showAngleIndicator) Render.bodyAxes(engine, bodies, context); if (options.showPositions) Render.bodyPositions(engine, bodies, context); if (options.showVelocity) Render.bodyVelocity(engine, bodies, context); if (options.showIds) Render.bodyIds(engine, bodies, context); if (options.showCollisions) Render.collisions(engine, engine.pairs.list, context); Render.constraints(constraints, context); if (options.showBroadphase && engine.broadphase.current === 'grid') Render.grid(engine, engine.broadphase[engine.broadphase.current].instance, context); if (options.showDebug) Render.debug(engine, context); if (options.hasBounds) context.translate(render.bounds.min.x, render.bounds.min.y); }; /** * Description * @method debug * @param {engine} engine * @param {RenderingContext} context */ Render.debug = function(engine, context) { var c = context, world = engine.world, render = engine.render, options = render.options, bodies = Composite.allBodies(world), space = " "; if (engine.timing.timestamp - (render.debugTimestamp || 0) >= 500) { var text = ""; text += "fps: " + Math.round(engine.timing.fps) + space; if (engine.metrics.extended) { text += "delta: " + engine.timing.delta.toFixed(3) + space; text += "correction: " + engine.timing.correction.toFixed(3) + space; text += "bodies: " + bodies.length + space; if (engine.broadphase.controller === Grid) text += "buckets: " + engine.metrics.buckets + space; text += "\n"; text += "collisions: " + engine.metrics.collisions + space; text += "pairs: " + engine.pairs.list.length + space; text += "broad: " + engine.metrics.broadEff + space; text += "mid: " + engine.metrics.midEff + space; text += "narrow: " + engine.metrics.narrowEff + space; } render.debugString = text; render.debugTimestamp = engine.timing.timestamp; } if (render.debugString) { c.font = "12px Arial"; if (options.wireframes) { c.fillStyle = 'rgba(255,255,255,0.5)'; } else { c.fillStyle = 'rgba(0,0,0,0.5)'; } var split = render.debugString.split('\n'); for (var i = 0; i < split.length; i++) { c.fillText(split[i], 50, 50 + i * 18); } } }; /** * Description * @method constraints * @param {constraint[]} constraints * @param {RenderingContext} context */ Render.constraints = function(constraints, context) { var c = context; for (var i = 0; i < constraints.length; i++) { var constraint = constraints[i]; if (!constraint.render.visible || !constraint.pointA || !constraint.pointB) continue; var bodyA = constraint.bodyA, bodyB = constraint.bodyB; if (bodyA) { c.beginPath(); c.moveTo(bodyA.position.x + constraint.pointA.x, bodyA.position.y + constraint.pointA.y); } else { c.beginPath(); c.moveTo(constraint.pointA.x, constraint.pointA.y); } if (bodyB) { c.lineTo(bodyB.position.x + constraint.pointB.x, bodyB.position.y + constraint.pointB.y); } else { c.lineTo(constraint.pointB.x, constraint.pointB.y); } c.lineWidth = constraint.render.lineWidth; c.strokeStyle = constraint.render.strokeStyle; c.stroke(); } }; /** * Description * @method bodyShadows * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyShadows = function(engine, bodies, context) { var c = context, render = engine.render, options = render.options; for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (!body.render.visible) continue; if (body.circleRadius) { c.beginPath(); c.arc(body.position.x, body.position.y, body.circleRadius, 0, 2 * Math.PI); c.closePath(); } else { c.beginPath(); c.moveTo(body.vertices[0].x, body.vertices[0].y); for (var j = 1; j < body.vertices.length; j++) { c.lineTo(body.vertices[j].x, body.vertices[j].y); } c.closePath(); } var distanceX = body.position.x - render.options.width * 0.5, distanceY = body.position.y - render.options.height * 0.2, distance = Math.abs(distanceX) + Math.abs(distanceY); c.shadowColor = 'rgba(0,0,0,0.15)'; c.shadowOffsetX = 0.05 * distanceX; c.shadowOffsetY = 0.05 * distanceY; c.shadowBlur = 1 + 12 * Math.min(1, distance / 1000); c.fill(); c.shadowColor = null; c.shadowOffsetX = null; c.shadowOffsetY = null; c.shadowBlur = null; } }; /** * Description * @method bodies * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodies = function(engine, bodies, context) { var c = context, render = engine.render, options = render.options, i; for (i = 0; i < bodies.length; i++) { var body = bodies[i]; if (!body.render.visible) continue; if (body.render.sprite && body.render.sprite.texture && !options.wireframes) { // body sprite var sprite = body.render.sprite, texture = _getTexture(render, sprite.texture); if (options.showSleeping && body.isSleeping) c.globalAlpha = 0.5; c.translate(body.position.x, body.position.y); c.rotate(body.angle); c.drawImage(texture, texture.width * -0.5 * sprite.xScale, texture.height * -0.5 * sprite.yScale, texture.width * sprite.xScale, texture.height * sprite.yScale); // revert translation, hopefully faster than save / restore c.rotate(-body.angle); c.translate(-body.position.x, -body.position.y); if (options.showSleeping && body.isSleeping) c.globalAlpha = 1; } else { // body polygon if (body.circleRadius) { c.beginPath(); c.arc(body.position.x, body.position.y, body.circleRadius, 0, 2 * Math.PI); } else { c.beginPath(); c.moveTo(body.vertices[0].x, body.vertices[0].y); for (var j = 1; j < body.vertices.length; j++) { c.lineTo(body.vertices[j].x, body.vertices[j].y); } c.closePath(); } if (!options.wireframes) { if (options.showSleeping && body.isSleeping) { c.fillStyle = Common.shadeColor(body.render.fillStyle, 50); } else { c.fillStyle = body.render.fillStyle; } c.lineWidth = body.render.lineWidth; c.strokeStyle = body.render.strokeStyle; c.fill(); c.stroke(); } else { c.lineWidth = 1; c.strokeStyle = '#bbb'; if (options.showSleeping && body.isSleeping) c.strokeStyle = 'rgba(255,255,255,0.2)'; c.stroke(); } } } }; /** * Optimised method for drawing body wireframes in one pass * @method bodyWireframes * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyWireframes = function(engine, bodies, context) { var c = context, i, j; c.beginPath(); for (i = 0; i < bodies.length; i++) { var body = bodies[i]; if (!body.render.visible) continue; c.moveTo(body.vertices[0].x, body.vertices[0].y); for (j = 1; j < body.vertices.length; j++) { c.lineTo(body.vertices[j].x, body.vertices[j].y); } c.lineTo(body.vertices[0].x, body.vertices[0].y); } c.lineWidth = 1; c.strokeStyle = '#bbb'; c.stroke(); }; /** * Draws body bounds * @method bodyBounds * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyBounds = function(engine, bodies, context) { var c = context, render = engine.render, options = render.options; c.beginPath(); for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (body.render.visible) c.rect(body.bounds.min.x, body.bounds.min.y, body.bounds.max.x - body.bounds.min.x, body.bounds.max.y - body.bounds.min.y); } if (options.wireframes) { c.strokeStyle = 'rgba(255,255,255,0.08)'; } else { c.strokeStyle = 'rgba(0,0,0,0.1)'; } c.lineWidth = 1; c.stroke(); }; /** * Draws body angle indicators and axes * @method bodyAxes * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyAxes = function(engine, bodies, context) { var c = context, render = engine.render, options = render.options, i, j; c.beginPath(); for (i = 0; i < bodies.length; i++) { var body = bodies[i]; if (!body.render.visible) continue; if (options.showAxes) { // render all axes for (j = 0; j < body.axes.length; j++) { var axis = body.axes[j]; c.moveTo(body.position.x, body.position.y); c.lineTo(body.position.x + axis.x * 20, body.position.y + axis.y * 20); } } else { // render a single axis indicator c.moveTo(body.position.x, body.position.y); c.lineTo((body.vertices[0].x + body.vertices[body.vertices.length-1].x) / 2, (body.vertices[0].y + body.vertices[body.vertices.length-1].y) / 2); } } if (options.wireframes) { c.strokeStyle = 'indianred'; } else { c.strokeStyle = 'rgba(0,0,0,0.3)'; } c.lineWidth = 1; c.stroke(); }; /** * Draws body positions * @method bodyPositions * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyPositions = function(engine, bodies, context) { var c = context, render = engine.render, options = render.options, body, i; c.beginPath(); // render current positions for (i = 0; i < bodies.length; i++) { body = bodies[i]; if (body.render.visible) { c.arc(body.position.x, body.position.y, 3, 0, 2 * Math.PI, false); c.closePath(); } } if (options.wireframes) { c.fillStyle = 'indianred'; } else { c.fillStyle = 'rgba(0,0,0,0.5)'; } c.fill(); c.beginPath(); // render previous positions for (i = 0; i < bodies.length; i++) { body = bodies[i]; if (body.render.visible) { c.arc(body.positionPrev.x, body.positionPrev.y, 2, 0, 2 * Math.PI, false); c.closePath(); } } c.fillStyle = 'rgba(255,165,0,0.8)'; c.fill(); }; /** * Draws body velocity * @method bodyVelocity * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyVelocity = function(engine, bodies, context) { var c = context, render = engine.render, options = render.options; c.beginPath(); for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (!body.render.visible) continue; c.moveTo(body.position.x, body.position.y); c.lineTo(body.position.x + (body.position.x - body.positionPrev.x) * 2, body.position.y + (body.position.y - body.positionPrev.y) * 2); } c.lineWidth = 3; c.strokeStyle = 'cornflowerblue'; c.stroke(); }; /** * Draws body ids * @method bodyIds * @param {engine} engine * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyIds = function(engine, bodies, context) { var c = context; for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (!body.render.visible) continue; c.font = "12px Arial"; c.fillStyle = 'rgba(255,255,255,0.5)'; c.fillText(body.id, body.position.x + 10, body.position.y - 10); } }; /** * Description * @method collisions * @param {engine} engine * @param {pair[]} pairs * @param {RenderingContext} context */ Render.collisions = function(engine, pairs, context) { var c = context, options = engine.render.options, pair, collision, i, j; c.beginPath(); // render collision positions for (i = 0; i < pairs.length; i++) { pair = pairs[i]; collision = pair.collision; for (j = 0; j < pair.activeContacts.length; j++) { var contact = pair.activeContacts[j], vertex = contact.vertex; c.rect(vertex.x - 1.5, vertex.y - 1.5, 3.5, 3.5); } } if (options.wireframes) { c.fillStyle = 'rgba(255,255,255,0.7)'; } else { c.fillStyle = 'orange'; } c.fill(); c.beginPath(); // render collision normals for (i = 0; i < pairs.length; i++) { pair = pairs[i]; collision = pair.collision; if (pair.activeContacts.length > 0) { var normalPosX = pair.activeContacts[0].vertex.x, normalPosY = pair.activeContacts[0].vertex.y; if (pair.activeContacts.length === 2) { normalPosX = (pair.activeContacts[0].vertex.x + pair.activeContacts[1].vertex.x) / 2; normalPosY = (pair.activeContacts[0].vertex.y + pair.activeContacts[1].vertex.y) / 2; } c.moveTo(normalPosX - collision.normal.x * 8, normalPosY - collision.normal.y * 8); c.lineTo(normalPosX, normalPosY); } } if (options.wireframes) { c.strokeStyle = 'rgba(255,165,0,0.7)'; } else { c.strokeStyle = 'orange'; } c.lineWidth = 1; c.stroke(); }; /** * Description * @method grid * @param {engine} engine * @param {grid} grid * @param {RenderingContext} context */ Render.grid = function(engine, grid, context) { var c = context, options = engine.render.options; if (options.wireframes) { c.strokeStyle = 'rgba(255,180,0,0.1)'; } else { c.strokeStyle = 'rgba(255,180,0,0.5)'; } c.beginPath(); var bucketKeys = Common.keys(grid.buckets); for (var i = 0; i < bucketKeys.length; i++) { var bucketId = bucketKeys[i]; if (grid.buckets[bucketId].length < 2) continue; var region = bucketId.split(','); c.rect(0.5 + parseInt(region[0], 10) * grid.bucketWidth, 0.5 + parseInt(region[1], 10) * grid.bucketHeight, grid.bucketWidth, grid.bucketHeight); } c.lineWidth = 1; c.stroke(); }; /** * Description * @method inspector * @param {inspector} inspector * @param {RenderingContext} context */ Render.inspector = function(inspector, context) { var engine = inspector.engine, mouse = engine.input.mouse, selected = inspector.selected, c = context, render = engine.render, options = render.options, bounds; if (options.hasBounds) context.translate(-render.bounds.min.x, -render.bounds.min.y); for (var i = 0; i < selected.length; i++) { var item = selected[i].data; context.translate(0.5, 0.5); context.lineWidth = 1; context.strokeStyle = 'rgba(255,165,0,0.9)'; context.setLineDash([1,2]); switch (item.type) { case 'body': // render body selections bounds = item.bounds; context.beginPath(); context.rect(Math.floor(bounds.min.x - 3), Math.floor(bounds.min.y - 3), Math.floor(bounds.max.x - bounds.min.x + 6), Math.floor(bounds.max.y - bounds.min.y + 6)); context.closePath(); context.stroke(); break; case 'constraint': // render constraint selections var point = item.pointA; if (item.bodyA) point = item.pointB; context.beginPath(); context.arc(point.x, point.y, 10, 0, 2 * Math.PI); context.closePath(); context.stroke(); break; } context.setLineDash([0]); context.translate(-0.5, -0.5); } // render selection region if (inspector.selectStart !== null) { context.translate(0.5, 0.5); context.lineWidth = 1; context.strokeStyle = 'rgba(255,165,0,0.6)'; context.fillStyle = 'rgba(255,165,0,0.1)'; bounds = inspector.selectBounds; context.beginPath(); context.rect(Math.floor(bounds.min.x), Math.floor(bounds.min.y), Math.floor(bounds.max.x - bounds.min.x), Math.floor(bounds.max.y - bounds.min.y)); context.closePath(); context.stroke(); context.fill(); context.translate(-0.5, -0.5); } if (options.hasBounds) context.translate(render.bounds.min.x, render.bounds.min.y); }; /** * Description * @method _createCanvas * @private * @param {} width * @param {} height * @return canvas */ var _createCanvas = function(width, height) { var canvas = document.createElement('canvas'); canvas.width = width; canvas.height = height; canvas.oncontextmenu = function() { return false; }; canvas.onselectstart = function() { return false; }; return canvas; }; /** * Gets the requested texture (an Image) via its path * @method _getTexture * @private * @param {render} render * @param {string} imagePath * @return {Image} texture */ var _getTexture = function(render, imagePath) { var image = render.textures[imagePath]; if (image) return image; image = render.textures[imagePath] = new Image(); image.src = imagePath; return image; }; })(); ; // End src/render/Render.js // Begin src/render/RenderPixi.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class RenderPixi */ var RenderPixi = {}; (function() { /** * Creates a new Pixi.js WebGL renderer * @method create * @param {object} options * @return {RenderPixi} A new renderer */ RenderPixi.create = function(options) { var defaults = { controller: RenderPixi, element: null, canvas: null, options: { width: 800, height: 600, background: '#fafafa', wireframeBackground: '#222', enabled: true, wireframes: true, showSleeping: true, showDebug: false, showBroadphase: false, showBounds: false, showVelocity: false, showCollisions: false, showAxes: false, showPositions: false, showAngleIndicator: false, showIds: false, showShadows: false } }; var render = Common.extend(defaults, options); // init pixi render.context = new PIXI.WebGLRenderer(800, 600, render.canvas, false, true); render.canvas = render.context.view; render.stage = new PIXI.Stage(); // caches render.textures = {}; render.sprites = {}; render.primitives = {}; // use a sprite batch for performance render.spriteBatch = new PIXI.SpriteBatch(); render.stage.addChild(render.spriteBatch); // insert canvas if (Common.isElement(render.element)) { render.element.appendChild(render.canvas); } else { Common.log('No "render.element" passed, "render.canvas" was not inserted into document.', 'warn'); } // prevent menus on canvas render.canvas.oncontextmenu = function() { return false; }; render.canvas.onselectstart = function() { return false; }; return render; }; /** * Clears the scene graph * @method clear * @param {RenderPixi} render */ RenderPixi.clear = function(render) { var stage = render.stage, spriteBatch = render.spriteBatch; // clear stage while (stage.children[0]) { stage.removeChild(stage.children[0]); } // clear sprite batch while (spriteBatch.children[0]) { spriteBatch.removeChild(spriteBatch.children[0]); } var bgSprite = render.sprites['bg-0']; // clear caches render.textures = {}; render.sprites = {}; render.primitives = {}; // set background sprite render.sprites['bg-0'] = bgSprite; if (bgSprite) spriteBatch.addChildAt(bgSprite, 0); // add sprite batch back into stage render.stage.addChild(render.spriteBatch); // reset background state render.currentBackground = null; }; /** * Sets the background of the canvas * @method setBackground * @param {RenderPixi} render * @param {string} background */ RenderPixi.setBackground = function(render, background) { if (render.currentBackground !== background) { var isColor = background.indexOf && background.indexOf('#') !== -1, bgSprite = render.sprites['bg-0']; if (isColor) { // if solid background color var color = Common.colorToNumber(background); render.stage.setBackgroundColor(color); // remove background sprite if existing if (bgSprite) render.spriteBatch.removeChild(bgSprite); } else { // initialise background sprite if needed if (!bgSprite) { var texture = _getTexture(render, background); bgSprite = render.sprites['bg-0'] = new PIXI.Sprite(texture); bgSprite.position.x = 0; bgSprite.position.y = 0; render.spriteBatch.addChildAt(bgSprite, 0); } } render.currentBackground = background; } }; /** * Description * @method world * @param {engine} engine */ RenderPixi.world = function(engine) { var render = engine.render, world = engine.world, context = render.context, stage = render.stage, options = render.options, bodies = Composite.allBodies(world), constraints = Composite.allConstraints(world), i; if (options.wireframes) { RenderPixi.setBackground(render, options.wireframeBackground); } else { RenderPixi.setBackground(render, options.background); } for (i = 0; i < bodies.length; i++) RenderPixi.body(engine, bodies[i]); for (i = 0; i < constraints.length; i++) RenderPixi.constraint(engine, constraints[i]); context.render(stage); }; /** * Description * @method constraint * @param {engine} engine * @param {constraint} constraint */ RenderPixi.constraint = function(engine, constraint) { var render = engine.render, bodyA = constraint.bodyA, bodyB = constraint.bodyB, pointA = constraint.pointA, pointB = constraint.pointB, stage = render.stage, constraintRender = constraint.render, primitiveId = 'c-' + constraint.id, primitive = render.primitives[primitiveId]; // initialise constraint primitive if not existing if (!primitive) primitive = render.primitives[primitiveId] = new PIXI.Graphics(); // don't render if constraint does not have two end points if (!constraintRender.visible || !constraint.pointA || !constraint.pointB) { primitive.clear(); return; } // add to scene graph if not already there if (stage.children.indexOf(primitive) === -1) stage.addChild(primitive); // render the constraint on every update, since they can change dynamically primitive.clear(); primitive.beginFill(0, 0); primitive.lineStyle(constraintRender.lineWidth, Common.colorToNumber(constraintRender.strokeStyle), 1); if (bodyA) { primitive.moveTo(bodyA.position.x + pointA.x, bodyA.position.y + pointA.y); } else { primitive.moveTo(pointA.x, pointA.y); } if (bodyB) { primitive.lineTo(bodyB.position.x + pointB.x, bodyB.position.y + pointB.y); } else { primitive.lineTo(pointB.x, pointB.y); } primitive.endFill(); }; /** * Description * @method body * @param {engine} engine * @param {body} body */ RenderPixi.body = function(engine, body) { var render = engine.render, bodyRender = body.render; if (!bodyRender.visible) return; if (bodyRender.sprite && bodyRender.sprite.texture) { var spriteId = 'b-' + body.id, sprite = render.sprites[spriteId], spriteBatch = render.spriteBatch; // initialise body sprite if not existing if (!sprite) sprite = render.sprites[spriteId] = _createBodySprite(render, body); // add to scene graph if not already there if (spriteBatch.children.indexOf(sprite) === -1) spriteBatch.addChild(sprite); // update body sprite sprite.position.x = body.position.x; sprite.position.y = body.position.y; sprite.rotation = body.angle; } else { var primitiveId = 'b-' + body.id, primitive = render.primitives[primitiveId], stage = render.stage; // initialise body primitive if not existing if (!primitive) { primitive = render.primitives[primitiveId] = _createBodyPrimitive(render, body); primitive.initialAngle = body.angle; } // add to scene graph if not already there if (stage.children.indexOf(primitive) === -1) stage.addChild(primitive); // update body primitive primitive.position.x = body.position.x; primitive.position.y = body.position.y; primitive.rotation = body.angle - primitive.initialAngle; } }; /** * Creates a body sprite * @method _createBodySprite * @private * @param {RenderPixi} render * @param {body} body * @return {PIXI.Sprite} sprite */ var _createBodySprite = function(render, body) { var bodyRender = body.render, texturePath = bodyRender.sprite.texture, texture = _getTexture(render, texturePath), sprite = new PIXI.Sprite(texture); sprite.anchor.x = 0.5; sprite.anchor.y = 0.5; return sprite; }; /** * Creates a body primitive * @method _createBodyPrimitive * @private * @param {RenderPixi} render * @param {body} body * @return {PIXI.Graphics} graphics */ var _createBodyPrimitive = function(render, body) { var bodyRender = body.render, options = render.options, primitive = new PIXI.Graphics(); primitive.clear(); if (!options.wireframes) { primitive.beginFill(Common.colorToNumber(bodyRender.fillStyle), 1); primitive.lineStyle(body.render.lineWidth, Common.colorToNumber(bodyRender.strokeStyle), 1); } else { primitive.beginFill(0, 0); primitive.lineStyle(1, Common.colorToNumber('#bbb'), 1); } primitive.moveTo(body.vertices[0].x - body.position.x, body.vertices[0].y - body.position.y); for (var j = 1; j < body.vertices.length; j++) { primitive.lineTo(body.vertices[j].x - body.position.x, body.vertices[j].y - body.position.y); } primitive.lineTo(body.vertices[0].x - body.position.x, body.vertices[0].y - body.position.y); primitive.endFill(); // angle indicator if (options.showAngleIndicator || options.showAxes) { primitive.beginFill(0, 0); if (options.wireframes) { primitive.lineStyle(1, Common.colorToNumber('#CD5C5C'), 1); } else { primitive.lineStyle(1, Common.colorToNumber(body.render.strokeStyle)); } primitive.moveTo(0, 0); primitive.lineTo(((body.vertices[0].x + body.vertices[body.vertices.length-1].x) / 2) - body.position.x, ((body.vertices[0].y + body.vertices[body.vertices.length-1].y) / 2) - body.position.y); primitive.endFill(); } return primitive; }; /** * Gets the requested texture (a PIXI.Texture) via its path * @method _getTexture * @private * @param {RenderPixi} render * @param {string} imagePath * @return {PIXI.Texture} texture */ var _getTexture = function(render, imagePath) { var texture = render.textures[imagePath]; if (!texture) texture = render.textures[imagePath] = PIXI.Texture.fromImage(imagePath); return texture; }; })(); ; // End src/render/RenderPixi.js // Begin src/tools/Gui.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Gui */ var Gui = {}; (function() { /** * Description * @method create * @param {engine} engine * @param {object} options * @return {gui} A container for a configured dat.gui */ Gui.create = function(engine, options) { var _datGuiSupported = window.dat && window.localStorage; if (!_datGuiSupported) { console.log("Could not create GUI. Check dat.gui library is loaded first."); return; } var datGui = new dat.GUI(options); var gui = { engine: engine, datGui: datGui, amount: 1, size: 40, sides: 4, density: 0.001, restitution: 0, friction: 0.1, frictionAir: 0.01, offset: { x: 0, y: 0 }, renderer: 'canvas' }; if (Resurrect) { gui.serializer = new Resurrect({ prefix: '$', cleanup: true }); gui.serializer.parse = gui.serializer.resurrect; } _initDatGui(gui); return gui; }; /** * Description * @method update * @param {gui} gui * @param {datGui} datGui */ Gui.update = function(gui, datGui) { var i; datGui = datGui || gui.datGui; for (i in datGui.__folders) { Gui.update(gui, datGui.__folders[i]); } for (i in datGui.__controllers) { var controller = datGui.__controllers[i]; if (controller.updateDisplay) controller.updateDisplay(); } }; /** * Description * @method closeAll * @param {gui} gui */ Gui.closeAll = function(gui) { var datGui = gui.datGui; for (var i in datGui.__folders) { datGui.__folders[i].close(); } }; /** * Saves world state to local storage * @method saveState * @param {object} serializer * @param {engine} engine * @param {string} key */ Gui.saveState = function(serializer, engine, key) { if (localStorage && serializer) localStorage.setItem(key, Gui.serialise(serializer, engine.world)); }; /** * Loads world state from local storage * @method loadState * @param {object} serializer * @param {engine} engine * @param {string} key */ Gui.loadState = function(serializer, engine, key) { var loadedWorld; if (localStorage && serializer) loadedWorld = serializer.parse(localStorage.getItem(key)); if (loadedWorld) Engine.merge(engine, { world: loadedWorld }); }; /** * Serialises the object using the given serializer and a Matter-specific replacer * @method serialise * @param {object} serializer * @param {object} object * @param {number} indent * @return {string} The serialised object */ Gui.serialise = function(serializer, object, indent) { indent = indent || 0; return serializer.stringify(object, function(key, value) { // skip non-required values if (key === 'path') return undefined; // limit precision of floats if (!/^#/.exec(key) && typeof value === 'number') { var fixed = parseFloat(value.toFixed(3)); // do not limit if limiting will cause value to zero // TODO: this should ideally dynamically find the SF precision required if (fixed === 0 && value !== 0) return value; return fixed; } return value; }, indent); }; var _initDatGui = function(gui) { var engine = gui.engine, datGui = gui.datGui; var funcs = { addBody: function() { _addBody(gui); }, clear: function() { _clear(gui); }, save: function() { Gui.saveState(gui.serializer, engine, 'guiState'); Events.trigger(gui, 'save'); }, load: function() { Gui.loadState(gui.serializer, engine, 'guiState'); Events.trigger(gui, 'load'); }, inspect: function() { if (!Inspector.instance) gui.inspector = Inspector.create(gui.engine); } }; var metrics = datGui.addFolder('Metrics'); metrics.add(engine.timing, 'fps').listen(); if (engine.metrics.extended) { metrics.add(engine.timing, 'delta').listen(); metrics.add(engine.timing, 'correction').listen(); metrics.add(engine.metrics, 'bodies').listen(); metrics.add(engine.metrics, 'collisions').listen(); metrics.add(engine.metrics, 'pairs').listen(); metrics.add(engine.metrics, 'broadEff').listen(); metrics.add(engine.metrics, 'midEff').listen(); metrics.add(engine.metrics, 'narrowEff').listen(); metrics.add(engine.metrics, 'narrowReuse').listen(); metrics.close(); } else { metrics.open(); } var controls = datGui.addFolder('Add Body'); controls.add(gui, 'amount', 1, 5).step(1); controls.add(gui, 'size', 5, 150).step(1); controls.add(gui, 'sides', 1, 8).step(1); controls.add(gui, 'density', 0.0001, 0.01).step(0.001); controls.add(gui, 'friction', 0, 1).step(0.05); controls.add(gui, 'frictionAir', 0, gui.frictionAir * 10).step(gui.frictionAir / 10); controls.add(gui, 'restitution', 0, 1).step(0.1); controls.add(funcs, 'addBody'); controls.open(); var worldGui = datGui.addFolder('World'); worldGui.add(funcs, 'inspect'); worldGui.add(funcs, 'load'); worldGui.add(funcs, 'save'); worldGui.add(funcs, 'clear'); worldGui.open(); var gravity = worldGui.addFolder('Gravity'); gravity.add(engine.world.gravity, 'x', -1, 1).step(0.01); gravity.add(engine.world.gravity, 'y', -1, 1).step(0.01); gravity.open(); var physics = datGui.addFolder('Engine'); physics.add(engine, 'enableSleeping'); physics.add(engine.broadphase, 'current', ['grid', 'bruteForce']) .onFinishChange(function(value) { Composite.setModified(engine.world, true, false, false); }); physics.add(engine.timing, 'timeScale', 0, 1.2).step(0.05).listen(); physics.add(engine, 'velocityIterations', 1, 10).step(1); physics.add(engine, 'positionIterations', 1, 10).step(1); physics.add(engine, 'enabled'); physics.open(); var render = datGui.addFolder('Render'); render.add(gui, 'renderer', ['canvas', 'webgl']) .onFinishChange(function(value) { _setRenderer(gui, value); }); render.add(engine.render.options, 'wireframes'); render.add(engine.render.options, 'showDebug'); render.add(engine.render.options, 'showPositions'); render.add(engine.render.options, 'showBroadphase'); render.add(engine.render.options, 'showBounds'); render.add(engine.render.options, 'showVelocity'); render.add(engine.render.options, 'showCollisions'); render.add(engine.render.options, 'showAxes'); render.add(engine.render.options, 'showAngleIndicator'); render.add(engine.render.options, 'showSleeping'); render.add(engine.render.options, 'showIds'); render.add(engine.render.options, 'showShadows'); render.add(engine.render.options, 'enabled'); render.open(); }; var _setRenderer = function(gui, rendererName) { var engine = gui.engine, controller; if (rendererName === 'canvas') controller = Render; if (rendererName === 'webgl') controller = RenderPixi; // remove old canvas engine.render.element.removeChild(engine.render.canvas); // create new renderer using the same options object var options = engine.render.options; engine.render = controller.create({ element: engine.render.element, options: options }); engine.render.options = options; // bind the mouse to the new canvas Mouse.setElement(engine.input.mouse, engine.render.canvas); }; var _addBody = function(gui) { var engine = gui.engine; var options = { density: gui.density, friction: gui.friction, frictionAir: gui.frictionAir, restitution: gui.restitution }; for (var i = 0; i < gui.amount; i++) { World.add(engine.world, Bodies.polygon(gui.offset.x + 120 + i * gui.size + i * 50, gui.offset.y + 200, gui.sides, gui.size, options)); } }; var _clear = function(gui) { var engine = gui.engine; World.clear(engine.world, true); Engine.clear(engine); // clear scene graph (if defined in controller) var renderController = engine.render.controller; if (renderController.clear) renderController.clear(engine.render); Events.trigger(gui, 'clear'); }; /* * * Events Documentation * */ /** * Fired after the gui's clear button pressed * * @event clear * @param {} event An event object * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after the gui's save button pressed * * @event save * @param {} event An event object * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after the gui's load button pressed * * @event load * @param {} event An event object * @param {} event.source The source object of the event * @param {} event.name The name of the event */ })(); ; // End src/tools/Gui.js // Begin src/tools/Inspector.js /** * See [Demo.js](https://github.com/liabru/matter-js/blob/master/demo/js/Demo.js) * and [DemoMobile.js](https://github.com/liabru/matter-js/blob/master/demo/js/DemoMobile.js) for usage examples. * * @class Inspector */ var Inspector = {}; (function() { var _key, _isWebkit = 'WebkitAppearance' in document.documentElement.style, $body; /** * Creates a new inspector tool and inserts it into the page. Requires keymaster, jQuery, jsTree libraries. * @method create * @param {engine} engine * @param {object} options * @return {inspector} An inspector */ Inspector.create = function(engine, options) { if (!jQuery || !$.fn.jstree || !window.key) { console.log('Could not create inspector. Check keymaster, jQuery, jsTree libraries are loaded first.'); return; } var inspector = { engine: engine, isPaused: false, selected: [], selectStart: null, selectEnd: null, selectBounds: Bounds.create(), mousePrevPosition: { x: 0, y: 0 }, offset: { x: 0, y: 0 }, autoHide: true, autoRewind: true, hasTransitions: _isWebkit ? true : false, bodyClass: '', exportIndent: 0, controls: { container: null, worldTree: null }, root: Composite.create({ label: 'Root' }) }; inspector = Common.extend(inspector, options); Inspector.instance = inspector; inspector.serializer = new Resurrect({ prefix: '$', cleanup: true }); inspector.serializer.parse = inspector.serializer.resurrect; localStorage.removeItem('pauseState'); $body = $('body'); $body.toggleClass('ins-auto-hide gui-auto-hide', inspector.autoHide); $body.toggleClass('ins-transitions gui-transitions', inspector.hasTransitions); Composite.add(inspector.root, engine.world); engine.world.isModified = true; engine.world.parent = null; _key = window.key; _initControls(inspector); _initEngineEvents(inspector); _initTree(inspector); _initKeybinds(inspector); return inspector; }; var _initControls = function(inspector) { var engine = inspector.engine, controls = inspector.controls; var $inspectorContainer = $('
'), $buttonGroup = $('
'), $searchBox = $(''), $importButton = $(''), $exportButton = $(''), $pauseButton = $(''), $helpButton = $(''), $addCompositeButton = $(''); $buttonGroup.append($pauseButton, $importButton, $exportButton, $helpButton); $inspectorContainer.prepend($buttonGroup, $searchBox, $addCompositeButton); $body.prepend($inspectorContainer); controls.pauseButton = $pauseButton; controls.importButton = $importButton; controls.exportButton = $exportButton; controls.helpButton = $helpButton; controls.searchBox = $searchBox; controls.container = $inspectorContainer; controls.addCompositeButton = $addCompositeButton; controls.pauseButton.click(function() { _setPaused(inspector, !inspector.isPaused); }); controls.exportButton.click(function() { _exportFile(inspector); }); controls.importButton.click(function() { _importFile(inspector); }); controls.helpButton.click(function() { _showHelp(inspector); }); controls.addCompositeButton.click(function() { _addNewComposite(inspector); }); var searchTimeout; controls.searchBox.keyup(function () { clearTimeout(searchTimeout); searchTimeout = setTimeout(function () { var value = controls.searchBox.val(), worldTree = controls.worldTree.data('jstree'); worldTree.search(value); }, 250); }); }; var _showHelp = function(inspector) { var help = "Matter Tools\n\n"; help += "Drag nodes in the tree to move them between composites.\n"; help += "Use browser's developer console to inspect selected objects.\n"; help += "Note: selections only render if renderer supports it.\n\n"; help += "[shift + space] pause or play simulation.\n"; help += "[right click] and drag on empty space to select a region.\n"; help += "[right click] and drag on an object to move it.\n"; help += "[right click + shift] and drag to move whole selection.\n"; help += "[del] or [backspace] delete selected objects.\n\n"; help += "[shift + s] scale-xy selected objects with mouse or arrows.\n"; help += "[shift + s + d] scale-x selected objects with mouse or arrows.\n"; help += "[shift + s + f] scale-y selected objects with mouse or arrows.\n"; help += "[shift + r] rotate selected objects with mouse or arrows.\n\n"; help += "[shift + q] set selected objects as static (can't be undone).\n"; help += "[shift + i] import objects.\n"; help += "[shift + o] export selected objects.\n"; help += "[shift + h] toggle Matter.Gui.\n"; help += "[shift + y] toggle auto-hide.\n"; help += "[shift + r] toggle auto-rewind on play/pause.\n\n"; help += "[shift + j] show this help message."; alert(help); }; var _initKeybinds = function(inspector) { var engine = inspector.engine, controls = inspector.controls; _key('shift+space', function() { _setPaused(inspector, !inspector.isPaused); }); _key('shift+o', function() { _exportFile(inspector); }); _key('shift+i', function() { _importFile(inspector); }); _key('shift+j', function() { _showHelp(inspector); }); _key('shift+y', function() { inspector.autoHide = !inspector.autoHide; $body.toggleClass('ins-auto-hide gui-auto-hide', inspector.autoHide); }); _key('shift+r', function() { inspector.autoRewind = !inspector.autoRewind; if (!inspector.autoRewind) localStorage.removeItem('pauseState'); }); _key('shift+q', function() { var worldTree = inspector.controls.worldTree.data('jstree'); for (var i = 0; i < inspector.selected.length; i++) { var object = inspector.selected[i].data; if (object.type === 'body' && !object.isStatic) Body.setStatic(object, true); } }); _key('del', function() { _deleteSelectedObjects(inspector); }); _key('backspace', function() { _deleteSelectedObjects(inspector); }); // prevent the backspace key from navigating back // http://stackoverflow.com/questions/1495219/how-can-i-prevent-the-backspace-key-from-navigating-back $(document).unbind('keydown').bind('keydown', function (event) { var doPrevent = false; if (event.keyCode === 8) { var d = event.srcElement || event.target; if ((d.tagName.toUpperCase() === 'INPUT' && (d.type.toUpperCase() === 'TEXT' || d.type.toUpperCase() === 'PASSWORD' || d.type.toUpperCase() === 'FILE' || d.type.toUpperCase() === 'EMAIL' || d.type.toUpperCase() === 'SEARCH')) || d.tagName.toUpperCase() === 'TEXTAREA') { doPrevent = d.readOnly || d.disabled; } else { doPrevent = true; } } if (doPrevent) { event.preventDefault(); } }); }; var _initTree = function(inspector) { var engine = inspector.engine, controls = inspector.controls, deferTimeout; var worldTreeOptions = { 'core': { 'check_callback': true }, 'dnd': { 'copy': false }, 'search': { 'show_only_matches': true, 'fuzzy': false }, 'types': { '#': { 'valid_children': [] }, 'body': { 'valid_children': [] }, 'constraint': { 'valid_children': [] }, 'composite': { 'valid_children': [] }, 'bodies': { 'valid_children': ['body'] }, 'constraints': { 'valid_children': ['constraint'] }, 'composites': { 'valid_children': ['composite'] } }, 'plugins' : ['dnd', 'types', 'unique', 'search'] }; controls.worldTree = $('
').jstree(worldTreeOptions); controls.container.prepend(controls.worldTree); controls.worldTree.on('changed.jstree', function(event, data) { var selected = [], worldTree = controls.worldTree.data('jstree'); if (data.action !== 'select_node') return; // defer selection update until selection has finished propagating clearTimeout(deferTimeout); deferTimeout = setTimeout(function() { data.selected = worldTree.get_selected(); for (var i = 0; i < data.selected.length; i++) { var nodeId = data.selected[i], objectType = nodeId.split('_')[0], objectId = nodeId.split('_')[1], worldObject = Composite.get(engine.world, objectId, objectType); switch (objectType) { case 'body': case 'constraint': case 'composite': selected.push(worldObject); break; } } _setSelectedObjects(inspector, selected); }, 1); }); $(document).on('dnd_stop.vakata', function(event, data) { var worldTree = controls.worldTree.data('jstree'), nodes = data.data.nodes; // handle drag and drop // move items between composites for (var i = 0; i < nodes.length; i++) { var node = worldTree.get_node(nodes[i]), parentNode = worldTree.get_node(worldTree.get_parent(nodes[i])), prevCompositeId = node.data.compositeId, newCompositeId = parentNode.data.compositeId; if (prevCompositeId === newCompositeId) continue; var nodeId = nodes[i], objectType = nodeId.split('_')[0], objectId = nodeId.split('_')[1], worldObject = Composite.get(inspector.root, objectId, objectType), prevComposite = Composite.get(inspector.root, prevCompositeId, 'composite'), newComposite = Composite.get(inspector.root, newCompositeId, 'composite'); Composite.move(prevComposite, worldObject, newComposite); } }); controls.worldTree.on('dblclick.jstree', function(event, data) { var worldTree = controls.worldTree.data('jstree'), selected = worldTree.get_selected(); // select all children of double clicked node for (var i = 0; i < selected.length; i++) { var nodeId = selected[i], objectType = nodeId.split('_')[0], objectId = nodeId.split('_')[1], worldObject = Composite.get(engine.world, objectId, objectType); switch (objectType) { case 'composite': case 'composites': case 'bodies': case 'constraints': var node = worldTree.get_node(nodeId), children = worldTree.get_node(nodeId).children; for (var j = 0; j < children.length; j++) worldTree.select_node(children[j], false); break; } } }); }; var _addBodyClass = function(inspector, classNames) { // only apply changes to prevent DOM lag if (inspector.bodyClass.indexOf(' ' + classNames) === -1) { $body.addClass(classNames); inspector.bodyClass = ' ' + $body.attr('class'); } }; var _removeBodyClass = function(inspector, classNames) { // only apply changes to prevent DOM lag var updateRequired = false, classes = classNames.split(' '); for (var i = 0; i < classes.length; i++) { updateRequired = inspector.bodyClass.indexOf(' ' + classes[i]) !== -1; if (updateRequired) break; } if (updateRequired) { $body.removeClass(classNames); inspector.bodyClass = ' ' + $body.attr('class'); } }; var _getMousePosition = function(inspector) { return Vector.add(inspector.engine.input.mouse.position, inspector.offset); }; var _initEngineEvents = function(inspector) { var engine = inspector.engine, mouse = engine.input.mouse, mousePosition = _getMousePosition(inspector), controls = inspector.controls; Events.on(engine, 'tick', function() { // update mouse position reference mousePosition = _getMousePosition(inspector); var mouseDelta = mousePosition.x - inspector.mousePrevPosition.x, keyDelta = _key.isPressed('up') + _key.isPressed('right') - _key.isPressed('down') - _key.isPressed('left'), delta = mouseDelta + keyDelta; // update interface when world changes if (engine.world.isModified) { var data = _generateCompositeTreeNode(inspector.root, null, true); _updateTree(controls.worldTree.data('jstree'), data); _setSelectedObjects(inspector, []); } // update region selection if (inspector.selectStart !== null) { inspector.selectEnd.x = mousePosition.x; inspector.selectEnd.y = mousePosition.y; Bounds.update(inspector.selectBounds, [inspector.selectStart, inspector.selectEnd]); } // rotate mode if (_key.shift && _key.isPressed('r')) { var rotateSpeed = 0.03, angle = Math.max(-2, Math.min(2, delta)) * rotateSpeed; _addBodyClass(inspector, 'ins-cursor-rotate'); _rotateSelectedObjects(inspector, angle); } else { _removeBodyClass(inspector, 'ins-cursor-rotate'); } // scale mode if (_key.shift && _key.isPressed('s')) { var scaleSpeed = 0.02, scale = 1 + Math.max(-2, Math.min(2, delta)) * scaleSpeed; _addBodyClass(inspector, 'ins-cursor-scale'); if (_key.isPressed('d')) { scaleX = scale; scaleY = 1; } else if (_key.isPressed('f')) { scaleX = 1; scaleY = scale; } else { scaleX = scaleY = scale; } _scaleSelectedObjects(inspector, scaleX, scaleY); } else { _removeBodyClass(inspector, 'ins-cursor-scale'); } // translate mode if (mouse.button === 2 && !mouse.sourceEvents.mousedown && !mouse.sourceEvents.mouseup) { _addBodyClass(inspector, 'ins-cursor-move'); _moveSelectedObjects(inspector, mousePosition.x, mousePosition.y); } else { _removeBodyClass(inspector, 'ins-cursor-move'); } inspector.mousePrevPosition = Common.clone(mousePosition); }); Events.on(engine, 'mouseup', function(event) { // select objects in region if making a region selection if (inspector.selectStart !== null) { var selected = Query.region(Composite.allBodies(engine.world), inspector.selectBounds); _setSelectedObjects(inspector, selected); } // clear selection region inspector.selectStart = null; inspector.selectEnd = null; Events.trigger(inspector, 'selectEnd'); }); Events.on(engine, 'mousedown', function(event) { var engine = event.source, bodies = Composite.allBodies(engine.world), constraints = Composite.allConstraints(engine.world), isUnionSelect = _key.shift || _key.control, worldTree = inspector.controls.worldTree.data('jstree'), i; if (mouse.button === 2) { var hasSelected = false; for (i = 0; i < bodies.length; i++) { var body = bodies[i]; if (Bounds.contains(body.bounds, mousePosition) && Vertices.contains(body.vertices, mousePosition)) { if (isUnionSelect) { _addSelectedObject(inspector, body); } else { _setSelectedObjects(inspector, [body]); } hasSelected = true; break; } } if (!hasSelected) { for (i = 0; i < constraints.length; i++) { var constraint = constraints[i], bodyA = constraint.bodyA, bodyB = constraint.bodyB; if (constraint.label.indexOf('Mouse Constraint') !== -1) continue; var pointAWorld = constraint.pointA, pointBWorld = constraint.pointB; if (bodyA) pointAWorld = Vector.add(bodyA.position, constraint.pointA); if (bodyB) pointBWorld = Vector.add(bodyB.position, constraint.pointB); if (!pointAWorld || !pointBWorld) continue; var distA = Vector.magnitudeSquared(Vector.sub(mousePosition, pointAWorld)), distB = Vector.magnitudeSquared(Vector.sub(mousePosition, pointBWorld)); if (distA < 100 || distB < 100) { if (isUnionSelect) { _addSelectedObject(inspector, constraint); } else { _setSelectedObjects(inspector, [constraint]); } hasSelected = true; break; } } if (!hasSelected) { worldTree.deselect_all(true); _setSelectedObjects(inspector, []); inspector.selectStart = Common.clone(mousePosition); inspector.selectEnd = Common.clone(mousePosition); Bounds.update(inspector.selectBounds, [inspector.selectStart, inspector.selectEnd]); Events.trigger(inspector, 'selectStart'); } else { inspector.selectStart = null; inspector.selectEnd = null; } } } if (mouse.button === 2 && inspector.selected.length > 0) { _addBodyClass(inspector, 'ins-cursor-move'); _updateSelectedMouseDownOffset(inspector); } }); // render hook Events.on(engine, 'afterRender', function() { var renderController = engine.render.controller, context = engine.render.context; if (renderController.inspector) renderController.inspector(inspector, context); }); }; var _deleteSelectedObjects = function(inspector) { var objects = [], object, worldTree = inspector.controls.worldTree.data('jstree'), i; // delete objects in world for (i = 0; i < inspector.selected.length; i++) { object = inspector.selected[i].data; if (object !== inspector.engine.world) objects.push(object); } // also delete non-world composites (selected only in the UI tree) var selectedNodes = worldTree.get_selected(); for (i = 0; i < selectedNodes.length; i++) { var node = worldTree.get_node(selectedNodes[i]); if (node.type === 'composite') { node = worldTree.get_node(node.children[0]); if (node.data) { var compositeId = node.data.compositeId; object = Composite.get(inspector.root, compositeId, 'composite'); if (object && object !== inspector.engine.world) { objects.push(object); worldTree.delete_node(selectedNodes[i]); } } } } Composite.remove(inspector.root, objects, true); _setSelectedObjects(inspector, []); }; var _updateSelectedMouseDownOffset = function(inspector) { var selected = inspector.selected, mouse = inspector.engine.input.mouse, mousePosition = _getMousePosition(inspector), item, data; for (var i = 0; i < selected.length; i++) { item = selected[i]; data = item.data; if (data.position) { item.mousedownOffset = { x: mousePosition.x - data.position.x, y: mousePosition.y - data.position.y }; } else if (data.pointA && !data.bodyA) { item.mousedownOffset = { x: mousePosition.x - data.pointA.x, y: mousePosition.y - data.pointA.y }; } else if (data.pointB && !data.bodyB) { item.mousedownOffset = { x: mousePosition.x - data.pointB.x, y: mousePosition.y - data.pointB.y }; } } }; var _moveSelectedObjects = function(inspector, x, y) { var selected = inspector.selected, mouse = inspector.engine.input.mouse, mousePosition = _getMousePosition(inspector), item, data; for (var i = 0; i < selected.length; i++) { item = selected[i]; data = item.data; if (!item.mousedownOffset) continue; switch (data.type) { case 'body': var delta = { x: x - data.position.x - item.mousedownOffset.x, y: y - data.position.y - item.mousedownOffset.y }; Body.translate(data, delta); data.positionPrev.x = data.position.x; data.positionPrev.y = data.position.y; break; case 'constraint': var point = data.pointA; if (data.bodyA) point = data.pointB; point.x = x - item.mousedownOffset.x; point.y = y - item.mousedownOffset.y; var initialPointA = data.bodyA ? Vector.add(data.bodyA.position, data.pointA) : data.pointA, initialPointB = data.bodyB ? Vector.add(data.bodyB.position, data.pointB) : data.pointB; data.length = Vector.magnitude(Vector.sub(initialPointA, initialPointB)); break; } } }; var _scaleSelectedObjects = function(inspector, scaleX, scaleY) { var selected = inspector.selected, item, data; for (var i = 0; i < selected.length; i++) { item = selected[i]; data = item.data; switch (data.type) { case 'body': Body.scale(data, scaleX, scaleY, data.position); if (data.circleRadius) data.circleRadius *= scaleX; break; } } }; var _rotateSelectedObjects = function(inspector, angle) { var selected = inspector.selected, item, data; for (var i = 0; i < selected.length; i++) { item = selected[i]; data = item.data; switch (data.type) { case 'body': Body.rotate(data, angle); break; } } }; var _setPaused = function(inspector, isPaused) { if (isPaused) { if (inspector.autoRewind) { _setSelectedObjects(inspector, []); Gui.loadState(inspector.serializer, inspector.engine, 'pauseState'); } inspector.engine.timing.timeScale = 0; inspector.isPaused = true; inspector.controls.pauseButton.text('Play'); Events.trigger(inspector, 'paused'); } else { if (inspector.autoRewind) { Gui.saveState(inspector.serializer, inspector.engine, 'pauseState'); } inspector.engine.timing.timeScale = 1; inspector.isPaused = false; inspector.controls.pauseButton.text('Pause'); Events.trigger(inspector, 'play'); } }; var _setSelectedObjects = function(inspector, objects) { var worldTree = inspector.controls.worldTree.data('jstree'), selectedItems = [], data, i; for (i = 0; i < inspector.selected.length; i++) { data = inspector.selected[i].data; worldTree.deselect_node(data.type + '_' + data.id, true); } inspector.selected = []; console.clear(); for (i = 0; i < objects.length; i++) { data = objects[i]; if (data) { // add the object to the selection _addSelectedObject(inspector, data); // log selected objects to console for property inspection if (i < 5) { console.log(data.label + ' ' + data.id + ': %O', data); } else if (i === 6) { console.warn('Omitted inspecting ' + (objects.length - 5) + ' more objects'); } } } }; var _addSelectedObject = function(inspector, object) { if (!object) return; var worldTree = inspector.controls.worldTree.data('jstree'); inspector.selected.push({ data: object }); worldTree.select_node(object.type + '_' + object.id, true); }; var _updateTree = function(tree, data) { data[0].state = data[0].state || { opened: true }; tree.settings.core.data = data; tree.refresh(-1); }; var _generateCompositeTreeNode = function(composite, compositeId, isRoot) { var children = [], node = { id: 'composite_' + composite.id, data: { compositeId: compositeId, }, type: 'composite', text: (composite.label ? composite.label : 'Composite') + ' ' + composite.id, 'li_attr': { 'class': 'jstree-node-type-composite' } }; var childNode = _generateCompositesTreeNode(composite.composites, composite.id); childNode.id = 'composites_' + composite.id; children.push(childNode); if (isRoot) return childNode.children; childNode = _generateBodiesTreeNode(composite.bodies, composite.id); childNode.id = 'bodies_' + composite.id; children.push(childNode); childNode = _generateConstraintsTreeNode(composite.constraints, composite.id); childNode.id = 'constraints_' + composite.id; children.push(childNode); node.children = children; return node; }; var _generateCompositesTreeNode = function(composites, compositeId) { var node = { type: 'composites', text: 'Composites', data: { compositeId: compositeId, }, children: [], 'li_attr': { 'class': 'jstree-node-type-composites' } }; for (var i = 0; i < composites.length; i++) { var composite = composites[i]; node.children.push(_generateCompositeTreeNode(composite, compositeId)); } return node; }; var _generateBodiesTreeNode = function(bodies, compositeId) { var node = { type: 'bodies', text: 'Bodies', data: { compositeId: compositeId, }, children: [], 'li_attr': { 'class': 'jstree-node-type-bodies' } }; for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; node.children.push({ type: 'body', id: 'body_' + body.id, data: { compositeId: compositeId, }, text: (body.label ? body.label : 'Body') + ' ' + body.id, 'li_attr': { 'class': 'jstree-node-type-body' } }); } return node; }; var _generateConstraintsTreeNode = function(constraints, compositeId) { var node = { type: 'constraints', text: 'Constraints', data: { compositeId: compositeId, }, children: [], 'li_attr': { 'class': 'jstree-node-type-constraints' } }; for (var i = 0; i < constraints.length; i++) { var constraint = constraints[i]; node.children.push({ type: 'constraint', id: 'constraint_' + constraint.id, data: { compositeId: compositeId, }, text: (constraint.label ? constraint.label : 'Constraint') + ' ' + constraint.id, 'li_attr': { 'class': 'jstree-node-type-constraint' } }); } return node; }; var _addNewComposite = function(inspector) { var newComposite = Composite.create(); Composite.add(inspector.root, newComposite); // move new composite to the start so that it appears top of tree inspector.root.composites.splice(inspector.root.composites.length - 1, 1); inspector.root.composites.unshift(newComposite); Composite.setModified(inspector.engine.world, true, true, false); }; var _exportFile = function(inspector) { var engine = inspector.engine, toExport = []; if (inspector.selected.length === 0) { alert('No objects were selected, so export could not be created. Can only export objects that are in the World composite.'); return; } var fileName = 'export-objects', exportComposite = Composite.create({ label: 'Exported Objects' }); // add everything else, must be in top-down order for (var i = 0; i < inspector.selected.length; i++) { var object = inspector.selected[i].data; // skip if it's already in the composite tree // this means orphans will be added in the root if (Composite.get(exportComposite, object.id, object.type)) continue; Composite.add(exportComposite, object); // better filename for small exports if (inspector.selected.length === 1) fileName = 'export-' + object.label + '-' + object.id; } // santise filename fileName = fileName.toLowerCase().replace(/[^\w\-]/g, '') + '.json'; // serialise var json = Gui.serialise(inspector.serializer, exportComposite, inspector.exportIndent); // launch export download if (_isWebkit) { var blob = new Blob([json], { type: 'application/json' }), anchor = document.createElement('a'); anchor.download = fileName; anchor.href = (window.webkitURL || window.URL).createObjectURL(blob); anchor.dataset.downloadurl = ['application/json', anchor.download, anchor.href].join(':'); anchor.click(); } else { window.open('data:application/json;charset=utf-8,' + escape(json)); } Events.trigger(inspector, 'export'); }; var _importFile = function(inspector) { var engine = inspector.engine, element = document.createElement('div'), fileInput; element.innerHTML = ''; fileInput = element.firstChild; fileInput.addEventListener('change', function(e) { var file = fileInput.files[0]; if (file.name.match(/\.(txt|json)$/)) { var reader = new FileReader(); reader.onload = function(e) { var importedComposite = inspector.serializer.parse(reader.result); if (importedComposite) { importedComposite.label = 'Imported Objects'; Composite.rebase(importedComposite); Composite.add(inspector.root, importedComposite); // move imported composite to the start so that it appears top of tree inspector.root.composites.splice(inspector.root.composites.length - 1, 1); inspector.root.composites.unshift(importedComposite); var worldTree = inspector.controls.worldTree.data('jstree'), data = _generateCompositeTreeNode(inspector.root, null, true); _updateTree(worldTree, data); } }; reader.readAsText(file); } else { alert('File not supported, .json or .txt JSON files only'); } }); fileInput.click(); }; /* * * Events Documentation * */ /** * Fired after the inspector's import button pressed * * @event export * @param {} event An event object * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after the inspector's export button pressed * * @event import * @param {} event An event object * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after the inspector user starts making a selection * * @event selectStart * @param {} event An event object * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after the inspector user ends making a selection * * @event selectEnd * @param {} event An event object * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after the inspector is paused * * @event pause * @param {} event An event object * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after the inspector is played * * @event play * @param {} event An event object * @param {} event.source The source object of the event * @param {} event.name The name of the event */ })(); ; // End src/tools/Inspector.js // aliases World.add = Composite.add; World.remove = Composite.remove; World.addComposite = Composite.addComposite; World.addBody = Composite.addBody; World.addConstraint = Composite.addConstraint; World.clear = Composite.clear; // exports Matter.Body = Body; Matter.Composite = Composite; Matter.World = World; Matter.Contact = Contact; Matter.Detector = Detector; Matter.Grid = Grid; Matter.Pairs = Pairs; Matter.Pair = Pair; Matter.Resolver = Resolver; Matter.SAT = SAT; Matter.Constraint = Constraint; Matter.MouseConstraint = MouseConstraint; Matter.Common = Common; Matter.Engine = Engine; Matter.Metrics = Metrics; Matter.Mouse = Mouse; Matter.Sleeping = Sleeping; Matter.Bodies = Bodies; Matter.Composites = Composites; Matter.Axes = Axes; Matter.Bounds = Bounds; Matter.Vector = Vector; Matter.Vertices = Vertices; Matter.Gui = Gui; Matter.Render = Render; Matter.RenderPixi = RenderPixi; Matter.Events = Events; Matter.Query = Query; Matter.Inspector = Inspector; // CommonJS module if (typeof exports !== 'undefined') { if (typeof module !== 'undefined' && module.exports) { exports = module.exports = Matter; } exports.Matter = Matter; } // AMD module if (typeof define === 'function' && define.amd) { define('Matter', [], function () { return Matter; }); } // browser if (typeof window === 'object' && typeof window.document === 'object') { window.Matter = Matter; } // End Matter namespace closure })();